chao преди 3 години
ревизия
3a613f233d
променени са 70 файла, в които са добавени 19252 реда и са изтрити 0 реда
  1. 33 0
      .gitignore
  2. 118 0
      .mvn/wrapper/MavenWrapperDownloader.java
  3. BIN
      .mvn/wrapper/maven-wrapper.jar
  4. 2 0
      .mvn/wrapper/maven-wrapper.properties
  5. 310 0
      mvnw
  6. 182 0
      mvnw.cmd
  7. 60 0
      pom.xml
  8. 16 0
      src/main/java/com/overseas/website/WebsiteApplication.java
  9. 48 0
      src/main/java/com/overseas/website/controller/PageController.java
  10. 116 0
      src/main/java/com/overseas/website/utils/RequestUtil.java
  11. 5 0
      src/main/resources/application.yml
  12. 6 0
      src/main/resources/static/css/animate.min.css
  13. 4 0
      src/main/resources/static/css/bootstrap.min.css
  14. 2 0
      src/main/resources/static/css/chosen.min.css
  15. 270 0
      src/main/resources/static/css/css2.css
  16. 95 0
      src/main/resources/static/css/flaticon.css
  17. 3 0
      src/main/resources/static/css/font-awesome.min.css
  18. 664 0
      src/main/resources/static/css/jquery-ui.css
  19. 274 0
      src/main/resources/static/css/jquery.fancybox.css
  20. 0 0
      src/main/resources/static/css/jquery.scrollbar.min.css
  21. 1 0
      src/main/resources/static/css/lightbox.min.css
  22. 0 0
      src/main/resources/static/css/magnific-popup.min.css
  23. 187 0
      src/main/resources/static/css/mobile-menu.css
  24. 0 0
      src/main/resources/static/css/owl.carousel.min.css
  25. 632 0
      src/main/resources/static/css/pe-icon-7-stroke.css
  26. 117 0
      src/main/resources/static/css/slick.css
  27. 11102 0
      src/main/resources/static/css/style.css
  28. BIN
      src/main/resources/static/font/92zUtBhPNqw73oHt4D4h.woff2
  29. BIN
      src/main/resources/static/font/92zUtBhPNqw73oHt5D4hTxM.woff2
  30. BIN
      src/main/resources/static/font/92zUtBhPNqw73oHt7j4hTxM.woff2
  31. BIN
      src/main/resources/static/font/92zatBhPNqw73oDd4iYl.woff2
  32. BIN
      src/main/resources/static/font/92zatBhPNqw73oTd4g.woff2
  33. BIN
      src/main/resources/static/font/92zatBhPNqw73ord4iYl.woff2
  34. BIN
      src/main/resources/static/font/Flaticon.woff2
  35. BIN
      src/main/resources/static/font/fontawesome-webfont.woff2
  36. BIN
      src/main/resources/static/image/blank.gif
  37. BIN
      src/main/resources/static/image/fancybox_overlay.png
  38. BIN
      src/main/resources/static/image/fancybox_sprite.png
  39. BIN
      src/main/resources/static/image/icon-checkout.png
  40. BIN
      src/main/resources/static/image/quote-item.png
  41. 5 0
      src/main/resources/static/js/bootstrap.min.js
  42. 1230 0
      src/main/resources/static/js/chosen.min.js
  43. 328 0
      src/main/resources/static/js/frontend-plugin.js
  44. 10 0
      src/main/resources/static/js/isotope.min.js
  45. 1 0
      src/main/resources/static/js/jquery-1.12.4.min.js
  46. 0 0
      src/main/resources/static/js/jquery-countdown.min.js
  47. 5 0
      src/main/resources/static/js/jquery-ui.min.js
  48. 14 0
      src/main/resources/static/js/jquery.actual.min.js
  49. 66 0
      src/main/resources/static/js/jquery.elevateZoom.min.js
  50. 2020 0
      src/main/resources/static/js/jquery.fancybox.js
  51. 0 0
      src/main/resources/static/js/jquery.plugin-countdown.min.js
  52. 1 0
      src/main/resources/static/js/jquery.scrollbar.min.js
  53. 1 0
      src/main/resources/static/js/lightbox.min.js
  54. 3 0
      src/main/resources/static/js/magnific-popup.min.js
  55. 5 0
      src/main/resources/static/js/mobile-menu.min.js
  56. 0 0
      src/main/resources/static/js/owl.carousel.min.js
  57. 1 0
      src/main/resources/static/js/owl.thumbs.min.js
  58. 17 0
      src/main/resources/static/js/slick.min.js
  59. BIN
      src/main/resources/static/picture/404.png
  60. BIN
      src/main/resources/static/picture/logo.png
  61. 14 0
      src/main/resources/templates/404.html
  62. 40 0
      src/main/resources/templates/about.html
  63. 30 0
      src/main/resources/templates/components/footer.html
  64. 21 0
      src/main/resources/templates/components/head-link.html
  65. 225 0
      src/main/resources/templates/components/header.html
  66. 40 0
      src/main/resources/templates/help.html
  67. 687 0
      src/main/resources/templates/index.html
  68. 107 0
      src/main/resources/templates/login.html
  69. 121 0
      src/main/resources/templates/product.html
  70. 13 0
      src/test/java/com/overseas/website/WebsiteApplicationTests.java

+ 33 - 0
.gitignore

@@ -0,0 +1,33 @@
+HELP.md
+target/
+!.mvn/wrapper/maven-wrapper.jar
+!**/src/main/**/target/
+!**/src/test/**/target/
+
+### STS ###
+.apt_generated
+.classpath
+.factorypath
+.project
+.settings
+.springBeans
+.sts4-cache
+
+### IntelliJ IDEA ###
+.idea
+*.iws
+*.iml
+*.ipr
+
+### NetBeans ###
+/nbproject/private/
+/nbbuild/
+/dist/
+/nbdist/
+/.nb-gradle/
+build/
+!**/src/main/**/build/
+!**/src/test/**/build/
+
+### VS Code ###
+.vscode/

+ 118 - 0
.mvn/wrapper/MavenWrapperDownloader.java

@@ -0,0 +1,118 @@
+/*
+ * Copyright 2007-present the original author or authors.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      https://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import java.net.*;
+import java.io.*;
+import java.nio.channels.*;
+import java.util.Properties;
+
+public class MavenWrapperDownloader {
+
+    private static final String WRAPPER_VERSION = "0.5.6";
+    /**
+     * Default URL to download the maven-wrapper.jar from, if no 'downloadUrl' is provided.
+     */
+    private static final String DEFAULT_DOWNLOAD_URL = "https://repo.maven.apache.org/maven2/io/takari/maven-wrapper/"
+            + WRAPPER_VERSION + "/maven-wrapper-" + WRAPPER_VERSION + ".jar";
+
+    /**
+     * Path to the maven-wrapper.properties file, which might contain a downloadUrl property to
+     * use instead of the default one.
+     */
+    private static final String MAVEN_WRAPPER_PROPERTIES_PATH =
+            ".mvn/wrapper/maven-wrapper.properties";
+
+    /**
+     * Path where the maven-wrapper.jar will be saved to.
+     */
+    private static final String MAVEN_WRAPPER_JAR_PATH =
+            ".mvn/wrapper/maven-wrapper.jar";
+
+    /**
+     * Name of the property which should be used to override the default download url for the wrapper.
+     */
+    private static final String PROPERTY_NAME_WRAPPER_URL = "wrapperUrl";
+
+    public static void main(String args[]) {
+        System.out.println("- Downloader started");
+        File baseDirectory = new File(args[0]);
+        System.out.println("- Using base directory: " + baseDirectory.getAbsolutePath());
+
+        // If the maven-wrapper.properties exists, read it and check if it contains a custom
+        // wrapperUrl parameter.
+        File mavenWrapperPropertyFile = new File(baseDirectory, MAVEN_WRAPPER_PROPERTIES_PATH);
+        String url = DEFAULT_DOWNLOAD_URL;
+        if (mavenWrapperPropertyFile.exists()) {
+            FileInputStream mavenWrapperPropertyFileInputStream = null;
+            try {
+                mavenWrapperPropertyFileInputStream = new FileInputStream(mavenWrapperPropertyFile);
+                Properties mavenWrapperProperties = new Properties();
+                mavenWrapperProperties.load(mavenWrapperPropertyFileInputStream);
+                url = mavenWrapperProperties.getProperty(PROPERTY_NAME_WRAPPER_URL, url);
+            } catch (IOException e) {
+                System.out.println("- ERROR loading '" + MAVEN_WRAPPER_PROPERTIES_PATH + "'");
+            } finally {
+                try {
+                    if (mavenWrapperPropertyFileInputStream != null) {
+                        mavenWrapperPropertyFileInputStream.close();
+                    }
+                } catch (IOException e) {
+                    // Ignore ...
+                }
+            }
+        }
+        System.out.println("- Downloading from: " + url);
+
+        File outputFile = new File(baseDirectory.getAbsolutePath(), MAVEN_WRAPPER_JAR_PATH);
+        if (!outputFile.getParentFile().exists()) {
+            if (!outputFile.getParentFile().mkdirs()) {
+                System.out.println(
+                        "- ERROR creating output directory '" + outputFile.getParentFile().getAbsolutePath() + "'");
+            }
+        }
+        System.out.println("- Downloading to: " + outputFile.getAbsolutePath());
+        try {
+            downloadFileFromURL(url, outputFile);
+            System.out.println("Done");
+            System.exit(0);
+        } catch (Throwable e) {
+            System.out.println("- Error downloading");
+            e.printStackTrace();
+            System.exit(1);
+        }
+    }
+
+    private static void downloadFileFromURL(String urlString, File destination) throws Exception {
+        if (System.getenv("MVNW_USERNAME") != null && System.getenv("MVNW_PASSWORD") != null) {
+            String username = System.getenv("MVNW_USERNAME");
+            char[] password = System.getenv("MVNW_PASSWORD").toCharArray();
+            Authenticator.setDefault(new Authenticator() {
+                @Override
+                protected PasswordAuthentication getPasswordAuthentication() {
+                    return new PasswordAuthentication(username, password);
+                }
+            });
+        }
+        URL website = new URL(urlString);
+        ReadableByteChannel rbc;
+        rbc = Channels.newChannel(website.openStream());
+        FileOutputStream fos = new FileOutputStream(destination);
+        fos.getChannel().transferFrom(rbc, 0, Long.MAX_VALUE);
+        fos.close();
+        rbc.close();
+    }
+
+}

BIN
.mvn/wrapper/maven-wrapper.jar


+ 2 - 0
.mvn/wrapper/maven-wrapper.properties

@@ -0,0 +1,2 @@
+distributionUrl=https://repo.maven.apache.org/maven2/org/apache/maven/apache-maven/3.8.2/apache-maven-3.8.2-bin.zip
+wrapperUrl=https://repo.maven.apache.org/maven2/io/takari/maven-wrapper/0.5.6/maven-wrapper-0.5.6.jar

+ 310 - 0
mvnw

@@ -0,0 +1,310 @@
+#!/bin/sh
+# ----------------------------------------------------------------------------
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#    https://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+# ----------------------------------------------------------------------------
+
+# ----------------------------------------------------------------------------
+# Maven Start Up Batch script
+#
+# Required ENV vars:
+# ------------------
+#   JAVA_HOME - location of a JDK home dir
+#
+# Optional ENV vars
+# -----------------
+#   M2_HOME - location of maven2's installed home dir
+#   MAVEN_OPTS - parameters passed to the Java VM when running Maven
+#     e.g. to debug Maven itself, use
+#       set MAVEN_OPTS=-Xdebug -Xrunjdwp:transport=dt_socket,server=y,suspend=y,address=8000
+#   MAVEN_SKIP_RC - flag to disable loading of mavenrc files
+# ----------------------------------------------------------------------------
+
+if [ -z "$MAVEN_SKIP_RC" ] ; then
+
+  if [ -f /etc/mavenrc ] ; then
+    . /etc/mavenrc
+  fi
+
+  if [ -f "$HOME/.mavenrc" ] ; then
+    . "$HOME/.mavenrc"
+  fi
+
+fi
+
+# OS specific support.  $var _must_ be set to either true or false.
+cygwin=false;
+darwin=false;
+mingw=false
+case "`uname`" in
+  CYGWIN*) cygwin=true ;;
+  MINGW*) mingw=true;;
+  Darwin*) darwin=true
+    # Use /usr/libexec/java_home if available, otherwise fall back to /Library/Java/Home
+    # See https://developer.apple.com/library/mac/qa/qa1170/_index.html
+    if [ -z "$JAVA_HOME" ]; then
+      if [ -x "/usr/libexec/java_home" ]; then
+        export JAVA_HOME="`/usr/libexec/java_home`"
+      else
+        export JAVA_HOME="/Library/Java/Home"
+      fi
+    fi
+    ;;
+esac
+
+if [ -z "$JAVA_HOME" ] ; then
+  if [ -r /etc/gentoo-release ] ; then
+    JAVA_HOME=`java-config --jre-home`
+  fi
+fi
+
+if [ -z "$M2_HOME" ] ; then
+  ## resolve links - $0 may be a link to maven's home
+  PRG="$0"
+
+  # need this for relative symlinks
+  while [ -h "$PRG" ] ; do
+    ls=`ls -ld "$PRG"`
+    link=`expr "$ls" : '.*-> \(.*\)$'`
+    if expr "$link" : '/.*' > /dev/null; then
+      PRG="$link"
+    else
+      PRG="`dirname "$PRG"`/$link"
+    fi
+  done
+
+  saveddir=`pwd`
+
+  M2_HOME=`dirname "$PRG"`/..
+
+  # make it fully qualified
+  M2_HOME=`cd "$M2_HOME" && pwd`
+
+  cd "$saveddir"
+  # echo Using m2 at $M2_HOME
+fi
+
+# For Cygwin, ensure paths are in UNIX format before anything is touched
+if $cygwin ; then
+  [ -n "$M2_HOME" ] &&
+    M2_HOME=`cygpath --unix "$M2_HOME"`
+  [ -n "$JAVA_HOME" ] &&
+    JAVA_HOME=`cygpath --unix "$JAVA_HOME"`
+  [ -n "$CLASSPATH" ] &&
+    CLASSPATH=`cygpath --path --unix "$CLASSPATH"`
+fi
+
+# For Mingw, ensure paths are in UNIX format before anything is touched
+if $mingw ; then
+  [ -n "$M2_HOME" ] &&
+    M2_HOME="`(cd "$M2_HOME"; pwd)`"
+  [ -n "$JAVA_HOME" ] &&
+    JAVA_HOME="`(cd "$JAVA_HOME"; pwd)`"
+fi
+
+if [ -z "$JAVA_HOME" ]; then
+  javaExecutable="`which javac`"
+  if [ -n "$javaExecutable" ] && ! [ "`expr \"$javaExecutable\" : '\([^ ]*\)'`" = "no" ]; then
+    # readlink(1) is not available as standard on Solaris 10.
+    readLink=`which readlink`
+    if [ ! `expr "$readLink" : '\([^ ]*\)'` = "no" ]; then
+      if $darwin ; then
+        javaHome="`dirname \"$javaExecutable\"`"
+        javaExecutable="`cd \"$javaHome\" && pwd -P`/javac"
+      else
+        javaExecutable="`readlink -f \"$javaExecutable\"`"
+      fi
+      javaHome="`dirname \"$javaExecutable\"`"
+      javaHome=`expr "$javaHome" : '\(.*\)/bin'`
+      JAVA_HOME="$javaHome"
+      export JAVA_HOME
+    fi
+  fi
+fi
+
+if [ -z "$JAVACMD" ] ; then
+  if [ -n "$JAVA_HOME"  ] ; then
+    if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
+      # IBM's JDK on AIX uses strange locations for the executables
+      JAVACMD="$JAVA_HOME/jre/sh/java"
+    else
+      JAVACMD="$JAVA_HOME/bin/java"
+    fi
+  else
+    JAVACMD="`which java`"
+  fi
+fi
+
+if [ ! -x "$JAVACMD" ] ; then
+  echo "Error: JAVA_HOME is not defined correctly." >&2
+  echo "  We cannot execute $JAVACMD" >&2
+  exit 1
+fi
+
+if [ -z "$JAVA_HOME" ] ; then
+  echo "Warning: JAVA_HOME environment variable is not set."
+fi
+
+CLASSWORLDS_LAUNCHER=org.codehaus.plexus.classworlds.launcher.Launcher
+
+# traverses directory structure from process work directory to filesystem root
+# first directory with .mvn subdirectory is considered project base directory
+find_maven_basedir() {
+
+  if [ -z "$1" ]
+  then
+    echo "Path not specified to find_maven_basedir"
+    return 1
+  fi
+
+  basedir="$1"
+  wdir="$1"
+  while [ "$wdir" != '/' ] ; do
+    if [ -d "$wdir"/.mvn ] ; then
+      basedir=$wdir
+      break
+    fi
+    # workaround for JBEAP-8937 (on Solaris 10/Sparc)
+    if [ -d "${wdir}" ]; then
+      wdir=`cd "$wdir/.."; pwd`
+    fi
+    # end of workaround
+  done
+  echo "${basedir}"
+}
+
+# concatenates all lines of a file
+concat_lines() {
+  if [ -f "$1" ]; then
+    echo "$(tr -s '\n' ' ' < "$1")"
+  fi
+}
+
+BASE_DIR=`find_maven_basedir "$(pwd)"`
+if [ -z "$BASE_DIR" ]; then
+  exit 1;
+fi
+
+##########################################################################################
+# Extension to allow automatically downloading the maven-wrapper.jar from Maven-central
+# This allows using the maven wrapper in projects that prohibit checking in binary data.
+##########################################################################################
+if [ -r "$BASE_DIR/.mvn/wrapper/maven-wrapper.jar" ]; then
+    if [ "$MVNW_VERBOSE" = true ]; then
+      echo "Found .mvn/wrapper/maven-wrapper.jar"
+    fi
+else
+    if [ "$MVNW_VERBOSE" = true ]; then
+      echo "Couldn't find .mvn/wrapper/maven-wrapper.jar, downloading it ..."
+    fi
+    if [ -n "$MVNW_REPOURL" ]; then
+      jarUrl="$MVNW_REPOURL/io/takari/maven-wrapper/0.5.6/maven-wrapper-0.5.6.jar"
+    else
+      jarUrl="https://repo.maven.apache.org/maven2/io/takari/maven-wrapper/0.5.6/maven-wrapper-0.5.6.jar"
+    fi
+    while IFS="=" read key value; do
+      case "$key" in (wrapperUrl) jarUrl="$value"; break ;;
+      esac
+    done < "$BASE_DIR/.mvn/wrapper/maven-wrapper.properties"
+    if [ "$MVNW_VERBOSE" = true ]; then
+      echo "Downloading from: $jarUrl"
+    fi
+    wrapperJarPath="$BASE_DIR/.mvn/wrapper/maven-wrapper.jar"
+    if $cygwin; then
+      wrapperJarPath=`cygpath --path --windows "$wrapperJarPath"`
+    fi
+
+    if command -v wget > /dev/null; then
+        if [ "$MVNW_VERBOSE" = true ]; then
+          echo "Found wget ... using wget"
+        fi
+        if [ -z "$MVNW_USERNAME" ] || [ -z "$MVNW_PASSWORD" ]; then
+            wget "$jarUrl" -O "$wrapperJarPath"
+        else
+            wget --http-user=$MVNW_USERNAME --http-password=$MVNW_PASSWORD "$jarUrl" -O "$wrapperJarPath"
+        fi
+    elif command -v curl > /dev/null; then
+        if [ "$MVNW_VERBOSE" = true ]; then
+          echo "Found curl ... using curl"
+        fi
+        if [ -z "$MVNW_USERNAME" ] || [ -z "$MVNW_PASSWORD" ]; then
+            curl -o "$wrapperJarPath" "$jarUrl" -f
+        else
+            curl --user $MVNW_USERNAME:$MVNW_PASSWORD -o "$wrapperJarPath" "$jarUrl" -f
+        fi
+
+    else
+        if [ "$MVNW_VERBOSE" = true ]; then
+          echo "Falling back to using Java to download"
+        fi
+        javaClass="$BASE_DIR/.mvn/wrapper/MavenWrapperDownloader.java"
+        # For Cygwin, switch paths to Windows format before running javac
+        if $cygwin; then
+          javaClass=`cygpath --path --windows "$javaClass"`
+        fi
+        if [ -e "$javaClass" ]; then
+            if [ ! -e "$BASE_DIR/.mvn/wrapper/MavenWrapperDownloader.class" ]; then
+                if [ "$MVNW_VERBOSE" = true ]; then
+                  echo " - Compiling MavenWrapperDownloader.java ..."
+                fi
+                # Compiling the Java class
+                ("$JAVA_HOME/bin/javac" "$javaClass")
+            fi
+            if [ -e "$BASE_DIR/.mvn/wrapper/MavenWrapperDownloader.class" ]; then
+                # Running the downloader
+                if [ "$MVNW_VERBOSE" = true ]; then
+                  echo " - Running MavenWrapperDownloader.java ..."
+                fi
+                ("$JAVA_HOME/bin/java" -cp .mvn/wrapper MavenWrapperDownloader "$MAVEN_PROJECTBASEDIR")
+            fi
+        fi
+    fi
+fi
+##########################################################################################
+# End of extension
+##########################################################################################
+
+export MAVEN_PROJECTBASEDIR=${MAVEN_BASEDIR:-"$BASE_DIR"}
+if [ "$MVNW_VERBOSE" = true ]; then
+  echo $MAVEN_PROJECTBASEDIR
+fi
+MAVEN_OPTS="$(concat_lines "$MAVEN_PROJECTBASEDIR/.mvn/jvm.config") $MAVEN_OPTS"
+
+# For Cygwin, switch paths to Windows format before running java
+if $cygwin; then
+  [ -n "$M2_HOME" ] &&
+    M2_HOME=`cygpath --path --windows "$M2_HOME"`
+  [ -n "$JAVA_HOME" ] &&
+    JAVA_HOME=`cygpath --path --windows "$JAVA_HOME"`
+  [ -n "$CLASSPATH" ] &&
+    CLASSPATH=`cygpath --path --windows "$CLASSPATH"`
+  [ -n "$MAVEN_PROJECTBASEDIR" ] &&
+    MAVEN_PROJECTBASEDIR=`cygpath --path --windows "$MAVEN_PROJECTBASEDIR"`
+fi
+
+# Provide a "standardized" way to retrieve the CLI args that will
+# work with both Windows and non-Windows executions.
+MAVEN_CMD_LINE_ARGS="$MAVEN_CONFIG $@"
+export MAVEN_CMD_LINE_ARGS
+
+WRAPPER_LAUNCHER=org.apache.maven.wrapper.MavenWrapperMain
+
+exec "$JAVACMD" \
+  $MAVEN_OPTS \
+  -classpath "$MAVEN_PROJECTBASEDIR/.mvn/wrapper/maven-wrapper.jar" \
+  "-Dmaven.home=${M2_HOME}" "-Dmaven.multiModuleProjectDirectory=${MAVEN_PROJECTBASEDIR}" \
+  ${WRAPPER_LAUNCHER} $MAVEN_CONFIG "$@"

+ 182 - 0
mvnw.cmd

@@ -0,0 +1,182 @@
+@REM ----------------------------------------------------------------------------
+@REM Licensed to the Apache Software Foundation (ASF) under one
+@REM or more contributor license agreements.  See the NOTICE file
+@REM distributed with this work for additional information
+@REM regarding copyright ownership.  The ASF licenses this file
+@REM to you under the Apache License, Version 2.0 (the
+@REM "License"); you may not use this file except in compliance
+@REM with the License.  You may obtain a copy of the License at
+@REM
+@REM    https://www.apache.org/licenses/LICENSE-2.0
+@REM
+@REM Unless required by applicable law or agreed to in writing,
+@REM software distributed under the License is distributed on an
+@REM "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+@REM KIND, either express or implied.  See the License for the
+@REM specific language governing permissions and limitations
+@REM under the License.
+@REM ----------------------------------------------------------------------------
+
+@REM ----------------------------------------------------------------------------
+@REM Maven Start Up Batch script
+@REM
+@REM Required ENV vars:
+@REM JAVA_HOME - location of a JDK home dir
+@REM
+@REM Optional ENV vars
+@REM M2_HOME - location of maven2's installed home dir
+@REM MAVEN_BATCH_ECHO - set to 'on' to enable the echoing of the batch commands
+@REM MAVEN_BATCH_PAUSE - set to 'on' to wait for a keystroke before ending
+@REM MAVEN_OPTS - parameters passed to the Java VM when running Maven
+@REM     e.g. to debug Maven itself, use
+@REM set MAVEN_OPTS=-Xdebug -Xrunjdwp:transport=dt_socket,server=y,suspend=y,address=8000
+@REM MAVEN_SKIP_RC - flag to disable loading of mavenrc files
+@REM ----------------------------------------------------------------------------
+
+@REM Begin all REM lines with '@' in case MAVEN_BATCH_ECHO is 'on'
+@echo off
+@REM set title of command window
+title %0
+@REM enable echoing by setting MAVEN_BATCH_ECHO to 'on'
+@if "%MAVEN_BATCH_ECHO%" == "on"  echo %MAVEN_BATCH_ECHO%
+
+@REM set %HOME% to equivalent of $HOME
+if "%HOME%" == "" (set "HOME=%HOMEDRIVE%%HOMEPATH%")
+
+@REM Execute a user defined script before this one
+if not "%MAVEN_SKIP_RC%" == "" goto skipRcPre
+@REM check for pre script, once with legacy .bat ending and once with .cmd ending
+if exist "%HOME%\mavenrc_pre.bat" call "%HOME%\mavenrc_pre.bat"
+if exist "%HOME%\mavenrc_pre.cmd" call "%HOME%\mavenrc_pre.cmd"
+:skipRcPre
+
+@setlocal
+
+set ERROR_CODE=0
+
+@REM To isolate internal variables from possible post scripts, we use another setlocal
+@setlocal
+
+@REM ==== START VALIDATION ====
+if not "%JAVA_HOME%" == "" goto OkJHome
+
+echo.
+echo Error: JAVA_HOME not found in your environment. >&2
+echo Please set the JAVA_HOME variable in your environment to match the >&2
+echo location of your Java installation. >&2
+echo.
+goto error
+
+:OkJHome
+if exist "%JAVA_HOME%\bin\java.exe" goto init
+
+echo.
+echo Error: JAVA_HOME is set to an invalid directory. >&2
+echo JAVA_HOME = "%JAVA_HOME%" >&2
+echo Please set the JAVA_HOME variable in your environment to match the >&2
+echo location of your Java installation. >&2
+echo.
+goto error
+
+@REM ==== END VALIDATION ====
+
+:init
+
+@REM Find the project base dir, i.e. the directory that contains the folder ".mvn".
+@REM Fallback to current working directory if not found.
+
+set MAVEN_PROJECTBASEDIR=%MAVEN_BASEDIR%
+IF NOT "%MAVEN_PROJECTBASEDIR%"=="" goto endDetectBaseDir
+
+set EXEC_DIR=%CD%
+set WDIR=%EXEC_DIR%
+:findBaseDir
+IF EXIST "%WDIR%"\.mvn goto baseDirFound
+cd ..
+IF "%WDIR%"=="%CD%" goto baseDirNotFound
+set WDIR=%CD%
+goto findBaseDir
+
+:baseDirFound
+set MAVEN_PROJECTBASEDIR=%WDIR%
+cd "%EXEC_DIR%"
+goto endDetectBaseDir
+
+:baseDirNotFound
+set MAVEN_PROJECTBASEDIR=%EXEC_DIR%
+cd "%EXEC_DIR%"
+
+:endDetectBaseDir
+
+IF NOT EXIST "%MAVEN_PROJECTBASEDIR%\.mvn\jvm.config" goto endReadAdditionalConfig
+
+@setlocal EnableExtensions EnableDelayedExpansion
+for /F "usebackq delims=" %%a in ("%MAVEN_PROJECTBASEDIR%\.mvn\jvm.config") do set JVM_CONFIG_MAVEN_PROPS=!JVM_CONFIG_MAVEN_PROPS! %%a
+@endlocal & set JVM_CONFIG_MAVEN_PROPS=%JVM_CONFIG_MAVEN_PROPS%
+
+:endReadAdditionalConfig
+
+SET MAVEN_JAVA_EXE="%JAVA_HOME%\bin\java.exe"
+set WRAPPER_JAR="%MAVEN_PROJECTBASEDIR%\.mvn\wrapper\maven-wrapper.jar"
+set WRAPPER_LAUNCHER=org.apache.maven.wrapper.MavenWrapperMain
+
+set DOWNLOAD_URL="https://repo.maven.apache.org/maven2/io/takari/maven-wrapper/0.5.6/maven-wrapper-0.5.6.jar"
+
+FOR /F "tokens=1,2 delims==" %%A IN ("%MAVEN_PROJECTBASEDIR%\.mvn\wrapper\maven-wrapper.properties") DO (
+    IF "%%A"=="wrapperUrl" SET DOWNLOAD_URL=%%B
+)
+
+@REM Extension to allow automatically downloading the maven-wrapper.jar from Maven-central
+@REM This allows using the maven wrapper in projects that prohibit checking in binary data.
+if exist %WRAPPER_JAR% (
+    if "%MVNW_VERBOSE%" == "true" (
+        echo Found %WRAPPER_JAR%
+    )
+) else (
+    if not "%MVNW_REPOURL%" == "" (
+        SET DOWNLOAD_URL="%MVNW_REPOURL%/io/takari/maven-wrapper/0.5.6/maven-wrapper-0.5.6.jar"
+    )
+    if "%MVNW_VERBOSE%" == "true" (
+        echo Couldn't find %WRAPPER_JAR%, downloading it ...
+        echo Downloading from: %DOWNLOAD_URL%
+    )
+
+    powershell -Command "&{"^
+		"$webclient = new-object System.Net.WebClient;"^
+		"if (-not ([string]::IsNullOrEmpty('%MVNW_USERNAME%') -and [string]::IsNullOrEmpty('%MVNW_PASSWORD%'))) {"^
+		"$webclient.Credentials = new-object System.Net.NetworkCredential('%MVNW_USERNAME%', '%MVNW_PASSWORD%');"^
+		"}"^
+		"[Net.ServicePointManager]::SecurityProtocol = [Net.SecurityProtocolType]::Tls12; $webclient.DownloadFile('%DOWNLOAD_URL%', '%WRAPPER_JAR%')"^
+		"}"
+    if "%MVNW_VERBOSE%" == "true" (
+        echo Finished downloading %WRAPPER_JAR%
+    )
+)
+@REM End of extension
+
+@REM Provide a "standardized" way to retrieve the CLI args that will
+@REM work with both Windows and non-Windows executions.
+set MAVEN_CMD_LINE_ARGS=%*
+
+%MAVEN_JAVA_EXE% %JVM_CONFIG_MAVEN_PROPS% %MAVEN_OPTS% %MAVEN_DEBUG_OPTS% -classpath %WRAPPER_JAR% "-Dmaven.multiModuleProjectDirectory=%MAVEN_PROJECTBASEDIR%" %WRAPPER_LAUNCHER% %MAVEN_CONFIG% %*
+if ERRORLEVEL 1 goto error
+goto end
+
+:error
+set ERROR_CODE=1
+
+:end
+@endlocal & set ERROR_CODE=%ERROR_CODE%
+
+if not "%MAVEN_SKIP_RC%" == "" goto skipRcPost
+@REM check for post script, once with legacy .bat ending and once with .cmd ending
+if exist "%HOME%\mavenrc_post.bat" call "%HOME%\mavenrc_post.bat"
+if exist "%HOME%\mavenrc_post.cmd" call "%HOME%\mavenrc_post.cmd"
+:skipRcPost
+
+@REM pause the script if MAVEN_BATCH_PAUSE is set to 'on'
+if "%MAVEN_BATCH_PAUSE%" == "on" pause
+
+if "%MAVEN_TERMINATE_CMD%" == "on" exit %ERROR_CODE%
+
+exit /B %ERROR_CODE%

+ 60 - 0
pom.xml

@@ -0,0 +1,60 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project xmlns="http://maven.apache.org/POM/4.0.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+         xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 https://maven.apache.org/xsd/maven-4.0.0.xsd">
+    <modelVersion>4.0.0</modelVersion>
+    <parent>
+        <groupId>org.springframework.boot</groupId>
+        <artifactId>spring-boot-starter-parent</artifactId>
+        <version>2.5.5</version>
+        <relativePath/> <!-- lookup parent from repository -->
+    </parent>
+    <groupId>com.overseas</groupId>
+    <artifactId>overseas-website-demo</artifactId>
+    <version>0.0.1-SNAPSHOT</version>
+    <name>overseas-website-demo</name>
+    <description>overseas-website-demo</description>
+    <properties>
+        <java.version>1.8</java.version>
+    </properties>
+    <dependencies>
+        <dependency>
+            <groupId>org.springframework.boot</groupId>
+            <artifactId>spring-boot-starter-thymeleaf</artifactId>
+        </dependency>
+        <dependency>
+            <groupId>org.springframework.boot</groupId>
+            <artifactId>spring-boot-starter-webflux</artifactId>
+        </dependency>
+        <dependency>
+            <groupId>com.alibaba</groupId>
+            <artifactId>fastjson</artifactId>
+            <version>1.2.6</version>
+        </dependency>
+        <dependency>
+            <groupId>org.springframework.boot</groupId>
+            <artifactId>spring-boot-devtools</artifactId>
+            <scope>runtime</scope>
+            <optional>true</optional>
+        </dependency>
+        <dependency>
+            <groupId>org.springframework.boot</groupId>
+            <artifactId>spring-boot-starter-test</artifactId>
+            <scope>test</scope>
+        </dependency>
+        <dependency>
+            <groupId>io.projectreactor</groupId>
+            <artifactId>reactor-test</artifactId>
+            <scope>test</scope>
+        </dependency>
+    </dependencies>
+
+    <build>
+        <plugins>
+            <plugin>
+                <groupId>org.springframework.boot</groupId>
+                <artifactId>spring-boot-maven-plugin</artifactId>
+            </plugin>
+        </plugins>
+    </build>
+
+</project>

+ 16 - 0
src/main/java/com/overseas/website/WebsiteApplication.java

@@ -0,0 +1,16 @@
+package com.overseas.website;
+
+import org.springframework.boot.SpringApplication;
+import org.springframework.boot.autoconfigure.SpringBootApplication;
+
+/**
+ * @author : Charles
+ */
+@SpringBootApplication
+public class WebsiteApplication {
+
+    public static void main(String[] args) {
+        SpringApplication.run(WebsiteApplication.class, args);
+    }
+
+}

+ 48 - 0
src/main/java/com/overseas/website/controller/PageController.java

@@ -0,0 +1,48 @@
+package com.overseas.website.controller;
+
+import com.alibaba.fastjson.JSONObject;
+import com.overseas.website.utils.RequestUtil;
+import org.springframework.stereotype.Controller;
+import org.springframework.ui.Model;
+import org.springframework.web.bind.annotation.GetMapping;
+import org.springframework.web.bind.annotation.PathVariable;
+
+import java.util.HashMap;
+import java.util.Map;
+
+/**
+ * Description
+ *
+ * @author : Charles
+ * @date : 2021/10/18
+ */
+@Controller
+public class PageController {
+    /**
+     * 页面路径
+     */
+    @GetMapping("/{path}.html")
+    public String page(final Model model, @PathVariable("path") String path) {
+        model.addAttribute("path", path);
+        return path;
+    }
+
+    /**
+     * 商品详情页面
+     */
+    @GetMapping("/product/{id}.html")
+    public String product(final Model model, @PathVariable("id") String productId) {
+        model.addAttribute("path", "product");
+        Map<String, Object> product = new HashMap<>();
+        try {
+            String floorResult = RequestUtil.sendGet("https://core.caimei365.com/commodity/product/details?productId="+productId);
+            Map<String, Object> floorMap = JSONObject.parseObject(floorResult, Map.class);
+            product = JSONObject.parseObject(String.valueOf(floorMap.get("data")), Map.class);
+        } catch (Exception e) {
+            return null;
+        }
+        model.addAttribute("product", product);
+        return "product";
+    }
+
+}

+ 116 - 0
src/main/java/com/overseas/website/utils/RequestUtil.java

@@ -0,0 +1,116 @@
+package com.overseas.website.utils;
+
+import java.io.BufferedReader;
+import java.io.InputStreamReader;
+import java.io.PrintWriter;
+import java.net.URL;
+import java.net.URLConnection;
+import java.nio.charset.StandardCharsets;
+import java.util.List;
+import java.util.Map;
+
+/**
+ * 请求工具类
+ *
+ * @author : Charles
+ * @date : 2021/3/8
+ */
+public class RequestUtil {
+
+    /**
+     * 向指定URL发送GET方法的请求
+     *
+     * @param url   发送请求的URL,请求参数应该是 name1=value1&name2=value2 的形式。
+     * @return 远程资源的响应结果
+     */
+    public static String sendGet(String url) throws Exception {
+        StringBuilder result = new StringBuilder();
+        BufferedReader in = null;
+        try {
+
+            URL realUrl = new URL(url);
+            // 打开和URL之间的连接
+            URLConnection connection = realUrl.openConnection();
+            // 设置通用的请求属性
+            connection.setRequestProperty("accept", "*/*");
+            connection.setRequestProperty("connection", "Keep-Alive");
+            connection.setRequestProperty("Accept-Charset", "utf-8");
+            connection.setRequestProperty("contentType", "utf-8");
+            connection.setConnectTimeout(5000);
+            // 建立实际的连接
+            connection.connect();
+            // 获取所有响应头字段
+            Map<String, List<String>> map = connection.getHeaderFields();
+            // 定义 BufferedReader输入流来读取URL的响应
+            in = new BufferedReader(new InputStreamReader(
+                    connection.getInputStream()));
+            String line;
+            while ((line = in.readLine()) != null) {
+                result.append(line);
+            }
+        }
+        // 使用finally块来关闭输入流
+        finally {
+            if (in != null) {
+                in.close();
+            }
+        }
+        return result.toString();
+    }
+
+    /**
+     * 向指定 URL 发送POST方法的请求
+     *
+     * @param url 发送请求的 URL
+     * @param paramMap 请求参数
+     * @return 所代表远程资源的响应结果
+     */
+    public static String sendPost(String url, Map<String, ?> paramMap) throws Exception{
+        PrintWriter out = null;
+        BufferedReader in = null;
+        StringBuilder result = new StringBuilder();
+
+        StringBuilder param = new StringBuilder();
+
+        for (String key : paramMap.keySet()) {
+            param.append(key).append("=").append(paramMap.get(key)).append("&");
+        }
+
+        try {
+            URL realUrl = new URL(url);
+            // 打开和URL之间的连接
+            URLConnection conn = realUrl.openConnection();
+            // 设置通用的请求属性
+            conn.setRequestProperty("accept", "*/*");
+            conn.setRequestProperty("connection", "Keep-Alive");
+            conn.setRequestProperty("Accept-Charset", "utf-8");
+            conn.setRequestProperty("user-agent", "Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1;SV1)");
+            // 发送POST请求必须设置如下两行
+            conn.setDoOutput(true);
+            conn.setDoInput(true);
+            // 获取URLConnection对象对应的输出流
+            out = new PrintWriter(conn.getOutputStream());
+            // 发送请求参数
+            out.print(param);
+            // flush输出流的缓冲
+            out.flush();
+            // 定义BufferedReader输入流来读取URL的响应
+            in = new BufferedReader(new InputStreamReader(conn.getInputStream(), StandardCharsets.UTF_8));
+            String line;
+            while ((line = in.readLine()) != null) {
+                result.append(line);
+            }
+        }
+        //使用finally块来关闭输出流、输入流
+        finally{
+            if(out!=null){
+                out.close();
+            }
+            if(in!=null){
+                in.close();
+            }
+        }
+        return result.toString();
+    }
+
+}

+ 5 - 0
src/main/resources/application.yml

@@ -0,0 +1,5 @@
+server:
+  port: 9999
+spring:
+  thymeleaf:
+    cache: false  #??????

Файловите разлики са ограничени, защото са твърде много
+ 6 - 0
src/main/resources/static/css/animate.min.css


Файловите разлики са ограничени, защото са твърде много
+ 4 - 0
src/main/resources/static/css/bootstrap.min.css


Файловите разлики са ограничени, защото са твърде много
+ 2 - 0
src/main/resources/static/css/chosen.min.css


+ 270 - 0
src/main/resources/static/css/css2.css

@@ -0,0 +1,270 @@
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 300;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt5D4hTxM.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 300;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt7j4hTxM.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 300;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt4D4h.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 400;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt5D4hTxM.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 400;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt7j4hTxM.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 400;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt4D4h.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 500;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt5D4hTxM.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 500;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt7j4hTxM.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 500;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt4D4h.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 600;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt5D4hTxM.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 600;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt7j4hTxM.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 600;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt4D4h.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 700;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt5D4hTxM.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 700;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt7j4hTxM.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: italic;
+  font-weight: 700;
+  font-display: swap;
+  src: url(../font/92zUtBhPNqw73oHt4D4h.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 300;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oDd4iYl.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 300;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73ord4iYl.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 300;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oTd4g.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 400;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oDd4iYl.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 400;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73ord4iYl.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 400;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oTd4g.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 500;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oDd4iYl.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 500;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73ord4iYl.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 500;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oTd4g.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 600;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oDd4iYl.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 600;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73ord4iYl.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 600;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oTd4g.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}
+/* cyrillic */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 700;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oDd4iYl.woff2) format('woff2');
+  unicode-range: U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
+}
+/* latin-ext */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 700;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73ord4iYl.woff2) format('woff2');
+  unicode-range: U+0100-024F, U+0259, U+1E00-1EFF, U+2020, U+20A0-20AB, U+20AD-20CF, U+2113, U+2C60-2C7F, U+A720-A7FF;
+}
+/* latin */
+@font-face {
+  font-family: 'Jost';
+  font-style: normal;
+  font-weight: 700;
+  font-display: swap;
+  src: url(../font/92zatBhPNqw73oTd4g.woff2) format('woff2');
+  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD;
+}

+ 95 - 0
src/main/resources/static/css/flaticon.css

@@ -0,0 +1,95 @@
+	/*
+  	Flaticon icon font: Flaticon
+  	Creation date: 20/03/2021 07:42
+  	*/
+
+@font-face {
+  font-family: "Flaticon";
+  src: url("https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/flaticon/Flaticon.eot");
+  src: url("https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/flaticon/Flaticon.eot?#iefix") format("embedded-opentype"),
+       url("../font/Flaticon.woff2") format("woff2"),
+       url("https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/flaticon/Flaticon.woff") format("woff"),
+       url("https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/flaticon/Flaticon.ttf") format("truetype"),
+       url("https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/flaticon/Flaticon.svg#Flaticon") format("svg");
+  font-weight: normal;
+  font-style: normal;
+}
+
+@media screen and (-webkit-min-device-pixel-ratio:0) {
+  @font-face {
+    font-family: "Flaticon";
+    src: url("https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/flaticon/Flaticon.svg#Flaticon") format("svg");
+  }
+}
+
+[class^="flaticon-"]:before, [class*=" flaticon-"]:before,
+[class^="flaticon-"]:after, [class*=" flaticon-"]:after {   
+  font-family: Flaticon;
+        font-size: inherit;
+font-style: normal;
+line-height: 1;
+}
+
+.flaticon-magnifying-glass:before { content: "\f100"; }
+.flaticon-profile:before { content: "\f101"; }
+.flaticon-bag:before { content: "\f102"; }
+.flaticon-right-arrow:before { content: "\f103"; }
+.flaticon-left-arrow:before { content: "\f104"; }
+.flaticon-right-arrow-1:before { content: "\f105"; }
+.flaticon-left-arrow-1:before { content: "\f106"; }
+.flaticon-mail:before { content: "\f107"; }
+.flaticon-flame:before { content: "\f108"; }
+.flaticon-clock:before { content: "\f109"; }
+.flaticon-comment:before { content: "\f10a"; }
+.flaticon-chat:before { content: "\f10b"; }
+.flaticon-heart:before { content: "\f10c"; }
+.flaticon-valentines-heart:before { content: "\f10d"; }
+.flaticon-filter:before { content: "\f10e"; }
+.flaticon-loading:before { content: "\f10f"; }
+.flaticon-checked:before { content: "\f110"; }
+.flaticon-tick:before { content: "\f111"; }
+.flaticon-close:before { content: "\f112"; }
+.flaticon-circular-check-button:before { content: "\f113"; }
+.flaticon-check:before { content: "\f114"; }
+.flaticon-play-button:before { content: "\f115"; }
+.flaticon-360-degrees:before { content: "\f116"; }
+.flaticon-login:before { content: "\f117"; }
+.flaticon-menu:before { content: "\f118"; }
+.flaticon-menu-1:before { content: "\f119"; }
+.flaticon-placeholder:before { content: "\f11a"; }
+.flaticon-metre:before { content: "\f11b"; }
+.flaticon-share:before { content: "\f11c"; }
+.flaticon-shuffle:before { content: "\f11d"; }
+.flaticon-running:before { content: "\f11e"; }
+.flaticon-recycle:before { content: "\f11f"; }
+.flaticon-instagram:before { content: "\f120"; }
+.flaticon-delivery-truck:before { content: "\f121"; }
+.flaticon-closed-lock:before { content: "\f122"; }
+.flaticon-support:before { content: "\f123"; }
+.flaticon-diamond:before { content: "\f124"; }
+.flaticon-high-heels:before { content: "\f125"; }
+.flaticon-shirt:before { content: "\f126"; }
+.flaticon-dress:before { content: "\f127"; }
+.flaticon-shirt-1:before { content: "\f128"; }
+.flaticon-glasses:before { content: "\f129"; }
+.flaticon-shopping-bag:before { content: "\f12a"; }
+.flaticon-trousers:before { content: "\f12b"; }
+.flaticon-user:before { content: "\f12c"; }
+.flaticon-magnifying-glass-1:before { content: "\f12d"; }
+.flaticon-shopping-bag-1:before { content: "\f12e"; }
+.flaticon-envelope:before { content: "\f12f"; }
+.flaticon-instagram-1:before { content: "\f130"; }
+.flaticon-rocket-ship:before { content: "\f131"; }
+.flaticon-refresh:before { content: "\f132"; }
+.flaticon-return:before { content: "\f133"; }
+.flaticon-padlock:before { content: "\f134"; }
+.flaticon-random:before { content: "\f135"; }
+.flaticon-shopping-cart:before { content: "\f136"; }
+.flaticon-cart:before { content: "\f137"; }
+.flaticon-filter-1:before { content: "\f138"; }
+.flaticon-startup:before { content: "\f139"; }
+.flaticon-return-1:before { content: "\f13a"; }
+.flaticon-letter:before { content: "\f13b"; }
+.flaticon-diamond-1:before { content: "\f13c"; }
+.flaticon-key:before { content: "\f13d"; }
+.flaticon-envelope-of-white-paper:before { content: "\f13e"; }

Файловите разлики са ограничени, защото са твърде много
+ 3 - 0
src/main/resources/static/css/font-awesome.min.css


Файловите разлики са ограничени, защото са твърде много
+ 664 - 0
src/main/resources/static/css/jquery-ui.css


+ 274 - 0
src/main/resources/static/css/jquery.fancybox.css

@@ -0,0 +1,274 @@
+/*! fancyBox v2.1.5 fancyapps.com | fancyapps.com/fancybox/#license */
+.fancybox-wrap,
+.fancybox-skin,
+.fancybox-outer,
+.fancybox-inner,
+.fancybox-image,
+.fancybox-wrap iframe,
+.fancybox-wrap object,
+.fancybox-nav,
+.fancybox-nav span,
+.fancybox-tmp
+{
+	padding: 0;
+	margin: 0;
+	border: 0;
+	outline: none;
+	vertical-align: top;
+}
+
+.fancybox-wrap {
+	position: absolute;
+	top: 0;
+	left: 0;
+	z-index: 8020;
+}
+
+.fancybox-skin {
+	position: relative;
+	background: #f9f9f9;
+	color: #444;
+	text-shadow: none;
+	-webkit-border-radius: 4px;
+	   -moz-border-radius: 4px;
+	        border-radius: 4px;
+}
+
+.fancybox-opened {
+	z-index: 8030;
+}
+
+.fancybox-opened .fancybox-skin {
+	-webkit-box-shadow: 0 10px 25px rgba(0, 0, 0, 0.5);
+	   -moz-box-shadow: 0 10px 25px rgba(0, 0, 0, 0.5);
+	        box-shadow: 0 10px 25px rgba(0, 0, 0, 0.5);
+}
+
+.fancybox-outer, .fancybox-inner {
+	position: relative;
+}
+
+.fancybox-inner {
+	overflow: hidden;
+}
+
+.fancybox-type-iframe .fancybox-inner {
+	-webkit-overflow-scrolling: touch;
+}
+
+.fancybox-error {
+	color: #444;
+	font: 14px/20px "Helvetica Neue",Helvetica,Arial,sans-serif;
+	margin: 0;
+	padding: 15px;
+	white-space: nowrap;
+}
+
+.fancybox-image, .fancybox-iframe {
+	display: block;
+	width: 100%;
+	height: 100%;
+}
+
+.fancybox-image {
+	max-width: 100%;
+	max-height: 100%;
+}
+
+#fancybox-loading, .fancybox-close, .fancybox-prev span, .fancybox-next span {
+	background-image: url('../image/fancybox_sprite.png');
+}
+
+#fancybox-loading {
+	position: fixed;
+	top: 50%;
+	left: 50%;
+	margin-top: -22px;
+	margin-left: -22px;
+	background-position: 0 -108px;
+	opacity: 0.8;
+	cursor: pointer;
+	z-index: 8060;
+}
+
+#fancybox-loading div {
+	width: 44px;
+	height: 44px;
+	background: url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/js/fancybox/source/fancybox_loading.gif') center center no-repeat;
+}
+
+.fancybox-close {
+	position: absolute;
+	top: -18px;
+	right: -18px;
+	width: 36px;
+	height: 36px;
+	cursor: pointer;
+	z-index: 8040;
+}
+
+.fancybox-nav {
+	position: absolute;
+	top: 0;
+	width: 40%;
+	height: 100%;
+	cursor: pointer;
+	text-decoration: none;
+	background: transparent url('../image/blank.gif'); /* helps IE */
+	-webkit-tap-highlight-color: rgba(0,0,0,0);
+	z-index: 8040;
+}
+
+.fancybox-prev {
+	left: 0;
+}
+
+.fancybox-next {
+	right: 0;
+}
+
+.fancybox-nav span {
+	position: absolute;
+	top: 50%;
+	width: 36px;
+	height: 34px;
+	margin-top: -18px;
+	cursor: pointer;
+	z-index: 8040;
+	visibility: hidden;
+}
+
+.fancybox-prev span {
+	left: 10px;
+	background-position: 0 -36px;
+}
+
+.fancybox-next span {
+	right: 10px;
+	background-position: 0 -72px;
+}
+
+.fancybox-nav:hover span {
+	visibility: visible;
+}
+
+.fancybox-tmp {
+	position: absolute;
+	top: -99999px;
+	left: -99999px;
+	visibility: hidden;
+	max-width: 99999px;
+	max-height: 99999px;
+	overflow: visible !important;
+}
+
+/* Overlay helper */
+
+.fancybox-lock {
+    overflow: hidden !important;
+    width: auto;
+}
+
+.fancybox-lock body {
+    overflow: hidden !important;
+}
+
+.fancybox-lock-test {
+    overflow-y: hidden !important;
+}
+
+.fancybox-overlay {
+	position: absolute;
+	top: 0;
+	left: 0;
+	overflow: hidden;
+	display: none;
+	z-index: 8010;
+	background: url('../image/fancybox_overlay.png');
+}
+
+.fancybox-overlay-fixed {
+	position: fixed;
+	bottom: 0;
+	right: 0;
+}
+
+.fancybox-lock .fancybox-overlay {
+	overflow: auto;
+	overflow-y: scroll;
+}
+
+/* Title helper */
+
+.fancybox-title {
+	visibility: hidden;
+	font: normal 13px/20px "Helvetica Neue",Helvetica,Arial,sans-serif;
+	position: relative;
+	text-shadow: none;
+	z-index: 8050;
+}
+
+.fancybox-opened .fancybox-title {
+	visibility: visible;
+}
+
+.fancybox-title-float-wrap {
+	position: absolute;
+	bottom: 0;
+	right: 50%;
+	margin-bottom: -35px;
+	z-index: 8050;
+	text-align: center;
+}
+
+.fancybox-title-float-wrap .child {
+	display: inline-block;
+	margin-right: -100%;
+	padding: 2px 20px;
+	background: transparent; /* Fallback for web browsers that doesn't support RGBa */
+	background: rgba(0, 0, 0, 0.8);
+	-webkit-border-radius: 15px;
+	   -moz-border-radius: 15px;
+	        border-radius: 15px;
+	text-shadow: 0 1px 2px #222;
+	color: #FFF;
+	font-weight: bold;
+	line-height: 24px;
+	white-space: nowrap;
+}
+
+.fancybox-title-outside-wrap {
+	position: relative;
+	margin-top: 10px;
+	color: #fff;
+}
+
+.fancybox-title-inside-wrap {
+	padding-top: 10px;
+}
+
+.fancybox-title-over-wrap {
+	position: absolute;
+	bottom: 0;
+	left: 0;
+	color: #fff;
+	padding: 10px;
+	background: #000;
+	background: rgba(0, 0, 0, .8);
+}
+
+/*Retina graphics!*/
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
+	   only screen and (min--moz-device-pixel-ratio: 1.5),
+	   only screen and (min-device-pixel-ratio: 1.5){
+
+	#fancybox-loading, .fancybox-close, .fancybox-prev span, .fancybox-next span {
+		background-image: url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/js/fancybox/source/fancybox_sprite@2x.png');
+		background-size: 44px 152px; /*The size of the normal image, half the size of the hi-res image*/
+	}
+
+	#fancybox-loading div {
+		background-image: url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/js/fancybox/source/fancybox_loading@2x.gif');
+		background-size: 24px 24px; /*The size of the normal image, half the size of the hi-res image*/
+	}
+}

Файловите разлики са ограничени, защото са твърде много
+ 0 - 0
src/main/resources/static/css/jquery.scrollbar.min.css


+ 1 - 0
src/main/resources/static/css/lightbox.min.css

@@ -0,0 +1 @@
+#slvj-window{width:100%;min-height:100%;z-index:30;background:rgba(0,0,0,.8);position:fixed;top:0;left:0}#slvj-window,#slvj-window *{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}#slvj-background-close{width:100%;min-height:100%;z-index:31;position:fixed;top:0;left:0}#slvj-back-lightbox{width:700px;height:420px;margin:auto;z-index:32}.slvj-lightbox{position:relative;width:100%;height:100%;padding:30px;margin:0;background-color:#FFF;-webkit-border-radius:10px;-moz-border-radius:10px;border-radius:10px;box-shadow:0 2px 2px 2px rgba(0,0,0,.3);z-index:53}#slvj-close-icon{background-image:url(https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/img/close-icon.png);background-repeat:no-repeat;width:11px;height:11px;position:absolute;top:10px;right:10px;z-index:551}#slvj-close-icon:hover{cursor:pointer}

Файловите разлики са ограничени, защото са твърде много
+ 0 - 0
src/main/resources/static/css/magnific-popup.min.css


+ 187 - 0
src/main/resources/static/css/mobile-menu.css

@@ -0,0 +1,187 @@
+/*------------------------------
+ MOBILE MENU
+ ------------------------------*/
+.dungar-menu-clone-wrap {
+    position: fixed;
+    top: 0;
+    left: -320px;
+    width: 320px;
+    height: 100vh;
+    background-color: #fff;
+    -webkit-transition: all 0.3s ease 0s;
+    -o-transition: all 0.3s ease 0s;
+    -moz-transition: all 0.3s ease 0s;
+    transition: all 0.3s ease 0s;
+    z-index: 100000;
+    -webkit-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
+    -moz-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
+    box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
+    color: #000;
+}
+.dungar-menu-clone-wrap.open {
+    left: 0;
+}
+.dungar-menu-panels-actions-wrap {
+    border-bottom: 1px solid #eee;
+    height: 50px;
+    position: relative;
+}
+.dungar-menu-panels-actions-wrap .dungar-menu-close-btn,
+.dungar-menu-panels-actions-wrap .dungar-menu-prev-panel {
+    width: 50px;
+    height: 50px;
+    position: absolute;
+    top: 0;
+    right: 0;
+    z-index: 10;
+    border-left: 1px solid #eee;
+    text-align: center;
+    line-height: 50px;
+    color: #000;
+}
+.dungar-menu-panels-actions-wrap .dungar-menu-close-btn:hover,
+.dungar-menu-panels-actions-wrap .dungar-menu-prev-panel:hover {
+    color: #000;
+}
+.dungar-menu-panels-actions-wrap .dungar-menu-prev-panel {
+    right: inherit;
+    left: 0;
+    border: none;
+    border-right: 1px solid #eee;
+    
+}
+.dungar-menu-panels-actions-wrap .dungar-menu-current-panel-title {
+    display: block;
+    text-align: center;
+    line-height: 50px;
+    padding: 0 50px;
+    text-transform: uppercase;
+}
+.dungar-menu-panels-actions-wrap .dungar-menu-prev-panel:before {
+    content: "\f104";
+    font-family: FontAwesome;
+}
+.dungar-menu-panel > ul {
+    padding: 0;
+    margin: 0;
+}
+.dungar-menu-panel li {
+    list-style: none;
+    position: relative;
+}
+.dungar-menu-panel > ul > li {
+    padding: 0 20px;
+    border-bottom: 1px solid #eee;
+    font-size: 14px;
+}
+.dungar-menu-panel > ul > li > a {
+    display: block;
+    line-height: 50px;
+    color: #000;
+    text-transform: uppercase;
+}
+.dungar-menu-panel > ul > li:hover > a,
+.dungar-menu-panel > ul > li.active > a {
+    color: #000;
+}
+.dungar-menu-next-panel {
+    width: 50px;
+    height: 50px;
+    text-align: center;
+    line-height: 50px;
+    position: absolute;
+    top: 0;
+    right: 0;
+    z-index: 10;
+}
+.dungar-menu-next-panel:before {
+    content: "\f105";
+    font-family: FontAwesome;
+}
+.dungar-menu-clone-wrap .toggle-submenu {
+    display: none !important;
+}
+.dungar-menu-clone-wrap .dungar-menu-panels {
+    background: inherit;
+    border-color: inherit;
+    z-index: 0;
+    box-sizing: border-box;
+    overflow: hidden;
+    height: calc(100% - 50px);
+    position: relative;
+}
+.dungar-menu-clone-wrap .dungar-menu-panel {
+    background-color: #fff;
+}
+.dungar-menu-clone-wrap .dungar-menu-panel.dungar-menu-sub-panel {
+    border-color: #fff;
+    bottom: 0;
+    box-sizing: border-box;
+    display: block;
+    left: 0;
+    margin: 0;
+    overflow-x: hidden;
+    overflow-y: auto;
+    position: absolute;
+    right: 0;
+    top: 0;
+    transform: translateX(100%);
+    transition: all 0.2s ease 0s;
+    z-index: 0;
+}
+.dungar-menu-clone-wrap .dungar-menu-panel.dungar-menu-panel-opened {
+    transform: translateX(0);
+    z-index: 999;
+}
+.dungar-menu-clone-wrap .dungar-menu-sub-opened {
+    z-index: 1;
+    opacity: 0;
+    visibility: hidden;
+}
+.dungar-menu-clone-wrap .dungar-menu-hidden {
+    display: block !important;
+    opacity: 0;
+    visibility: hidden;
+}
+.dungar-menu-clone-wrap .submenu.mega-menu {
+    padding: 20px;
+    max-width: 100% !important;
+    width: 100% !important;
+}
+.dungar-menu li > a > .icon {
+    margin-right: 10px;
+}
+.dungar-menu-panel-main {
+    position: absolute;
+    top: 0;
+    right: 0;
+    left: 0;
+    bottom: 0;
+    overflow-x: hidden;
+    overflow-y: auto;
+    -webkit-transition: all .3s ease;
+    -moz-transition: all .3s ease;
+    -ms-transition: all .3s ease;
+    -o-transition: all .3s ease;
+    transition: all .3s ease;
+}
+.dungar-menu-panel.dungar-menu-panel-opened .submenu{
+    opacity: 1;
+    visibility: visible;
+}
+.dungar-menu-panel > .mega-menu .widget-custom-menu {
+    width: 100%;
+}
+.dungar-menu-panels .menu-item-has-children > a::after {
+    display: none;
+}
+.dungar-menu-panel.dungar-menu-panel-opened .menu-page{
+    background-image: none;
+}
+.dungar-menu-panel .main-menu > li > a,.dungar-menu-panel .dungar-demolink .title,
+.dungar-menu-panel .mega-menu .dungar-custommenu .widgettitle{
+    color: #222222 !important;
+}
+.dungar-menu-panel .mega-menu .dungar-custommenu ul li{
+    color: #555;
+}

Файловите разлики са ограничени, защото са твърде много
+ 0 - 0
src/main/resources/static/css/owl.carousel.min.css


+ 632 - 0
src/main/resources/static/css/pe-icon-7-stroke.css

@@ -0,0 +1,632 @@
+@font-face {
+	font-family: 'Pe-icon-7-stroke';
+	src:url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/Pe-icon-7-stroke.eot?d7yf1v');
+	src:url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/Pe-icon-7-stroke.eot?#iefixd7yf1v') format('embedded-opentype'),
+		url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/Pe-icon-7-stroke.woff?d7yf1v') format('woff'),
+		url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/Pe-icon-7-stroke.ttf?d7yf1v') format('truetype'),
+		url('https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/fonts/Pe-icon-7-stroke.svg?d7yf1v#Pe-icon-7-stroke') format('svg');
+	font-weight: normal;
+	font-style: normal;
+}
+
+[class^="pe-7s-"], [class*=" pe-7s-"] {
+	display: inline-block;
+	font-family: 'Pe-icon-7-stroke';
+	speak: none;
+	font-style: normal;
+	font-weight: normal;
+	font-variant: normal;
+	text-transform: none;
+	line-height: 1;
+
+	/* Better Font Rendering =========== */
+	-webkit-font-smoothing: antialiased;
+	-moz-osx-font-smoothing: grayscale;
+}
+
+.pe-7s-album:before {
+	content: "\e6aa";
+}
+.pe-7s-arc:before {
+	content: "\e6ab";
+}
+.pe-7s-back-2:before {
+	content: "\e6ac";
+}
+.pe-7s-bandaid:before {
+	content: "\e6ad";
+}
+.pe-7s-car:before {
+	content: "\e6ae";
+}
+.pe-7s-diamond:before {
+	content: "\e6af";
+}
+.pe-7s-door-lock:before {
+	content: "\e6b0";
+}
+.pe-7s-eyedropper:before {
+	content: "\e6b1";
+}
+.pe-7s-female:before {
+	content: "\e6b2";
+}
+.pe-7s-gym:before {
+	content: "\e6b3";
+}
+.pe-7s-hammer:before {
+	content: "\e6b4";
+}
+.pe-7s-headphones:before {
+	content: "\e6b5";
+}
+.pe-7s-helm:before {
+	content: "\e6b6";
+}
+.pe-7s-hourglass:before {
+	content: "\e6b7";
+}
+.pe-7s-leaf:before {
+	content: "\e6b8";
+}
+.pe-7s-magic-wand:before {
+	content: "\e6b9";
+}
+.pe-7s-male:before {
+	content: "\e6ba";
+}
+.pe-7s-map-2:before {
+	content: "\e6bb";
+}
+.pe-7s-next-2:before {
+	content: "\e6bc";
+}
+.pe-7s-paint-bucket:before {
+	content: "\e6bd";
+}
+.pe-7s-pendrive:before {
+	content: "\e6be";
+}
+.pe-7s-photo:before {
+	content: "\e6bf";
+}
+.pe-7s-piggy:before {
+	content: "\e6c0";
+}
+.pe-7s-plugin:before {
+	content: "\e6c1";
+}
+.pe-7s-refresh-2:before {
+	content: "\e6c2";
+}
+.pe-7s-rocket:before {
+	content: "\e6c3";
+}
+.pe-7s-settings:before {
+	content: "\e6c4";
+}
+.pe-7s-shield:before {
+	content: "\e6c5";
+}
+.pe-7s-smile:before {
+	content: "\e6c6";
+}
+.pe-7s-usb:before {
+	content: "\e6c7";
+}
+.pe-7s-vector:before {
+	content: "\e6c8";
+}
+.pe-7s-wine:before {
+	content: "\e6c9";
+}
+.pe-7s-cloud-upload:before {
+	content: "\e68a";
+}
+.pe-7s-cash:before {
+	content: "\e68c";
+}
+.pe-7s-close:before {
+	content: "\e680";
+}
+.pe-7s-bluetooth:before {
+	content: "\e68d";
+}
+.pe-7s-cloud-download:before {
+	content: "\e68b";
+}
+.pe-7s-way:before {
+	content: "\e68e";
+}
+.pe-7s-close-circle:before {
+	content: "\e681";
+}
+.pe-7s-id:before {
+	content: "\e68f";
+}
+.pe-7s-angle-up:before {
+	content: "\e682";
+}
+.pe-7s-wristwatch:before {
+	content: "\e690";
+}
+.pe-7s-angle-up-circle:before {
+	content: "\e683";
+}
+.pe-7s-world:before {
+	content: "\e691";
+}
+.pe-7s-angle-right:before {
+	content: "\e684";
+}
+.pe-7s-volume:before {
+	content: "\e692";
+}
+.pe-7s-angle-right-circle:before {
+	content: "\e685";
+}
+.pe-7s-users:before {
+	content: "\e693";
+}
+.pe-7s-angle-left:before {
+	content: "\e686";
+}
+.pe-7s-user-female:before {
+	content: "\e694";
+}
+.pe-7s-angle-left-circle:before {
+	content: "\e687";
+}
+.pe-7s-up-arrow:before {
+	content: "\e695";
+}
+.pe-7s-angle-down:before {
+	content: "\e688";
+}
+.pe-7s-switch:before {
+	content: "\e696";
+}
+.pe-7s-angle-down-circle:before {
+	content: "\e689";
+}
+.pe-7s-scissors:before {
+	content: "\e697";
+}
+.pe-7s-wallet:before {
+	content: "\e600";
+}
+.pe-7s-safe:before {
+	content: "\e698";
+}
+.pe-7s-volume2:before {
+	content: "\e601";
+}
+.pe-7s-volume1:before {
+	content: "\e602";
+}
+.pe-7s-voicemail:before {
+	content: "\e603";
+}
+.pe-7s-video:before {
+	content: "\e604";
+}
+.pe-7s-user:before {
+	content: "\e605";
+}
+.pe-7s-upload:before {
+	content: "\e606";
+}
+.pe-7s-unlock:before {
+	content: "\e607";
+}
+.pe-7s-umbrella:before {
+	content: "\e608";
+}
+.pe-7s-trash:before {
+	content: "\e609";
+}
+.pe-7s-tools:before {
+	content: "\e60a";
+}
+.pe-7s-timer:before {
+	content: "\e60b";
+}
+.pe-7s-ticket:before {
+	content: "\e60c";
+}
+.pe-7s-target:before {
+	content: "\e60d";
+}
+.pe-7s-sun:before {
+	content: "\e60e";
+}
+.pe-7s-study:before {
+	content: "\e60f";
+}
+.pe-7s-stopwatch:before {
+	content: "\e610";
+}
+.pe-7s-star:before {
+	content: "\e611";
+}
+.pe-7s-speaker:before {
+	content: "\e612";
+}
+.pe-7s-signal:before {
+	content: "\e613";
+}
+.pe-7s-shuffle:before {
+	content: "\e614";
+}
+.pe-7s-shopbag:before {
+	content: "\e615";
+}
+.pe-7s-share:before {
+	content: "\e616";
+}
+.pe-7s-server:before {
+	content: "\e617";
+}
+.pe-7s-search:before {
+	content: "\e618";
+}
+.pe-7s-film:before {
+	content: "\e6a5";
+}
+.pe-7s-science:before {
+	content: "\e619";
+}
+.pe-7s-disk:before {
+	content: "\e6a6";
+}
+.pe-7s-ribbon:before {
+	content: "\e61a";
+}
+.pe-7s-repeat:before {
+	content: "\e61b";
+}
+.pe-7s-refresh:before {
+	content: "\e61c";
+}
+.pe-7s-add-user:before {
+	content: "\e6a9";
+}
+.pe-7s-refresh-cloud:before {
+	content: "\e61d";
+}
+.pe-7s-paperclip:before {
+	content: "\e69c";
+}
+.pe-7s-radio:before {
+	content: "\e61e";
+}
+.pe-7s-note2:before {
+	content: "\e69d";
+}
+.pe-7s-print:before {
+	content: "\e61f";
+}
+.pe-7s-network:before {
+	content: "\e69e";
+}
+.pe-7s-prev:before {
+	content: "\e620";
+}
+.pe-7s-mute:before {
+	content: "\e69f";
+}
+.pe-7s-power:before {
+	content: "\e621";
+}
+.pe-7s-medal:before {
+	content: "\e6a0";
+}
+.pe-7s-portfolio:before {
+	content: "\e622";
+}
+.pe-7s-like2:before {
+	content: "\e6a1";
+}
+.pe-7s-plus:before {
+	content: "\e623";
+}
+.pe-7s-left-arrow:before {
+	content: "\e6a2";
+}
+.pe-7s-play:before {
+	content: "\e624";
+}
+.pe-7s-key:before {
+	content: "\e6a3";
+}
+.pe-7s-plane:before {
+	content: "\e625";
+}
+.pe-7s-joy:before {
+	content: "\e6a4";
+}
+.pe-7s-photo-gallery:before {
+	content: "\e626";
+}
+.pe-7s-pin:before {
+	content: "\e69b";
+}
+.pe-7s-phone:before {
+	content: "\e627";
+}
+.pe-7s-plug:before {
+	content: "\e69a";
+}
+.pe-7s-pen:before {
+	content: "\e628";
+}
+.pe-7s-right-arrow:before {
+	content: "\e699";
+}
+.pe-7s-paper-plane:before {
+	content: "\e629";
+}
+.pe-7s-delete-user:before {
+	content: "\e6a7";
+}
+.pe-7s-paint:before {
+	content: "\e62a";
+}
+.pe-7s-bottom-arrow:before {
+	content: "\e6a8";
+}
+.pe-7s-notebook:before {
+	content: "\e62b";
+}
+.pe-7s-note:before {
+	content: "\e62c";
+}
+.pe-7s-next:before {
+	content: "\e62d";
+}
+.pe-7s-news-paper:before {
+	content: "\e62e";
+}
+.pe-7s-musiclist:before {
+	content: "\e62f";
+}
+.pe-7s-music:before {
+	content: "\e630";
+}
+.pe-7s-mouse:before {
+	content: "\e631";
+}
+.pe-7s-more:before {
+	content: "\e632";
+}
+.pe-7s-moon:before {
+	content: "\e633";
+}
+.pe-7s-monitor:before {
+	content: "\e634";
+}
+.pe-7s-micro:before {
+	content: "\e635";
+}
+.pe-7s-menu:before {
+	content: "\e636";
+}
+.pe-7s-map:before {
+	content: "\e637";
+}
+.pe-7s-map-marker:before {
+	content: "\e638";
+}
+.pe-7s-mail:before {
+	content: "\e639";
+}
+.pe-7s-mail-open:before {
+	content: "\e63a";
+}
+.pe-7s-mail-open-file:before {
+	content: "\e63b";
+}
+.pe-7s-magnet:before {
+	content: "\e63c";
+}
+.pe-7s-loop:before {
+	content: "\e63d";
+}
+.pe-7s-look:before {
+	content: "\e63e";
+}
+.pe-7s-lock:before {
+	content: "\e63f";
+}
+.pe-7s-lintern:before {
+	content: "\e640";
+}
+.pe-7s-link:before {
+	content: "\e641";
+}
+.pe-7s-like:before {
+	content: "\e642";
+}
+.pe-7s-light:before {
+	content: "\e643";
+}
+.pe-7s-less:before {
+	content: "\e644";
+}
+.pe-7s-keypad:before {
+	content: "\e645";
+}
+.pe-7s-junk:before {
+	content: "\e646";
+}
+.pe-7s-info:before {
+	content: "\e647";
+}
+.pe-7s-home:before {
+	content: "\e648";
+}
+.pe-7s-help2:before {
+	content: "\e649";
+}
+.pe-7s-help1:before {
+	content: "\e64a";
+}
+.pe-7s-graph3:before {
+	content: "\e64b";
+}
+.pe-7s-graph2:before {
+	content: "\e64c";
+}
+.pe-7s-graph1:before {
+	content: "\e64d";
+}
+.pe-7s-graph:before {
+	content: "\e64e";
+}
+.pe-7s-global:before {
+	content: "\e64f";
+}
+.pe-7s-gleam:before {
+	content: "\e650";
+}
+.pe-7s-glasses:before {
+	content: "\e651";
+}
+.pe-7s-gift:before {
+	content: "\e652";
+}
+.pe-7s-folder:before {
+	content: "\e653";
+}
+.pe-7s-flag:before {
+	content: "\e654";
+}
+.pe-7s-filter:before {
+	content: "\e655";
+}
+.pe-7s-file:before {
+	content: "\e656";
+}
+.pe-7s-expand1:before {
+	content: "\e657";
+}
+.pe-7s-exapnd2:before {
+	content: "\e658";
+}
+.pe-7s-edit:before {
+	content: "\e659";
+}
+.pe-7s-drop:before {
+	content: "\e65a";
+}
+.pe-7s-drawer:before {
+	content: "\e65b";
+}
+.pe-7s-download:before {
+	content: "\e65c";
+}
+.pe-7s-display2:before {
+	content: "\e65d";
+}
+.pe-7s-display1:before {
+	content: "\e65e";
+}
+.pe-7s-diskette:before {
+	content: "\e65f";
+}
+.pe-7s-date:before {
+	content: "\e660";
+}
+.pe-7s-cup:before {
+	content: "\e661";
+}
+.pe-7s-culture:before {
+	content: "\e662";
+}
+.pe-7s-crop:before {
+	content: "\e663";
+}
+.pe-7s-credit:before {
+	content: "\e664";
+}
+.pe-7s-copy-file:before {
+	content: "\e665";
+}
+.pe-7s-config:before {
+	content: "\e666";
+}
+.pe-7s-compass:before {
+	content: "\e667";
+}
+.pe-7s-comment:before {
+	content: "\e668";
+}
+.pe-7s-coffee:before {
+	content: "\e669";
+}
+.pe-7s-cloud:before {
+	content: "\e66a";
+}
+.pe-7s-clock:before {
+	content: "\e66b";
+}
+.pe-7s-check:before {
+	content: "\e66c";
+}
+.pe-7s-chat:before {
+	content: "\e66d";
+}
+.pe-7s-cart:before {
+	content: "\e66e";
+}
+.pe-7s-camera:before {
+	content: "\e66f";
+}
+.pe-7s-call:before {
+	content: "\e670";
+}
+.pe-7s-calculator:before {
+	content: "\e671";
+}
+.pe-7s-browser:before {
+	content: "\e672";
+}
+.pe-7s-box2:before {
+	content: "\e673";
+}
+.pe-7s-box1:before {
+	content: "\e674";
+}
+.pe-7s-bookmarks:before {
+	content: "\e675";
+}
+.pe-7s-bicycle:before {
+	content: "\e676";
+}
+.pe-7s-bell:before {
+	content: "\e677";
+}
+.pe-7s-battery:before {
+	content: "\e678";
+}
+.pe-7s-ball:before {
+	content: "\e679";
+}
+.pe-7s-back:before {
+	content: "\e67a";
+}
+.pe-7s-attention:before {
+	content: "\e67b";
+}
+.pe-7s-anchor:before {
+	content: "\e67c";
+}
+.pe-7s-albums:before {
+	content: "\e67d";
+}
+.pe-7s-alarm:before {
+	content: "\e67e";
+}
+.pe-7s-airplay:before {
+	content: "\e67f";
+}

+ 117 - 0
src/main/resources/static/css/slick.css

@@ -0,0 +1,117 @@
+/* Slider */
+.slick-slider
+{
+    position: relative;
+
+    display: block;
+    box-sizing: border-box;
+
+    -webkit-user-select: none;
+       -moz-user-select: none;
+        -ms-user-select: none;
+            user-select: none;
+
+    -webkit-touch-callout: none;
+    -khtml-user-select: none;
+    -ms-touch-action: pan-y;
+        touch-action: pan-y;
+    -webkit-tap-highlight-color: transparent;
+}
+
+.slick-list
+{
+    position: relative;
+
+    display: block;
+    overflow: hidden;
+
+    margin: 0;
+    padding: 0;
+}
+.slick-list:focus
+{
+    outline: none;
+}
+.slick-list.dragging
+{
+    cursor: pointer;
+    cursor: hand;
+}
+
+.slick-slider .slick-track,
+.slick-slider .slick-list
+{
+    -webkit-transform: translate3d(0, 0, 0);
+       -moz-transform: translate3d(0, 0, 0);
+        -ms-transform: translate3d(0, 0, 0);
+         -o-transform: translate3d(0, 0, 0);
+            transform: translate3d(0, 0, 0);
+}
+
+.slick-track
+{
+    position: relative;
+    top: 0;
+    left: 0;
+
+    display: block;
+}
+.slick-track:before,
+.slick-track:after
+{
+    display: table;
+
+    content: '';
+}
+.slick-track:after
+{
+    clear: both;
+}
+.slick-loading .slick-track
+{
+    visibility: hidden;
+}
+
+.slick-slide
+{
+    display: none;
+    float: left;
+
+    height: 100%;
+    min-height: 1px;
+}
+[dir='rtl'] .slick-slide
+{
+    float: right;
+}
+.slick-slide img
+{
+    display: block;
+}
+.slick-slide.slick-loading img
+{
+    display: none;
+}
+.slick-slide.dragging img
+{
+    pointer-events: none;
+}
+.slick-initialized .slick-slide
+{
+    display: block;
+}
+.slick-loading .slick-slide
+{
+    visibility: hidden;
+}
+.slick-vertical .slick-slide
+{
+    display: block;
+
+    height: auto;
+
+    border: 1px solid transparent;
+}
+.slick-arrow.slick-hidden {
+    display: none;
+}

+ 11102 - 0
src/main/resources/static/css/style.css

@@ -0,0 +1,11102 @@
+/*--------------------------/*
+Tempale name : Dungar
+
+/*--------------------------/*
+
+[Table of contents]
+[Color codes]
+Background: #ffffff
+Body Color : #191919
+[Typography]
+Body:       14px/24px Jost, sans-serif;
+Heading:    Jost, sans-serif;
+Input, textarea: 14px/24px Jost, sans-serif;
+
+1 COMPONENT STYLES
+2. HEADER
+  2.1 General
+  2.2 Header Skin
+3. MAIN
+4. BLOG
+  4.1 Blog page
+  4.2 Blog single
+5. SIDEBAR
+  5.1 Left Sidebar
+  5.2 Right Sidebar
+6. SHOP
+  6.1 Shop Page
+  6.2 Shop Single
+7.INNER PAGES
+8. FOOTER
+9. RESPONSIVE
+SLIDESHOW
+REPONSIVE
+/*-------------------------*/
+/*==========================================================================
+  1.0 COMPONENT STYLES
+============================================================================ */
+body {
+	font-family: 'Jost', sans-serif;
+	font-size: 16px;
+	line-height: 26px;
+	color: #666;
+	overflow-x: hidden;
+}
+label {
+	font-weight: 700;
+}
+a {
+	color: inherit;
+	text-decoration: none;
+}
+a:hover, a:focus, a:active {
+	text-decoration: none;
+	outline: none;
+	color: #0a0a0a;
+}
+img {
+	max-width: 100%;
+	height: auto;
+}
+figure.image img {
+    width: 100%;
+}
+ul, ol {
+	margin: 0;
+	padding-left: 17px;
+}
+ul ul,
+ul ol,
+ol ol,
+ol ul {
+	padding-left: 17px;
+}
+h1, h2, h3, h4, h5, h6 {
+	line-height: 1.428;
+	font-weight: 500;
+	color: #000;
+	margin-top: 0;
+}
+h1 {
+	font-size: 36px;
+}
+h2 {
+	font-size: 30px;
+}
+h3 {
+	font-size: 24px;
+}
+h4 {
+	font-size: 20px;
+}
+h5 {
+	font-size: 18px;
+}
+h6 {
+	font-size: 16px;
+}
+p {
+	margin-bottom: 20px;
+}
+blockquote, q {
+	font-weight: 500;
+	display: inline-block;
+	border-left: none;
+	color: #333;
+	font-size: 16px;
+	line-height: 26px;
+	border-bottom: 1px solid #f2f2f2;
+	border-top: 1px solid #f2f2f2;
+	padding: 20px 0;
+	margin-top: 10px;
+	margin-bottom: 38px;
+}
+blockquote p, q p {
+	font-style: italic;
+	font-size: 14px;
+}
+blockquote::before {
+	content: url('../image/quote-item.png');
+	display: block;
+}
+/* ==========================================================================
+  1.1 FORM
+============================================================================ */
+.screen-reader-text {
+	clip: rect(1px, 1px, 1px, 1px);
+	clip-path: polygon(0px 0px, 0px 0px, 0px 0px, 0px 0px);
+	position: absolute !important;
+	white-space: nowrap;
+	height: 1px;
+	width: 1px;
+	overflow: hidden;
+}
+input[type="text"],
+input[type="email"],
+input[type="password"],
+input[type="tel"],
+input[type="search"],
+input[type="url"],
+textarea,
+select {
+	border: 1px solid #eeeeee;
+	padding: 7px 20px;
+	max-width: 100%;
+	background: none;
+}
+input[type="text"],
+input[type="email"],
+input[type="password"],
+input[type="tel"],
+input[type="search"],
+input[type="url"] {
+	height: 42px;
+	border-radius: 0;
+}
+textarea {
+	line-height: 28px;
+	padding: 11px 26px;
+	height: auto;
+	width: 100%;
+	border-radius: 0;
+}
+select {
+	font-size: 15px;
+	color: #0a0a0a;
+	padding: 0 21px;
+}
+option {
+	padding: 5px 21px;
+	height: 30px;
+	line-height: 30px;
+}
+.button, button, input[type="submit"] {
+	display: inline-block;
+	padding: 9px 20px;
+	color: #fff;
+	border: none;
+	text-align: center;
+	font-size: 14px;
+	font-weight: 600;
+	-webkit-transition: all 0.4s ease 0s;
+	-moz-transition: all 0.4s ease 0s;
+	-o-transition: all 0.4s ease 0s;
+	transition: all 0.4s ease 0s;
+	border-radius: 0;
+	font-family: 'Jost', sans-serif;
+	line-height: 24px;
+}
+input[type="text"]:focus,
+input[type="number"]:focus,
+input[type="search"]:focus,
+input[type="email"]:focus,
+input[type="password"]:focus,
+input[type="tel"]:focus,
+input[type="url"]:focus,
+textarea:focus,
+button:focus,
+select:focus {
+	outline: none;
+	border-color: #e6e6e6 !important;
+}
+:focus {
+	outline: none;
+}
+::-webkit-input-placeholder {
+	text-align: inherit;
+	color: inherit;
+	opacity: 1;
+	filter: alpha(opacity=100);
+}
+:-moz-placeholder {
+	/* Firefox 18- */
+	text-align: inherit;
+	color: inherit;
+	opacity: 1;
+	filter: alpha(opacity=100);
+}
+::-moz-placeholder {
+	/* Firefox 19+ */
+	text-align: inherit;
+	color: inherit;
+	opacity: 1;
+	filter: alpha(opacity=100);
+}
+:-ms-input-placeholder {
+	text-align: inherit;
+	color: inherit;
+	opacity: 1;
+	filter: alpha(opacity=100);
+}
+.return-message {
+	line-height: 20px;
+	padding: 10px 30px;
+	margin-top: 15px;
+}
+/* ==========================================================================
+                              1.2 TABLE
+============================================================================ */
+table {
+	border: 1px solid #f3f3f3;
+	border-collapse: collapse;
+	border-spacing: 0;
+	table-layout: auto;
+	width: 100%;
+	margin-bottom: 20px;
+}
+table thead {
+	background-color: #f8f8f8;
+}
+th, td {
+	border: 1px solid #f3f3f3;
+	padding: 10px;
+	font-weight: normal;
+}
+table tr th:last-child,
+table tr td:last-child {
+	border-right: 0;
+}
+table tr:last-child td, table tr:last-child th {
+	border-bottom: none;
+}
+/*----------------------------Auto Clear--------------------------------*/
+@media (min-width: 1500px) {
+	.auto-clear .col-bg-1:nth-child(12n+1) {
+		clear: left;
+	}
+	.auto-clear .col-bg-2:nth-child(6n+1) {
+		clear: left;
+	}
+	.auto-clear .col-bg-15:nth-child(5n+1) {
+		clear: left;
+	}
+	.auto-clear .col-bg-3:nth-child(4n+1) {
+		clear: left;
+	}
+	.auto-clear .col-bg-4:nth-child(3n+1) {
+		clear: left;
+	}
+	.auto-clear .col-bg-6:nth-child(odd) {
+		clear: left;
+	}
+}
+@media (min-width: 1200px) and (max-width: 1499px) {
+	.auto-clear .col-lg-1:nth-child(12n+1) {
+		clear: left;
+	}
+	.auto-clear .col-lg-2:nth-child(6n+1) {
+		clear: left;
+	}
+	.auto-clear .col-lg-15:nth-child(5n+1) {
+		clear: left;
+	}
+	.auto-clear .col-lg-3:nth-child(4n+1) {
+		clear: left;
+	}
+	.auto-clear .col-lg-4:nth-child(3n+1) {
+		clear: left;
+	}
+	.auto-clear .col-lg-6:nth-child(odd) {
+		clear: left;
+	}
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+	.auto-clear .col-md-1:nth-child(12n+1) {
+		clear: left;
+	}
+	.auto-clear .col-md-2:nth-child(6n+1) {
+		clear: left;
+	}
+	.auto-clear .col-md-15:nth-child(5n+1) {
+		clear: left;
+	}
+	.auto-clear .col-md-3:nth-child(4n+1) {
+		clear: left;
+	}
+	.auto-clear .col-md-4:nth-child(3n+1) {
+		clear: left;
+	}
+	.auto-clear .col-md-6:nth-child(odd) {
+		clear: left;
+	}
+}
+@media (min-width: 768px) and (max-width: 991px) {
+	.auto-clear .col-sm-1:nth-child(12n+1) {
+		clear: left;
+	}
+	.auto-clear .col-sm-2:nth-child(6n+1) {
+		clear: left;
+	}
+	.auto-clear .col-sm-15:nth-child(5n+1) {
+		clear: left;
+	}
+	.auto-clear .col-sm-3:nth-child(4n+1) {
+		clear: left;
+	}
+	.auto-clear .col-sm-4:nth-child(3n+1) {
+		clear: left;
+	}
+	.auto-clear .col-sm-6:nth-child(odd) {
+		clear: left;
+	}
+}
+@media (min-width: 480px) and (max-width: 767px) {
+	.auto-clear .col-xs-1:nth-child(12n+1) {
+		clear: left;
+	}
+	.auto-clear .col-xs-2:nth-child(6n+1) {
+		clear: left;
+	}
+	.auto-clear .col-xs-15:nth-child(5n+1) {
+		clear: left;
+	}
+	.auto-clear .col-xs-3:nth-child(4n+1) {
+		clear: left;
+	}
+	.auto-clear .col-xs-4:nth-child(3n+1) {
+		clear: left;
+	}
+	.auto-clear .col-xs-6:nth-child(odd) {
+		clear: left;
+	}
+}
+@media (max-width: 479px) {
+	.auto-clear .col-ts-1:nth-child(12n+1) {
+		clear: left;
+	}
+	.auto-clear .col-ts-2:nth-child(6n+1) {
+		clear: left;
+	}
+	.auto-clear .col-ts-15:nth-child(5n+1) {
+		clear: left;
+	}
+	.auto-clear .col-ts-3:nth-child(4n+1) {
+		clear: left;
+	}
+	.auto-clear .col-ts-4:nth-child(3n+1) {
+		clear: left;
+	}
+	.auto-clear .col-ts-6:nth-child(odd) {
+		clear: left;
+	}
+}
+/*-------------------Custom Bostrap Colum > 1500px---------------------*/
+@media (min-width: 1500px) {
+	.col-bg-1,
+	.col-bg-10,
+	.col-bg-11,
+	.col-bg-12,
+	.col-bg-2,
+	.col-bg-3,
+	.col-bg-4,
+	.col-bg-5,
+	.col-bg-6,
+	.col-bg-7,
+	.col-bg-8,
+	.col-bg-9 {
+		position: relative;
+		min-height: 1px;
+		padding-right: 15px;
+		padding-left: 15px
+	}
+	.col-bg-1,
+	.col-bg-2,
+	.col-bg-3,
+	.col-bg-4,
+	.col-bg-5,
+	.col-bg-6,
+	.col-bg-7,
+	.col-bg-8,
+	.col-bg-9,
+	.col-bg-10,
+	.col-bg-11 {
+		float: left;
+	}
+	.col-bg-12 {
+		width: 100%;
+	}
+	.col-bg-11 {
+		width: 91.66666667%;
+	}
+	.col-bg-10 {
+		width: 83.33333333%;
+	}
+	.col-bg-9 {
+		width: 75%;
+	}
+	.col-bg-8 {
+		width: 66.66666667%;
+	}
+	.col-bg-7 {
+		width: 58.33333333%;
+	}
+	.col-bg-6 {
+		width: 50%;
+	}
+	.col-bg-5 {
+		width: 41.66666667%;
+	}
+	.col-bg-4 {
+		width: 33.33333333%;
+	}
+	.col-bg-3 {
+		width: 25%;
+	}
+	.col-bg-2 {
+		width: 16.66666667%;
+	}
+	.col-bg-1 {
+		width: 8.33333333%;
+	}
+}
+/*-------------------Custom Bostrap Colum < 480px----------------------*/
+@media (max-width: 480px) {
+	.col-ts-1,
+	.col-ts-10,
+	.col-ts-11,
+	.col-ts-12,
+	.col-ts-2,
+	.col-ts-3,
+	.col-ts-4,
+	.col-ts-5,
+	.col-ts-6,
+	.col-ts-7,
+	.col-ts-8,
+	.col-ts-9 {
+		position: relative;
+		min-height: 1px;
+		padding-right: 15px;
+		padding-left: 15px;
+	}
+	.col-ts-1,
+	.col-ts-2,
+	.col-ts-3,
+	.col-ts-4,
+	.col-ts-5,
+	.col-ts-6,
+	.col-ts-7,
+	.col-ts-8,
+	.col-ts-9,
+	.col-ts-10,
+	.col-ts-11 {
+		float: left;
+	}
+	.col-ts-12 {
+		width: 100%;
+	}
+	.col-ts-11 {
+		width: 91.66666667%;
+	}
+	.col-ts-10 {
+		width: 83.33333333%;
+	}
+	.col-ts-9 {
+		width: 75%;
+	}
+	.col-ts-8 {
+		width: 66.66666667%;
+	}
+	.col-ts-7 {
+		width: 58.33333333%;
+	}
+	.col-ts-6 {
+		width: 50%;
+	}
+	.col-ts-5 {
+		width: 41.66666667%;
+	}
+	.col-ts-4 {
+		width: 33.33333333%;
+	}
+	.col-ts-3 {
+		width: 25%;
+	}
+	.col-ts-2 {
+		width: 16.66666667%;
+	}
+	.col-ts-1 {
+		width: 8.33333333%;
+	}
+	.col-ts-pull-12 {
+		right: 100%;
+	}
+	.col-ts-pull-11 {
+		right: 91.66666667%;
+	}
+	.col-ts-pull-10 {
+		right: 83.33333333%;
+	}
+	.col-ts-pull-9 {
+		right: 75%;
+	}
+	.col-ts-pull-8 {
+		right: 66.66666667%;
+	}
+	.col-ts-pull-7 {
+		right: 58.33333333%;
+	}
+	.col-ts-pull-6 {
+		right: 50%;
+	}
+	.col-ts-pull-5 {
+		right: 41.66666667%;
+	}
+	.col-ts-pull-4 {
+		right: 33.33333333%;
+	}
+	.col-ts-pull-3 {
+		right: 25%;
+	}
+	.col-ts-pull-2 {
+		right: 16.66666667%;
+	}
+	.col-ts-pull-1 {
+		right: 8.33333333%;
+	}
+	.col-ts-pull-0 {
+		right: auto;
+	}
+	.col-ts-push-12 {
+		left: 100%;
+	}
+	.col-ts-push-11 {
+		left: 91.66666667%;
+	}
+	.col-ts-push-10 {
+		left: 83.33333333%;
+	}
+	.col-ts-push-9 {
+		left: 75%;
+	}
+	.col-ts-push-8 {
+		left: 66.66666667%;
+	}
+	.col-ts-push-7 {
+		left: 58.33333333%;
+	}
+	.col-ts-push-6 {
+		left: 50%;
+	}
+	.col-ts-push-5 {
+		left: 41.66666667%;
+	}
+	.col-ts-push-4 {
+		left: 33.33333333%;
+	}
+	.col-ts-push-3 {
+		left: 25%;
+	}
+	.col-ts-push-2 {
+		left: 16.66666667%;
+	}
+	.col-ts-push-1 {
+		left: 8.33333333%;
+	}
+	.col-ts-push-0 {
+		left: auto;
+	}
+	.col-ts-offset-12 {
+		margin-left: 100%;
+	}
+	.col-ts-offset-11 {
+		margin-left: 91.66666667%;
+	}
+	.col-ts-offset-10 {
+		margin-left: 83.33333333%;
+	}
+	.col-ts-offset-9 {
+		margin-left: 75%;
+	}
+	.col-ts-offset-8 {
+		margin-left: 66.66666667%;
+	}
+	.col-ts-offset-7 {
+		margin-left: 58.33333333%;
+	}
+	.col-ts-offset-6 {
+		margin-left: 50%;
+	}
+	.col-ts-offset-5 {
+		margin-left: 41.66666667%;
+	}
+	.col-ts-offset-4 {
+		margin-left: 33.33333333%;
+	}
+	.col-ts-offset-3 {
+		margin-left: 25%;
+	}
+	.col-ts-offset-2 {
+		margin-left: 16.66666667%;
+	}
+	.col-ts-offset-1 {
+		margin-left: 8.33333333%;
+	}
+	.col-ts-offset-0 {
+		margin-left: 0;
+	}
+	.hidden-ts {
+		display: none;
+	}
+}
+/*---------------------Custom Bostrap 5 columns------------------------*/
+.col-bg-15,
+.col-bg-45,
+.col-lg-15,
+.col-lg-45,
+.col-md-15,
+.col-md-45,
+.col-sm-15,
+.col-sm-45,
+.col-xs-15,
+.col-xs-45,
+.col-ts-15,
+.col-ts-45 {
+	position: relative;
+	min-height: 1px;
+	padding-right: 15px;
+	padding-left: 15px
+}
+.col-ts-15,
+.col-ts-45 {
+	float: left;
+}
+.col-ts-15 {
+	width: 20%;
+}
+.col-ts-45 {
+	width: 80%;
+}
+@media (min-width: 480px) {
+	.col-xs-15,
+	.col-xs-45 {
+		float: left;
+	}
+	.col-xs-15 {
+		width: 20%;
+	}
+	.col-xs-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 768px) {
+	.col-sm-15,
+	.col-sm-45 {
+		float: left;
+	}
+	.col-sm-15 {
+		width: 20%;
+	}
+	.col-sm-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 992px) {
+	.col-md-15,
+	.col-md-45 {
+		float: left;
+	}
+	.col-md-15 {
+		width: 20%;
+	}
+	.col-md-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 1200px) {
+	.col-lg-15,
+	.col-lg-45 {
+		float: left;
+	}
+	.col-lg-15 {
+		width: 20%;
+	}
+	.col-lg-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 1500px) {
+	.col-bg-15,
+	.col-bg-45 {
+		float: left;
+	}
+	.col-bg-15 {
+		width: 20%;
+	}
+	.col-bg-45 {
+		width: 80%;
+	}
+}
+/*rows-space*/
+.rows-space-0 {
+	margin-bottom: 0;
+}
+.rows-space-5 {
+	margin-bottom: 5px;
+}
+.rows-space-10 {
+	margin-bottom: 10px;
+}
+.rows-space-15 {
+	margin-bottom: 15px;
+}
+.rows-space-20 {
+	margin-bottom: 20px;
+}
+.rows-space-25 {
+	margin-bottom: 25px;
+}
+.rows-space-30 {
+	margin-bottom: 30px;
+}
+.rows-space-35 {
+	margin-bottom: 35px;
+}
+.rows-space-40 {
+	margin-bottom: 40px;
+}
+.rows-space-45 {
+	margin-bottom: 45px;
+}
+.rows-space-50 {
+	margin-bottom: 50px;
+}
+.rows-space-55 {
+	margin-bottom: 55px;
+}
+.rows-space-60 {
+	margin-bottom: 60px;
+}
+.rows-space-65 {
+	margin-bottom: 65px;
+}
+.rows-space-70 {
+	margin-bottom: 70px;
+}
+.rows-space-75 {
+	margin-bottom: 75px;
+}
+.rows-space-80 {
+	margin-bottom: 80px;
+}
+.rows-space-85 {
+	margin-bottom: 85px;
+}
+.rows-space-90 {
+	margin-bottom: 90px;
+}
+.rows-space-85 {
+	margin-bottom: 85px;
+}
+.rows-space-100 {
+	margin-bottom: 100px;
+}
+.row10 {
+	margin-left: -10px;
+	margin-right: -10px;
+}
+.row10::before, .row10::after {
+	display: table;
+	content: "";
+}
+.row10::after {
+	clear: both;
+}
+.no-padding {
+	padding-left: 0 !important;
+	padding-right: 0 !important;
+}
+/*----------------------------AUTO CLEAR--------------------------------*/
+@media (min-width: 1200px) {
+	.auto-clear .vc_col-lg-1:nth-child(12n+1),
+	.auto-clear .vc_col-lg-2:nth-child(6n+1),
+	.auto-clear .vc_col-lg-15:nth-child(5n+1),
+	.auto-clear .vc_col-lg-3:nth-child(4n+1),
+	.auto-clear .vc_col-lg-4:nth-child(3n+1),
+	.auto-clear .vc_col-lg-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (min-width: 1500px) {
+	.auto-clear .col-bg-1:nth-child(12n+1),
+	.auto-clear .col-bg-2:nth-child(6n+1),
+	.auto-clear .col-bg-15:nth-child(5n+1),
+	.auto-clear .col-bg-3:nth-child(4n+1),
+	.auto-clear .col-bg-4:nth-child(3n+1),
+	.auto-clear .col-bg-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (min-width: 1200px) and (max-width: 1499px) {
+	.auto-clear .col-lg-1:nth-child(12n+1),
+	.auto-clear .col-lg-2:nth-child(6n+1),
+	.auto-clear .col-lg-15:nth-child(5n+1),
+	.auto-clear .col-lg-3:nth-child(4n+1),
+	.auto-clear .col-lg-4:nth-child(3n+1),
+	.auto-clear .col-lg-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+	.auto-clear .vc_col-md-1:nth-child(12n+1),
+	.auto-clear .vc_col-md-2:nth-child(6n+1),
+	.auto-clear .vc_col-md-15:nth-child(5n+1),
+	.auto-clear .vc_col-md-3:nth-child(4n+1),
+	.auto-clear .vc_col-md-4:nth-child(3n+1),
+	.auto-clear .vc_col-md-6:nth-child(odd),
+	.auto-clear .col-md-1:nth-child(12n+1),
+	.auto-clear .col-md-2:nth-child(6n+1),
+	.auto-clear .col-md-15:nth-child(5n+1),
+	.auto-clear .col-md-3:nth-child(4n+1),
+	.auto-clear .col-md-4:nth-child(3n+1),
+	.auto-clear .col-md-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (min-width: 768px) and (max-width: 991px) {
+	.auto-clear .vc_col-sm-1:nth-child(12n+1),
+	.auto-clear .vc_col-sm-2:nth-child(6n+1),
+	.auto-clear .vc_col-sm-15:nth-child(5n+1),
+	.auto-clear .vc_col-sm-3:nth-child(4n+1),
+	.auto-clear .vc_col-sm-4:nth-child(3n+1),
+	.auto-clear .vc_col-sm-6:nth-child(odd),
+	.auto-clear .col-sm-1:nth-child(12n+1),
+	.auto-clear .col-sm-2:nth-child(6n+1),
+	.auto-clear .col-sm-15:nth-child(5n+1),
+	.auto-clear .col-sm-3:nth-child(4n+1),
+	.auto-clear .col-sm-4:nth-child(3n+1),
+	.auto-clear .col-sm-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (min-width: 480px) and (max-width: 767px) {
+	.auto-clear .col-xs-1:nth-child(12n+1),
+	.auto-clear .col-xs-2:nth-child(6n+1),
+	.auto-clear .col-xs-15:nth-child(5n+1),
+	.auto-clear .col-xs-3:nth-child(4n+1),
+	.auto-clear .col-xs-4:nth-child(3n+1),
+	.auto-clear .col-xs-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (max-width: 479px) {
+	.auto-clear .col-ts-1:nth-child(12n+1),
+	.auto-clear .col-ts-2:nth-child(6n+1),
+	.auto-clear .col-ts-15:nth-child(5n+1),
+	.auto-clear .col-ts-3:nth-child(4n+1),
+	.auto-clear .col-ts-4:nth-child(3n+1),
+	.auto-clear .col-ts-6:nth-child(odd) {
+		clear: both;
+	}
+}
+@media (max-width: 767px) {
+	.auto-clear .vc_col-xs-1:nth-child(12n+1),
+	.auto-clear .vc_col-xs-2:nth-child(6n+1),
+	.auto-clear .vc_col-xs-15:nth-child(5n+1),
+	.auto-clear .vc_col-xs-3:nth-child(4n+1),
+	.auto-clear .vc_col-xs-4:nth-child(3n+1),
+	.auto-clear .vc_col-xs-6:nth-child(odd) {
+		clear: both;
+	}
+}
+/*-----------------------CUSTOM COL > 1500---------------------------*/
+@media (min-width: 1500px) {
+	.col-bg-1,
+	.col-bg-10,
+	.col-bg-11,
+	.col-bg-12,
+	.col-bg-2,
+	.col-bg-3,
+	.col-bg-4,
+	.col-bg-5,
+	.col-bg-6,
+	.col-bg-7,
+	.col-bg-8,
+	.col-bg-9 {
+		position: relative;
+		min-height: 1px;
+		padding-right: 15px;
+		padding-left: 15px
+	}
+	.col-bg-1,
+	.col-bg-2,
+	.col-bg-3,
+	.col-bg-4,
+	.col-bg-5,
+	.col-bg-6,
+	.col-bg-7,
+	.col-bg-8,
+	.col-bg-9,
+	.col-bg-10,
+	.col-bg-11 {
+		float: left;
+	}
+	.col-bg-12 {
+		width: 100%;
+	}
+	.col-bg-11 {
+		width: 91.66666667%;
+	}
+	.col-bg-10 {
+		width: 83.33333333%;
+	}
+	.col-bg-9 {
+		width: 75%;
+	}
+	.col-bg-8 {
+		width: 66.66666667%;
+	}
+	.col-bg-7 {
+		width: 58.33333333%;
+	}
+	.col-bg-6 {
+		width: 50%;
+	}
+	.col-bg-5 {
+		width: 41.66666667%;
+	}
+	.col-bg-4 {
+		width: 33.33333333%;
+	}
+	.col-bg-3 {
+		width: 25%;
+	}
+	.col-bg-2 {
+		width: 16.66666667%;
+	}
+	.col-bg-1 {
+		width: 8.33333333%;
+	}
+}
+/*-----------------------CUSTOM COL < 480---------------------------*/
+@media (max-width: 479px) {
+	.col-ts-1,
+	.col-ts-10,
+	.col-ts-11,
+	.col-ts-12,
+	.col-ts-2,
+	.col-ts-3,
+	.col-ts-4,
+	.col-ts-5,
+	.col-ts-6,
+	.col-ts-7,
+	.col-ts-8,
+	.col-ts-9 {
+		position: relative;
+		min-height: 1px;
+		padding-right: 15px;
+		padding-left: 15px;
+	}
+	.col-ts-1,
+	.col-ts-2,
+	.col-ts-3,
+	.col-ts-4,
+	.col-ts-5,
+	.col-ts-6,
+	.col-ts-7,
+	.col-ts-8,
+	.col-ts-9,
+	.col-ts-10,
+	.col-ts-11 {
+		float: left;
+	}
+	.col-ts-12 {
+		width: 100%;
+	}
+	.col-ts-11 {
+		width: 91.66666667%;
+	}
+	.col-ts-10 {
+		width: 83.33333333%;
+	}
+	.col-ts-9 {
+		width: 75%;
+	}
+	.col-ts-8 {
+		width: 66.66666667%;
+	}
+	.col-ts-7 {
+		width: 58.33333333%;
+	}
+	.col-ts-6 {
+		width: 50%;
+	}
+	.col-ts-5 {
+		width: 41.66666667%;
+	}
+	.col-ts-4 {
+		width: 33.33333333%;
+	}
+	.col-ts-3 {
+		width: 25%;
+	}
+	.col-ts-2 {
+		width: 16.66666667%;
+	}
+	.col-ts-1 {
+		width: 8.33333333%;
+	}
+}
+/*-----------------------CUSTOM 5 COLUMNS---------------------------*/
+.col-bg-15,
+.col-bg-25,
+.col-bg-35,
+.col-bg-45,
+.col-lg-15,
+.col-lg-25,
+.col-lg-35,
+.col-lg-45,
+.col-md-15,
+.col-md-25,
+.col-md-35,
+.col-md-45,
+.col-sm-15,
+.col-sm-25,
+.col-sm-35,
+.col-sm-45,
+.col-xs-15,
+.col-xs-25,
+.col-xs-35,
+.col-xs-45,
+.col-ts-15,
+.col-ts-25,
+.col-ts-35,
+.col-ts-45 {
+	position: relative;
+	min-height: 1px;
+	padding-right: 15px;
+	padding-left: 15px
+}
+.col-ts-15,
+.col-ts-25,
+.col-ts-35,
+.col-ts-45 {
+	float: left;
+}
+.col-ts-15 {
+	width: 20%;
+}
+.col-ts-25 {
+	width: 40%;
+}
+.col-ts-35 {
+	width: 60%;
+}
+.col-ts-45 {
+	width: 80%;
+}
+@media (min-width: 480px) {
+	.col-xs-15,
+	.col-xs-25,
+	.col-xs-35,
+	.col-xs-45 {
+		float: left;
+	}
+	.col-xs-15 {
+		width: 20%;
+	}
+	.col-xs-25 {
+		width: 40%;
+	}
+	.col-xs-35 {
+		width: 60%;
+	}
+	.col-xs-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 768px) {
+	.col-sm-15,
+	.col-sm-25,
+	.col-sm-35,
+	.col-sm-45 {
+		float: left;
+	}
+	.col-sm-15 {
+		width: 20%;
+	}
+	.col-sm-25 {
+		width: 40%;
+	}
+	.col-sm-35 {
+		width: 60%;
+	}
+	.col-sm-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 992px) {
+	.col-md-15,
+	.col-md-25,
+	.col-md-35,
+	.col-md-45 {
+		float: left;
+	}
+	.col-md-15 {
+		width: 20%;
+	}
+	.col-md-25 {
+		width: 40%;
+	}
+	.col-md-35 {
+		width: 60%;
+	}
+	.col-md-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 1200px) {
+	.col-lg-15,
+	.col-lg-25,
+	.col-lg-35,
+	.col-lg-45 {
+		float: left;
+	}
+	.col-lg-15 {
+		width: 20%;
+	}
+	.col-lg-25 {
+		width: 40%;
+	}
+	.col-lg-35 {
+		width: 60%;
+	}
+	.col-lg-45 {
+		width: 80%;
+	}
+}
+@media (min-width: 1500px) {
+	.col-bg-15,
+	.col-bg-25,
+	.col-bg-35,
+	.col-bg-45 {
+		float: left;
+	}
+	.col-bg-15 {
+		width: 20%;
+	}
+	.col-bg-25 {
+		width: 40%;
+	}
+	.col-bg-35 {
+		width: 60%;
+	}
+	.col-bg-45 {
+		width: 80%;
+	}
+}
+/*---------------------------SLICK SLIDER------------------------------*/
+/* Slider */
+.slick-list {
+	margin: 0 -15px;
+	padding: 0;
+}
+.owl-slick .slick-list {
+	margin-top: -5px !important;
+	padding-top: 5px;
+	margin-bottom: -5px !important;
+	padding-bottom: 5px;
+}
+.slick-track {
+	margin-left: 0;
+}
+.slick-slide {
+	padding: 0 15px;
+}
+.slick-slider .slick-arrow {
+	display: inline-block;
+	position: absolute;
+	top: -4px;
+	right: 0;
+	font-size: 24px;
+	line-height: 1;
+	color: #fff;
+	background-color: #dd3232;
+	z-index: 1;
+	cursor: pointer;
+	border-radius: 50%;
+}
+.slick-slider .slick-arrow:first-child {
+	right: 29px;
+}
+.slick-vertical .slick-slide {
+	border: none;
+}
+.slick-slider.nav-center {
+	position: relative !important;
+}
+.slick-slider.nav-center > .slick-arrow {
+	top: 50%;
+	transform: translateY(-50%);
+	margin: 0;
+	font-size: 30px;
+	background-color: transparent;
+	color: #aaaaaa;
+}
+.slick-slider.nav-center > .slick-arrow:hover {
+	color: #0a0a0a;
+}
+.slick-slider.nav-center > .slick-arrow::before {
+	font-family: FontAwesome, sans-serif;
+	content: '\f105';
+}
+.slick-slider.nav-center > .slick-arrow:first-child {
+	right: auto;
+	left: 0;
+}
+.slick-slider.nav-center > .slick-arrow:first-child::before {
+	content: '\f104';
+}
+.slick-slide > div:not([class]) > * {
+	display: block !important;
+}
+.slick-dots {
+	list-style: none;
+	padding: 0;
+	margin-bottom: 0;
+	text-align: center;
+	margin-top: 40px;
+}
+.slick-dots li {
+	list-style: none;
+	display: inline-block;
+	font-size: 0;
+	padding: 0;
+	width: 8px;
+	height: 8px;
+	border-radius: 50%;
+	margin: 0 7px;
+	cursor: pointer;
+	-webkit-transition: all 0.25s ease 0s;
+	-moz-transition: all 0.25s ease 0s;
+	-o-transition: all 0.25s ease 0s;
+	transition: all 0.25s ease 0s;
+	background-color: #ccc;
+	position: relative;
+}
+.slick-dots li.slick-active {
+	background-color: transparent;
+}
+.slick-dots li.slick-active::before {
+	content: '';
+	position: absolute;
+	top: -2px;
+	left: -2px;
+	right: -2px;
+	bottom: -2px;
+	border: 2px solid #dd3232;
+	border-radius: 50%;
+}
+.slick-dots li button {
+	display: none;
+}
+.slick-dots .slick-slide img {
+	cursor: pointer;
+	margin: auto;
+}
+.slick-slider.nav-botton-center > .slick-arrow {
+	top: auto;
+	bottom: 0;
+	right: 43.5%;
+}
+/*---------------------------------CHOSEN------------------------------*/
+.chosen-container {
+	vertical-align: top;
+	font-size: inherit;
+	line-height: inherit;
+	text-align: left;
+	width: auto !important;
+}
+.chosen-container-single .chosen-single {
+	padding: 8px 17px;
+	height: auto;
+	border: 1px solid #eee;
+	background: #f6f6f6;
+	box-shadow: none;
+	font-size: 14px;
+	line-height: 24px;
+	color: inherit;
+	border-radius: 0;
+}
+.chosen-container-single .chosen-single div b {
+	position: relative;
+	background-image: none !important;
+}
+.chosen-container-single .chosen-single div b::after {
+	content: "\f0d7";
+	font-size: 14px;
+	font-weight: normal;
+	color: #aaaaaa;
+	font-family: 'FontAwesome';
+	position: absolute;
+	left: 50%;
+	top: 50%;
+	line-height: normal;
+	margin-left: -5px;
+	margin-top: -8px;
+}
+.chosen-container-single .chosen-single span {
+	vertical-align: top;
+	margin-right: 17px;
+}
+.chosen-container-active.chosen-with-drop .chosen-single {
+	border: 1px solid #eee;
+	background: #f6f6f6;
+	box-shadow: none;
+}
+.chosen-container-single .chosen-drop {
+	top: calc(100% + 1px);
+	left: -1px;
+	clip: auto;
+	border-radius: 0;
+	border: 1px solid #eee;
+	border-top: none;
+	box-shadow: none;
+	width: auto;
+	min-width: 100%;
+	white-space: nowrap;
+	margin: 0;
+	-webkit-transition: all 0.3s ease;
+	-moz-transition: all 0.3s ease;
+	-ms-transition: all 0.3s ease;
+	-o-transition: all 0.3s ease;
+	transition: all 0.3s ease;
+}
+.chosen-container:not(.chosen-with-drop) .chosen-drop {
+	visibility: hidden;
+	opacity: 0;
+	-webkit-transform: translateY(20px);
+	-moz-transform: translateY(20px);
+	-ms-transform: translateY(20px);
+	-o-transform: translateY(20px);
+	transform: translateY(20px);
+}
+.chosen-container-single .chosen-drop .chosen-search {
+	display: none;
+}
+.chosen-container-single .chosen-results {
+	color: #888;
+	padding: 0;
+	margin: 0;
+}
+.chosen-container .chosen-results li {
+	font-size: 14px;
+	line-height: 18px;
+	padding: 6px 20px;
+	text-transform: capitalize;
+}
+.chosen-container .chosen-results li.result-selected {
+	background-color: #f6f6f6;
+}
+.chosen-container .chosen-results li.highlighted {
+	background-image: none;
+	color: inherit;
+	background-color: #f6f6f6;
+}
+/* -------------------- */
+/*   custom container   */
+/* -------------------- */
+@media (min-width: 1200px) {
+	.container {
+		width: 1200px;
+	}
+}
+/* -------------------- */
+/*     HEADER        */
+/* -------------------- */
+
+/*header-style-1*/
+.header .main-header {
+	padding: 50px 0;
+}
+.social-header, .header-language {
+	display: inline-block;
+	vertical-align: middle;
+}
+.social-header .socials {
+	padding-top: 10px;
+	overflow: hidden;
+}
+.social-header .social-item {
+	font-size: 23px;
+	line-height: 20px;
+	display: inline-block;
+	padding: 0 15px;
+	color: #222;
+	float: left;
+}
+.social-header .social-item:first-child {
+	padding-left: 0;
+}
+.header-language .dungar-language {
+	padding-top: 10px;
+	margin-left: 100px;
+	position: relative;
+}
+.dungar-language .language-toggle {
+	color: #fff;
+}
+.dungar-submenu {
+	position: absolute;
+	background-color: #fff;
+	z-index: 10;
+	-webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	-moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	padding: 0;
+	margin: 0;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transition: .35s;
+	-o-transition: .35s;
+	transition: .35s;
+	-webkit-transform: translateY(10px);
+	-moz-transform: translateY(10px);
+	-ms-transform: translateY(10px);
+	-o-transform: translateY(10px);
+	transform: translateY(10px);
+	text-align: left;
+}
+.dungar-dropdown.open .dungar-submenu {
+	opacity: 1;
+	visibility: visible;
+	-webkit-transform: translateY(0);
+	-moz-transform: translateY(0);
+	-ms-transform: translateY(0);
+	-o-transform: translateY(0);
+	transform: translateY(0);
+	z-index: 1001;
+}
+.dungar-dropdown .language-toggle:after {
+	content: "\f107";
+	font-family: 'FontAwesome';
+	display: inline-block;
+	margin-left: 5px;
+	vertical-align: top;
+}
+.header-language .dungar-submenu {
+	margin: 15px 0 0;
+	min-width: 175px;
+	top: 100%;
+	left: 0;
+}
+.header-language .dungar-submenu li {
+	list-style: none;
+}
+.header-language .dungar-submenu > li > a {
+	display: block;
+	padding: 11px 20px;
+	color: #888;
+}
+.header-language .dungar-submenu > li > a:hover {
+	background: #f1f1f1;
+}
+.header .logo {
+	text-align: center;
+}
+.header-control {
+	text-align: right;
+}
+.header.style7 .header-control {
+	margin-top: 10px;
+}
+.header-control .block-header {
+	display: inline-block;
+	position: relative;
+	text-align: left;
+	vertical-align: middle;
+	padding-left: 20px;
+}
+.header-control .block-header:first-child {
+	padding-left: 0;
+}
+/*minicar*/
+.shopcart-description .content-wrap .title {
+	font-size: 18px;
+	color: #222;
+	padding: 15px 20px;
+	border-bottom: 1px solid #f1f1f1;
+	margin: 0;
+}
+.shopcart-description .content-wrap ul {
+	padding: 0 20px;
+	margin: 0;
+	overflow-y: auto;
+	max-height: 250px;
+}
+.shopcart-description .content-wrap ul li {
+	list-style: none;
+	overflow: hidden;
+	padding: 20px 0;
+	border-bottom: 1px solid #f1f1f1;
+}
+.mini_cart_item .product-media {
+	float: left;
+	width: 80px;
+}
+.mini_cart_item .product-details {
+	overflow: hidden;
+	padding-left: 10px;
+}
+.mini_cart_item .product-name {
+	font-size: 15px;
+	color: #333;
+	text-transform: capitalize;
+	margin-bottom: 0;
+}
+.shopcart-description .subtotal {
+	padding: 15px 20px;
+	overflow: hidden;
+}
+.shopcart-description .actions {
+	padding: 0 20px 30px;
+}
+.mini_cart_item .variations {
+	font-size: 13px;
+	color: #888888;
+	margin-bottom: 0px;
+}
+.mini_cart_item .variations .attribute_color {
+	text-transform: capitalize;
+}
+.mini_cart_item .variations .attribute_size {
+	text-transform: uppercase;
+}
+.mini_cart_item .product-price {
+	font-size: 16px;
+	color: #111111;
+}
+.mini_cart_item .product-quantity {
+	color: #888881;
+	font-size: 16px;
+}
+.mini_cart_item .product-remove {
+	display: inline-block;
+	float: right;
+	color: #ccc;
+	font-size: 15px
+}
+.shopcart-description .subtotal .total-title {
+	font-size: 14px;
+	color: #333;
+	font-weight: 700;
+}
+.shopcart-description .subtotal .total-price {
+	font-size: 20px;
+	color: #111;
+	font-weight: 600;
+}
+.shopcart-description .actions .button-viewcart {
+	width: 140px;
+	background: transparent;
+	color: #333;
+	border: 1px solid #ebebeb;
+	padding: 7px 20px;
+	border-radius: 30px;
+}
+.shopcart-description .actions .button-viewcart:hover {
+	color: #ffffff;
+}
+.shopcart-description .actions .button-checkout {
+	width: 110px;
+	float: right;
+	color: #ffffff;
+	border-radius: 30px;
+}
+.minicart-items .mCSB_scrollTools {
+	right: -5px;
+}
+.minicart-items .mCSB_scrollTools .mCSB_dragger .mCSB_dragger_bar {
+	background: #0a0a0a;
+}
+.minicart-items .mCSB_scrollTools .mCSB_draggerRail {
+	background: #aaaaaa;
+}
+.minicart-items .mCSB_inside > .mCSB_container {
+	margin-right: 20px;
+}
+.block-minicart .shopcart-icon {
+	font-size: 14px;
+	font-family: 'Jost';
+	color: #555555;
+	position: relative;
+	text-transform: uppercase;
+	font-weight: 600;
+	border: 2px solid #e9e9e9;
+	padding: 0 15px;
+	height: 43px;
+	display: inline-block;
+	line-height: 37px;
+	width: 102px;
+	border-radius: 30px;
+}
+.block-minicart .shopcart-icon::after {
+	content: "\f107";
+	font-family: 'FontAwesome';
+	position: absolute;
+	display: inline-block;
+	color: #888;
+	top: 0;
+	right: 30px;
+	font-weight: normal;
+}
+.block-minicart .shopcart-icon .count {
+	position: absolute;
+	display: inline-block;
+	text-align: center;
+	width: 22px;
+	height: 22px;
+	border-radius: 50%;
+	top: -5px;
+	right: -5px;
+	color: #ffffff;
+	font-size: 14px;
+	line-height: 22px;
+}
+.header-control .block-header .dungar-submenu {
+	top: 100%;
+	right: 0;
+}
+.block-minicart .dungar-submenu {
+	min-width: 300px;
+	margin: 10px 0 0;
+}
+.block-minicart .no-product.dungar-submenu {
+	text-align: center;
+	padding: 20px
+}
+.block-minicart .no-product .text {
+	color: #888;
+	font-weight: 700;
+	margin-bottom: 0;
+}
+.block-minicart .no-product .text span {
+	text-transform: uppercase;
+}
+/*search header*/
+.header-control .block-search {
+	padding-left: 35px;
+}
+.block-search .icon-search::before {
+	content: "\f12d";
+	font-family: Flaticon;
+	display: inline-block;
+	vertical-align: middle;
+}
+.block-search .dungar-submenu {
+	min-width: 425px;
+	margin-top: 17px;
+}
+.block-search .title-search {
+	font-size: 18px;
+	color: #0a0a0a;
+	padding: 15px 20px;
+	border-bottom: 1px solid #f1f1f1;
+	margin: 0;
+}
+.form-search .form-content {
+	padding: 30px 20px;
+}
+.form-search .form-content .inner {
+	display: inline-block;
+	width: 100%
+}
+.form-search .form-content .input {
+	width: 261px;
+	color: #888;
+}
+.form-search .form-content .btn-search {
+	width: 110px;
+	float: right;
+}
+/*account header*/
+.block-account > a {
+	font-size: 26px;
+	color: #555555;
+}
+.block-account .dungar-submenu {
+	min-width: 270px;
+	margin-top: 17px;
+}
+.header-user-form-tabs .tab-link {
+	padding: 15px 20px;
+	margin: 0;
+	border-bottom: 1px solid #f1f1f1;
+}
+.header-user-form-tabs .tab-link li {
+	display: inline-block;
+	list-style: none;
+	padding-right: 15px;
+	font-size: 16px;
+	font-weight: 700;
+	color: #aaaaaa;
+	text-transform: capitalize;
+}
+.header-account form {
+	padding: 15px 20px;
+}
+.header-account form .form-row-wide {
+	margin-bottom: 10px;
+}
+.header-account form .input-text {
+	width: 100%;
+	color: #888;
+	font-size: 13px;
+}
+/*header-tab-login */
+.header-account .form-checkbox {
+	display: block;
+}
+.form-checkbox .input-checkbox {
+	display: none;
+}
+.form-checkbox span {
+	position: relative;
+	padding-left: 31px;
+	cursor: pointer
+}
+.form-checkbox span::before {
+	position: absolute;
+	content: '';
+	width: 21px;
+	height: 21px;
+	border: 1px solid #f1f1f1;
+	left: 0px;
+	top: -2px;
+}
+.form-checkbox input[type="checkbox"]:checked + span::after,
+.form-checkbox:hover span::after {
+	font-family: 'FontAwesome';
+	content: "\f00c";
+	display: inline-block;
+	top: 2px;
+	left: 6px;
+	width: 10px;
+	height: 12px;
+	text-align: center;
+	font-size: 10px;
+	color: #444;
+	position: absolute;
+	z-index: 11;
+	padding: 0;
+	line-height: 14px;
+}
+.header-account .form-row .button {
+	display: block;
+	width: 100%;
+}
+.header-account .login .lost_password {
+	font-size: 13px;
+	color: #0a0a0a;
+	font-weight: 700;
+	margin-bottom: 10px
+}
+/*main menu*/
+.main-menu .submenu {
+	position: absolute;
+	top: 100%;
+	left: 0;
+	background-color: #fff;
+	min-width: 175px;
+	z-index: 1001;
+	-webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	-moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	padding: 0;
+	margin: 0;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transition: .35s;
+	-o-transition: .35s;
+	transition: .35s;
+	-webkit-transform: translateY(10px);
+	-moz-transform: translateY(10px);
+	-ms-transform: translateY(10px);
+	-o-transform: translateY(10px);
+	transform: translateY(10px);
+}
+.main-menu .menu-item:hover > .submenu {
+	opacity: 1;
+	visibility: visible;
+	-webkit-transform: translateY(0);
+	-moz-transform: translateY(0);
+	-ms-transform: translateY(0);
+	-o-transform: translateY(0);
+	transform: translateY(0);
+}
+.header.style1 .header-nav, .header.style10 .header-nav {
+	border-top: 1px solid #f1f1f1;
+}
+.main-menu {
+	display: table;
+	padding: 0;
+}
+.main-menu li {
+	list-style: none;
+	position: relative;
+}
+.main-menu > li {
+	display: inline-block;
+}
+.main-menu > li > a {
+	font-size: 14px;
+	padding: 18px 20px;
+	display: inline-block;
+	cursor: pointer;
+	text-transform: uppercase;
+	font-weight: 600;
+	font-family: 'Jost';
+	letter-spacing: 0.05em;
+	color: #000;
+}
+/* .main-menu > li.menu-item-has-children > a:after {
+	font-family: 'FontAwesome';
+	content: "\f107";
+	margin-left: 5px;
+	font-size: 15px;
+	font-weight: normal;
+	vertical-align: top;
+} */
+/*megamenu*/
+.submenu.mega-menu {
+	padding: 30px 20px;
+}
+.home-menu .home-item {
+	padding: 0 10px;
+}
+.dungar-demolink {
+	text-align: center;
+	margin-top: 30px;
+}
+.dungar-demolink .image {
+	position: relative;
+	margin-bottom: 5px;
+}
+.dungar-demolink .image::before {
+	content: '';
+	background-color: #0a0a0a;
+	transition: all 0.9s ease-out 0s;
+	-webkit-transition: all 0.9s ease-out 0s;
+	-o-transition: all 0.9s ease-out 0s;
+	-moz-transition: all 0.9s ease-out 0s;
+	position: absolute;
+	top: 0;
+	left: 0;
+	width: 100%;
+	bottom: 0;
+	opacity: 0;
+	visibility: hidden;
+	z-index: 100;
+}
+.dungar-demolink .image:hover::before {
+	opacity: 0.5;
+	visibility: visible;
+}
+.dungar-demolink .image a {
+	position: absolute;
+	top: 50%;
+	left: 50%;
+	transform: translate(-50%, -50%);
+	padding: 10px 20px;
+	background: #0a0a0a;
+	color: #fff;
+	font-weight: 700;
+	font-size: 14px;
+	
+	opacity: 0;
+	visibility: hidden;
+	z-index: 1001;
+	min-width: 134px;
+}
+.dungar-demolink .image:hover a {
+	opacity: 1;
+	visibility: visible;
+}
+.dungar-demolink .title {
+	font-size: 16px;
+	color: #0a0a0a;
+	font-weight: 700;
+	margin-bottom: 0;
+}
+.submenu.menu-page {
+	background-image: url(../image/mega-bg.jpg);
+	background-repeat: no-repeat;
+	background-size: cover;
+	padding: 50px 0 40px;
+}
+.dungar-nav .mega-menu .menu-page-item:first-child .dungar-custommenu {
+	padding-left: 50px;
+}
+.dungar-nav .mega-menu .menu-page-item:nth-child(2) .dungar-custommenu {
+	padding-left: 47px;
+}
+.dungar-nav .mega-menu .menu-page-item:nth-child(3) .dungar-custommenu {
+	padding-left: 17px;
+}
+.dungar-nav .mega-menu .menu-page-item:last-child .dungar-custommenu {
+	padding-right: 50px;
+}
+.dungar-nav .mega-menu .dungar-custommenu {
+	margin-bottom: 30px;
+}
+.mega-menu .dungar-custommenu .widgettitle {
+	font-size: 14px;
+	color: #0a0a0a;
+	font-weight: 600;
+	margin-bottom: 15px;
+	text-transform: uppercase;
+	position: relative;
+	padding-bottom: 10px;
+}
+.mega-menu .dungar-custommenu .widgettitle::before {
+	content: '';
+	position: absolute;
+	left: 0;
+	bottom: 0;
+	border-bottom: 2px solid #dd3232;
+	width: 30px;
+}
+.mega-menu .dungar-custommenu ul {
+	padding: 0;
+	margin: 0;
+}
+.mega-menu .dungar-custommenu ul li {
+	line-height: 32px;
+	color: #555;
+}
+.mega-menu .dungar-custommenu ul li a {
+	line-height: 28px;
+}
+.main-menu .submenu .submenu {
+	left: 100%;
+	top: 0;
+}
+.main-menu .submenu > li > a {
+	display: block;
+	padding: 11px 20px;
+	color: #555555;
+}
+.main-menu .submenu > li:hover > a, .main-menu .submenu > li.active > a {
+	background-color: #f1f1f1;
+}
+.main-menu .submenu > li.menu-item-has-children > a:after {
+	font-family: 'FontAwesome';
+	content: "\f105";
+	float: right;
+}
+/* -------------------- */
+/*      MAIN         */
+/* -------------------- */
+.main-content {
+	padding-bottom: 65px;
+}
+.main-content.main-content-inlookbook {
+	padding-bottom: 0;
+}
+.main-content.mansory {
+	padding-bottom: 120px;
+}
+.home-01 .main-content {
+	padding-bottom: 0;
+}
+.home-03 .main-content {
+	padding-bottom: 55px;
+}
+.home-05 .main-content {
+	padding-bottom: 0;
+}
+.home-08 .main-content {
+	padding-bottom: 0;
+}
+.left-sidebar .content-area {
+	float: right;
+}
+.no-sidebar .sidebar {
+	display: none;
+}
+.no-sidebar .content-area {
+	width: 100% !important;
+}
+/* -------------------- */
+/*      Blog         */
+/* -------------------- */
+.content-blog .custom_blog_title {
+	margin-top: -8px;
+}
+.main-content-blog.right-sidebar .content-blog::after {
+	right: -15px;
+}
+.main-content-blog.left-sidebar .content-blog::after {
+	left: -15px;
+}
+.main-content-blog.no-sidebar .content-blog::after {
+	display: none;
+}
+.custom_blog_title {
+	font-size: 20px;
+	letter-spacing: 0;
+	font-weight: 600;
+	color: #222;
+	margin-bottom: 40px;
+	text-transform: uppercase;
+}
+.blog-articles > .custom_blog_title,
+.comments-area > .custom_blog_title {
+	font-size: 18px;
+}
+.category-blog {
+	font-size: 12px;
+	color: #aaa;
+	text-transform: uppercase;
+	margin-bottom: 10px;
+	margin-top: 15px;
+	font-weight: 500;
+}
+.post-item .post-format {
+	position: relative;
+	overflow: hidden;
+}
+.post-item .post-title {
+	font-size: 26px;
+	color: #333;
+	margin-bottom: 20px;
+	font-weight: 500;
+}
+.post-item .post-title a:not(:hover) {
+	color: inherit;
+}
+blockquote .author .name {
+	display: block;
+	color: #222;
+}
+blockquote .author .desc {
+	display: block;
+	color: #aaa;
+	font-size: 13px;
+	line-height: 1.1;
+	font-weight: normal;
+}
+.blog-articles {
+	position: relative;
+}
+.blog-articles .owl-slick {
+	position: static;
+}
+.blog-articles .owl-slick .slick-arrow {
+	position: absolute;
+	top: -5px;
+	right: 0;
+	font-size: 24px;
+	border: 1px solid #eeeeee;
+	width: 37px;
+	height: 35px;
+	line-height: 31px;
+	color: #aaa;
+	text-align: center;
+	cursor: pointer;
+	background-color: #ffffff;
+}
+.blog-articles .owl-slick .fa-angle-left {
+	margin-right: 47px;
+}
+.blog-articles .owl-slick .slick-arrow:hover {
+	color: #222;
+}
+.owl-slick.blog-slider .slick-list {
+	margin: 0 !important;
+	padding: 0 !important;
+}
+.blog-slider.style-1 .blog-item {
+	width: 570px;
+	margin: 0 15px;
+	padding: 0
+}
+.blog-item {
+	overflow: hidden;
+	border: 1px solid #f4f4f4;
+}
+.blog-item .post-format {
+	float: left;
+}
+.blog-item .post-info {
+	padding: 0 0 0 30px;
+	overflow: hidden;
+	position: relative;
+}
+.blog-item .category-blog {
+	margin-top: 20px;
+}
+.blog-item .post-title {
+	font-size: 18px;
+	color: #333;
+	font-weight: 600;
+}
+.blog-item .main-info-post p {
+	margin-bottom: 15px;
+}
+.blog-item .post-title a span {
+	color: #aaa;
+	display: none;
+}
+.author-view .author, .author-view .review {
+	display: inline-block;
+	vertical-align: middle;
+}
+.author-view .avt {
+	display: inline-block;
+	float: left;
+}
+.author-view .avt img {
+	display: inline-block;
+	width: 31px;
+	height: 28px;
+	border-radius: 50%;
+	text-align: center;
+}
+.author-view .name {
+	display: inline-block;
+	overflow: hidden;
+	padding: 6px 0;
+	font-size: 14px;
+	color: #333;
+	padding-left: 5px;
+	margin: 0;
+	font-weight: 500;
+}
+.author-view .review {
+	padding: 3px 0;
+	color: #aaa;
+	display: none;
+}
+.review .view, .review .s-comments {
+	display: inline-block;
+	cursor: pointer;
+}
+.review .icon-cmt {
+	margin-left: 10px;
+}
+.main-info-post {
+	margin-bottom: 20px;
+}
+.dungar-blog-item .main-info-post {
+	margin-bottom: 0;
+}
+.dungar-blog-item .main-info-post p {
+	margin-bottom: 10px;
+}
+.dungar-blog-item .readmore {
+	display: inline-block;
+	font-weight: 600;
+	position: relative;
+	padding-bottom: 3px;
+	font-size: 15px;
+	color: #000;
+	overflow: hidden;
+	font-family: 'Jost';
+}
+.dungar-blog-item .readmore::before {
+	content: '';
+	position: absolute;
+	left: 0;
+	bottom: 0;
+	width: 100%;
+	border-bottom: 2px solid;
+}
+@-webkit-keyframes underline-link {
+	0% {
+		-webkit-transform: translateX(0);
+		transform: translateX(0)
+	}
+	50% {
+		-webkit-transform: translateX(100%);
+		transform: translateX(100%)
+	}
+	50.01% {
+		-webkit-transform: translateX(-100%);
+		transform: translateX(-100%)
+	}
+	to {
+		-webkit-transform: translateX(0);
+		transform: translateX(0)
+	}
+}
+@keyframes underline-link {
+	0% {
+		-webkit-transform: translateX(0);
+		transform: translateX(0)
+	}
+	50% {
+		-webkit-transform: translateX(100%);
+		transform: translateX(100%)
+	}
+	50.01% {
+		-webkit-transform: translateX(-100%);
+		transform: translateX(-100%)
+	}
+	to {
+		-webkit-transform: translateX(0);
+		transform: translateX(0)
+	}
+}
+.dungar-blog-item .readmore:hover::before {
+	-webkit-animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+	animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+}
+.blog-articles > .main-info-post {
+	margin-top: 40px;
+	margin-bottom: 45px;
+}
+.main-info-post p:last-child {
+	margin-bottom: 0;
+}
+/*tags*/
+.tags-blog {
+	margin-bottom: 15px;
+}
+.tags .widgettitle {
+	font-size: 16px;
+	color: #666;
+	display: inline-block;
+	padding-right: 10px;
+}
+.tagcloud {
+	display: inline-block;
+	padding: 0;
+	list-style: none;
+	margin-left: 0;
+}
+.tag-cloud-link {
+	display: inline-block;
+	padding: 0 12px;
+	border: 1px solid #ececec;
+	height: 28px;
+	line-height: 24px;
+	text-align: center;
+	margin-right: 5px;
+	font-weight: 500;
+	margin-bottom: 10px;
+	font-size: 15px;
+	border-radius: 0;
+}
+.tag-cloud-link a {
+	color: #888888;
+}
+/*view-share*/
+.view-share {
+	display: block;
+	padding-top: 20px;
+	border-top: 1px solid #f4f4f4;
+	border-bottom: 1px solid #f4f4f4;
+	padding-bottom: 13px;
+	margin-bottom: 50px;
+}
+.view-share .author-view .author {
+	float: none;
+}
+.view-share .author-view, .view-share .share {
+	display: inline-block;
+	vertical-align: middle;
+}
+.author-view .author {
+	float: left;
+	margin-right: 20px;
+}
+.view-share .share {
+	float: right;
+	padding: 6px 0;
+}
+.share .title {
+	display: inline-block;
+	font-size: 16px;
+	color: #666;
+	padding-right: 5px;
+	margin: 0;
+}
+.share .icon {
+	font-size: 16px;
+	padding: 0 10px;
+	color: #222;
+	cursor: pointer;
+}
+/*comment*/
+.comments-area {
+	margin-bottom: 75px;
+}
+.comment-form {
+	border: 1px solid #F1F1F1;
+	padding-top: 30px;
+	margin-bottom: 50px;
+}
+.comment-form .comment-reply-content {
+	padding: 0 30px;
+}
+.comment-form .input-form {
+	border: none;
+	padding-left: 0;
+	padding-right: 0;
+	width: 100%;
+	border-radius: 0;
+	min-width: 100%;
+}
+.comment-form .form-submit {
+	border-top: 1px solid #F1F1F1;
+	padding: 20px 30px;
+	margin: 0;
+	overflow: hidden
+}
+.comment-form .form-submit .controll {
+	display: block;
+	float: right;
+}
+.comment-form .controll .icon {
+	line-height: 43px;
+	padding: 0 8px;
+	font-size: 18px;
+	color: #888;
+}
+.comment-form .controll .submit {
+	margin-left: 20px;
+}
+.comments-area ul {
+	padding: 0;
+	margin: 0;
+}
+.comments-area ul li {
+	list-style: none;
+	border-bottom: 1px solid #e6e6e6;
+	margin-bottom: 30px;
+}
+.comments-area ul li:last-child {
+	border: none;
+	margin-bottom: 0;
+}
+.comment-item .author-view {
+	display: inline-block;
+	width: 100%;
+}
+.date-reply-comment {
+	display: inline-block;
+	padding: 5px 0;
+	padding-left: 0px;
+	font-size: 14px;
+	color: #aaa;
+}
+.comments-area .comment-reply-link {
+	margin-bottom: 30px;
+}
+.comment-reply-link > * {
+	display: inline-block;
+	padding: 0 10px;
+	font-size: 14px;
+	color: #aaa;
+}
+.comment-reply-link .Comment {
+	padding-left: 0;
+}
+.comments-area .comment-reply-link .icon {
+	font-size: 18px;
+}
+.comments-area .comment .children {
+	list-style: none;
+	padding-left: 60px;
+	padding-top: 50px;
+	border-top: 1px solid #e6e6e6;
+}
+.blog-list .blog-item {
+	margin-bottom: 30px;
+}
+.blog-list .blog-item .post-format {
+	margin-top: -2px;
+	margin-left: -2px;
+	margin-bottom: -2px;
+	position: relative;
+	max-width: 50%;
+}
+.blog-list .blog-item .post-format img {
+	width: 100%;
+}
+.blog-list .blog-item .post-format > a::before {
+	content: "";
+	position: absolute;
+	left: 50%;
+	right: 50%;
+	top: 6px;
+	bottom: 6px;
+	z-index: 9;
+	transition: all 0.5s;
+	-o-transition: all 0.5s;
+	-webkit-transition: all 0.5s;
+	border-top: 4px solid rgba(255, 255, 255, 0.6);
+	border-bottom: 4px solid rgba(255, 255, 255, 0.6);
+}
+.blog-list .blog-item .post-format:hover > a::before {
+	left: 10px;
+	right: 10px;
+}
+.blog-list .blog-item .post-format > a::after {
+	content: "";
+	position: absolute;
+	top: 50%;
+	bottom: 50%;
+	left: 6px;
+	right: 6px;
+	z-index: 9;
+	transition: all 0.5s;
+	-o-transition: all 0.5s;
+	-webkit-transition: all 0.5s;
+	border-left: 4px solid rgba(255, 255, 255, 0.6);
+	border-right: 4px solid rgba(255, 255, 255, 0.6);
+}
+.blog-list .blog-item .post-format:hover > a::after {
+	top: 6px;
+	bottom: 6px;
+}
+/*blog list*/
+/*blog grid*/
+/*blog mansory*/
+.masonry-grid .grid-sizer, .masonry-grid .grid-item {
+	width: 33.333333% !important;
+	padding: 0 15px;
+}
+.masonry-grid .blog-item {
+	margin-bottom: 42px;
+	border: none;
+}
+.masonry-grid .blog-item .post-info {
+	overflow: visible;
+	padding: 0;
+}
+.blog-list.masonry-style .blog-item .post-format {
+	margin: 0;
+	float: none;
+}
+.masonry-grid .category-blog {
+	margin-top: 13px;
+	margin-bottom: 3px;
+}
+/* -------------------- */
+/*      LOOKBOOK        */
+/* -------------------- */
+
+/* -------------------- */
+/*        login         */
+/* -------------------- */
+.customer_login .title-login {
+	border: 1px solid #f1f1f1;
+	margin: 0;
+	border-bottom: 0;
+	font-size: 18px;
+	padding: 25px 40px;
+	color: #222;
+	font-weight: 500;
+}
+.customer_login .login, .customer_login .register {
+	border: 1px solid #f1f1f1;
+	padding: 25px 40px;
+}
+.login .social-account {
+	margin-bottom: 20px;
+}
+.social-account .title-social {
+	color: #aaa;
+	margin-bottom: 20px;
+	font-family: inherit;
+	letter-spacing: 0;
+}
+.social-account .mxh-item {
+	font-size: 13px;
+	font-weight: 500;
+	color: #222;
+	margin-right: 30px;
+}
+.social-account .icon {
+	font-size: 23px;
+	vertical-align: middle;
+}
+.social-account .text {
+	vertical-align: middle;
+	padding-left: 5px;
+}
+.customer_login .form-row-wide .text {
+	margin-bottom: 5px;
+	font-size: 14px;
+	color: #222;
+	font-weight: 500;
+	text-transform: none;
+	display: block;
+}
+.customer_login input[type="text"],
+.customer_login input[type="email"],
+.customer_login input[type="password"] {
+	margin-bottom: 0;
+	width: 100%;
+	border-color: #f1f1f1;
+}
+.customer_login input[type="checkbox"] {
+	display: none;
+}
+.customer_login .label-text {
+	cursor: pointer;
+	font-size: 14px;
+	color: #888;
+	margin: 0;
+	padding-left: 25px;
+	position: relative;
+	font-weight: normal;
+}
+.customer_login input[type="checkbox"]:checked + label::before, .customer_login .label-text:hover::before {
+	font-family: 'FontAwesome';
+	content: "\f00c";
+	display: inline-block;
+	top: 5px;
+	left: 0;
+	width: 20px;
+	height: 20px;
+	text-align: center;
+	font-size: 14px;
+	color: #222;
+	position: absolute;
+	z-index: 2;
+	padding: 0;
+	line-height: 14px;
+}
+.customer_login input[type="checkbox"] + label::after {
+	position: absolute;
+	z-index: 1;
+	content: "";
+	left: 0;
+	top: 2px;
+	width: 20px;
+	height: 20px;
+	border: solid 1px #eeeeee;
+}
+.customer_login .lost_password .forgot-pw {
+	font-size: 14px;
+	color: #222;
+	font-weight: 500;
+	float: right
+}
+.customer_login .label-text span {
+	font-size: 14px;
+	color: #222;
+	font-weight: 500;
+}
+.customer_login .login-item:hover {
+	box-shadow: 0 0 10px #ddd;
+	z-index: 2;
+	background-color: #fff;
+	border-radius: 0;
+}
+/* -------------------- */
+/*      Short Code      */
+/* -------------------- */
+/*dungar-countdown*/
+.dungar-countdown {
+	text-align: center;
+}
+.dungar-countdown .box-count {
+	display: inline-block;
+	vertical-align: middle;
+	text-align: center;
+	padding: 7px 0 7px;
+	min-width: 40px;
+	border-radius: 50%;
+	margin-bottom: 7px;
+	font-family: 'Jost';
+	font-weight: 700;
+	margin-right: 10px;
+	position: relative;
+	background-color: #dd3232;
+	color: #fff;
+}
+.dungar-countdown .box-count:last-child {
+	margin-right: 0;
+}
+.dungar-countdown .box-count span {
+	display: block;
+	text-align: center;
+	line-height: 12px;
+}
+.dungar-countdown .box-count .number {
+	font-size: 11px;
+	line-height: 11px;
+	padding-bottom: 3px;
+}
+.dungar-countdown .box-count .text {
+	font-size: 9px;
+	text-transform: uppercase;
+}
+/*dungar-ionbox*/
+.dungar-iconbox.default {
+	color: #fff;
+    text-align:center;
+}
+.dungar-iconbox.default.center {
+    text-align:center;
+}
+.dungar-iconbox.default .iconbox-inner {
+	display: table;
+	vertical-align: middle;
+	overflow: hidden;
+	margin: 0 auto;
+}
+.dungar-iconbox.default .content .title {
+	font-size: 14px;
+	text-transform: uppercase;
+	color: inherit;
+}
+.dungar-iconbox.default .icon,
+.dungar-iconbox.default .content {
+	display: table-cell;
+	vertical-align: middle;
+}
+.dungar-iconbox.default .icon {
+	font-size: 60px;
+	padding: 0 25px 0 0;
+}
+.dungar-iconbox.default .icon span {
+	position: relative;
+	top: 12px;
+}
+.dungar-iconbox.default .icon .fa.fa-life-ring {
+	font-size: 48px;
+}
+.dungar-iconbox.default .iconbox-inner .content .title {
+	margin-bottom: 10px;
+}
+.dungar-iconbox-wrapp.default {
+	background: #dd3232;
+	padding: 50px 0;
+}
+.dungar-iconbox-wrapp.layout2 .dungar-iconbox.default .iconbox-inner .content .title {
+	color: #fff;
+}
+.dungar-iconbox.default .iconbox-inner .content .text {
+	font-size: 15px;
+}
+.dungar-iconbox-wrapp.rows-space-40 .row {
+	margin-left: -10px;
+	margin-right: -10px;
+}
+.dungar-iconbox-wrapp.rows-space-40 .col-lg-4 {
+	padding-left: 10px;
+	padding-right: 10px;
+}
+/*kt-popup-quickview*/
+.kt-popup-quickview {
+	width: 770px;
+	margin: 0 auto;
+	background-color: #fff;
+	position: relative;
+	padding: 40px 30px;
+}
+.kt-popup-quickview:after, .kt-popup-quickview:before {
+	display: table;
+	content: '';
+}
+.kt-popup-quickview:after {
+	clear: both;
+}
+.kt-popup-quickview .details-thumb {
+	width: 51.9480519%;
+	float: left;
+	padding-right: 20px;
+	position: relative;
+}
+.kt-popup-quickview .details-infor {
+	width: 48.0519481%;
+	padding-left: 30px;
+	border-left: 0;
+}
+.kt-popup-quickview .details-thumb .slider-product {
+	margin-bottom: 20px;
+}
+.kt-popup-quickview .slider-product-button .slick-list {
+	margin-left: -12.5px;
+	margin-right: -12.5px;
+}
+.kt-popup-quickview .slider-product-button .details-item {
+	padding: 0 12.5px;
+}
+.kt-popup-quickview .slider-product-button .details-item img {
+	border: 1px solid #eeeeee;
+}
+.kt-popup-quickview .slider-product-button .details-item.slick-current img {
+	border-color: #333333;
+}
+.kt-popup-quickview .slider-product-button .slick-arrow {
+	width: 37px;
+	height: 35px;
+	line-height: 31px;
+	border: 1px solid #eeeeee;
+	text-align: center;
+	font-size: 20px;
+	right: 30px;
+	opacity: 0;
+	visibility: hidden;
+	background: #ffffff;
+	-moz-transition: all 0.45s ease;
+	-webkit-transition: all 0.45s ease;
+	-o-transition: all 0.45s ease;
+	-ms-transition: all 0.45s ease;
+}
+.kt-popup-quickview .slider-product-button:hover .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+	right: -20px;
+}
+.kt-popup-quickview .slider-product-button .slick-arrow:first-child {
+	left: 30px;
+}
+.kt-popup-quickview .slider-product-button:hover .slick-arrow:first-child {
+	left: -20px;
+}
+.kt-popup-quickview .mfp-close {
+	width: 30px;
+	height: 30px;
+	border-radius: 50px;
+	text-align: center;
+	line-height: 28px;
+	color: #ffffff;
+	position: absolute;
+	top: -15px;
+	right: -15px;
+	opacity: 1;
+}
+.mfp-bg {
+	opacity: 0.5;
+}
+/*popup-newsletter*/
+.kt-popup-newsletter {
+	position: relative;
+	margin: 0 auto;
+}
+.kt-popup-newsletter .popup-content {
+	overflow: hidden;
+}
+.kt-popup-newsletter.style-1 {
+	width: 770px;
+}
+.kt-popup-newsletter .image-newsletter {
+	background-repeat: no-repeat;
+	background-position: left center;
+	background-color: #ffffff;
+	background-size: cover;
+	
+}
+.kt-popup-newsletter.style-1 .image-newsletter {
+	width: 38.9610%;
+	display: inline-block;
+	float: left;
+	padding: 40px 40px 24px 40px;
+}
+.kt-popup-newsletter .newsletter-infor {
+	background: #ffffff;
+	overflow: hidden;
+	text-align: center;
+}
+.kt-popup-newsletter.style-1 .newsletter-infor {
+	width: 61.039%;
+	display: inline-block;
+	padding: 40px 40px 24px 40px;
+}
+.kt-popup-newsletter .title {
+	font-size: 36px;
+	font-weight: 700;
+	color: #0a0a0a;
+	letter-spacing: -0.05em;
+	margin-bottom: 5px;
+}
+.kt-popup-newsletter .sub-title {
+	font-size: 16px;
+	color: #555555;
+	font-weight: 700;
+	margin-bottom: 50px;
+}
+.kt-popup-newsletter .sub-title span {
+	color: #111111;
+	text-decoration: underline;
+}
+.kt-popup-newsletter .newsletter-form-wrap {
+	margin-bottom: 56px;
+}
+.kt-popup-newsletter .newsletter-form-wrap input {
+	width: 100%;
+	font-size: 14px;
+	color: #888888;
+	margin-bottom: 20px;
+	height: 43px;
+	text-align: center;
+}
+.kt-popup-newsletter .newsletter-form-wrap button {
+	width: 100%;
+	font-size: 13px;
+	height: 43px;
+}
+.dungar-disablepopupnewsletter .checkbox {
+	margin: 0;
+	font-size: 13px;
+	color: #aaa;
+	font-style: italic;
+}
+.dungar-disablepopupnewsletter input.dungar_disabled_popup_by_user {
+	display: none;
+}
+.dungar-disablepopupnewsletter .checkbox label {
+	display: table;
+	margin: 0 auto;
+	padding: 0;
+}
+.dungar-disablepopupnewsletter span {
+	position: relative;
+	padding-left: 23px;
+	cursor: pointer;
+}
+.dungar-disablepopupnewsletter span::before {
+	position: absolute;
+	content: '';
+	width: 17px;
+	height: 17px;
+	border: 1px solid #e9e9e9;
+	left: 0;
+	top: 0;
+}
+.dungar-disablepopupnewsletter input[type="checkbox"]:checked + span::after {
+	font-family: 'FontAwesome';
+	content: "\f00c";
+	display: inline-block;
+	top: 1px;
+	left: 2px;
+	width: 10px;
+	height: 12px;
+	text-align: center;
+	font-size: 10px;
+	color: #444;
+	position: absolute;
+	z-index: 11;
+	padding: 0;
+	line-height: 14px;
+}
+/*popup-newsletter* style-2*/
+.kt-popup-newsletter.style-2 {
+	width: 570px;
+}
+.kt-popup-newsletter.style-2 .newsletter-infor {
+	padding-right: 70px;
+	padding-bottom: 10px;
+	padding-left: 70px;
+}
+.kt-popup-newsletter.style-2 .title {
+	padding-bottom: 0;
+	padding-top: 18px;
+}
+.kt-popup-newsletter.style-2 .sub-title {
+	margin-top: 1px;
+	margin-bottom: 0;
+}
+.kt-popup-newsletter.style-2 .newsletter-form-wrap {
+	margin-top: 25px;
+	margin-bottom: 0;
+}
+.kt-popup-newsletter.style-2 .dungar-disablepopupnewsletter .checkbox {
+	margin-top: 42px;
+	text-decoration: underline;
+	font-style: normal;
+}
+.kt-popup-newsletter.style-2 .dungar-disablepopupnewsletter span {
+	padding: 0;
+}
+.kt-popup-newsletter.style-2 .dungar-disablepopupnewsletter span::before {
+	display: none;
+}
+.kt-popup-newsletter.style-2 .mfp-close {
+	width: 30px;
+	height: 30px;
+	border-radius: 50px;
+	text-align: center;
+	line-height: 28px;
+	color: #ffffff;
+	position: absolute;
+	top: -15px;
+	right: -15px;
+	opacity: 1;
+}
+.kt-popup-newsletter.style-2 .newsletter-form-wrap input {
+	margin-bottom: 10px;
+}
+/*popup-newsletter* style-3*/
+.kt-popup-newsletter.style-3 {
+	width: 770px;
+	background-color: #ffffff;
+}
+.kt-popup-newsletter.style-3 .newsletter-infor {
+	width: 48.0519%;
+	display: inline-block;
+	float: left;
+	padding: 44px 30px 15px 30px;
+}
+.kt-popup-newsletter.style-3 .newsletter-slider {
+	padding: 44px 50px 15px 50px;
+	width: 51.9481%;
+	display: inline-block;
+}
+.kt-popup-newsletter.style-3 .sub-title {
+	font-size: 16px;
+	color: #888888;
+	text-align: left;
+	margin-bottom: 7px;
+}
+.kt-popup-newsletter.style-3 .newsletter-infor .sub-title span {
+	color: #ffffff;
+}
+.kt-popup-newsletter.style-3 .title {
+	font-size: 36px;
+	color: #ffffff;
+	line-height: 42px;
+	text-align: left;
+	margin-bottom: 53px;
+}
+.kt-popup-newsletter.style-3 .input-text {
+	background-color: #fff;
+	border-color: #fff;
+	color: #888;
+	text-align: left;
+	margin-bottom: 20px;
+}
+.kt-popup-newsletter.style-3 input:focus {
+	border-color: #ffffff !important;
+}
+.dungar-newsletter-form .input-text, .dungar-newsletter-form .submit-newsletter {
+	width: 100%;
+	text-align: center;
+}
+.kt-popup-newsletter.style-3 .newsletter-slider .title {
+	font-size: 30px;
+	color: #0a0a0a;
+	text-align: center;
+	margin-bottom: 4px;
+	margin-top: 6px;
+}
+.kt-popup-newsletter.style-3 .newsletter-slider .sub-title {
+	font-size: 16px;
+	color: #888888;
+	text-align: center;
+	margin-bottom: 45px;
+}
+.kt-popup-newsletter.style-3 .dungar-slider-wrapp .slick-dots {
+	overflow: hidden;
+	text-align: center;
+	margin-top: 10px;
+}
+.kt-popup-newsletter.style-3 .dungar-slider-wrapp .slick-dots > li {
+	width: 8px;
+	height: 8px;
+	float: none;
+	margin: 0 5px;
+}
+.kt-popup-newsletter.style-3 .dungar-slider-wrapp .slick-dots > li.slick-active {
+	background-color: #0a0a0a;
+}
+.kt-popup-newsletter.style-3 .dungar-disablepopupnewsletter span {
+	padding-left: 0;
+}
+.kt-popup-newsletter.style-3 .dungar-disablepopupnewsletter span::before {
+	display: none;
+}
+.kt-popup-newsletter.style-3 .dungar-disablepopupnewsletter .checkbox {
+	margin-top: 22px;
+	text-decoration: underline;
+	font-style: normal;
+}
+.kt-popup-newsletter.style-3 .owl-product .newsletter-slider-item img {
+	width: 278px;
+	margin: 0 auto;
+}
+.kt-popup-newsletter.style-3 .dungar-disablepopupnewsletter input[type="checkbox"]:checked + span::after {
+	display: none;
+}
+.newsletter-slider-item .product-item {
+	margin-bottom: 0;
+}
+.newsletter-slider-item .product-item .product-inner {
+	padding: 0;
+	border: none;
+}
+.newsletter-slider-item .product-item .product-thumb {
+	margin-bottom: 0;
+}
+.newsletter-slider-item .product-item:hover .product-inner {
+	box-shadow: none;
+}
+.newsletter-slider-item .product-item .product-thumb .variations {
+	position: static;
+	opacity: 1;
+	visibility: visible;
+	margin-top: 10px;
+}
+.newsletter-slider-item .attribute_color .list-color a {
+	margin-right: 0;
+}
+.newsletter-slider-item .attribute_color .list-color a:hover::before, .newsletter-slider-item .attribute_color .list-color a.active::before {
+	display: none;
+}
+.newsletter-slider-item .product-item .product-thumb .attribute_color .list-color a.active {
+	border: none;
+}
+/*.load-more*/
+.load-more {
+	text-align: center;
+	overflow: hidden;
+	margin-top: 20px;
+}
+.load-more a {
+	display: inline-block;
+	height: 43px;
+	line-height: 38px;
+	border: 1px solid #f4f4f4;
+	padding: 0 10px;
+	width: 149px;
+	color: #222;
+	font-weight: 700;
+	border-radius: 40px;
+}
+.load-more a:hover, .load-more a:hover .icon {
+	color: #ffffff;
+}
+.load-more a:hover {
+	border-color: transparent;
+}
+.load-more .icon {
+	color: #aaa;
+	font-weight: normal;
+	margin-right: 5px;
+}
+/*header mobile*/
+.header-device-mobile {
+	padding: 25px 0;
+	display: none;
+	position: relative;
+}
+.header-device-mobile .wapper {
+	display: table;
+	width: 100%;
+	padding: 0 15px;
+}
+.header-device-mobile .item {
+	display: table-cell;
+	vertical-align: middle;
+}
+.header-device-mobile .item .block-sub {
+	position: absolute;
+	top: 100%;
+	right: 0;
+	background-color: #fff;
+	padding: 15px;
+	left: 0;
+	z-index: 100;
+	margin-top: 1px;
+	-webkit-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	-moz-box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.16);
+	-webkit-transition: opacity .5s, -webkit-transform .5s;
+	transition: opacity .3s, transform .3s;
+	-webkit-transform: translate(0, 30px);
+	-moz-transform: translate(0, 30px);
+	-o-transform: translate(0, 30px);
+	-ms-transform: translate(0, 30px);
+	transform: translate(0, 30px);
+	opacity: 0;
+	display: block;
+	visibility: hidden;
+	padding-top: 50px;
+}
+.header-device-mobile .item.open .block-sub {
+	-webkit-transform: translate(0, 0);
+	-moz-transform: translate(0, 0);
+	-o-transform: translate(0, 0);
+	-ms-transform: translate(0, 0);
+	transform: translate(0, 0);
+	opacity: 1;
+	visibility: visible;
+}
+.header-device-mobile .mobile-search-box, .header-device-mobile .mobile-settings-box, .header-device-mobile .menu-bar {
+	width: 40px;
+	padding-left: 5px;
+}
+.header-device-mobile .mobile-navigation {
+	top: auto;
+}
+.header-device-mobile .mobile-navigation, .mobile-search-box > a, .mobile-settings-box > a {
+	width: 40px;
+	height: 40px;
+	float: left;
+	border: 1px solid #dedede;
+	padding: 0;
+	text-align: center;
+	line-height: 36px;
+	color: #555;
+	font-size: 16px;
+	border-radius: 0;
+}
+.header-device-mobile .mobile-navigation {
+	margin: 0;
+	text-align: center;
+	padding: 13px 11px 10px;
+}
+.header-device-mobile .mobile-navigation span {
+	background-color: #555;
+}
+.mobile-search-box > a, .mobile-settings-box > a:hover {
+	color: #555;
+}
+.header-device-mobile .item .block-sub .close {
+	font-size: 14px;
+	display: inline-block;
+	width: 30px;
+	height: 30px;
+	text-align: center;
+	float: none;
+	position: absolute;
+	top: 10px;
+	right: 15px;
+	line-height: 27px;
+	border: 1px solid #eee;
+}
+.header-device-mobile .header-searchform-box {
+	padding: 19px 0;
+}
+.header-device-mobile .header-searchform-box .search-input {
+	width: calc(100% - 100px);
+	font-size: 13px;
+	color: #999999;
+	background: #ffffff;
+}
+.header-device-mobile .block-item-title {
+	font-size: 14px;
+	border-bottom: 1px solid #eee;
+	padding-bottom: 10px;
+	margin-bottom: 15px;
+}
+.mobile-settings-box .dungar-language-wrap {
+	padding: 0;
+	margin: 0;
+}
+.mobile-settings-box .dungar-language-wrap li {
+	list-style: none;
+	display: inline-block;
+	font-size: 15px;
+	color: #888;
+	margin-right: 20px;
+	margin-bottom: 20px;
+}
+.mobile-settings-box .dungar-language-wrap li.active {
+	color: #0a0a0a;
+}
+/*footer-device-mobile*/
+.footer-device-mobile {
+	position: fixed;
+	bottom: 0;
+	left: 0;
+	width: 100%;
+	z-index: 999;
+	background-color: #fff;
+	border-top: 1px solid #eee;
+	display: none;
+}
+.footer-device-mobile-item {
+	display: table-cell;
+	vertical-align: middle;
+	text-align: center;
+}
+.footer-device-mobile .wapper {
+	display: table;
+	width: 100%;
+	table-layout: fixed;
+}
+.footer-device-mobile-item > a {
+	display: inline-block;
+	padding: 5px 0;
+	color: #222;
+	line-height: normal;
+}
+.footer-device-mobile-item > a .icon {
+	font-size: 20px;
+	display: block;
+	position: relative;
+	height: 30px;
+	line-height: 30px;
+	font-weight: 700;
+}
+.footer-device-mobile-item.device-cart .count-icon {
+	width: 20px;
+	height: 20px;
+	text-align: center;
+	line-height: 20px;
+	border-radius: 50%;
+	color: #ffffff;
+	font-weight: 700;
+	display: inline-block;
+	position: absolute;
+	top: 0;
+	right: -10px;
+	font-size: 12px;
+}
+/*border - style*/
+.mega-menu .border-custom {
+	margin-top: 30px;
+}
+.footer .border-custom span {
+	border-bottom: 1px solid #eee;
+}
+.border-custom span {
+	width: 100%;
+	border-bottom: 1px solid #eee;
+	display: inline-block;
+	float: left
+}
+/*mobile menu*/
+.kt-clone-wrap .kt-sub-opened {
+	z-index: 1;
+	opacity: 0;
+	visibility: hidden;
+}
+.kt-clone-wrap {
+	position: fixed;
+	overflow-x: hidden;
+	top: 0;
+	left: -100%;
+	width: 320px;
+	height: 100vh;
+	background-color: #fff;
+	-webkit-transition: all 0.3s ease 0s;
+	-o-transition: all 0.3s ease 0s;
+	-moz-transition: all 0.3s ease 0s;
+	transition: all 0.3s ease 0s;
+	z-index: 100000;
+	-webkit-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
+	-moz-box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
+	box-shadow: 3px 5px 14px -3px rgba(0, 0, 0, 0.11);
+}
+.kt-clone-wrap.open {
+	left: 0;
+}
+.kt-panels-actions-wrap {
+	border-bottom: 1px solid #eee;
+	height: 50px;
+	position: relative;
+}
+.kt-panels-actions-wrap .kt-close-btn, .kt-panels-actions-wrap .kt-prev-panel {
+	width: 50px;
+	height: 50px;
+	position: absolute;
+	top: 0;
+	right: 0;
+	z-index: 10;
+	border-left: 1px solid #eee;
+	text-align: center;
+	line-height: 50px;
+	font-size: 20px;
+	color: #222;
+}
+.kt-panels-actions-wrap .kt-prev-panel {
+	right: inherit;
+	left: 0;
+	border: none;
+	border-right: 1px solid #eee;
+}
+.kt-panels-actions-wrap .kt-prev-panel:before {
+	content: "\f104";
+	font-family: FontAwesome;
+}
+.kt-clone-wrap .kt-panels {
+	background: inherit;
+	border-color: inherit;
+	position: absolute;
+	margin-top: 50px;
+	left: 0;
+	right: 0;
+	top: 0;
+	bottom: 0;
+	z-index: 0;
+	box-sizing: border-box;
+}
+.kt-clone-wrap .kt-panel {
+	border-color: #fff;
+	bottom: 0;
+	background: #fff;
+	box-sizing: border-box;
+	display: block;
+	left: 0;
+	margin: 0;
+	overflow-x: hidden;
+	overflow-y: auto;
+	position: absolute;
+	right: 0;
+	top: 0;
+	transform: translateX(100%);
+	transition: all 0.2s ease 0s;
+	z-index: 0;
+}
+.kt-clone-wrap .kt-main-panel, .kt-clone-wrap .kt-panel.kt-panel-opened {
+	transform: translateX(0);
+	z-index: 10
+}
+.kt-panel > ul {
+	padding: 0;
+	margin: 0;
+}
+.kt-panel li {
+	list-style: none;
+	position: relative
+}
+.kt-panel > ul > li {
+	padding: 0 20px;
+	border-bottom: 1px solid #eee;
+}
+.kt-panel > ul > li > a {
+	display: block;
+	font-size: 14px;
+	color: #222;
+	padding: 10px 20px;
+	text-transform: uppercase;
+}
+.kt-next-panel {
+	width: 50px;
+	text-align: center;
+	position: absolute;
+	top: 0;
+	right: 0;
+	z-index: 10;
+}
+.kt-next-panel:before {
+	content: "\f105";
+	font-family: FontAwesome;
+}
+.kt-panels-actions-wrap .kt-current-panel-title {
+	display: block;
+	text-align: center;
+	line-height: 50px;
+	padding: 0 50px;
+	text-transform: uppercase;
+	color: #0a0a0a;
+}
+.kt-clone-wrap .kt-panel .menu-page {
+	background-image: none;
+}
+.dungar-menu-panels .submenu {
+	position: static;
+	visibility: visible;
+	opacity: 1;
+	min-width: 1px;
+	-webkit-box-shadow: none;
+	-moz-box-shadow: none;
+	box-shadow: none;
+	-webkit-transition: opacity .5s, -webkit-transform .5s;
+	transition: opacity .3s, transform .3s;
+	-webkit-transform: translate(0, 0);
+	-moz-transform: translate(0, 0);
+	-o-transform: translate(0, 0);
+	-ms-transform: translate(0, 0);
+	transform: translate(0, 0);
+	display: block;
+	text-align: left;
+}
+/*backtotop*/
+.backtotop {
+	display: none;
+	width: 50px;
+	height: 50px;
+	font-size: 24px;
+	font-weight: 700;
+	background: #333;
+	color: #fff;
+	border-radius: 50%;
+	position: fixed;
+	bottom: 50px;
+	right: 25px;
+	text-align: center;
+	line-height: 50px;
+	z-index: 999;
+}
+.backtotop.show {
+	display: block;
+}
+.backtotop:hover {
+	background: #dd3232;
+	color: #fff !important;
+}
+/*coppyright*/
+.coppyright {
+	color: #888888;
+	padding: 5px 0;
+}
+.coppyright a {
+	color: #dd3232;
+}
+/*dungar-payment*/
+.footer-end .dungar-payment {
+	cursor: pointer;
+	text-align: right;
+}
+.footer-end .dungar-payment:hover {
+	opacity: 0.6;
+}
+/*footer demo*/
+.footer-end .demos {
+	text-align: right;
+}
+.footer-end .demos a {
+	min-width: 139px;
+	height: 34px;
+	border: 1px solid #363636;
+	display: inline-block;
+	text-align: center;
+	line-height: 30px;
+	text-transform: capitalize;
+	color: #888888;
+	font-size: 13px;
+}
+.footer-end .demos a::after {
+	font-family: 'FontAwesome';
+	content: "\f107";
+	margin-left: 5px;
+	font-size: 15px;
+	color: #888;
+	font-weight: normal;
+	vertical-align: top;
+}
+.footer-end .demos span {
+	color: #ffffff;
+}
+/*header-top-message*/
+.header-top-message {
+	background-color: #111111;
+	color: #aaaaaa;
+	font-weight: 700;
+	text-transform: uppercase;
+	text-align: center;
+	font-size: 15px;
+	padding: 12px 15px;
+}
+.header-top-message .icon {
+	color: #fff;
+	font-size: 22px;
+}
+.header-top-message a {
+	color: #fff;
+	text-decoration: underline;
+}
+.header-top-message a:hover {
+	color: #ffffff;
+}
+/*header-block-text*/
+.header-block-text {
+	background-color: #111111;
+	color: #aaaaaa;
+	font-weight: 700;
+	text-transform: uppercase;
+	text-align: center;
+	font-size: 15px;
+	padding: 12px 0;
+}
+.header-block-text .icon {
+	color: #fff;
+	font-size: 18px;
+	margin-right: 10px;
+}
+.header-block-text a {
+	color: #ffffff;
+	text-decoration: underline;
+}
+.header-block-text a:hover {
+	color: #aaaaaa;
+}
+/*tabs*/
+.tab-container {
+	position: relative;
+}
+.tab-container .tab-panel {
+	position: absolute;
+	top: 0;
+	left: 0;
+	width: 100%;
+	opacity: 0;
+	visibility: hidden;
+	height: 1px;
+	overflow: hidden
+}
+.tab-container .active {
+	opacity: 1;
+	visibility: inherit;
+	position: inherit;
+	-vendor-animation-duration: 0.3s;
+	-vendor-animation-delay: 1s;
+	-vendor-animation-iteration-count: infinite;
+	height: auto;
+	overflow: inherit;
+}
+/*---------BREADCRUMB-----------*/
+.breadcrumb {
+	padding: 34px 0 30px;
+	background: #ffffff;
+	margin: 0;
+}
+.breadcrumb > li {
+	display: inline-block;
+	list-style: none;
+	font-weight: 500;
+	font-size: 14px;
+}
+.breadcrumb a {
+	color: #888888;
+	
+}
+.breadcrumb > .active {
+	color: #222;
+}
+.breadcrumb > li + li:before {
+	padding: 0 8px;
+	content: "\f101";
+	font-family: 'FontAwesome';
+	font-weight: 400;
+}
+/*--------PAGINATION--------------*/
+.pagination {
+	display: block;
+	margin: 50px 0 0;
+	padding: 0;
+}
+.pagination.grid {
+	margin-top: 20px;
+}
+.pagination .page-numbers {
+	display: inline-block;
+	width: 42px;
+	height: 42px;
+	line-height: 39px;
+	text-align: center;
+	border: 1px solid #F1F1F1;
+	font-size: 16px;
+	color: #888;
+	font-weight: 500;
+	margin-left: 5px;
+	border-radius: 50%;
+}
+.pagination .page-numbers:first-child {
+	margin-left: 0;
+}
+.pagination .page-numbers.current, .pagination .page-numbers:hover {
+	color: #fff;
+	border-color: transparent;
+	background-color: #dd3232;
+}
+.pagination .page-numbers .icon {
+	font-weight: 700;
+}
+.pagination.style1 {
+	text-align: right;
+}
+.pagination.style2 {
+	text-align: center;
+}
+.shop-grid-content .pagination {
+	margin-top: 10px;
+}
+.content-inlookbook .pagination {
+	margin-top: 10px;
+	margin-bottom: 60px
+}
+.main-content-blog.mansory .pagination {
+	margin-top: 10px;
+}
+/* -------------------- */
+/*        SIDEBAR       */
+/* -------------------- */
+.widget {
+	margin-bottom: 45px;
+}
+.widget:last-child {
+	margin-bottom: 0;
+}
+.widget .widgettitle {
+	font-size: 14px;
+	font-family: 'Jost';
+	text-transform: uppercase;
+	font-weight: 700;
+	padding-bottom: 25px;
+	margin-bottom: 0;
+	position: relative;
+	letter-spacing: 0.1em;
+	z-index: 1;
+	padding-left: 40px;
+}
+.widget .widgettitle::before {
+	content: "";
+	width: 32px;
+	border-top: 3px solid #333;
+	position: absolute;
+	display: inline-block;
+	left: 0;
+	top: 8px;
+}
+.widget ul, .widget ol {
+	padding: 0;
+	margin: 0;
+}
+.widget li {
+	list-style: none;
+	line-height: 28px;
+}
+.widget a {
+	color: #555555;
+}
+.sidebar .price-slider-wrapper {
+	padding-top: 10px;
+}
+.sidebar input[type="checkbox"] {
+	display: none;
+}
+.sidebar .label-text {
+	cursor: pointer;
+	font-size: 15px;
+	color: #555;
+	margin: 0;
+	padding-left: 25px;
+	position: relative;
+	font-weight: normal;
+}
+.sidebar input[type="checkbox"] + label::after {
+	position: absolute;
+	z-index: 1;
+	content: "";
+	left: 0;
+	top: 5px;
+	width: 18px;
+	height: 18px;
+	border: solid 1px #eeeeee;
+	border-radius: 0;
+}
+.sidebar input[type="checkbox"]:checked + label::before {
+	font-family: 'FontAwesome';
+	content: "\f00c";
+	display: inline-block;
+	top: 7px;
+	left: 2px;
+	width: 15px;
+	height: 14px;
+	text-align: center;
+	font-size: 10px;
+	color: #222;
+	position: absolute;
+	z-index: 2;
+	padding: 0;
+	line-height: 14px;
+}
+.widget-socials .social-list {
+	overflow: hidden;
+}
+.widget-socials .social-list .social-item {
+	font-size: 23px;
+	color: #222;
+	display: inline-block;
+	float: left;
+	padding: 0 15px;
+	margin-bottom: 10px;
+}
+.widget-socials .social-list .social-item:first-child {
+	padding-left: 0;
+}
+.widget-socials .social-list .social-item:last-child {
+	padding-right: 0;
+}
+.widget-post .widget-post-item {
+	overflow: hidden;
+	margin-bottom: 20px;
+}
+.widget-post .widget-post-item:last-child {
+	margin-bottom: 0;
+}
+.widget-post .widget-post-item .thumb-blog {
+	width: 100px;
+	float: left;
+}
+.widget-post .widget-post-item .post-content {
+	overflow: hidden;
+	padding-left: 10px;
+}
+.widget-post .widget-post-item .cat {
+	font-size: 11px;
+	font-weight: 600;
+	text-transform: uppercase;
+	color: #aaaaaa;
+	line-height: normal;
+	margin-top: 0;
+}
+.widget-post .widget-post-item .cat a:not(:hover) {
+	color: inherit;
+}
+.widget-post .widget-post-item .post-title {
+	font-size: 14px;
+	font-weight: 500;
+	margin-bottom: 0;
+	line-height: 20px;
+	margin-top: 6px;
+}
+.widget-post .widget-post-item .post-title a {
+	color: #333333;
+}
+.widget-post .widget-post-item .post-title span {
+	color: #aaaaaa;
+	display: none;
+}
+.widget-tags .tagcloud {
+	overflow: hidden;
+	margin: 0;
+	width: 100%;
+}
+.widget-tags .tag-cloud-link {
+	color: #888888;
+	margin-right: 10px;
+	margin-top: 5px;
+	margin-bottom: 5px;
+	float: left;
+	line-height: 26px;
+	text-transform: capitalize;
+	border-radius: 0;
+}
+.widget-tags .tag-cloud-link a {
+	color: #888888;
+}
+.widget .view-all:not(:hover) {
+	color: #aaa;
+	text-decoration: underline;
+}
+.woof_Widget .widget:last-child {
+	border-bottom: 0;
+	margin-bottom: 0;
+	border-radius: 0;
+}
+/*sidebar shop*/
+.list-brand {
+	border-top: none;
+}
+.woof_Widget {
+	border-radius: 0;
+}
+.widget_filter_price .ui-widget-content {
+	background: #ddd;
+	border-radius: 2px;
+	height: 4px;
+	border: none;
+}
+.widget_filter_price .ui-slider .ui-slider-range {
+	background: #dd3232;
+}
+.widget_filter_price .ui-slider .ui-slider-handle {
+	width: 0;
+	height: 0;
+	border: none;
+	top: -6px;
+	border-radius: 1em;
+	cursor: ew-resize;
+	margin-left: -0.3em;
+	outline: 0 none;
+	position: absolute;
+	z-index: 2;
+	border-color: #dd3232 transparent;
+}
+.widget_filter_price .ui-slider .ui-slider-handle::before {
+	content: '';
+	border-style: solid;
+	border-width: 8px 6px 0 6px;
+	border-color: #dd3232 transparent;
+}
+.widget_filter_price .price-slider-amount {
+	margin-top: 25px;
+	font-size: 13px;
+	color: #666666;
+	overflow: hidden;
+}
+.woof_Widget .price-slider-amount span {
+	display: inline-block;
+	font-size: 15px;
+	color: #0a0a0a;
+	border: 1px solid #eeeeee;
+	padding: 4px 10px;
+	font-weight: 600;
+	border-radius: 0;
+}
+.woof_Widget .price-slider-amount span:first-child {
+	margin-right: 10px;
+}
+.widget-color .list-color a {
+	display: inline-block;
+	height: 27px;
+	margin-top: 3px;
+	margin-right: 10px;
+	position: relative;
+	text-align: center;
+	width: 26px;
+	line-height: 23px;
+	border-radius: 0;
+}
+.widget-color .list-color .color1 {
+	border: 1px solid #eeeeee;
+}
+.widget-color .list-color .color2 {
+	background: #0a0a0a;
+}
+.widget-color .list-color .color3 {
+	background: #4a5365;
+}
+.widget-color .list-color .color4 {
+	background: #84664d;
+}
+.widget-color .list-color .color5 {
+	background: #d27d53;
+}
+.widget-color .list-color .color6 {
+	background: #719271;
+}
+.widget-color .list-color .color7 {
+	background: #5f8ea9;
+}
+.list-color a.active::before, .list-color a:hover::before {
+	color: #fff;
+	content: "\f00c";
+	display: inline-block;
+	font-family: FontAwesome;
+	font-size: 12px;
+	left: 0;
+	position: absolute;
+	width: 100%;
+	line-height: 27px;
+}
+.list-color .colo1.active::before, .list-color .colo1:hover::before {
+	color: #0a0a0a;
+}
+.tag-cloud-link a:hover, .tag-cloud-link.active a {
+	color: #111111;
+}
+/*sidebar Details page*/
+.sidebar-details .widget {
+	position: relative;
+}
+.sidebar-details .widget .slick-slider {
+	position: static;
+}
+.sidebar-details .widget.widget-related-products .slick-slider {
+	margin-top: 20px;
+}
+.sidebar-details .widget .slick-slider .slick-arrow {
+	width: 20px;
+	height: 35px;
+	line-height: 31px;
+	text-align: center;
+	background: none;
+	color: #aaaaaa;
+	font-size: 20px;
+}
+.sidebar-details .widget .slick-slider .slick-arrow:first-child {
+	right: 30px;
+}
+.widget-related-products .product-item {
+	margin-bottom: 0;
+}
+.sidebar-details .widgettitle {
+	margin-bottom: 0;
+}
+.sidebar-details .widget-categories .widgettitle {
+	margin-bottom: 0;
+}
+.sidebar-details .widget-banner {
+	text-align: center;
+}
+.sidebar-details .widget-banner img {
+	border-radius: 0;
+}
+.Testimonial-inner {
+	padding: 17px 22px 20px;
+	border: 1px solid #f3f3f3;
+	border-radius: 0;
+}
+.Testimonial-inner .comment {
+	font-size: 14px;
+	color: #555555;
+	margin-bottom: 25px;
+	position: relative;
+	padding-top: 30px;
+}
+.Testimonial-inner .comment::before {
+	content: '“';
+	font-size: 60px;
+	font-family: Georgia;
+	color: #aaaaaa;
+	position: absolute;
+	top: 0;
+	line-height: 1;
+}
+.Testimonial-inner .author {
+	overflow: hidden;
+}
+.Testimonial-inner .author .avt {
+	float: left;
+	width: 41px;
+}
+.Testimonial-inner .author .avt img {
+	border-radius: 50%;
+}
+.Testimonial-inner .author .name {
+	overflow: hidden;
+	padding-left: 10px;
+	font-size: 14px;
+	color: #333333;
+	font-weight: 600;
+}
+.Testimonial-inner .author .name span {
+	font-size: 13px;
+	font-weight: normal;
+	color: #aaaaaa;
+	display: block;
+	letter-spacing: 0;
+}
+/*newlletter-widget*/
+.newsletter-widget {
+	padding: 20px;
+	padding-top: 30px;
+	padding-bottom: 32px;
+	border: 1px solid #F1F1F1;
+	position: relative;
+	border-radius: 0;
+}
+.newsletter-widget:before {
+	font-family: 'FontAwesome';
+	content: "\f003";
+	font-size: 150px;
+	color: #f5f5f5;
+	position: absolute;
+	top: 15px;
+	left: 32px;
+	line-height: normal;
+	-ms-transform: rotate(-30deg);
+	-webkit-transform: rotate(-30deg);
+	transform: rotate(-30deg);
+}
+.newsletter-widget .newsletter-form-wrap {
+	position: relative;
+	z-index: 2
+}
+.newsletter-widget .title {
+	font-size: 22px;
+	color: #222;
+	line-height: 1.2;
+	margin-bottom: 10px;
+	font-weight: 600;
+	letter-spacing: 0;
+}
+.newsletter-widget .subtitle {
+	font-size: 15px;
+	color: #555;
+	line-height: 20px;
+	margin-bottom: 60px;
+}
+.newsletter-widget .email, .newsletter-widget .submit-newsletter {
+	width: 100%;
+	text-align: center;
+	border-radius: 30px;
+}
+.newsletter-widget .email {
+	margin-bottom: 10px;
+}
+/*---------FORM control shop--------------*/
+.shop-top-control {
+	border: 1px solid #f3f3f3;
+	background-color: #f3f3f3;
+	border-radius: 0;
+	padding: 15px 0 15px;
+	margin-bottom: 40px;
+	display: table;
+	width: 100%;
+	font-weight: 500;
+	color: #888888;
+	position: relative;
+}
+.shop-top-control .select-form, .shop-top-control .grid-view-mode {
+	padding: 0 13px;
+	border-right: 1px solid #F1F1F1;
+	display: table-cell;
+	vertical-align: middle;
+}
+.shop-top-control .select-form {
+	position: relative;
+	z-index: 999;
+	line-height: 28px;
+}
+.shop-top-control .select-form .title {
+	margin-right: 3px;
+}
+.shop-top-control .select-form.select-item {
+	z-index: 1000;
+}
+.shop-top-control .chosen-container-single .chosen-single {
+	height: 28px;
+	line-height: 28px;
+	border: 1px solid #fff;
+	background: #fff !important;
+	padding: 0 10px;
+	max-width: 100%;
+	background: none;
+	box-shadow: none;
+	width: 154px;
+	color: #222;
+	border-radius: 0;
+}
+.shop-top-control .chosen-container-single .chosen-single span {
+	font-size: 13px;
+	line-height: 26px;
+	margin-right: 0;
+}
+.shop-top-control .chosen-container .chosen-results li.highlighted {
+	background-image: none;
+	background-color: #0a0a0a;
+}
+.shop-top-control .grid-view-mode {
+	border-right: none;
+	width: 125px;
+	padding: 0;
+}
+.grid-view-mode .inner {
+	display: table;
+	margin: 0 auto;
+}
+.grid-view-mode .modes-mode {
+	display: inline-block;
+	padding: 4px 0;
+	overflow: hidden;
+	margin: 0 5px;
+	vertical-align: top;
+}
+.grid-view-mode .modes-mode.active {
+	color: #dd3232;
+}
+.grid-view-mode .modes-mode.mode-grid::before {
+	content: "\f118";
+	font-family: Flaticon;
+	font-size: 17px;
+}
+.grid-view-mode .modes-mode.mode-list::before {
+	content: "\f119";
+	font-family: Flaticon;
+	font-size: 23px;
+}
+/*list-products*/
+ul.list-products {
+	padding: 0;
+	margin-top: 0;
+	margin-bottom: 0;
+}
+/*product item*/
+.product-item {
+	list-style: none;
+	margin-bottom: 30px;
+}
+.product-item .product-inner {
+	border-radius: 0;
+	overflow: hidden;
+	position: relative;
+	border: 2px solid #F1F1F1;
+	padding: 0 0 20px;
+	background-color: #fff;
+}
+.product-item.style-list .product-inner {
+	padding: 20px 0 20px;
+}
+.dungar-product.layout1 .product-item .product-inner {
+	background-color: transparent;
+	border: none;
+}
+.product-item:hover .product-inner {
+	z-index: 2;
+	border-color: #dd3232;
+}
+.product-item .product-top {
+	overflow: hidden;
+	z-index: 1;
+	position: absolute;
+	left: 0;
+	top: 8px;
+	right: 0;
+}
+.product-item .flash {
+	font-size: 12px;
+	border-radius: 0;
+	font-weight: 500;
+	text-transform: capitalize;
+	display: inline-block;
+	float: left;
+	line-height: 22px;
+	height: 22px;
+	min-width: 44px;
+	padding: 0 5px;
+	text-align: center;
+	background-color: #dd3232;
+	color: #fff;
+	position: relative;
+}
+.product-item .yith-wcwl-add-to-wishlist > div a:before {
+	font-size: 18px;
+	font-family: 'FontAwesome';
+	content: "\f08a";
+	color: #fff;
+}
+.product-item .yith-wcwl-add-to-wishlist > div a:hover::before {
+	content: "\f004";
+}
+.product-item .product-thumb {
+	margin-bottom: 15px;
+	position: relative;
+	text-align: center;
+}
+.product-item.style-list .button.quick-wiew-button,
+.product-item.style2 .button.quick-wiew-button,
+.product-item.style-3 .button.quick-wiew-button {
+	position: absolute;
+	top: 50%;
+	left: 50%;
+	width: 46px;
+	height: 46px;
+	line-height: 46px;
+	padding: 0;
+	font-size: 0;
+	background-color: #fff;
+	color: #222;
+	border-radius: 100%;
+	z-index: 10;
+	font-weight: 400;
+	text-align: center;
+	opacity: 0;
+	visibility: hidden;
+	transform: translate(-50%, -50%);
+	-webkit-transition: all 0.4s ease 0s;
+	-moz-transition: all 0.4s ease 0s;
+	-o-transition: all 0.4s ease 0s;
+	transition: all 0.4s ease 0s;
+}
+.product-item.style-list:hover .button.quick-wiew-button,
+.product-item.style2:hover .button.quick-wiew-button,
+.product-item.style-3:hover .button.quick-wiew-button {
+	opacity: 1;
+	visibility: visible;
+}
+.product-item.style-list .button.quick-wiew-button::before,
+.product-item.style2 .button.quick-wiew-button::before,
+.product-item.style-3 .button.quick-wiew-button::before {
+	font-size: 18px;
+	content: "\f12d";
+	font-family: 'Flaticon';
+	font-weight: normal;
+}
+.product-item.style-list .button.quick-wiew-button:hover,
+.product-item.style2 .button.quick-wiew-button:hover,
+.product-item.style-3 .button.quick-wiew-button:hover {
+	color: #fff;
+}
+.product-item .product-info {
+	text-align: center;
+	position: relative;
+}
+.product-item .product-name {
+	font-size: 18px;
+	font-weight: 500;
+	margin: 0;
+	margin-bottom: 4px;
+	letter-spacing: 0;
+}
+.product-item.style-list .product-name {
+	font-size: 22px;
+}
+.product-item .thumb-group {
+	position: absolute;
+	top: 50%;
+	right: 0;
+	-webkit-transform: translate(0, -50%);
+	-moz-transform: translate(0, -50%);
+	-ms-transform: translate(0, -50%);
+	-o-transform: translate(0, -50%);
+	transform: translate(0, -50%);
+	text-align: center;
+	background-color: #dd3232;
+	border-radius: 10px 0 0 10px;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transition: all 0.25s ease 0s;
+	-moz-transition: all 0.25s ease 0s;
+	-o-transition: all 0.25s ease 0s;
+	transition: all 0.25s ease 0s;
+	margin-right: -10px;
+}
+.product-item .product-inner:hover .thumb-group {
+	opacity: 1;
+	visibility: visible;
+	margin-right: 0;
+}
+.product-item .thumb-group .quick-wiew-button,
+.product-item .thumb-group .yith-wcwl-add-to-wishlist,
+.product-item .thumb-group .loop-form-add-to-cart {
+	width: 46px;
+	height: 46px;
+	line-height: 46px;
+	color: #fff;
+	position: relative !important;
+	display: block;
+	vertical-align: top;
+}
+.product-item .thumb-group .yith-wcwl-add-to-wishlist {
+	font-size: 0;
+}
+.product-item .thumb-group .quick-wiew-button {
+	font-size: 0;
+	padding: 0;
+}
+.product-item .thumb-group .quick-wiew-button::before {
+	font-size: 18px;
+	content: "\f12d";
+	font-family: 'Flaticon';
+	font-weight: normal;
+}
+.product-item .thumb-group .loop-form-add-to-cart {
+	-webkit-transition: all 0.6s ease 0s;
+	-moz-transition: all 0.6s ease 0s;
+	-o-transition: all 0.6s ease 0s;
+	transition: all 0.6s ease 0s;
+}
+.cart-form .single_add_to_cart_button {
+	color: #fff !important;
+	white-space: nowrap;
+}
+.cart-form .product-addtocart {
+	text-align: center !important;
+}
+.product-item .thumb-group .loop-form-add-to-cart .single_add_to_cart_button {
+	font-size: 0;
+	background-color: transparent;
+	padding: 0;
+}
+.product-item .thumb-group .loop-form-add-to-cart .single_add_to_cart_button::before {
+	font-family: 'Flaticon';
+	content: "\f12e";
+	font-size: 18px;
+	color: #fff;
+	font-weight: normal;
+}
+.product-item .thumb-group .loop-form-add-to-cart:hover .single_add_to_cart_button::before {
+	color: #fff;
+}
+.product-item .thumb-group .quick-wiew-button:hover,
+.product-item .thumb-group .button.quick-wiew-button:hover {
+	color: #fff;
+}
+.product-item .thumb-group .yith-wcwl-add-to-wishlist:hover a {
+	color: #fff;
+}
+.shop-grid-content.full-width .shop-top-control .select-item {
+	width: 23.2%;
+}
+/*product item style2*/
+.product-item.style2 .product-inner {
+	display: table;
+	border: 1px solid #eee;
+}
+.product-item.style2 .product-thumb {
+	width: 240px;
+	margin-bottom: 0;
+	display: table-cell;
+	vertical-align: middle
+}
+.product-item.style2 .yith-wcwl-add-to-wishlist {
+	display: none;
+}
+.product-item.style2 .product-info {
+	text-align: left;
+	padding-left: 20px;
+	display: table-cell;
+	vertical-align: middle;
+	opacity: 1;
+}
+.product-item.style2 .product-name {
+	font-size: 22px;
+	margin-bottom: 9px;
+}
+.product-item.style2 .product-name a {
+	color: #0a0a0a;
+}
+.product-item.style2 .stars-rating {
+	margin-bottom: 5px;
+}
+.product-item.style2 .desc {
+	font-size: 16px;
+	color: #555555;
+	margin-bottom: 15px;
+}
+.product-item.style2 .group-buttons .price, .product-item.style2 .group-buttons .added_to_cart {
+	vertical-align: middle;
+	color: #0a0a0a;
+}
+.product-item.style2 .group-buttons .price {
+	padding: 0 10px 15px 0;
+	border-right: 0;
+	font-size: 16px
+}
+.product-item.style2 .group-buttons .button {
+	background-color: #000;
+}
+.product-item.style-2 .group-buttons .added_to_cart {
+	background: transparent;
+	border: 1px solid #dddddd;
+	position: relative;
+	text-align: center;
+	text-transform: uppercase;
+}
+.product-item.style-2 .group-buttons .added_to_cart:hover {
+	color: #ffffff;
+}
+.slider-product .slick-slider > .slick-arrow {
+	width: 44px;
+	height: 44px;
+	text-align: center;
+	line-height: 42px;
+	border: 1px solid #fff;
+	color: #aaaaaa;
+	right: -22px;
+	z-index: 33;
+	background: #ffffff;
+	border-radius: 50%;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-box-shadow: 0px 0px 9px 0px rgba(0, 0, 0, 0.1);
+	-moz-box-shadow: 0px 0px 9px 0px rgba(0, 0, 0, 0.1);
+	box-shadow: 0px 0px 9px 0px rgba(0, 0, 0, 0.1);
+}
+.slider-product:hover .slick-slider > .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+}
+.slider-product .slick-slider > .slick-arrow:first-child {
+	left: -22px;
+}
+/*produc list*/
+.product-item.style-list .product-top {
+	position: absolute;
+	z-index: 1;
+}
+.product-item.style-list .products-bottom-content {
+	display: table;
+	width: 100%
+}
+.product-item.style-list .product-thumb {
+	width: 250px;
+}
+.product-item.style-list .product-thumb .thumb-inner {
+	position: relative;
+}
+.product-item.style-list .product-thumb, .product-item.style-list .product-info-left, .product-item.style-list .product-info-right {
+	display: table-cell;
+	vertical-align: top;
+}
+.product-item.style-list .product-info-left {
+	vertical-align: top;
+	padding: 0 30px;
+}
+.product-item.style-list .product-info-right {
+	padding-left: 30px;
+	border-left: 1px solid #eee;
+	width: 250px;
+}
+.product-item .quantity {
+	display: none;
+}
+.product-item.style-list .yith-wcwl-add-to-wishlist {
+	width: 100%;
+	margin-bottom: 15px;
+	display: none;
+}
+.product-item.style-list .stars-rating {
+	margin-bottom: 20px;
+}
+.product-item.style-list .product-info-left ul {
+	padding: 0;
+	margin: 0;
+}
+.product-item.style-list .product-info-left ul li {
+	font-size: 15px;
+	color: #222;
+	line-height: 30px;
+	display: inline-block;
+}
+.product-item.style-list .product-info-left .attributes-display li a {
+	color: #888888;
+}
+.product-item.style-list .product-info-left .attributes-display li a:after {
+	content: "/";
+	display: inline-block;
+	color: #888888;
+}
+.product-item.style-list .product-info-left .attributes-display li:last-child a:after {
+	display: none;
+}
+.product-item.style-list .price {
+	font-size: 22px;
+	margin-bottom: 15px;
+}
+.product-item.style-list .product-list-message {
+	font-size: 14px;
+	color: #111;
+	font-weight: 500;
+	position: relative;
+	padding-bottom: 15px;
+	margin-bottom: 20px;
+	display: inline-block;
+}
+.product-item.style-list .product-list-message::after {
+	content: '';
+	height: 2px;
+	width: 36px;
+	bottom: 0;
+	left: 0;
+	background: #e7e7e7;
+	display: inline-block;
+	position: absolute;
+}
+.product-item.style-list .product-list-message .icon {
+	font-size: 20px;
+}
+.product-item.style-list .single_variation_wrap > .button {
+	margin-bottom: 10px;
+	background-color: #000;
+	font-weight: 600;
+	vertical-align: middle;
+	height: 43px;
+	padding: 0 20px;
+	line-height: 41px;
+	text-transform: uppercase;
+	font-size: 12px;
+}
+.product-item.style-list .single_variation_wrap > .button:hover {
+	color: #ffffff;
+}
+.full-width .product-item.style-list .product-info-right {
+	width: 270px;
+}
+/*quantity*/
+.quantity .control {
+	display: table;
+	border: 1px solid #e9e9e9;
+	width: 100%;
+	padding: 0 10px;
+}
+.quantity .control {
+	display: table;
+	border: 1px solid #e9e9e9;
+	width: 100%;
+	padding: 0 10px;
+	border-radius: 0;
+}
+.quantity .control .btn-number, .quantity .control .input-qty {
+	display: table-cell;
+	vertical-align: middle;
+}
+.quantity .control .btn-number {
+	font-size: 23px;
+	color: #d9d9d9;
+	font-weight: 500;
+}
+.quantity .control .input-qty {
+	border: none;
+	padding: 7px 0;
+	text-align: center;
+	font-size: 16px;
+	color: #333333;
+	font-weight: 500;
+	width: 34px;
+	height: inherit;
+}
+/*STARS-RATING*/
+.star-rating {
+	font-size: 0;
+	position: relative;
+	display: inline-block;
+	overflow: hidden;
+}
+.star-rating:before, .star-rating > span:before {
+	display: inline-block;
+	float: left;
+	font-family: FontAwesome;
+	content: "\f006\f006\f006\f006\f006";
+	font-size: 13px;
+	line-height: 13px;
+	color: #ffb933;
+	letter-spacing: 0.1em;
+}
+.star-rating > span {
+	display: inline-block;
+	position: absolute;
+	top: 0;
+	left: 0;
+	overflow: hidden;
+	line-height: 13px;
+}
+.star-rating .star-1 {
+	width: 20%;
+}
+.star-rating .star-2 {
+	width: 40%;
+}
+.star-rating .star-3 {
+	width: 60%;
+}
+.star-rating .star-4 {
+	width: 80%;
+}
+.star-rating .star-5 {
+	width: 100%
+}
+.star-rating > span:before {
+	content: "\f005\f005\f005\f005\f005";
+	color: #ffb933;
+}
+.count-star {
+	position: relative;
+	display: inline-block;
+	overflow: hidden;
+	line-height: 14px;
+}
+/*-----------------PRICE----------------------*/
+.product-item .price {
+	display: block;
+	font-size: 14px;
+	color: #dd3232;
+	font-weight: 500;
+	line-height: 100%;
+}
+.product-item .price del {
+	color: #aaa;
+	margin-right: 5px;
+	font-size: 14px;
+}
+.product-item .price ins {
+	text-decoration: none;
+}
+/* -------------------- */
+/*   Product Style     */
+/* -------------------- */
+
+/*404 page*/
+.error-404 {
+	display: table;
+	padding: 60px 0 0;
+	width: 100%;
+}
+.error-404 .images {
+	display: table-cell;
+	vertical-align: middle;
+	text-align: right;
+}
+.error-404 .text-404 {
+	display: table-cell;
+	vertical-align: middle;
+	padding-left: 40px;
+}
+.text-404 .page-title {
+	font-size: 36px;
+	font-weight: 700;
+	color: #111111;
+	text-transform: capitalize;
+	margin-bottom: 25px;
+	line-height: 1;
+	margin-top: 110px;
+}
+.text-404 .page-content {
+	font-size: 15px;
+	line-height: 24px;
+	color: #888888;
+}
+.text-404 .page-content .hightlight {
+	color: #0a0a0a;
+	font-weight: 500;
+	cursor: pointer;
+}
+.error-404 .search-form .search-field {
+	display: inline-block;
+	margin-right: 5px;
+	margin-bottom: 30px;
+}
+.error-404 .search-form {
+	-webkit-transition: .35s;
+	-o-transition: .35s;
+	transition: .35s;
+}
+.error-404 .search-form.open {
+	opacity: 1;
+	visibility: visible;
+	-webkit-transform: translateY(0);
+	-moz-transform: translateY(0);
+	-ms-transform: translateY(0);
+	-o-transform: translateY(0);
+	transform: translateY(0);
+}
+/*contact page*/
+#gmap_canvas {
+	border: none;
+	width: 100%;
+}
+.dungar-google-maps {
+	min-height: 480px;
+}
+.form-contact {
+	margin-top: -200px;
+	background-color: #ffffff;
+	-webkit-box-shadow: 0 0 12px 0 rgba(2, 2, 2, 0.16);
+	-moz-box-shadow: 0 0 12px 0 rgba(2, 2, 2, 0.16);
+	box-shadow: 0 0 12px 0 rgba(2, 2, 2, 0.16);
+	border-radius: 0;
+	overflow: hidden;
+}
+.form-contact::after, .form-contact::before {
+	display: table;
+	content: '';
+}
+.form-contact::after {
+	clear: both;
+}
+.form-message {
+	padding-top: 55px;
+	padding-right: 70px;
+	padding-bottom: 55px;
+	padding-left: 70px;
+	background-color: #ffffff;
+}
+.form-message .title {
+	font-size: 16px;
+	font-weight: 500;
+	color: #0a0a0a;
+	text-align: left;
+	font-style: normal;
+	margin-bottom: 27px;
+	text-transform: uppercase;
+}
+.dungar-contact-fom p:last-child {
+	margin-bottom: 0;
+}
+.dungar-contact-fom .form-label {
+	font-size: 14px;
+	line-height: 30px;
+	color: #888;
+	display: block;
+	margin-bottom: 5px;
+}
+.dungar-contact-fom .form-control {
+	position: relative;
+	overflow: hidden;
+}
+.dungar-contact-fom .form-control:focus {
+	-webkit-box-shadow: none;
+	box-shadow: none;
+}
+.dungar-contact-fom .your-textarea {
+	border: 1px solid #eeeeee;
+}
+.dungar-contact-fom .button-submit {
+	min-width: 157px;
+	margin-top: 10px;
+}
+.form-contact-information {
+	padding-top: 55px;
+	padding-right: 45px;
+	padding-bottom: 45px;
+	padding-left: 45px;
+	background-color: #111111;
+}
+.dungar-contact-info .title {
+	font-size: 16px;
+	font-weight: 500;
+	color: #fff;
+	margin-bottom: 55px;
+	text-transform: uppercase;
+}
+.dungar-contact-info .item {
+	display: block;
+	overflow: hidden;
+	margin-bottom: 32px;
+}
+.dungar-contact-info .item .icon {
+	display: inline-block;
+	float: left;
+	border: 1px solid #dd3232;
+	border-radius: 50%;
+	width: 42px;
+	height: 42px;
+	margin-right: 20px;
+	text-align: center;
+	line-height: 40px;
+}
+.dungar-contact-info .item .icon::before {
+	font-family: 'FontAwesome';
+	font-size: 20px;
+	color: #dd3232;
+	display: inline-block;
+	text-align: center;
+}
+.dungar-contact-info .address .icon::before {
+	content: "\f041";
+}
+.dungar-contact-info .phone .icon::before {
+	content: "\f095";
+}
+.dungar-contact-info .email .icon::before {
+	content: "\f003";
+}
+.dungar-contact-info .item .text {
+	display: block;
+	color: #dddddd;
+	text-transform: capitalize;
+	font-size: 14px;
+	overflow: hidden;
+}
+.dungar-contact-info .socials {
+	padding-top: 238px;
+}
+.dungar-contact-info .socials .social-item {
+	font-size: 23px;
+	color: #555;
+	margin-right: 20px;
+}
+.dungar-contact-info .socials .social-item:hover {
+	color: #ffffff;
+}
+/*shopping cart page*/
+.cart-form {
+	border: 1px solid #f1f1f1;
+	border-radius: 0;
+}
+.cart-form .shop_table {
+	border: none;
+	margin-bottom: 0;
+}
+.cart-form .shop_table thead {
+	display: none;
+}
+.cart-form .shop_table thead > tr, .cart-form .shop_table tbody > tr.cart_item {
+	font-size: 0;
+	line-height: 0;
+	position: relative;
+	text-align: left;
+}
+.cart-form .shop_table thead tr, .cart-form .shop_table tr.cart_item {
+	border-bottom: 1px solid #f1f1f1;
+}
+.cart-form .shop_table th, .cart-form .shop_table td {
+	border: none;
+	text-align: left;
+}
+.shop_table td.product-remove a {
+	display: block;
+	font-size: 20px;
+	text-align: center;
+}
+.cart-form .product-remove a:before {
+	content: "\f014";
+	font-family: FontAwesome;
+	font-size: 20px;
+	color: #aaa;
+}
+.cart-form .shop_table thead th, .cart-form .shop_table tbody tr.cart_item td {
+	line-height: 24px;
+	border: none;
+	text-align: left;
+}
+.cart-form .shop_table .product-thumbnail {
+	width: 160px;
+	padding-left: 30px;
+}
+.cart-form .shop_table .product-thumbnail img {
+	width: 200px;
+}
+.cart-form .shop_table .product-name {
+	color: #333333;
+	font-size: 16px;
+}
+.cart-form .shop_table .product-name a {
+	display: block;
+	font-weight: 500;
+	font-size: 16px;
+}
+.cart-form .shop_table .product-name .attributes-select {
+	display: inline-block;
+	font-size: 14px;
+	color: #888888;
+	cursor: pointer;
+}
+.cart-form .shop_table .product-name .attributes-size {
+	text-transform: capitalize;
+}
+.cart-form .shop_table .product-quantity .quantity {
+	display: block;
+	border: 1px solid #f1f1f1;
+	padding: 0 6px;
+	width: 75px;
+	text-align: center;
+}
+.cart-form .shop_table .product-quantity .quantity .control {
+	border: none;
+}
+.cart-form .shop_table .product-price {
+	font-size: 20px;
+	color: #111;
+	font-weight: 500;
+}
+.cart-form .shop_table tbody > tr > td.actions {
+	padding: 50px 60px 50px 30px;
+}
+.shop_table .actions .coupon {
+	position: relative;
+	display: inline-block;
+}
+.shop_table .actions > .order-total {
+	float: right;
+	padding: 8px 0;
+}
+.cart-form .shop_table .actions .coupon_code {
+	font-size: 16px;
+	font-weight: 500;
+	color: #333333;
+}
+.cart-form .shop_table .actions input[type="text"] {
+	min-width: 281px;
+	color: #888888;
+}
+.cart-form .coupon .button {
+	font-size: 0;
+	padding: 0;
+	width: 42px;
+	height: 42px;
+	line-height: 40px;
+	color: #aaaaaa;
+	position: absolute;
+	top: 0;
+	right: 0;
+	border: none;
+	text-align: center;
+	cursor: pointer;
+	background: transparent;
+}
+.shop_table .actions .coupon .button::after {
+	content: '\f061';
+	display: inline-block;
+	font-family: 'FontAwesome';
+	font-size: 14px;
+}
+.shop_table .actions .order-total span {
+	color: #333333;
+	text-transform: capitalize;
+	font-weight: 500;
+}
+.shop_table .actions .order-total .title {
+	font-size: 16px;
+}
+.shop_table .actions .order-total .total-price {
+	font-size: 20px;
+}
+.shoppingcart-content .control-cart {
+	text-align: right;
+	margin-top: 30px;
+}
+.shoppingcart-content .control-cart .button {
+	background: transparent;
+	color: #333333;
+	border: 1px solid #e9e9e9;
+	margin-left: 15px;
+}
+.shoppingcart-content .control-cart .button:hover {
+	color: #ffffff;
+}
+/*about page*/
+/*banner about*/
+.header-banner.banner-image .banner-wrap {
+	background-image: url(../image/about-background.jpg) !important;
+	background-position: center !important;
+	background-repeat: no-repeat !important;
+	background-size: cover !important;
+	position: relative;
+}
+.header-banner.banner-image .banner-wrap::after, .header-banner.banner-image .banner-wrap::before {
+	display: table;
+	content: '';
+}
+.header-banner.banner-image .banner-wrap::after {
+	clear: both;
+}
+.header-banner.banner-image .banner-wrap .content-inner {
+	padding-top: 65px;
+	padding-bottom: 65px;
+	float: right;
+}
+.header-banner .title {
+	font-size: 34px;
+	line-height: 1.2;
+	text-align: left;
+	font-style: normal;
+	font-weight: 600;
+	margin-bottom: 15px;
+}
+.header-banner .sub-title {
+	font-size: 16px;
+	text-align: left;
+	margin-bottom: 35px;
+}
+.header-banner .button {
+	color: #000;
+	background-color: transparent;
+	border-color: transparent;
+	height: 43px;
+	line-height: 39px;
+	padding: 0;
+	font-size: 18px;
+	position: relative;
+	overflow: hidden;
+}
+.header-banner .button::before {
+	content: '';
+	position: absolute;
+	left: 0;
+	bottom: 0;
+	width: 100%;
+	border-bottom: 2px solid;
+}
+.header-banner .button:hover::before {
+	-webkit-animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+	animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+}
+.header-banner .dungar-button.button {
+	background-color: transparent;
+	border-color: transparent;
+	color: #000;
+	margin-top: 0;
+}
+/*dungar-iconbox */
+.dungar-iconbox.layout1 {
+	margin-top: 63px;
+}
+.dungar-iconbox.layout1 .icon-item {
+	position: relative;
+	margin-bottom: 15px;
+	color: #0a0a0a;
+}
+.dungar-iconbox.layout1 .icon-item .placeholder-text {
+	font-size: 90px;
+	color: #555;
+	opacity: 0.1;
+	line-height: 1;
+	display: block;
+	font-weight: 500;
+	display: none;
+}
+.dungar-iconbox.layout1 .icon-item .icon {
+	/*position: absolute;*/
+	left: 3px;
+	font-size: 60px;
+	bottom: 20px;
+	color: #dd3232;
+}
+.dungar-iconbox .content .title {
+	font-size: 15px;
+	text-transform: uppercase;
+	font-weight: 600;
+	font-family: 'Jost';
+}
+.dungar-iconbox.layout1 .content .title {
+	color: #222;
+	margin-bottom: 8px;
+}
+.dungar-iconbox.layout1 .iconbox-inner .content .text {
+	color: #888;
+}
+/*team-member*/
+.team-member .border-custom {
+	margin-top: 75px;
+}
+.team-member .custom_blog_title {
+	margin-top: 65px;
+	margin-bottom: 50px;
+	text-transform: capitalize;
+}
+.custom_blog_title.center {
+	text-align: center;
+}
+.dungar-team-member {
+	text-align: center;
+	padding: 0 15px;
+}
+.dungar-team-member .member_avatar img {
+	margin: 0 auto;
+	border-radius: 50%;
+}
+.dungar-team-member .member_name {
+	font-size: 15px;
+	text-transform: uppercase;
+	font-weight: 600;
+	font-family: 'Jost';
+	color: #222;
+	margin-top: 20px;
+	margin-bottom: 3px;
+}
+.team-member-slider.nav-center .slick-arrow {
+	top: calc(50% - 50px);
+	transform: none;
+	opacity: 0;
+	visibility: hidden;
+}
+.team-member-slider:hover .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+}
+/*inlookbook page*/
+.sevice-item.style-1 {
+	padding-bottom: 60px;
+	border-bottom: 1px solid #e9e9e9;
+	margin-bottom: 60px;
+}
+.sevice-box-wrap {
+	position: relative;
+}
+.sevice-box-content {
+	padding: 0 45px;
+	position: absolute;
+	text-align: center;
+	top: 50%;
+	-webkit-transform: translateY(-50%);
+	-ms-transform: translateY(-50%);
+	-o-transform: translateY(-50%);
+	transform: translateY(-50%);
+	width: 100%;
+}
+.sevice-box-content .sevice-title {
+	font-size: 32px;
+	font-weight: 700;
+	color: #222;
+	line-height: 1.3;
+	margin-bottom: 25px;
+}
+.sevice-box-content .sevice-title span {
+	display: block;
+}
+.sevice-box-content .sevide-desc {
+	margin: 0 0 35px;
+}
+.sevice-box-content .sevice-button {
+	border: 1px solid #e9e9e9;
+	min-width: 206px;
+	height: 43px;
+	line-height: 38px;
+	color: #333;
+	display: inline-block;
+	padding: 0 15px;
+	font-size: 12px;
+	font-weight: 700;
+}
+.sevice-box-content .sevice-button:hover {
+	color: #ffffff;
+}
+.wapper-slider-lookbook {
+	padding: 60px 0;
+	background: #f4f4f4;
+}
+.slider-lookbook-item {
+	padding: 0 15px;
+}
+.slider-lookbook-item .lookbook-inner {
+	padding: 30px;
+	background: #ffffff;
+	overflow: hidden;
+}
+.slider-lookbook-item .lookboox-thumb {
+	float: left;
+	max-width: 200px;
+}
+.slider-lookbook-item .lookboox-infore {
+	text-align: center;
+	padding: 35px 0 0 50px;
+	overflow: hidden;
+}
+.slider-lookbook-item .name-lookbook {
+	font-size: 20px;
+	text-transform: capitalize;
+	margin-bottom: 45px;
+	font-weight: 700;
+}
+.slider-lookbook-item .view-the-look {
+	color: #aaaaaa;
+	font-size: 13px;
+	font-weight: 700;
+	text-transform: uppercase
+}
+.slider-lookbook.nav-center > .slick-arrow {
+	width: 50px;
+	border: 1px solid #eeeeee;
+	text-align: center;
+	line-height: 48px;
+	background: #ffffff;
+}
+.slider-lookbook.nav-center > .slick-arrow:hover {
+	background: #ffffff;
+}
+.slick-slider.slider-lookbook.nav-center > .slick-arrow {
+	right: -40px;
+}
+.slick-slider.slider-lookbook.nav-center > .slick-arrow:first-child {
+	left: -40px;
+}
+.sevice-item.style-1:last-child {
+	padding-bottom: 0;
+	margin-bottom: 0;
+	border-bottom: 0;
+}
+/*check out*/
+.checkout-form {
+	display: inline-block;
+	padding: 40px 30px;
+	border: 1px solid #f3f3f3;
+	margin-bottom: 25px;
+	width: 100%;
+	border-radius: 0;
+}
+.checkout-wrapp .row-col {
+	display: inline-block;
+	float: left;
+}
+.checkout-wrapp .row-col-1 {
+	width: 57.264957%;
+	padding-right: 15px;
+}
+.checkout-wrapp .row-col-2 {
+	width: 42.735043%;
+	padding-left: 135px;
+}
+.title-form {
+	font-size: 18px;
+	font-weight: 500;
+	color: #0a0a0a;
+	margin-bottom: 25px;
+	padding-bottom: 10px;
+	position: relative;
+}
+.title-form::before {
+	content: '';
+	position: absolute;
+	left: 0;
+	bottom: 0;
+	border-bottom: 2px solid #dd3232;
+	width: 30px;
+}
+.shipping-address .form-row:not(.form-row-last) {
+	clear: left;
+}
+.shipping-address .form-row.form-row-first, .shipping-address .form-row.form-row-last {
+	display: inline-block;
+	width: calc(50% - 10px);
+	overflow: visible;
+}
+.shipping-address .form-row.form-row-last {
+	float: right;
+}
+.shipping-address .form-row .text {
+	display: block;
+	font-weight: 500;
+	font-size: 14px;
+	color: #333;
+	text-transform: capitalize;
+}
+.checkout-wrapp .form-row .input-text {
+	width: 100%;
+}
+.checkout-wrapp .forn-row-col {
+	width: 33%;
+	display: inline-block;
+	padding: 0 8px;
+}
+.checkout-wrapp .forn-row-col.forn-row-col-1 {
+	padding-left: 0
+}
+.checkout-wrapp .forn-row-col.forn-row-col-3 {
+	padding-right: 0;
+	float: right;
+}
+.checkout-wrapp .chosen-container {
+	width: 100% !important;
+}
+.checkout-wrapp .chosen-container-single .chosen-single {
+	background: transparent;
+	font-weight: 400;
+	text-transform: capitalize;
+}
+.checkout-wrapp .chosen-container-single .chosen-single div {
+	right: 10px;
+}
+.your-order .title-form {
+	margin-bottom: 35px;
+	position: relative;
+	padding-bottom: 10px;
+}
+.list-product-order {
+	padding: 0;
+	margin: 0;
+}
+.list-product-order li {
+	list-style: none;
+	overflow: hidden;
+	padding-bottom: 30px;
+	margin-bottom: 30px;
+	border-bottom: 1px solid #f3f3f3
+}
+.list-product-order li:last-child {
+	padding-bottom: 0;
+	border-bottom: 0;
+	margin-bottom: 35px;
+}
+.list-product-order .product-thumb {
+	float: left;
+	width: 100px;
+	margin-right: 30px;
+}
+.list-product-order .product-order-inner {
+	overflow: hidden;
+}
+.list-product-order .product-name {
+	font-size: 16px;
+	color: #333333;
+	margin-bottom: 5px;
+	margin-top: 5px;
+	position: relative;
+}
+.list-product-order .attributes-select {
+	font-size: 14px;
+	color: #888888;
+	text-transform: capitalize;
+	cursor: pointer;
+	margin-bottom: 5px;
+	display: inline-block;
+}
+.list-product-order .attributes-size {
+	text-transform: uppercase;
+}
+.list-product-order .price {
+	font-size: 16px;
+	color: #111111;
+	font-weight: 500;
+}
+.list-product-order .price .count {
+	color: #888881;
+}
+.your-order .order-total {
+	color: #333333;
+	font-weight: 500;
+}
+.your-order .order-total .title {
+	font-size: 16px;
+	text-transform: capitalize;
+}
+.your-order .order-total .total-price {
+	font-size: 20px;
+}
+.checkout-wrapp .button {
+	min-width: 110px;
+	background: transparent;
+	color: #333333;
+	border: 1px solid #e9e9e9;
+	margin-bottom: 50px;
+}
+.checkout-wrapp .button-payment {
+	float: right;
+	min-width: 135px;
+}
+.checkout-wrapp .button-payment::after {
+	content: "\f061";
+	font-family: "FontAwesome";
+	font-size: 13px;
+	color: #aaaaaa;
+	margin-left: 10px;
+}
+.checkout-wrapp .button:hover, .checkout-wrapp .button:hover:after, .button-control .btn-back-to-shipping:hover::before {
+	color: #ffffff;
+}
+.payment-method-wrapp .button-control {
+	float: right;
+}
+.payment-method .title-form {
+	margin-bottom: 35px;
+}
+.checkout-wrapp .group-button-payment .button {
+	margin-bottom: 20px;
+	margin-right: 15px;
+}
+.checkout-wrapp .group-button-payment .btn-credit-card {
+	min-width: 155px;
+	color: #ffffff;
+}
+.payment-method .form-row-card-number {
+	max-width: 360px;
+}
+.form-row-card-number .input-text {
+	text-align: center;
+}
+.payment-method-wrapp .button-control .button {
+	margin-left: 15px;
+}
+.payment-method-wrapp .button-control .btn-pay-now {
+	color: #ffffff;
+}
+.button-control .btn-back-to-shipping::before {
+	content: "\f060";
+	font-family: "FontAwesome";
+	font-size: 13px;
+	color: #aaaaaa;
+	margin-right: 10px;
+}
+.end-checkout {
+	text-align: center;
+	padding: 50px 30px;
+	margin-bottom: 0;
+}
+.end-checkout .icon {
+	display: inline-block;
+	width: 98px;
+	height: 98px;
+	border: 3px solid #555555;
+	border-radius: 50%;
+	line-height: 102px;
+	text-align: center;
+	margin-bottom: 25px;
+}
+.end-checkout .icon::before {
+	content: url("../image/icon-checkout.png");
+}
+.end-checkout .title-checkend {
+	font-size: 18px;
+	color: #0a0a0a;
+}
+.end-checkout .sub-title {
+	font-size: 14px;
+	color: #555555;
+	margin: 0 auto 40px;
+	max-width: 570px;
+}
+.end-checkout .button {
+	min-width: 200px;
+	margin-bottom: 0;
+	color: #ffffff;
+}
+.end-checkout .button:hover, .payment-method-wrapp .button-control .btn-pay-now:hover, .checkout-wrapp .group-button-payment .btn-credit-card:hover {
+	background: #333333 !important;
+	border-color: #333333 !important;
+}
+/*detaills page*/
+.details-thumd {
+	width: 51.7241%;
+	float: left;
+	padding-right: 50px;
+	position: relative;
+}
+.details-infor {
+	width: 48.2759%;
+	float: right;
+}
+.details-thumd .thumbnails_carousel .owl-item a {
+	display: block;
+	position: relative;
+}
+.details-thumd .thumbnails_carousel .owl-item a::before {
+	border: 1px solid #eee;
+	position: absolute;
+	left: 1px;
+	right: 1px;
+	top: 1px;
+	bottom: 1px;
+	content: '';
+	z-index: 1;
+	border-radius: 0;
+}
+.details-thumd .thumbnails_carousel .owl-item a.active::before {
+	border-color: #dd3232;
+}
+.details-thumd .thumbnails_carousel .owl-item img {
+	margin: 0 auto;
+}
+.details-thumd .image-preview-container {
+	position: relative;
+	border: 1px solid #eee;
+	margin-bottom: 10px;
+	overflow: hidden;
+	border-radius: 0;
+}
+.btn-zoom.open_qv {
+	position: absolute;
+	width: 40px;
+	height: 40px;
+	right: 10px;
+	top: 10px;
+	border-radius: 50%;
+	overflow: hidden;
+	border: 1px solid #dddddd;
+	background-color: #fff;
+	text-align: center;
+	line-height: 38px;
+	z-index: 32;
+	
+}
+.btn-zoom.open_qv:hover {
+	color: #ffffff;
+}
+.zoomContainer:nth-child(n+1), .zoomContainer:first-child {
+	display: none !important;
+}
+.zoomContainer:last-child {
+	display: block !important;
+}
+.details-thumd .product-preview {
+	padding: 0 40px;
+}
+.details-thumd .owl-thumb-item {
+	font-size: 0;
+	display: none;
+}
+.details-thumd .owl-nav .owl-next {
+	right: -40px;
+}
+.details-thumd .owl-nav .owl-prev {
+	left: -40px;
+}
+.details-thumd .owl-nav div {
+	width: 35px;
+	height: 35px;
+	border: 1px solid #eeeeee;
+	text-align: center;
+	line-height: 30px;
+	display: inline-block;
+	position: absolute;
+	top: 50%;
+	transform: translateY(-50%);
+	font-size: 20px;
+	color: #aaaaaa;
+	background: #ffffff;
+	z-index: 33;
+	border-radius: 50%;
+}
+.details-infor .product-title {
+	font-size: 26px;
+	font-weight: 500;
+	color: #333;
+	margin-bottom: 9px;
+	margin-top: -9px;
+}
+.details-infor .stars-rating {
+	display: inline-block;
+	vertical-align: middle;
+	margin-bottom: 5px;
+}
+.details-infor .availability {
+	text-transform: capitalize;
+	font-size: 14px;
+	color: #555555;
+	margin-bottom: 10px;
+}
+.details-infor .availability a {
+	font-weight: 700;
+}
+.details-infor .price {
+	font-size: 22px;
+	font-weight: 500;
+	color: #111111;
+	margin-bottom: 20px;
+}
+.details-infor .product-details-description {
+	font-size: 14px;
+	color: #555555;
+	margin-bottom: 15px;
+}
+.details-infor .variations .text-attribute {
+	font-size: 14px;
+	font-weight: 700;
+}
+.details-infor .variations .text-attribute span {
+	color: #555555;
+	font-weight: normal;
+}
+.attribute .list-item {
+	overflow: hidden;
+	margin: 15px 0 10px;
+}
+.attribute_color .list-color a {
+	display: inline-block;
+	height: 27px;
+	margin-bottom: 15px;
+	margin-right: 10px;
+	position: relative;
+	text-align: center;
+	width: 26px;
+	line-height: 27px;
+	float: left;
+	border-radius: 0;
+}
+.attribute_color .list-color a:last-child {
+	margin-right: 0;
+}
+.attribute_color .list-color .color1 {
+	border: 1px solid #eeeeee
+}
+.attribute_color .list-color .color2 {
+	background: #0a0a0a;
+}
+.attribute_color .list-color .color3 {
+	background: #4a5365;
+}
+.attribute_color .list-color .color4 {
+	background: #84664d;
+}
+.attribute_color .list-color a:hover::before, .attribute_color .list-color a.active::before {
+	color: #fff;
+	content: "\f00c";
+	display: inline-block;
+	font-family: FontAwesome;
+	font-size: 12px;
+	left: 0;
+	position: absolute;
+	width: 100%;
+}
+.attribute_color .list-color .color1:hover::before, .attribute_color .list-color .color1.active::before {
+	color: #0a0a0a;
+}
+.attribute_size .list-size a {
+	display: inline-block;
+	min-width: 54px;
+	line-height: 28px;
+	height: 30px;
+	border: 1px solid #eeeeee;
+	text-align: center;
+	margin-right: 10px;
+	margin-bottom: 15px;
+	text-transform: uppercase;
+	font-weight: 600;
+	border-radius: 0;
+	font-family: 'Jost';
+	font-size: 12px;
+}
+.attribute_size .list-size a.active, .attribute_size .list-size a:hover {
+	color: #ffffff;
+}
+.details-infor .group-button .yith-wcwl-add-to-wishlist, .details-infor .group-button .size-chart-wrapp {
+	display: inline-block;
+	vertical-align: middle;
+	margin-bottom: 25px;
+	font-size: 14px;
+	color: #555555;
+}
+.details-infor .group-button .size-chart-wrapp {
+	margin-left: 25px;
+}
+.details-infor .group-button .yith-wcwl-add-to-wishlist div a::before,
+.details-infor .group-button .size-chart-wrapp .btn-size-chart a::before {
+	font-family: 'FontAwesome';
+	margin-right: 7px;
+	color: #ccc;
+	font-size: 18px;
+	line-height: normal;
+	vertical-align: middle;
+	display: inline-block;
+	margin-top: -2px;
+}
+.details-infor .group-button .yith-wcwl-add-to-wishlist div a::before {
+	content: "\f08a";
+}
+.details-infor .group-button .yith-wcwl-add-to-wishlist div a:hover::before {
+	content: "\f004";
+}
+.details-infor .group-button .size-chart-wrapp .btn-size-chart a::before {
+	content: "\f11b";
+	font-family: 'Flaticon';
+}
+.details-infor .quantity, .details-infor .group-button .button {
+	display: inline-block;
+	vertical-align: middle;
+	margin-right: 5px;
+}
+.details-infor .quantity .control {
+	padding: 1px 8px;
+}
+.details-infor .group-button .button {
+	min-width: 150px;
+	font-size: 13px;
+	color: #fff;
+}
+.tab-details-product {
+	margin-top: 80px;
+	width: 100%;
+	float: left;
+}
+.tab-details-product .tab-link {
+	margin-bottom: 35px;
+	padding: 0;
+	padding-bottom: 4px;
+}
+.no-sidebar .tab-details-product .tab-link {
+	text-align: center;
+}
+.tab-details-product .tab-link li {
+	list-style: none;
+	display: inline-block;
+	padding: 0 30px;
+	font-weight: 700;
+}
+.tab-details-product .tab-link li:first-child {
+	padding-left: 0;
+}
+.tab-details-product .tab-link li:last-child {
+	padding-right: 0;
+}
+.tab-details-product .tab-link li a {
+	display: inline-block;
+	font-size: 14px;
+	color: #bbb;
+	position: relative;
+	text-transform: uppercase;
+	font-family: 'Jost';
+}
+.tab-details-product .tab-link li.active a::after {
+	height: 3px;
+	width: 100%;
+	position: absolute;
+	bottom: -8px;
+	left: 0;
+	content: '';
+}
+.tab-details-product #product-descriptions p {
+	margin-bottom: 0;
+}
+.reviews-tab .comments .reviews-title {
+	font-size: 16px;
+	text-transform: uppercase;
+	margin-bottom: 20px;
+}
+.reviews-tab .commentlist {
+	padding: 0;
+	margin: 0;
+}
+.reviews-tab .conment {
+	list-style: none;
+	margin-bottom: 30px;
+}
+.reviews-tab .avatar {
+	float: left;
+}
+.reviews-tab .comment-text {
+	overflow: hidden;
+	padding-left: 30px;
+}
+.reviews-tab .stars-rating {
+	float: right;
+	display: inline-block;
+}
+.reviews-tab .comment-text .meta {
+	border-bottom: 1px solid #eee;
+	padding-bottom: 5px;
+	margin-bottom: 5px;
+}
+.review_form .comment-reply-title {
+	font-size: 14px;
+	text-transform: uppercase;
+	margin-bottom: 20px;
+}
+.comment-form-review p {
+	width: 100%;
+	float: left;
+	margin-bottom: 30px;
+}
+.comment-form-review label {
+	display: block;
+	font-weight: normal;
+}
+.review_form .comment-form-review .stars {
+	margin-bottom: 0;
+}
+.review_form .comment-form-review .stars a {
+	font-size: 0;
+	color: #ccc;
+	display: inline-block;
+	border-right: 1px solid #eee;
+	padding: 0 10px;
+	line-height: 13px;
+	float: left;
+}
+.review_form .comment-form-review .stars a:last-child {
+	border: none;
+}
+.review_form .comment-form-review .stars a:first-child {
+	padding-left: 0;
+}
+.review_form .comment-form-review .stars a::before {
+	font-family: 'FontAwesome';
+	font-size: 13px;
+	display: inline-block
+}
+.review_form .comment-form-review .stars a.star-1::before {
+	content: "\f005";
+}
+.review_form .comment-form-review .stars a.star-2::before {
+	content: "\f005\f005";
+}
+.review_form .comment-form-review .stars a.star-3::before {
+	content: "\f005\f005\f005";
+}
+.review_form .comment-form-review .stars a.star-4::before {
+	content: "\f005\f005\f005\f005";
+}
+.review_form .comment-form-review .stars a.star-5::before {
+	content: "\f005\f005\f005\f005\f005";
+}
+.comment-form-review input[type="text"], .comment-form-review input[type="email"], .comment-form input[type="url"] {
+	clear: both;
+	float: left;
+	padding: 6px 15px;
+	width: 48%;
+}
+.comment-form-review .form-submit .submit {
+	padding: 9px 30px;
+}
+/*product related/ product upsells*/
+.related, .up-sells {
+	position: relative;
+}
+.product-grid-title {
+	font-size: 20px;
+	text-transform: uppercase;
+	color: #0a0a0a;
+	text-align: center;
+	font-style: normal;
+	margin-bottom: 40px;
+	position: relative;
+	font-weight: 700;
+	letter-spacing: 0;
+	display: table;
+	margin-left: auto;
+	margin-right: auto;
+	padding-bottom: 15px;
+	padding-top: 60px;
+}
+.product-grid-title::before {
+	position: absolute;
+	content: '';
+	width: 70px;
+	border-bottom: 4px solid #dd3232;
+	bottom: 0;
+	left: 50%;
+	-webkit-transform: translateX(-50%);
+	-moz-transform: translateX(-50%);
+	-ms-transform: translateX(-50%);
+	-o-transform: translateX(-50%);
+	transform: translateX(-50%);
+}
+.related .product-item, .up-sells .product-item {
+	margin-bottom: 0;
+}
+.related .slick-slider.nav-center > .slick-arrow,
+.up-sells .slick-slider.nav-center > .slick-arrow {
+	color: #aaaaaa;
+	width: 35px;
+	height: 35px;
+	text-align: center;
+	line-height: 30px;
+	border: 1px solid #f3f3f3;
+	font-size: 20px;
+	opacity: 0;
+	right: 50px;
+	visibility: hidden;
+	background: #ffffff;
+	-moz-transition: all 0.45s ease;
+	-webkit-transition: all 0.45s ease;
+	-o-transition: all 0.45s ease;
+	-ms-transition: all 0.45s ease;
+}
+.related .slick-slider.nav-center > .slick-arrow:first-child,
+.up-sells .slick-slider.nav-center > .slick-arrow:first-child {
+	left: 50px;
+}
+.related:hover .slick-slider.nav-center > .slick-arrow,
+.up-sells:hover .slick-slider.nav-center > .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+	right: -20px;
+}
+.related:hover .slick-slider.nav-center > .slick-arrow:first-child,
+.up-sells:hover .slick-slider.nav-center > .slick-arrow:first-child {
+	left: -20px;
+}
+/*details full width*/
+.full-width .details-thumd {
+	padding-right: 70px;
+}
+.full-width .details-thumd .product-preview {
+	padding: 0;
+}
+.full-width .details-thumd .owl-nav .owl-prev {
+	left: -17px;
+}
+.full-width .details-thumd .owl-nav .owl-next {
+	right: -17px;
+}
+/*============================================
+
+===================HOME PAGE=================
+
+=============================================*/
+/*-------------------------
+----------HOME 01----------
+--------------------------*/
+/*home-slider*/
+.slider-item .slider-inner {
+	background-position: center;
+	background-repeat: no-repeat;
+	background-size: cover;
+	position: relative;
+	border-radius: 0;
+	overflow: hidden;
+}
+.slider-item .title-small {
+	color: #dd3232;
+	font-size: 14px;
+	letter-spacing: 0.05em;
+	font-weight: 700;
+	padding: 0;
+	text-transform: uppercase;
+	margin-bottom: 12px;
+	font-family: 'Jost';
+}
+.slider-item.slick-active .title-small {
+	animation-duration: 2s;
+	-webkit-animation-duration: 2s;
+	animation-fill-mode: both;
+	-webkit-animation-fill-mode: both;
+	animation-name: bounceInDown;
+	-webkit-animation-name: bounceInDown;
+}
+.slider-item .title-big {
+	font-size: 38px;
+	font-weight: 500;
+	line-height: 1;
+	max-width: 370px;
+	text-transform: capitalize;
+}
+.slider-item.slick-active .title-big {
+	animation-duration: 2s;
+	-webkit-animation-duration: 2s;
+	animation-fill-mode: both;
+	-webkit-animation-fill-mode: both;
+	animation-name: bounceInRight;
+	-webkit-animation-name: bounceInRight;
+}
+.slider-item .price {
+	font-size: 18px;
+	letter-spacing: -0.05em;
+	font-weight: 500;
+	display: block;
+	margin-bottom: 35px;
+}
+.slider-item.slick-active .price, .slider-item.slick-active .description {
+	animation-duration: 2s;
+	-webkit-animation-duration: 2s;
+	animation-fill-mode: both;
+	-webkit-animation-fill-mode: both;
+	animation-name: bounceInLeft;
+	-webkit-animation-name: bounceInLeft;
+}
+.slider-item .price .number-price {
+	text-transform: uppercase;
+	font-size: 28px;
+	color: #dd3232;
+	font-weight: 600;
+	position: relative;
+}
+.slider-item .slider-infor .button {
+	padding-top: 7px;
+	padding-bottom: 7px;
+	padding-right: 0;
+	padding-left: 0;
+	background: none;
+	border: 1px solid transparent;
+	color: #000;
+	margin-right: 5px;
+	border-radius: 0;
+	position: relative;
+	overflow: hidden;
+	font-size: 18px;
+}
+.slider-item .slider-infor .button::before {
+	content: '';
+	position: absolute;
+	left: 0;
+	bottom: 0;
+	width: 100%;
+	border-bottom: 2px solid;
+}
+.slider-item .slider-infor .button:hover::before {
+	-webkit-animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+	animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+}
+.slider-item.slick-active .slider-infor .button {
+	animation-duration: 2s;
+	-webkit-animation-duration: 2s;
+	animation-fill-mode: both;
+	-webkit-animation-fill-mode: both;
+	animation-name: bounceInUp;
+	-webkit-animation-name: bounceInUp;
+	font-family: 'Jost';
+}
+.slider-item .slider-infor .button:last-child {
+	margin-right: 0;
+}
+.slider-item .slider-infor .button:hover {
+	background: none;
+	border-color: transparent;
+	color: #dd3232;
+}
+.slider-item.style1 .slider-inner {
+	background-image: url(../image/slider-thumb1.jpg);
+}
+.slider-item.style1 .slider-inner .slider-infor,
+.slider-item.style2 .slider-inner .slider-infor,
+.slider-item.style3 .slider-inner .slider-infor {
+	padding-bottom: 126px;
+	padding-top: 139px;
+	padding-left: 680px;
+	padding-right: 170px;
+	float: right;
+}
+.slider-item.style2 .slider-inner {
+	background-image: url(../image/slider-thumb2.jpg);
+}
+.slider-item.style2 .slider-inner .slider-infor {
+	padding-left: 680px;
+	padding-right: 170px;
+}
+.slider-item.style2 .title-big span {
+	position: relative;
+	color: #dd3232;
+}
+.slider-item.style3 .slider-inner {
+	background-image: url(../image/slider-thumb3.jpg);
+}
+.home-slider.style1 {
+	padding-top: 30px;
+}
+.home-slider .slick-slider.nav-center > .slick-arrow {
+	width: 52px;
+	height: 52px;
+	background-color: #fff;
+	font-size: 30px;
+	text-align: center;
+	line-height: 52px;
+	opacity: 0;
+	right: 30px;
+	visibility: hidden;
+	-moz-transition: all 0.45s ease;
+	-webkit-transition: all 0.45s ease;
+	-o-transition: all 0.45s ease;
+	-ms-transition: all 0.45s ease;
+}
+.home-slider .slick-slider.nav-center > .slick-arrow:first-child {
+	left: 30px;
+}
+.home-slider:hover .slick-slider.nav-center > .slick-arrow:first-child {
+	left: 15px;
+}
+.home-slider:hover .slick-slider.nav-center > .slick-arrow {
+	right: 15px;
+	opacity: 1;
+	visibility: visible;
+}
+/*dungar newsletter*/
+.dungar-newsletter.default {
+	padding-top: 34px;
+	padding-right: 30px;
+	padding-bottom: 36px;
+	padding-left: 30px;
+	background-image: url(../image/newsletter-bg.jpg);
+	background-position: right top;
+	background-repeat: no-repeat;
+	background-color: #f3f3f3;
+	margin-bottom: 30px;
+	border-radius: 0;
+}
+.dungar-newsletter.default .title {
+	font-size: 26px;
+	font-weight: 500;
+	margin-bottom: 0;
+}
+.dungar-newsletter.default .subtitle {
+	font-size: 15px;
+	margin-bottom: 54px;
+}
+.dungar-newsletter.default .newsletter-form-wrap .email-newsletter {
+	margin-bottom: 10px;
+	width: 100%;
+	background: #fff;
+	font-size: 14px;
+	text-align: center;
+	color: #888;
+	border-color: #fff;
+	border-radius: 30px;
+}
+.dungar-newsletter.default .newsletter-form-wrap .submit-newsletter {
+	width: 100%;
+	border-radius: 30px;
+}
+/*dungar-tabs*/
+.dungar-tabs.default.rows-space-40 {
+	padding-top: 9px;
+}
+.dungar-tabs .tab-head {
+	margin-bottom: 55px;
+}
+.dungar-tabs .tab-link {
+	padding: 0;
+	margin: 0;
+	text-align: center;
+	position: relative;
+}
+.dungar-tabs .tab-link::before {
+	content: '';
+	top: 50%;
+	left: 0;
+	right: 0;
+	position: absolute;
+	border-top: 2px solid #F1F1F1;
+	display: none;
+}
+.dungar-tabs .tab-link li {
+	display: inline-block;
+	list-style: none;
+}
+.dungar-tabs .tab-link li a {
+	margin: 0 25px;
+	font-family: 'Jost';
+	font-size: 14px;
+	font-weight: 700;
+	position: relative;
+	text-transform: uppercase;
+	letter-spacing: 0.1em;
+	border-radius: 0;
+	padding-bottom: 15px;
+}
+.dungar-tabs .tab-link li a::before {
+	content: '';
+	position: absolute;
+	bottom: 0;
+	left: 0;
+	right: 0;
+	transform: scale(0);
+	border-bottom: 2px solid;
+	-webkit-transition: transform 0.25s ease 0s;
+	-moz-transition: transform 0.25s ease 0s;
+	-o-transition: transform 0.25s ease 0s;
+	transition: transform 0.25s ease 0s;
+}
+.dungar-tabs .tab-link li.active a {
+	color: #dd3232;
+}
+.dungar-tabs .tab-link li.active a::before,
+.dungar-tabs .tab-link li a:hover::before {
+	-webkit-transform: scale(1);
+	-moz-transform: scale(1);
+	-ms-transform: scale(1);
+	-o-transform: scale(1);
+	transform: scale(1);
+}
+/*dungar-blog*/
+.dungar-blog-wraap.default {
+	padding-top: 58px;
+	padding-bottom: 63px;
+}
+.custommenu-title-blog {
+	font-size: 28px;
+	color: #0a0a0a;
+	text-transform: uppercase;
+	text-align: center;
+	font-style: normal;
+	margin-bottom: 55px;
+	position: relative;
+	font-weight: 600;
+	letter-spacing: 0;
+	display: table;
+	margin-left: auto;
+	margin-right: auto;
+	font-family: 'Jost';
+	padding-bottom: 15px;
+}
+.custommenu-title-blog::before {
+	position: absolute;
+	content: '';
+	width: 70px;
+	border-bottom: 4px solid #dd3232;
+	bottom: 0;
+	left: 50%;
+	-webkit-transform: translateX(-50%);
+	-moz-transform: translateX(-50%);
+	-ms-transform: translateX(-50%);
+	-o-transform: translateX(-50%);
+	transform: translateX(-50%);
+}
+.dungar-blog .owl-slick .slick-list {
+	margin-top: 0 !important;
+	margin-bottom: 0 !important;
+	padding: 0;
+}
+.dungar-blog-item .post-thumb {
+	position: relative;
+}
+.dungar-blog-item .post-thumb > a::after, .dungar-blog-item .post-thumb .video-dungar-blog figure::after {
+	position: absolute;
+	content: '';
+	top: 0;
+	bottom: 0;
+	left: 0;
+	right: 0;
+	background-color: rgba(0, 0, 0, 0.3);
+	-webkit-transition: opacity 0.2s ease;
+	-moz-transition: opacity 0.2s ease;
+	-ms-transition: opacity 0.2s ease;
+	-o-transition: opacity 0.2s ease;
+	transition: opacity 0.2s ease;
+	opacity: 0;
+}
+.dungar-blog-item .post-thumb:hover .video-dungar-blog figure::after,
+.dungar-blog-item .post-thumb:hover > a::after {
+	opacity: 1;
+}
+.dungar-blog-item .post-thumb .post-item-share {
+	position: absolute;
+	top: 15px;
+	right: 20px;
+	display: none;
+}
+.dungar-blog-item .post-item-share .icon {
+	color: #fff;
+	opacity: 0.5
+}
+.post-item-share .icon {
+	font-size: 16px;
+	color: #a3a4a6;
+}
+.post-item-share .box-content {
+	position: absolute;
+	top: 100%;
+	left: 0;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transition: .35s;
+	-o-transition: .35s;
+	transition: .35s;
+	-webkit-transform: translateY(10px);
+	-moz-transform: translateY(10px);
+	-ms-transform: translateY(10px);
+	-o-transform: translateY(10px);
+	transform: translateY(10px);
+	z-index: 5;
+}
+.post-item-share .box-content a {
+	display: list-item;
+	list-style: none;
+	color: #a3a4a6;
+	font-size: 15px;
+}
+.dungar-blog-item .post-item-share .icon:hover {
+	opacity: 1
+}
+.post-item-share:hover .box-content {
+	opacity: 1;
+	visibility: visible;
+	-webkit-transform: translateY(0);
+	-moz-transform: translateY(0);
+	-ms-transform: translateY(0);
+	-o-transform: translateY(0);
+	transform: translateY(0);
+}
+.post-item-share .box-content a:hover {
+	color: #fff;
+}
+.dungar-blog-item .post-date {
+	font-size: 11px;
+	color: #aaa;
+	padding: 15px 20px 0;
+	margin-bottom: 5px;
+	text-transform: uppercase;
+	font-weight: 500;
+	letter-spacing: 0.1em;
+}
+.dungar-blog-item .blog-title {
+	font-size: 20px;
+	margin-bottom: 15px;
+	position: relative;
+}
+.dungar-blog-item .blog-title span {
+	color: #aaaaaa;
+}
+.dungar-blog-item .blog-meta {
+	padding: 10px 0 5px;
+}
+.dungar-blog-item .blog-meta .author {
+	display: inline-block;
+	float: left;
+	font-size: 14px;
+	color: #333;
+	font-weight: 500;
+	text-transform: capitalize;
+}
+.dungar-blog-item .blog-meta .author img {
+	display: inline-block;
+	width: 29px;
+	height: 28px;
+	border-radius: 50%;
+	text-align: center
+}
+.dungar-blog-item .blog-meta .view, .dungar-blog-item .blog-meta .comment {
+	color: #aaa;
+	font-size: 13px;
+	font-weight: 700;
+	display: none;
+}
+.dungar-blog .slick-slider > .slick-arrow {
+	width: 51px;
+	height: 51px;
+	text-align: center;
+	line-height: 48px;
+	border: 1px solid #eeeeee;
+	color: #aaaaaa;
+	right: -40px;
+	z-index: 33;
+	background: #ffffff;
+	
+	opacity: 0;
+	visibility: hidden;
+}
+.dungar-blog .slick-slider > .slick-arrow:first-child {
+	left: -40px;
+}
+.dungar-blog:hover .slick-slider > .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+}
+/*dungar-blog style2*/
+.dungar-blog-item.style2 .dungar-blog-inner {
+	overflow: hidden;
+	background: #f5f5f5;
+	border-radius: 0;
+}
+.dungar-blog-item.style2 .post-thumb {
+	float: left;
+	margin-top: -2px;
+	margin-left: -2px;
+	margin-bottom: -2px;
+}
+.dungar-blog-item.style2 .blog-info {
+	overflow: hidden;
+	border-left: 0;
+}
+.dungar-blog-item.style2 .post-top {
+	margin: 20px 20px 20px;
+	position: relative;
+	padding-bottom: 5px;
+}
+.dungar-blog-item.style2 .post-date {
+	padding-top: 0;
+}
+.dungar-blog-item .post-top > a {
+	font-size: 14px;
+	color: #222;
+	font-weight: 600;
+	text-transform: uppercase;
+}
+.dungar-blog-item .post-top .post-item-share {
+	position: relative;
+	display: none;
+	float: right;
+}
+.dungar-blog-item.style2 .post-top > a {
+	color: #fff;
+	padding: 3px 10px;
+	background-color: #dd3232;
+	font-size: 11px;
+	letter-spacing: 0.1em;
+}
+.dungar-blog-item.style2 .post-item-share .icon {
+	color: #aaa;
+	font-size: 16px;
+	opacity: 1;
+}
+.post-top .post-item-share .box-content {
+	padding-top: 20px;
+}
+.dungar-blog-item.style2 .post-item-share .icon:hover, .dungar-blog-item.style2 .post-item-share .box-content a:hover {
+	color: #333333;
+}
+.dungar-blog-item.style2 .blog-title {
+	height: 75px;
+	margin-bottom: 59px;
+	overflow: hidden;
+	font-size: 20px;
+	padding: 0 20px;
+}
+.dungar-blog-item.style2 .blog-title::before {
+	left: 20px;
+	display: none;
+}
+.dungar-blog-item.style2 .blog-meta {
+	border: none;
+	padding: 0 20px;
+}
+.dungar-blog-item.style2 .blog-meta .blog-meta-wrapp {
+	padding: 11px 0 12px;
+	border-top: 1px solid #e4e4e4;
+}
+/*video blog dungar*/
+.video-dungar-blog .quick-install {
+	border-radius: 50%;
+	cursor: pointer;
+	display: inline-block;
+	height: 64px;
+	left: 50%;
+	line-height: 64px;
+	position: absolute;
+	text-align: center;
+	top: 50%;
+	width: 64px;
+	-webkit-transform: translateX(-50%) translateY(-50%);
+	-ms-transform: translateX(-50%) translateY(-50%);
+	-o-transform: translateX(-50%) translateY(-50%);
+	transform: translateX(-50%) translateY(-50%);
+	-webkit-transition: all .6s ease-in-out;
+	-moz-transition: all .6s ease-in-out;
+	-ms-transition: all .6s ease-in-out;
+	-o-transition: all .6s ease-in-out;
+	transition: all .6s ease-in-out;
+	font-size: 64px;
+	color: #fff;
+}
+.video-dungar-blog .quick-install::before {
+	content: "\f115";
+	font-family: 'Flaticon', sans-serif;
+}
+.video-dungar-blog .quick-install:hover {
+	-webkit-transform: translateX(-50%) translateY(-50%) scale(0.9);
+	-ms-transform: translateX(-50%) translateY(-50%) scale(0.9);
+	-o-transform: translateX(-50%) translateY(-50%) scale(0.9);
+	transform: translateX(-50%) translateY(-50%) scale(0.9);
+}
+#slvj-close-icon {
+	background-image: url(https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/images/close-icon.png);
+	width: 30px;
+	height: 30px;
+}
+/*========================================
+-----------------home 02------------------
+=========================================*/
+.top-bar {
+	background: #dd3232;
+	padding: 10px 0;
+	color: #fff;
+}
+.top-bar-left {
+	display: inline-block;
+	line-height: 48px;
+}
+.top-bar-right {
+	display: inline-block;
+	float: right;
+}
+.top-bar .header-language {
+	float: left;
+}
+.top-bar .header-user-links {
+	display: inline-block;
+	margin: 0;
+	list-style: none;
+	padding-left: 15px;
+}
+.top-bar .social-header {
+	float: right;
+}
+.top-bar .header-language .dungar-language {
+	padding-top: 0;
+	margin: 0;
+}
+.top-bar .dungar-language .language-toggle {
+	line-height: 48px;
+	padding-right: 13px;
+}
+.top-bar .header-language .dungar-submenu {
+	margin-top: 0;
+}
+.top-bar .header-language .dungar-language::after {
+	content: '|';
+}
+.top-bar .header-user-links a {
+	line-height: 48px;
+	color: #fff;
+}
+.top-bar-right .social-header .socials {
+	padding-top: 0;
+}
+.top-bar-right .social-header .social-item {
+	color: #fff;
+	line-height: 48px;
+	padding: 0 12px;
+}
+.top-bar-right .social-header .social-item:last-child {
+	padding-right: 0;
+}
+.header.style2 .top-bar {
+	background: #f3f3f3;
+	color: #000;
+}
+.header.style2 .dungar-language .language-toggle,
+.header.style2 .top-bar .header-user-links a {
+	color: #000;
+}
+.header.style2 .header-nav-container {
+	background: #dd3232;
+}
+.header.style2 .main-menu {
+	margin: 0 auto;
+}
+.header.style2 .main-menu > li > a,
+.header.style2 .main-menu > li.menu-item-has-children > a::after {
+	color: #fff;
+}
+.header.style2 .main-menu > li > a {
+	padding: 18px 25px;
+}
+.header.style2 .form-search .form-content {
+	padding: 0;
+}
+.header.style2 .form-search .form-content .inner {
+	border: 2px solid #e9e9e9;
+	width: 251px;
+	position: relative;
+	padding: 0;
+	text-align: left;
+	margin: 0;
+	border-radius: 30px;
+}
+.header.style2 .form-search .form-content .input {
+	width: 171px;
+	border: none;
+}
+.header.style2 .form-search .form-content .btn-search {
+	top: 0;
+	right: 0;
+	border: none;
+	line-height: 38px;
+	position: absolute;
+	width: 25%;
+	padding: 0;
+	height: 100%;
+	background: transparent;
+	color: #888;
+	font-size: 22px;
+	font-weight: normal;
+	margin: 0
+}
+.form-search .form-content .btn-search .icon-search::before {
+	content: "\f12d";
+	font-family: Flaticon;
+	display: inline-block;
+	vertical-align: middle;
+	position: relative;
+}
+/*produc slider home2*/
+.product-item.layout-3 .product-thumb ul {
+	margin: 0;
+	padding: 0;
+}
+.product-item.layout-3 .product-thumb ul li {
+	list-style: none;
+	position: relative;
+}
+.product-item.layout-3 .product-thumb .slick-slider.nav-center > .slick-arrow {
+	font-size: 23px;
+	color: #0a0a0a;
+	width: 20px;
+	height: 20px;
+	text-align: center;
+	line-height: 20px;
+	opacity: 0;
+	visibility: hidden;
+	border: none;
+	border-radius: 0;
+	background-color: transparent;
+}
+.product-item.layout-3 .product-thumb .slick-slider .thumb-inner img {
+	margin: 0 auto;
+}
+.product-item.layout-3:hover .product-thumb .slick-slider.nav-center > .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+}
+.product-item.layout-3 .product-thumb .slick-slider.nav-center > .slick-arrow {
+	right: 0;
+}
+.product-item.layout-3 .product-thumb .slick-slider.nav-center > .slick-arrow:first-child {
+	left: 0;
+}
+.product-item .product-thumb .variations {
+	border: none;
+	text-align: center;
+	position: absolute;
+	bottom: 100%;
+	opacity: 0;
+	-webkit-transition: .35s;
+	-o-transition: .35s;
+	transition: .35s;
+	visibility: hidden;
+	left: 0;
+	right: 0;
+}
+.product-item:hover .product-thumb .variations {
+	opacity: 1;
+	visibility: visible;
+	bottom: -6px;
+}
+.product-item .product-thumb .attribute .list-item {
+	margin: 0;
+}
+.product-item .product-thumb .attribute_color .list-color a {
+	margin-bottom: 0;
+	float: none;
+}
+.product-item .product-thumb .attribute_color .list-color a {
+	border: 1px solid #ffffff;
+}
+.product-item .product-thumb .attribute_color .list-color a:hover::before, .product-item .product-thumb .attribute_color .list-color a.active::before {
+	left: 1px;
+	top: -1px;
+}
+.dungar-tabs-wrapp.style2 .custommenu-title-blog {
+	margin-bottom: 13px;
+}
+.dungar-tabs.style2 .tab-link li a {
+	margin: 0 15px;
+	font-weight: 400;
+	color: #555;
+	font-size: 16px;
+	line-height: 30px;
+}
+.dungar-tabs.style2 .tab-link li.active a {
+	border-bottom: none;
+	font-weight: 700;
+	color: #0a0a0a;
+}
+.dungar-tabs.style2 .tab-link li:after {
+	content: '';
+	width: 2px;
+	height: 30px;
+	background: #f1f1f1;
+	display: inline-block;
+	vertical-align: middle
+}
+.dungar-tabs.style2 .tab-link li:last-child:after {
+	display: none;
+}
+.dungar-product.style2 .product-list-owl .slick-dots {
+	overflow: hidden;
+	margin: 0 auto;
+	text-align: center
+}
+.dungar-product.style2 .product-list-owl .slick-dots li {
+	width: 72px;
+	height: 7px;
+	background: #f9f9f9;
+	margin: 0;
+	border-radius: 0;
+	float: none;
+}
+.dungar-product.style2 .product-list-owl .slick-dots .slick-active {
+	background: #666666;
+	
+}
+.dungar-product.style2 .product-list-owl .slick-dots li:first-child {
+	border-bottom-left-radius: 5px;
+	border-top-left-radius: 5px
+}
+/*slider home 02*/
+.fullwidth .slick-list {
+	margin: 0 !important;
+	padding: 0;
+}
+.fullwidth .slick-list .slick-slide {
+	padding: 0;
+}
+.slider-item.style4 .slider-inner {
+	background-image: url(../image/slider-thumb-full-1.jpg);
+	border-radius: 0;
+}
+.slider-item.style4 .slider-inner .slider-infor {
+	padding-bottom: 162px;
+	padding-top: 153px;
+	padding-left: 770px;
+	padding-right: 30px;
+	float: right;
+}
+.slider-item.style5 .slider-inner {
+	background-image: url(../image/slider-thumb-full-2.jpg);
+	border-radius: 0;
+}
+.slider-item.style5 .slider-inner .slider-infor {
+	padding-bottom: 154px;
+	padding-top: 119px;
+	padding-left: 735px;
+	padding-right: 30px;
+	float: right;
+}
+.slider-item.style5 .title-small {
+	margin-bottom: 3px;
+}
+.slider-item.style4 .title-big,
+.slider-item.style5 .title-big,
+.slider-item.style6 .title-big {
+	font-size: 40px;
+}
+.slider-inner .when-code {
+	font-size: 13px;
+	font-weight: 500;
+	text-transform: uppercase;
+	display: block;
+	margin-bottom: 23px;
+	position: relative;
+}
+.slider-inner .when-code .number-code {
+	color: #dd3232;
+	font-size: 18px;
+	font-weight: 700;
+}
+.slider-item.style6 .slider-inner {
+	background-image: url(../image/slider-thumb-full-3.jpg);
+}
+.slider-item.style6 .slider-inner .slider-infor {
+	padding-bottom: 162px;
+	padding-top: 153px;
+	padding-left: 770px;
+	padding-right: 30px;
+	float: right;
+}
+/*===========================
+==========HOME 03============
+=============================*/
+/*header 03*/
+.header.style3 .main-header {
+	padding: 33px 0;
+}
+.header.style3 .logo {
+	text-align: left;
+	line-height: 74px;
+}
+.header.style3 .header-control {
+	padding: 15px 0 16px;
+}
+.header.style3 .main-menu {
+	margin: 7px auto 0;
+}
+/*slider-banner*/
+.home-slider-banner {
+	margin-bottom: 38px;
+}
+.home-slider-banner .silider-wrapp, .home-slider-banner .banner-wrapp {
+	padding: 0 10px;
+}
+.home-slider-banner .silider-wrapp {
+	margin-bottom: 20px;
+}
+.slider-item.style7 .slider-inner {
+    /*https://www.caimei365.com/product-4032.html*/
+    background-image: url(https://img.caimei365.com/group1/M00/00/1A/rB-lGGDAfv-AdtvsAAE_PCpspiw478.jpg);
+}
+.slider-item.style7 .slider-inner .slider-infor {
+	padding-top: 185px;
+	padding-bottom: 200px;
+	padding-left: 50px;
+	padding-right: 400px;
+}
+.slider-item.style8 .slider-inner {
+    /*https://www.caimei365.com/product-6255.html*/
+	background-image: url(https://img.caimei365.com/group1/M00/00/20/rB-lF2DS1WuAeEiUAAD6DicJ7TE817.jpg);
+}
+.slider-item.style8 .slider-inner .slider-infor {
+	padding-top: 185px;
+	padding-bottom: 200px;
+	padding-left: 50px;
+	padding-right: 400px;
+}
+.slider-item.style9 .slider-inner {
+    /*https://www.caimei365.com/product-4730.html*/
+	background-image: url(https://img.caimei365.com/group1/M00/00/20/rB-lF2DS-8yALw_1AAFWTyV4zVY156.jpg);
+}
+.slider-item.style9 .slider-inner .slider-infor {
+	padding-top: 185px;
+	padding-bottom: 200px;
+	padding-left: 50px;
+	padding-right: 400px;
+}
+.slider-owl .slick-dots {
+	position: absolute;
+	bottom: 25px;
+	left: 50%;
+	z-index: 10;
+	-webkit-transform: translateX(-50%);
+	-moz-transform: translateX(-50%);
+	-ms-transform: translateX(-50%);
+	-o-transform: translateX(-50%);
+	transform: translateX(-50%);
+}
+.content_element .block-text {
+	font-size: 15px;
+	color: #222;
+	font-weight: 700;
+}
+.content_element .block-text .icon {
+	font-size: 22px;
+}
+.content_element .block-text span {
+	color: #666666;
+	text-decoration: underline;
+}
+/*===========================
+==========HOME 04============
+=============================*/
+/*header*/
+.home .header.style4 {
+	position: absolute;
+	top: 0;
+	left: 0;
+	right: 0;
+	background: transparent;
+	z-index: 1001;
+}
+.header.style4 .main-header {
+	padding: 30px 0;
+}
+.bar-open-menu {
+	display: inline-block;
+	padding: 11px 0;
+}
+.bar-open-menu span {
+	width: 20px;
+	display: block;
+	background: #fff;
+	height: 2px;
+	margin-bottom: 5px;
+}
+.bar-open-menu span:nth-child(2) {
+	width: 17px;
+}
+.header.style4 .block-minicart .shopcart-icon {
+	border-color: #363d44;
+	color: #eeeeee;
+}
+.header.style4 .block-minicart .shopcart-icon .count {
+	background-color: #333333;
+}
+.header.style4 .block-account > a {
+	color: #eeeeee;
+}
+.vertical-style .header-nav {
+	text-align: left;
+	position: fixed;
+	top: 0;
+	left: -500px;
+	width: 365px;
+	max-width: 100%;
+	min-height: 100vh;
+	background-color: #090909;
+	z-index: 1001;
+	-webkit-transition: left 0.4s;
+	-moz-transition: left 0.4s;
+	-o-transition: left 0.4s;
+	transition: left 0.4s;
+	padding: 35px 40px 30px 60px;
+}
+body.vertical-menu-open .header .header-nav {
+	left: 0;
+}
+.vertical-style .main-menu > li .toggle-submenu {
+	position: absolute;
+	right: 0px;
+	display: block;
+	width: 24px;
+	height: 24px;
+	z-index: 99;
+	cursor: pointer;
+	top: 18px;
+}
+.vertical-style .main-menu > li .toggle-submenu:before {
+	font-family: 'FontAwesome';
+	content: "\f107";
+	font-size: 15px;
+	color: #fff;
+	font-weight: normal;
+	vertical-align: top;
+	display: block;
+	text-align: center;
+}
+.vertical-style .main-menu > li > a {
+	padding: 18px 0;
+	display: block;
+	width: 100%;
+}
+.vertical-style .main-menu .submenu, .vertical-style .header-nav .header-language .dungar-submenu {
+	display: none;
+	position: static;
+	box-shadow: none;
+	background: none;
+	width: 100% !important;
+	opacity: 1;
+	visibility: visible;
+	padding: 0;
+	transition: none;
+	transform: none;
+	padding-left: 20px;
+}
+.vertical-style .main-menu .submenu > li > a {
+	padding-left: 0;
+}
+.vertical-style .main-menu > li {
+	width: 100%;
+}
+.vertical-menu-overlay {
+	position: fixed;
+	top: 0;
+	bottom: 0;
+	right: 0;
+	height: 100vh;
+	background: transparent;
+	z-index: 10;
+}
+body.vertical-menu-open .vertical-menu-overlay {
+	left: 0;
+}
+.vertical-style .header-nav .mCustomScrollbar {
+	height: calc(100vh - 148px);
+	overflow-x: hidden;
+}
+.vertical-style.main-menu > li.menu-item-has-children > a:after {
+	display: none;
+}
+.vertical-style .main-menu {
+	display: block;
+}
+.vertical-style .dungar-demolink .title {
+	color: #eeeeee;
+}
+.vertical-style .dungar-demolink {
+	margin-top: 0;
+	margin-bottom: 30px;
+}
+.vertical-style .header-nav .header-language .dungar-language {
+	margin: 0;
+	padding: 0;
+	margin-top: 30px;
+}
+.vertical-style .header-nav .header-language {
+	display: block;
+}
+.vertical-style.header .social-header .social-item {
+	color: #ffffff;
+}
+.vertical-style.header .header-copyright {
+	display: inline-block;
+	width: 100%;
+	font-size: 15px;
+	color: #888;
+}
+.vertical-style.header .header-copyright span {
+	color: #ffffff;
+}
+.vertical-style.header .social-header {
+	width: 100%;
+	margin-bottom: 25px;
+}
+.vertical-style .header-language .dungar-dropdown.open .dungar-submenu {
+	display: block;
+}
+.vertical-style .main-menu .submenu > li.menu-item-has-children > a:after {
+	display: none;
+}
+.vertical-style .main-menu .submenu > li > a {
+	background: transparent;
+	color: #9b9b9b;
+}
+.vertical-style .main-menu .submenu > li:hover > a {
+	color: #9b9b9b;
+	background-color: transparent;
+}
+.vertical-style .main-menu > li .submenu .toggle-submenu {
+	top: 10px;
+}
+.vertical-style .main-menu > li.menu-item-has-children > a:after {
+	display: none;
+}
+.vertical-style .clone-main-menu .mega-menu .menu-page-item:first-child .dungar-custommenu,
+.vertical-style .clone-main-menu .mega-menu .menu-page-item:nth-child(2) .dungar-custommenu,
+.vertical-style .clone-main-menu .mega-menu .menu-page-item:nth-child(3) .dungar-custommenu {
+	padding-left: 0;
+}
+.vertical-style .mega-menu .dungar-custommenu .widgettitle {
+	color: #eeeeee;
+}
+.vertical-style .mega-menu .dungar-custommenu ul li a {
+	color: #9b9b9b;
+}
+.vertical-style .header-nav .mCSB_inside > .mCSB_container {
+	margin-right: 15px;
+}
+.vertical-style .header-nav .header-language .dungar-submenu > li > a {
+	padding-left: 0;
+	background: transparent;
+	color: #888888 !important;
+}
+/*slider*/
+.slider-item.style22 .slider-inner .slider-infor,
+.slider-item.style23 .slider-inner .slider-infor {
+	padding-bottom: 193px;
+	padding-top: 222px;
+	padding-left: 760px;
+	padding-right: 15px;
+}
+.slider-item.style24 .slider-inner .slider-infor {
+	padding-bottom: 193px;
+	padding-top: 212px;
+	padding-left: 808px;
+	padding-right: 15px;
+}
+.slider-item.style24 .price {
+	margin-bottom: 45px;
+}
+.header-block-text-wrapp .header-block-text .icon {
+	font-size: 22px;
+}
+/*===========================
+==========HOME 05============
+=============================*/
+.header.style5 .bar-open-menu {
+	width: 44px;
+	height: 43px;
+	text-align: center;
+	line-height: 43px;
+	border: 1px solid #e9e9e9;
+	padding: 11px 10px;
+	float: left;
+	margin-right: 50px;
+}
+.header.style5 .bar-open-menu span {
+	background: #555555;
+}
+.header.style5 .logo {
+	text-align: left;
+}
+.header.style5 .block-search-block {
+	display: inline-block;
+}
+.header.style5 .form-search .form-content {
+	padding: 0;
+}
+.header.style5 .form-search .form-content .inner {
+	width: 251px;
+	position: relative;
+	border: 1px solid #f1f1f1;
+}
+.header.style5 .form-search .form-content .input {
+	width: 75%;
+	border: none;
+}
+.header.style5 .form-search .form-content .btn-search {
+	top: 0;
+	right: 0;
+	border: none;
+	line-height: 38px;
+	position: absolute;
+	width: 25%;
+	padding: 0;
+	height: 100%;
+	background: transparent;
+	color: #888;
+	font-size: 22px;
+	font-weight: normal;
+	margin: 0;
+}
+.header.style5 .header-language .dungar-language {
+	padding-top: 0;
+	margin-right: 38px;
+	margin-left: 62px;
+}
+.header.style5 .header-nav .header-language .dungar-language {
+	margin: 0;
+	padding: 0;
+	margin-top: 30px;
+}
+.header.style5 .header-nav .header-language {
+	display: none;
+}
+/*slider*/
+.fullwidth.style2 .slick-list .slick-slide {
+	padding: 0 15px;
+}
+.slider-item.style25 .slider-inner .slider-infor {
+	padding-bottom: 139px;
+	padding-top: 116px;
+	padding-left: 720px;
+	padding-right: 15px
+}
+.slider-item.style25 .price {
+	margin-bottom: 45px;
+}
+.slider-item.style26 .slider-inner .slider-infor {
+	padding-bottom: 139px;
+	padding-top: 115px;
+	padding-left: 720px;
+	padding-right: 15px
+}
+.slider-item .description {
+	font-size: 16px;
+	line-height: 22px;
+	color: #888;
+	margin-bottom: 30px;
+}
+.slider-item.style27 .slider-inner .slider-infor {
+	padding-bottom: 139px;
+	padding-top: 126px;
+	padding-left: 720px;
+	padding-right: 15px
+}
+/*newletter*/
+.dungar-newsletter.style3 {
+	overflow: hidden;
+	padding: 90px 0 80px;
+	background: #f3f3f3;
+	background-position: center;
+	background-repeat: no-repeat;
+	position: relative;
+	text-align: center;
+	background-attachment: fixed;
+	background-size: cover;
+}
+.dungar-newsletter.style3 .newsletter-form-wrap {
+	display: inline-block;
+	overflow: hidden;
+	margin-top: 20px;
+}
+.dungar-newsletter.style3 .title {
+	font-size: 26px;
+	font-weight: 700;
+	margin-bottom: 20px;
+	padding-bottom: 15px;
+	position: relative;
+	text-transform: uppercase;
+}
+.dungar-newsletter.style3 .title::before {
+	position: absolute;
+	content: '';
+	width: 70px;
+	border-bottom: 4px solid #dd3232;
+	bottom: 0;
+	left: 50%;
+	-webkit-transform: translateX(-50%);
+	-moz-transform: translateX(-50%);
+	-ms-transform: translateX(-50%);
+	-o-transform: translateX(-50%);
+	transform: translateX(-50%);
+	color: #fff;
+}
+.dungar-newsletter.style3 .subtitle {
+	margin-bottom: 15px;
+	font-size: 16px;
+}
+.dungar-newsletter.style3 .email-newsletter {
+	width: 313px;
+	border-color: #e9e9e9;
+	background: #fff;
+	color: #888;
+	margin-bottom: 10px;
+	border: none;
+	text-align: left;
+}
+.dungar-newsletter.style3 .submit-newsletter {
+	min-width: 139px;
+	margin-left: 5px;
+	background-color: #dd3232;
+	color: #ffffff;
+	vertical-align: top;
+	font-size: 14px;
+}
+/*===========================
+==========HOME 06============
+=============================*/
+.header-vertical {
+	padding-left: 375px;
+}
+.header.style6 {
+	padding: 80px 40px 80px 60px;
+	position: fixed;
+	top: 0;
+	left: 0;
+	z-index: 99;
+	background: #090909;
+	min-height: 100vh;
+	bottom: 0;
+	max-width: 100%
+}
+.header-vertical .header {
+	width: 375px;
+	float: left;
+}
+.header.style6.vertical-style .header-nav {
+	position: static;
+	padding: 0;
+	min-height: 0;
+}
+.header.style6 .header-nav .mCustomScrollbar {
+	height: calc(100vh - 405px);
+}
+.header.style6 .logo, .header.style6 .header-control {
+	text-align: left;
+}
+.header.style6 .logo {
+	padding-bottom: 50px;
+}
+.header.style6 .header-control {
+	margin-bottom: 35px;
+}
+.header.style6 .form-search .form-content {
+	padding: 0;
+}
+.header.style6 .form-search .form-content .inner {
+	position: relative;
+	border: 1px solid #353535;
+	margin-bottom: 85px;
+	width: 100%;
+}
+.header.style6 .form-search .form-content .input {
+	width: 75%;
+	border: none;
+}
+.header.style6 .form-search .form-content .btn-search {
+	position: absolute;
+	height: 100%;
+	background: transparent;
+	color: #888;
+	font-size: 20px;
+	font-weight: normal;
+	top: 0;
+	right: 0;
+	border: none;
+	padding: 0 15px;
+	width: auto;
+}
+.header.style6 .header-language {
+	margin-bottom: 35px;
+}
+.header.style6 .block-account > a, .header.style6 .block-minicart .shopcart-icon {
+	color: #ffffff;
+}
+.header.style6 .block-minicart .shopcart-icon {
+	border-color: #353535;
+}
+.header-vertical .block-header .dungar-submenu {
+	right: auto;
+	left: 0;
+}
+.header.style6 .block-minicart .shopcart-icon .count {
+	background-color: #444444;
+}
+/*banner*/
+.item-banner .banner-content.full-height {
+	text-align: center;
+}
+.item-banner .banner-content.full-height .title {
+	font-size: 30px;
+	letter-spacing: 0;
+	text-transform: uppercase;
+	line-height: 1.2;
+	margin-bottom: 20px;
+}
+.item-banner.style28 .banner-content {
+	padding-top: 50px;
+	padding-right: 30px;
+	padding-bottom: 705px;
+	padding-left: 30px;
+}
+.item-banner.style29 .banner-content {
+	padding-top: 705px;
+	padding-right: 30px;
+	padding-bottom: 50px;
+	padding-left: 30px;
+}
+.item-banner.style30 .banner-content {
+	padding-top: 50px;
+	padding-right: 30px;
+	padding-bottom: 705px;
+	padding-left: 30px;
+}
+.item-banner.style30 .title sup {
+	color: #888888;
+	font-size: 16px;
+	top: -0.5em;
+}
+.header-vertical .main-content::before,
+.header-vertical .main-content::after {
+	content: '';
+	display: table;
+}
+.header-vertical .main-content::after {
+	clear: both;
+}
+.header-vertical .main-content {
+	padding: 0;
+}
+.item-banner .banner-content.full-height .title span {
+	text-decoration: underline;
+}
+/*===========================
+==========HOME 07============
+=============================*/
+.header.style7 .logo {
+	text-align: left;
+}
+.header.style7 .form-search .form-content {
+	position: relative;
+	display: table;
+	width: 100%;
+	margin: 0 auto;
+	background-color: #fff;
+	max-width: 584px;
+	padding: 0;
+	border: 1px solid #eee;
+	height: 43px;
+	border-radius: 30px;
+}
+.header.style7 .form-search-width-category .category,
+.header.style7 .form-search-width-category .inner,
+.header.style7 .form-search-width-category .btn-search {
+	display: table-cell;
+	vertical-align: middle;
+}
+.header.style7 .form-search-width-category .category {
+	width: 154px;
+	position: absolute;
+	top: 2px;
+	right: 60px;
+}
+.header.style7 .form-search-width-category .category .chosen-container {
+	width: 154px !important;
+}
+.header.style7 .form-search-width-category .btn-search {
+	width: 60px;
+	font-size: 21px;
+	font-weight: normal;
+	color: #fff;
+	position: relative;
+	padding: 8px 0;
+	margin: 0;
+	border-radius: 0 30px 30px 0;
+}
+.form-search-width-category .chosen-container-single .chosen-single {
+	width: 100%;
+	border: none;
+	background-color: transparent;
+	padding: 0 20px;
+	line-height: 40px !important;
+	height: 40px !important;
+	border-left: 1px solid #e3e3e3;
+	border-radius: 0;
+}
+.form-search-width-category .chosen-container-single .chosen-single > span {
+	display: inline-block;
+	vertical-align: middle;
+	font-size: 16px;
+	color: #888;
+	margin-right: 20px;
+}
+.header.style7 .form-search .form-content .input {
+	border: none;
+	width: 100%;
+}
+.form-search-width-category .chosen-container-single .chosen-single div {
+	right: 20px;
+}
+.form-search-width-category .chosen-container-single .chosen-single div b::after {
+	margin-top: -8px;
+}
+.header.style7 .header-control .block-header {
+	vertical-align: top;
+}
+.header-nav-container {
+	background: #f3f3f3;
+}
+.header-nav-wapper {
+	display: table;
+	width: 100%;
+}
+.header-nav-wapper .vertical-wapper, .header-nav-wapper .header-nav {
+	display: table-cell;
+	vertical-align: middle;
+}
+.header-nav-wapper .vertical-wapper {
+	width: 270px;
+	position: relative;
+}
+.vertical-wapper .block-title {
+	font-size: 14px;
+	font-weight: 600;
+	text-transform: uppercase;
+	color: #ffffff;
+	height: 60px;
+	line-height: 28px;
+	cursor: pointer;
+	display: block;
+	padding: 15px 30px 14px;
+	letter-spacing: 0.05em;
+}
+.vertical-wapper .block-title .text {
+	display: inline-block;
+	vertical-align: top;
+}
+.verticalmenu-content {
+	background-color: #fff;
+	padding: 20px 0;
+	position: absolute;
+	top: 100%;
+	z-index: 9999999;
+	left: 0;
+	width: 100%;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transform: translateY(50px);
+	-moz-transform: translateY(50px);
+	-ms-transform: translateY(50px);
+	-o-transform: translateY(50px);
+	transform: translateY(50px);
+	transition: all 0.3s;
+	-webkit-box-shadow: 0 3px 18px 0 rgba(0, 0, 0, 0.1);
+	-moz-box-shadow: 0 3px 18px 0 rgba(0, 0, 0, 0.1);
+	box-shadow: 0 3px 18px 0 rgba(0, 0, 0, 0.1);
+}
+.verticalmenu-content.show-up {
+	opacity: 1;
+	-webkit-transform: translateY(0px);
+	-moz-transform: translateY(0px);
+	-ms-transform: translateY(0px);
+	-o-transform: translateY(0px);
+	transform: translateY(0px);
+	visibility: visible;
+}
+.vertical-wapper .icon-bar {
+	display: inline-block;
+	margin-right: 15px;
+	vertical-align: middle;
+	padding-top: 2px;
+}
+.vertical-wapper .icon-bar span {
+	width: 20px;
+	display: block;
+	background: #fff;
+	height: 2px;
+	margin-bottom: 5px;
+}
+.vertical-wapper .icon-bar span:nth-child(2) {
+	width: 16px;
+}
+.header.style7 .main-menu > li > a {
+	padding: 18px 20px;
+}
+.header-nav-wapper .vertical-wapper ~ .header-nav {
+	padding-left: 20px;
+}
+.vertical-menu {
+	padding: 0;
+	list-style: none;
+}
+.vertical-menu .menu-item {
+	list-style: none;
+	position: relative;
+}
+.vertical-menu .menu-item a {
+	line-height: 41px;
+	font-size: 16px;
+	color: #555555;
+	text-transform: capitalize;
+	position: relative;
+	display: block;
+	border-bottom: 1px solid #e6e6e6;
+	margin: 0 25px;
+}
+.vertical-menu .menu-item a:hover {
+	color: #dd3232;
+}
+.vertical-menu .menu-item:last-child a {
+	border: none;
+}
+.vertical-menu .submenu {
+	position: absolute;
+	z-index: 100;
+	background-color: #fff;
+	padding: 0;
+	left: 100%;
+	top: 0;
+	min-width: 100%;
+	-webkit-transition: opacity .5s;
+	-o-transition: opacity .5s;
+	-moz-transition: opacity .5s;
+	transition: opacity .5s;
+	opacity: 0;
+	display: block;
+	visibility: hidden;
+	list-style: none;
+}
+.vertical-menu .menu-item-has-children:hover > .submenu {
+	opacity: 1;
+	visibility: visible;
+	-webkit-box-shadow: 0 0 9px 0 rgba(0, 0, 0, 0.2);
+	-moz-box-shadow: 0 0 9px 0 rgba(0, 0, 0, 0.2);
+	box-shadow: 0 0 9px 0 rgba(0, 0, 0, 0.2);
+	-webkit-transform: translate(0, 0);
+	-moz-transform: translate(0, 0);
+	-o-transform: translate(0, 0);
+	-ms-transform: translate(0, 0);
+	transform: translate(0, 0)
+}
+.vertical-menu .menu-item-has-children > a::before {
+	content: '\f105';
+	font-family: 'FontAwesome';
+	position: absolute;
+	top: 0;
+	right: 0;
+	font-size: 15px;
+	color: #aaa;
+}
+/*slider*/
+.home-slider-7 .slider-item .slider-infor .button {
+	color: #000;
+}
+.slider-item.style19 .slider-inner .slider-infor {
+	padding-bottom: 169px;
+	padding-top: 136px;
+	padding-left: 800px;
+	padding-right: 15px;
+}
+.slider-item.style19 .price {
+	margin-bottom: 45px;
+}
+.slider-item.style20 .slider-inner .slider-infor {
+	padding-bottom: 154px;
+	padding-top: 136px;
+	padding-left: 800px;
+	padding-right: 15px;
+}
+.slider-item.style20 .description {
+	font-size: 13px;
+	font-weight: 700;
+	color: #888888;
+	text-transform: uppercase;
+	margin-bottom: 25px;
+}
+.slider-item.style20 .title-big {
+	font-weight: 900;
+	margin-bottom: 6px;
+}
+.slider-item.style20 .title-small {
+	color: #909090;
+}
+.slider-item.style21 .slider-inner .slider-infor {
+	padding-bottom: 199px;
+	padding-top: 179px;
+	padding-left: 755px;
+	padding-right: 38px;
+	text-align: center;
+}
+.tabs-sidebar-wrapp .product-deal-slider {
+	border-width: 2px;
+	padding: 29px 15px 40px;
+}
+.tabs-sidebar-wrapp .product-deal-slider .title {
+	border: none;
+}
+.tabs-sidebar-wrapp .product-deal-slider .sub-title {
+	margin-bottom: 25px;
+}
+.tabs-sidebar-wrapp .product-item.style-4 .product-thumb {
+	margin-bottom: 25px;
+}
+.tabs-sidebar-wrapp .dungar-tabs .tab-head {
+	margin-bottom: 40px;
+}
+.tabs-sidebar-wrapp .dungar-tabs.default {
+	margin-top: 25px;
+}
+.dungar-iconbox-wrapp.layout2 .dungar-iconbox.default {
+	margin-top: 30px;
+	padding-top: 34px;
+	padding-bottom: 34px;
+	background-color: #070707;
+	border: none;
+}
+.product-item.style-3 .product-inner {
+	overflow: hidden;
+	padding-bottom: 0;
+}
+.product-item.style-3 .product-top {
+	display: none;
+}
+.product-item.style-3 .product-thumb {
+	float: left;
+	margin-right: 20px;
+	max-width: 140px;
+	margin-bottom: 0;
+}
+.product-item.style-3 .product-info {
+	overflow: hidden;
+	text-align: left;
+	opacity: 1;
+}
+.product-item.style-3 .group-buttons .button {
+	display: inline-block;
+	vertical-align: middle;
+	padding: 5px 15px;
+	min-width: 103px;
+	background-color: #dd3232;
+	font-size: 13px;
+	border-radius: 30px;
+}
+.product-item.style-3 .group-buttons .button:hover {
+	background-color: #000;
+}
+.product-item.style-3 .product-name a {
+	overflow: hidden;
+	display: block;
+	text-overflow: ellipsis;
+	white-space: nowrap;
+	margin-top: 12px;
+	font-size: 16px;
+}
+.product-item.style-3 .price {
+	margin-bottom: 10px;
+}
+.product-item.style-3 .quantity {
+	margin-bottom: 0;
+	display: none;
+}
+.dungar-blog-item .blog-meta .post-date {
+	margin: 0;
+	padding: 0;
+}
+.dungar-blog-item .post-thumb .category-blog {
+	margin: 0 70px 0 0;
+	position: absolute;
+	top: 20px;
+	left: 20px;
+	display: none;
+}
+.category-blog .list-category {
+	margin: 0;
+	padding: 0;
+}
+.list-category .category-item {
+	list-style: none;
+	display: inline-block;
+	padding: 0 10px;
+	background: #dd3232;
+	min-width: 77px;
+	height: 26px;
+	line-height: 26px;
+	text-align: center;
+	border-radius: 26px;
+}
+.list-category .category-item a {
+	color: #ffffff;
+}
+/*===========================
+==========HOME 08============
+=============================*/
+.header.style8 .main-header {
+	padding: 10px 0;
+}
+.header.style8 .logo {
+	line-height: 74px;
+}
+.header.style8 .header-control {
+	padding-top: 16px;
+	padding-bottom: 15px;
+}
+.home-slider-8 .slider-item .slider-infor .button:hover {
+	color: #ffffff;
+}
+/*silider*/
+.slider-item.style16 .slider-inner .slider-infor, .slider-item.style17 .slider-inner .slider-infor, .slider-item.style18 .slider-inner .slider-infor {
+	padding-bottom: 60px;
+	padding-top: 305px;
+	padding-left: 40px;
+	padding-right: 15px;
+}
+/*product*/
+/*.dungar-product.layout1 .product-item .price {*/
+/*color: #fff;*/
+/*}*/
+/*.dungar-product.layout1 .product-item .product-name a {*/
+/*color: #fff;*/
+/*}*/
+.dungar-product.layout1 {
+	background: #f3f3f3;
+	padding: 70px 0 35px;
+}
+.dungar-product.layout1 .container-wapper {
+	position: relative;
+}
+.dungar-product.layout1 .head {
+	width: 270px;
+	margin-right: 30px;
+	text-align: center;
+	float: left;
+	padding-top: 100px;
+}
+.dungar-product.layout1 .head .title {
+	font-size: 26px;
+	font-weight: 600;
+	margin-bottom: 20px;
+	position: relative;
+}
+.dungar-product.layout1 .head .title::before {
+	position: absolute;
+	content: '';
+	width: 40px;
+	top: auto;
+	bottom: -10px;
+	right: 50%;
+	-webkit-transform: translateX(50%);
+	-moz-transform: translateX(50%);
+	-ms-transform: translateX(50%);
+	-o-transform: translateX(50%);
+	transform: translateX(50%);
+	border-bottom: 2px solid #dd3232;
+}
+.dungar-product.layout1 .head .subtitle {
+	font-size: 15px;
+	line-height: 28px;
+}
+.dungar-product.layout1 .product-list-owl {
+	width: calc(100% - 300px);
+	display: inline-block;
+}
+.slick-slider.nav-center-left {
+	position: static;
+}
+.slick-slider.nav-center-left .slick-arrow {
+	display: block;
+	left: 145px;
+	width: 51px;
+	height: 51px;
+	text-align: center;
+	line-height: 47px;
+	top: 52%;
+	color: #fff;
+	border-radius: 50%;
+}
+.slick-slider.nav-center-left .slick-arrow:first-child {
+	left: 70px;
+}
+.slick-slider.nav-center-left .slick-arrow:hover {
+	color: #eeeeee;
+}
+/*dungar-testimonials*/
+.dungar-testimonials.default {
+	margin-bottom: 30px;
+	background: #f3f3f3;
+	background-position: center;
+	background-repeat: no-repeat;
+	background-size: cover;
+	border-radius: 0;
+}
+.dungar-testimonials.default .testimonial-item {
+	overflow: hidden;
+	padding: 62px 60px 62px 60px;
+}
+.testimonial-item .image {
+	display: inline-block;
+	float: left;
+	border-radius: 50%;
+	overflow: hidden;
+	margin-top: 9px;
+	border: 3px solid #dd3232;
+}
+.testimonial-item .info {
+	display: block;
+	overflow: hidden;
+	padding: 10px 10px 10px 50px;
+	position: relative;
+}
+.testimonial-item .info .text p {
+	margin-bottom: 0;
+}
+.testimonial-item .info .text {
+	font-size: 16px;
+	line-height: 26px;
+	margin-top: 15px;
+	font-style: italic;
+}
+.testimonial-item .info .name {
+	font-size: 18px;
+	margin-bottom: 0;
+	text-transform: capitalize;
+	font-weight: 600;
+}
+.testimonial-item .info .name span {
+	display: block;
+	font-size: 13px;
+	color: #dd3232;
+}
+.dungar-testimonials.default .owl-slick .slick-list {
+	margin: 0 !important;
+	padding: 0 !important;
+}
+.dungar-testimonials.default .slick-dots {
+	position: absolute;
+	bottom: 18px;
+	left: 50%;
+	transform: translateX(-50%);
+}
+/*instagram*/
+.instagram-wrapp {
+	border-top: 2px solid #eee;
+	text-align: center;
+}
+.instagram-wrapp .custommenu-title-blog {
+	margin-top: 60px;
+	position: relative;
+}
+.instagram-wrapp .custommenu-title-blog i {
+	display: block;
+	font-size: 60px;
+	color: #dd3232;
+	font-weight: normal;
+}
+.dungar-instagram {
+	overflow: hidden;
+}
+.dungar-instagram .instagram {
+	padding: 0;
+	margin: 0;
+}
+.instagram .item-instagram {
+	position: relative;
+	padding: 0;
+}
+.instagram .item-instagram img {
+	width: 100%;
+}
+.instagram .item-instagram .text {
+	position: absolute;
+	top: 50%;
+	transform: translateY(-50%);
+	left: 0;
+	right: 0;
+	text-align: center;
+	z-index: 5;
+	font-size: 16px;
+	color: #ffffff;
+	font-weight: normal;
+	opacity: 0;
+	visibility: hidden;
+}
+.instagram .item-instagram:hover .text {
+	opacity: 1;
+	visibility: visible;
+}
+.instagram .item-instagram::after {
+	position: absolute;
+	top: 0px;
+	content: '';
+	left: 0px;
+	right: 0px;
+	bottom: 0px;
+	background-color: rgba(0, 0, 0, 0.6);
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transform: scale(0.3);
+	-moz-transform: scale(0.3);
+	-ms-transform: scale(0.3);
+	-o-transform: scale(0.3);
+	transform: scale(0.3);
+	-webkit-transition: all 0.4s ease 0s;
+	-moz-transition: all 0.4s ease 0s;
+	-o-transition: all 0.4s ease 0s;
+	transition: all 0.4s ease 0s;
+}
+.instagram .item-instagram:hover::after, .instagram .item-instagram.active::after {
+	opacity: 1;
+	visibility: visible;
+	-webkit-transform: scale(1);
+	-moz-transform: scale(1);
+	-ms-transform: scale(1);
+	-o-transform: scale(1);
+	transform: scale(1);
+}
+.instagram .item-instagram .text .icon {
+	font-size: 36px;
+	color: #f7f7f7;
+	display: block;
+	margin-bottom: 8px;
+}
+.instagram .item-instagram .text a {
+	text-decoration: underline;
+}
+.dungar-button.button {
+	background-color: #111;
+	border: 1px solid #111111;
+	margin-top: 40px;
+}
+.brand-slider-wrapp.layout1 {
+	background-color: #030303;
+}
+/*===========================
+==========HOME 10============
+=============================*/
+.header.style10 .block-minicart .shopcart-icon, .header.style9 .block-minicart .shopcart-icon, .header.style8 .block-minicart .shopcart-icon,
+.header.style7 .block-minicart .shopcart-icon {
+	font-size: 0;
+	border: none;
+	border-radius: 0;
+	width: auto;
+}
+.header.style10 .block-minicart .shopcart-icon:before, .header.style9 .block-minicart .shopcart-icon:before, .header.style8 .block-minicart .shopcart-icon:before,
+.header.style7 .block-minicart .shopcart-icon:before {
+	content: "\f137";
+	font-family: Flaticon;
+	font-size: 26px;
+	font-weight: normal;
+	position: relative;
+	top: -5px;
+}
+.header.style10 .block-minicart .shopcart-icon .count, .header.style9 .block-minicart .shopcart-icon .count, .header.style8 .block-minicart .shopcart-icon .count,
+.header.style7 .block-minicart .shopcart-icon .count {
+	top: -11px;
+	right: 0;
+	font-size: 12px;
+}
+.header.style10 .header-control .block-header, .header.style9 .header-control .block-header, .header.style8 .header-control .block-header,
+.header.style7 .header-control .block-header {
+	padding-left: 15px;
+}
+.slider-item.style10 .slider-inner .slider-infor, .slider-item.style11 .slider-inner .slider-infor, .slider-item.style12 .slider-inner .slider-infor {
+	padding-bottom: 130px;
+	padding-top: 133px;
+	padding-left: 494px;
+	padding-right: 70px;
+}
+.slider-item.style10 .title-big, .slider-item.style11 .title-big, .slider-item.style12 .title-big {
+	letter-spacing: -0.05em;
+	font-size: 32px;
+	margin-bottom: 16px;
+}
+.slider-item.style10 .title-small, .slider-item.style11 .title-small, .slider-item.style12 .title-small {
+	margin-bottom: 6px;
+}
+.slider-product.style6 .slick-slider > .slick-arrow {
+	width: 51px;
+	height: 51px;
+	text-align: center;
+	line-height: 48px;
+	border: 1px solid #eeeeee;
+	color: #aaaaaa;
+	right: -20px;
+	z-index: 33;
+	background: #ffffff;
+	
+	opacity: 0;
+	visibility: hidden;
+}
+.slider-product.style6:hover .slick-slider > .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+}
+.slider-product.style6 .slick-slider > .slick-arrow:first-child {
+	left: -20px;
+}
+.home-slider-10 .slider-item .slider-infor .button.bgroud-style-2, .home-slider-10 .slider-item .slider-infor .button:hover {
+	color: #ffffff
+}
+.slider-product.style6 .product-thumb .slick-slider > .slick-arrow:first-child {
+	left: 0;
+}
+.product-item.style-6 .product-inner {
+	border-width: 4px;
+	padding: 15px;
+}
+.product-item.style-6 .product-info {
+	opacity: 1;
+}
+.product-item.style-6 .loop-form-add-to-cart {
+	opacity: 1;
+	visibility: visible;
+	position: static;
+	padding: 0;
+	margin-top: 15px;
+}
+.product-item.style-6.product-type-variable .product-inner {
+	padding-bottom: 0;
+}
+.product-item.style-6 .product-thumb .variations {
+	position: static;
+	opacity: 1;
+	visibility: visible;
+	margin-top: 1px;
+}
+.product-item.style-6 .loop-form-add-to-cart .button {
+	width: 100%;
+	background-color: #75905e;
+	border-color: #75905e;
+	color: #ffffff;
+}
+.product-item.style-6 .loop-form-add-to-cart .button:hover {
+	opacity: 0.8;
+}
+.product-item.style-6 .product-top {
+	position: absolute;
+	left: 15px;
+	right: 15px;
+	z-index: 999;
+}
+.product-item.style-6:hover .product-inner {
+	box-shadow: none;
+}
+.product-item.style-4 .product-inner {
+	padding: 0;
+	border: 0;
+}
+.product-item.style-4:hover .product-inner {
+	box-shadow: none;
+}
+.product-item.style-4 .product-info {
+	opacity: 1;
+}
+.product-deal-slider {
+	border: 4px solid #eeeeee;
+	padding: 19px 15px 25px;
+}
+.product-deal-slider .title {
+	font-size: 26px;
+	color: #0a0a0a;
+	text-align: center;
+	font-weight: 700;
+	padding-bottom: 2px;
+	border-bottom: 3px solid #75905e;
+	margin: 0 25px 3px;
+}
+.product-deal-slider .sub-title {
+	color: #888888;
+	text-align: center;
+	margin-bottom: 15px;
+	font-size: 15px;
+}
+.product-item.style-4 .product-thumb {
+	margin-bottom: 10px;
+}
+.product-item.style-4 .group-info {
+	overflow: hidden;
+	display: inline-block;
+	margin-bottom: 5px
+}
+.product-item.style-4 .price {
+	display: inline-block;
+	font-size: 24px;
+	font-weight: 700;
+	margin-right: 10px;
+}
+.product-item.style-4 .stars-rating {
+	display: inline-block;
+}
+.product-item.style-4 .group-buttons .button, .product-item.style-4 .group-buttons .added_to_cart {
+	width: 100%;
+	margin-top: 20px;
+	font-size: 14px;
+	color: #ffffff;
+}
+.product-item.style-4 .group-buttons .button:hover, .product-item.style-4 .group-buttons .added_to_cart:hover {
+	opacity: 0.8;
+}
+.product-item.style-4 {
+	margin-bottom: 0;
+}
+.weekly-featured-wrapp .custommenu-title-blog {
+	margin-top: -9px;
+}
+.dungar-product .product-list-owl.nav-botton-center {
+	padding-bottom: 51px
+}
+.slider-product .slick-slider.nav-botton-center > .slick-arrow {
+	right: 43.5%;
+	bottom: 0px;
+	opacity: 1;
+	visibility: visible;
+	font-size: 30px;
+}
+.slider-product .slick-slider.nav-botton-center > .slick-arrow:hover {
+	color: #0a0a0a;
+}
+.slider-product .slick-slider.nav-botton-center > .slick-arrow:first-child {
+	left: 43.5%;
+}
+.sevice-item {
+	position: relative;
+}
+.sevice-item .quick-install {
+	background: rgba(0, 0, 0, 0.3) url(https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/images/play.png) no-repeat scroll 24px 20px;
+	border-radius: 50%;
+	cursor: pointer;
+	display: inline-block;
+	height: 64px;
+	left: 50%;
+	line-height: 64px;
+	border: 1px solid rgba(255, 255, 255, 0.3);
+	position: absolute;
+	text-align: center;
+	top: 50%;
+	width: 64px;
+	-webkit-transform: translateX(-50%) translateY(-50%);
+	-ms-transform: translateX(-50%) translateY(-50%);
+	-o-transform: translateX(-50%) translateY(-50%);
+	transform: translateX(-50%) translateY(-50%);
+	-webkit-transition: all .6s ease-in-out;
+	-moz-transition: all .6s ease-in-out;
+	-ms-transition: all .6s ease-in-out;
+	-o-transition: all .6s ease-in-out;
+	transition: all .6s ease-in-out;
+}
+.sevice-item .quick-install:hover {
+	-webkit-transform: translateX(-50%) translateY(-50%) scale(0.9);
+	-ms-transform: translateX(-50%) translateY(-50%) scale(0.9);
+	-o-transform: translateX(-50%) translateY(-50%) scale(0.9);
+	transform: translateX(-50%) translateY(-50%) scale(0.9);
+}
+.loadmore-wapper {
+	text-align: center;
+	margin-top: 10px;
+	margin-bottom: 50px;
+}
+.loadmore-wapper a {
+	display: inline-block;
+	min-width: 161px;
+	height: 42px;
+	padding: 8px 10px;
+	border: 1px solid #eeeeee;
+	color: #0a0a0a;
+	font-weight: 700;
+	text-align: center;
+	font-size: 14px;
+	text-transform: uppercase;
+}
+.brand-slider-wrapp .owl-slick .slick-arrow {
+	width: 51px;
+	height: 51px;
+	line-height: 45px;
+	font-size: 30px;
+	position: absolute;
+	top: 50%;
+	transform: translateY(-50%);
+	border: 1px solid #F1F1F1;
+	z-index: 9;
+	background-color: #fff;
+	text-align: center;
+	opacity: 0;
+	visibility: hidden;
+}
+@media (min-width: 1280px) {
+	.brand-slider-wrapp .owl-slick .slick-arrow:first-child {
+		left: -41px;
+	}
+	.brand-slider-wrapp .owl-slick .slick-arrow {
+		right: -41px;
+	}
+}
+.brand-item img {
+	border: 1px solid transparent;
+	margin: 0 auto;
+}
+.brand-slider-wrapp:hover .owl-slick .slick-arrow {
+	opacity: 1;
+	visibility: visible;
+}
+/*===========================
+==========HOME 09============
+=============================*/
+.header.style9 .logo {
+	text-align: left;
+}
+.header.style9 .bar-open-menu {
+	padding: 12px 10px;
+	border: 1px solid #e9e9e9;
+	margin: 0 auto;
+	display: block;
+	width: 44px;
+}
+.bar-open-menu span {
+	width: 20px;
+	display: block;
+	background: #fff;
+	height: 2px;
+	margin-bottom: 5px;
+}
+.header.style9 .bar-open-menu span {
+	background: #555555;
+}
+.bar-open-menu span:last-child {
+	margin-bottom: 0;
+}
+.bar-open-menu span:nth-child(2) {
+	width: 17px;
+}
+.header.style9 .main-header {
+	position: relative;
+}
+.header.style9 .header-nav {
+	position: absolute;
+	top: 100%;
+	background: #fff;
+	z-index: 99;
+	width: 100%;
+	border-top: 1px solid #f1f1f1;
+	opacity: 0;
+	visibility: hidden;
+	-webkit-transition: .35s;
+	-o-transition: .35s;
+	transition: .35s;
+	-webkit-transform: translateY(-20px);
+	-moz-transform: translateY(-20px);
+	-ms-transform: translateY(-20px);
+	-o-transform: translateY(-20px);
+	transform: translateY(-20px);
+}
+.header.style9 .header-nav.show-menu {
+	-webkit-transform: translateY(0px);
+	-moz-transform: translateY(0px);
+	-ms-transform: translateY(0px);
+	-o-transform: translateY(0px);
+	transform: translateY(0px);
+	opacity: 1;
+	visibility: visible;
+	z-index: 100;
+}
+.header.style9 .bar-open-menu.active:before {
+	display: inline-block;
+	position: absolute;
+	content: url(https://www.17sucai.com/preview/776298/2021-07-27/dungar/assets/images/hover-menu.png);
+	width: 100%;
+	top: 0;
+	border: 0;
+	text-align: center;
+	left: 0;
+	line-height: 44px;
+}
+.header.style9 .bar-open-menu.active span {
+	width: 0;
+}
+.slider-item.style13 .slider-inner .slider-infor {
+	padding-bottom: 165px;
+	padding-top: 188px;
+	padding-left: 700px;
+	padding-right: 70px;
+}
+.slider-item.style13 .price, .slider-item.style14 .price {
+	font-size: 13px;
+	text-transform: uppercase;
+	font-weight: 600;
+	margin-bottom: 45px;
+}
+.slider-item.style13 .price .number-price, .slider-item.style14 .price .number-price {
+	font-weight: 400
+}
+.slider-item.style14 .slider-inner .slider-infor {
+	padding-bottom: 165px;
+	padding-top: 145px;
+	padding-left: 700px;
+	padding-right: 70px;
+}
+.slider-item.style14 .title-big {
+	font-weight: 900;
+}
+.slider-item.style15 .slider-inner .slider-infor {
+	padding-bottom: 167px;
+	padding-top: 158px;
+	padding-left: 700px;
+	padding-right: 170px
+}
+.slider-item.style15 .title-big {
+	font-size: 48px;
+	line-height: 48px;
+	letter-spacing: -0.05em;
+	margin-bottom: 6px;
+}
+.home-slider-9 .slider-item .slider-infor .button.bgroud-style-2, .home-slider-9 .slider-item .slider-infor .button:hover {
+	color: #ffffff;
+}
+.product-item.style-5 {
+	margin-bottom: 0;
+}
+.product-item.style-5 .product-thumb {
+	margin-bottom: 10px;
+}
+.product-item .thumb-inner {
+	position: relative;
+}
+.product-item.style-5 .thumb-inner {
+	margin-bottom: 20px;
+}
+.product-item.style-5 .product-thumb img {
+	margin: 0 auto;
+}
+/*pin map*/
+.group-pinap {
+	display: none;
+}
+.group-pinap .pinmap-buttom {
+	position: absolute;
+	width: 30px;
+	height: 30px;
+	border-radius: 100%;
+	text-align: center;
+	line-height: 30px;
+}
+.group-pinap .pinmap-buttom .icon {
+	font-size: 15px;
+	color: #ffffff;
+}
+.slider-item.style13 .pinmap-buttom.btn-pinmap-1 {
+	top: 230px;
+	left: 475px;
+}
+.slider-item.style13 .pinmap-buttom.btn-pinmap-2 {
+	top: 365px;
+	left: 330px;
+}
+.slider-item.style14 .pinmap-buttom.btn-pinmap-1 {
+	top: 270px;
+	left: 500px;
+}
+.slider-item.style14 .pinmap-buttom.btn-pinmap-2 {
+	top: 400px;
+	left: 515px;
+}
+.slider-item.style15 .pinmap-buttom.btn-pinmap-1 {
+	top: 290px;
+	left: 340px;
+}
+.popup-pinmap {
+	position: absolute;
+	top: 50%;
+	-webkit-transform: translateY(-50%);
+	-ms-transform: translateY(-50%);
+	-o-transform: translateY(-50%);
+	transform: translateY(-50%);
+	opacity: 0;
+	visibility: hidden;
+}
+.popup-pinmap.left {
+	right: calc(100% + 20px)
+}
+.popup-pinmap.right {
+	left: calc(100% + 20px);
+}
+.pinmap-popup-main {
+	min-width: 279px;
+	background: #ffffff;
+	text-align: center;
+	padding: 20px;
+}
+.pinmap-popup-main .product-thumbnail {
+	margin-bottom: 15px;
+}
+.pinmap-popup-main .product-thumbnail img {
+	margin: 0 auto;
+}
+.pinmap-popup-main .product-name-pinmap {
+	font-size: 16px;
+	color: #333333;
+	font-weight: 700;
+	margin-bottom: 0;
+}
+.pinmap-popup-main .pinmap-price {
+	font-size: 16px;
+	color: #111111;
+	text-decoration: none;
+	font-weight: 600;
+}
+.pinmap-price del {
+	font-weight: 300;
+	color: #888888;
+	margin-right: 10px;
+}
+.pinmap-price ins {
+	text-decoration: none;
+}
+.popup-pinmap::before {
+	content: '';
+	position: absolute;
+	border: 8px solid transparent;
+	opacity: 0;
+	visibility: hidden;
+}
+.popup-pinmap.left:before {
+	border-left: 8px solid #fff;
+	right: -16px;
+}
+.popup-pinmap.right:before {
+	border-right: 8px solid #fff;
+	left: -16px;
+}
+.popup-pinmap.left:before, .popup-pinmap.right:before {
+	top: calc(50% - 8px);
+}
+.pinmap-popup-buttons .button {
+	width: 100%;
+	border: 1px solid #e9e9e9;
+	color: #0a0a0a;
+	font-size: 14px;
+	height: 43px;
+	padding-top: 0;
+	padding-bottom: 0;
+	line-height: 39px;
+	
+	background: transparent;
+}
+.group-pinap .pinmap-buttom:hover .popup-pinmap, .group-pinap .pinmap-buttom:hover .popup-pinmap::before {
+	opacity: 1;
+	visibility: visible;
+}
+.popup-pinmap::after {
+	content: '';
+	position: absolute;
+	width: 20px;
+	height: 100%;
+	display: inline-block;
+	top: 0;
+}
+.popup-pinmap.left::after {
+	right: -20px;
+}
+.popup-pinmap.right::after {
+	left: -20px;
+}
+/*----------------------*/
+/*       banner         */
+/* -------------------- */
+/*banner shop*/
+.banner-shop {
+	margin-bottom: 30px;
+}
+.item-banner .inner {
+	background-position: center;
+	background-repeat: no-repeat;
+	border-radius: 0;
+	position: relative;
+	background-color: #f3f3f3;
+}
+.full-width .item-banner.style1 .inner {
+	background-image: url(../image/banner-01_full_width.jpg);
+}
+.item-banner.style1 .banner-content {
+	padding-left: 150px;
+	padding-right: 30px;;
+	padding-top: 65px;
+	padding-bottom: 70px;
+}
+.item-banner .dungar-subtitle {
+	color: #dd3232;
+	font-size: 14px;
+	font-weight: 600;
+	padding: 0 0 5px;
+	margin-bottom: 0;
+	text-transform: uppercase;
+	font-family: 'Jost';
+}
+.item-banner.style1 .dungar-subtitle {
+	margin-bottom: 9px;
+}
+.item-banner .title {
+	font-weight: 500;
+	line-height: 1;
+	text-transform: capitalize;
+}
+.item-banner.style1 .inner .title {
+	font-size: 40px;
+	margin-bottom: 8px;
+}
+.item-banner .when-code {
+	font-size: 13px;
+	text-transform: uppercase;
+	color: #888888;
+	margin-bottom: 22px;
+	display: block;
+	font-weight: 700;
+}
+.item-banner .when-code .code {
+	font-size: 18px;
+	color: #dd3232;
+	position: relative;
+}
+.item-banner .button {
+	color: #000;
+	background-color: transparent;
+	padding-right: 0;
+	padding-left: 0;
+	padding-top: 7px;
+	padding-bottom: 7px;
+	margin-right: 5px;
+	border-radius: 0;
+	position: relative;
+	overflow: hidden;
+	font-size: 16px;
+}
+.item-banner .button::before {
+	content: '';
+	position: absolute;
+	left: 0;
+	bottom: 0;
+	width: 100%;
+	border-bottom: 2px solid;
+}
+.item-banner .banner-content > .button:last-child {
+	margin-right: 0;
+}
+.item-banner .button:hover {
+	color: #dd3232;
+	background: none;
+}
+.item-banner .button:hover::before {
+	-webkit-animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+	animation: underline-link .8s cubic-bezier(.58, .3, .005, 1) 0s 1;
+}
+.full-width .item-banner.style2 .inner {
+	background-image: url(../image/banner-02_full_width.jpg);
+}
+.item-banner.style2 .banner-content {
+	padding-left: 130px;
+	padding-right: 30px;;
+	padding-top: 78px;
+	padding-bottom: 78px;
+}
+.item-banner .description {
+	font-size: 16px;
+	line-height: 22px;
+	margin-bottom: 17px;
+	display: block;
+}
+.item-banner .hot-price {
+	font-size: 16px;
+	text-transform: capitalize;
+	display: block;
+}
+.item-banner .hot-price .price-number {
+	font-size: 30px;
+	letter-spacing: -0.05em;
+	color: #dd3232;
+	text-transform: uppercase;
+	font-weight: 700;
+	position: relative;
+}
+.item-banner.style2 .hot-price {
+	margin-bottom: 25px;
+}
+.item-banner.style2 .title {
+	font-size: 30px;
+	margin-bottom: 5px;
+	font-weight: 600;
+	line-height: 32px;
+}
+.banner-slider .slick-dots {
+	position: absolute;
+	bottom: 25px;
+	left: 50%;
+	z-index: 10;
+	-webkit-transform: translateX(-50%);
+	-moz-transform: translateX(-50%);
+	-ms-transform: translateX(-50%);
+	-o-transform: translateX(-50%);
+	transform: translateX(-50%);
+}
+/*banner home 01*/
+.item-banner.style3 .banner-content {
+	padding-top: 57px;
+	padding-right: 70px;
+	padding-bottom: 58px;
+	padding-left: 480px;
+	margin-bottom: 30px;
+}
+.item-banner.style3 .title {
+	font-size: 30px;
+	line-height: 32px;
+	margin-bottom: 7px;
+	font-weight: 700;
+}
+.item-banner.style3 .dungar-subtitle {
+	margin-bottom: 7px;
+}
+.item-banner.style3 .description {
+	margin-bottom: 25px;
+}
+/*banner home 02*/
+.item-banner.style4 .inner {
+	background-image: url(https://img.caimei365.com/group1/M00/00/1A/rB-lGGDAfv-ATjKVAAIY28KJLgo901.jpg);
+	background-size: cover;
+}
+.item-banner.style4 .banner-content {
+	padding-left: 40px;
+	padding-bottom: 60px;
+	padding-right: 300px;
+	padding-top: 57px;
+	margin-bottom: 30px;
+}
+.item-banner.style4 .title {
+	margin-bottom: 12px;
+	font-size: 26px;
+	line-height: 32px;
+}
+.item-banner.style4 .description {
+	margin-bottom: 28px;
+	max-width: 195px;
+}
+.item-banner.style5 .inner {
+	background-image: url(https://img.caimei365.com/group1/M00/00/1A/rB-lGGDAj0CAFdBsAAG8fuVaU00947.jpg);
+	background-size: cover;
+}
+.item-banner.style5 .banner-content {
+	padding-left: 40px;
+	padding-bottom: 60px;
+	padding-right: 300px;
+	padding-top: 60px;
+	margin-bottom: 30px;
+}
+.item-banner.style5 .title {
+	margin-bottom: 12px;
+	font-size: 26px;
+	line-height: 32px;
+}
+.item-banner.style5 .description {
+	margin-bottom: 28px;
+	max-width: 195px;
+}
+.item-banner.style6 .inner {
+	background-image: url(https://img.caimei365.com/group1/M00/00/1E/rB-lGGDS3juAJJflAAFgdY6l-ZQ231.jpg);
+	border-radius: 0;
+}
+.item-banner.style6 .banner-content {
+	padding-left: 0;
+	padding-bottom: 180px;
+	padding-right: 0;
+	padding-top: 180px;
+}
+.item-banner.style6 .title {
+	font-size: 44px;
+	margin-bottom: 20px;
+	line-height: 1.2;
+}
+/*banner home 03*/
+.item-banner.style7 .inner {
+	background-image: url(https://img.caimei365.com/group1/M00/00/1D/rB-lGGDMN2SAayNVAAG7PaAEV0s951.jpg);
+}
+.item-banner.style7 .banner-content {
+	padding-top: 59px;
+	padding-right: 165px;
+	padding-bottom: 60px;
+	padding-left: 30px;
+	margin-bottom: 20px;
+}
+.item-banner.style7 .title, .item-banner.style8 .title {
+	font-size: 26px;
+	line-height: 32px;
+}
+.item-banner.style7 .description {
+	margin-bottom: 15px;
+	max-width: 185px;
+}
+.item-banner.style8 .inner {
+    /*https://www.caimei365.com/product-3904.html*/
+	background-image: url(https://img.caimei365.com/group1/M00/00/20/rB-lF2DUKmKAQrKvAAFXTwRwsUk495.jpg);
+}
+.item-banner.style8 .banner-content {
+	padding-top: 64px;
+	padding-right: 166px;
+	padding-bottom: 73px;
+	padding-left: 30px;
+	margin-bottom: 20px;
+}
+.item-banner.style8 .description {
+	margin-bottom: 13px;
+	max-width: 185px;
+}
+.item-banner .price {
+	font-size: 23px;
+	font-weight: 600;
+	line-height: 28px;
+	color: #dd3232;
+	position: relative;
+}
+/*banner video*/
+iframe {
+	max-width: 100%;
+}
+.videoWrapper {
+	position: relative;
+	padding-bottom: 66.666667%;
+	overflow: hidden;
+	max-width: 100%;
+	height: auto;
+}
+.videoWrapper iframe, .videoWrapper object, .videoWrapper embed {
+	position: absolute;
+	top: 0;
+	left: 0;
+	width: 100%;
+	height: 100%;
+	background: #0a0a0a;
+	border: none;
+}
+.videoWrapper .player .vp-player-layout {
+	top: 0 !important;
+}
+.item-banner.style9 .inner {
+	background-image: url(../image/banner-home-7.jpg);
+}
+.item-banner.style9.type1 .inner {
+	background-image: url(../image/banner-home-71.jpg);
+}
+.item-banner.style9 .banner-content {
+	padding-top: 74px;
+	padding-right: 300px;
+	padding-bottom: 77px;
+	padding-left: 40px;
+	margin-bottom: 30px;
+}
+.item-banner.style9 .title {
+	font-size: 32px;
+	line-height: 1.1;
+	margin-bottom: 15px;
+}
+.item-banner.style9 .dungar-subtitle {
+	font-style: normal;
+}
+.item-banner.style9 .code {
+	font-size: 13px;
+	font-weight: 600;
+	text-transform: uppercase;
+	margin-bottom: 26px;
+}
+.item-banner.style9 .code .nummer-code {
+	font-size: 18px;
+	color: #dd3232;
+	font-weight: 600;
+	position: relative;
+}
+/*banner home 04*/
+.item-banner.style22 .banner-content {
+	padding-top: 88px;
+	padding-right: 15px;
+	padding-bottom: 99px;
+	padding-left: 39px;
+	margin-bottom: 30px;
+}
+.item-banner.style22 .title {
+	font-size: 30px;
+	line-height: 32px;
+	color: #ffffff;
+	font-weight: 700;
+}
+.item-banner.style23 .banner-content {
+	padding-top: 110px;
+	padding-right: 15px;
+	padding-bottom: 109px;
+	padding-left: 41px;
+	margin-bottom: 30px;
+}
+.item-banner.style23 .title {
+	font-size: 30px;
+	line-height: 32px;
+	color: #ffffff;
+	font-weight: 700;
+}
+/*banner home 05*/
+.item-banner.style24 .banner-content {
+	padding-top: 324px;
+	padding-right: 15px;
+	padding-bottom: 39px;
+	padding-left: 25px;
+	margin-bottom: 30px;
+}
+.item-banner.style24 .title {
+	font-weight: 700;
+	font-size: 30px;
+	line-height: 32px;
+	margin-bottom: 25px;
+}
+.item-banner.style25 .banner-content {
+	padding-top: 190px;
+	padding-right: 15px;
+	padding-bottom: 110px;
+	padding-left: 27px;
+	margin-bottom: 30px;
+}
+.item-banner.style25 .title {
+	font-size: 48px;
+	font-weight: 900;
+	line-height: 48px;
+	text-transform: uppercase;
+	margin-bottom: 5px;
+}
+.item-banner.style25 .code {
+	font-size: 13px;
+	font-weight: 700;
+	color: #888888;
+	text-transform: uppercase;
+	display: block;
+	margin-bottom: 25px;
+}
+.item-banner.style25 .code span {
+	font-size: 18px;
+	color: #ffffff;
+}
+.item-banner.style25 .code span {
+	border-bottom: 1px solid;
+}
+.item-banner.style26 .banner-content {
+	padding-top: 72px;
+	padding-right: 15px;
+	padding-bottom: 53px;
+	padding-left: 15px;
+	margin-bottom: 30px;
+	text-align: center;
+}
+.item-banner.style26 .title {
+	font-size: 24px;
+	border-bottom: 1px solid;
+	margin-bottom: 15px;
+	display: inline-block;
+}
+.item-banner .icon {
+	font-size: 48px;
+	color: #f7f7f7;
+	margin-bottom: 6px;
+	display: block;
+}
+.item-banner .sub-title {
+	font-size: 15px;
+	color: #888888;
+	font-weight: 700;
+	line-height: 30px;
+}
+.item-banner.style27 .banner-content {
+	padding-top: 43px;
+	padding-right: 15px;
+	padding-bottom: 59px;
+	padding-left: 30px;
+	margin-bottom: 30px;
+}
+.item-banner.style27 .title {
+	font-size: 48px;
+	font-weight: 900;
+	text-transform: uppercase;
+	margin-bottom: 2px;
+}
+.item-banner.style27 .description {
+	font-size: 13px;
+	font-weight: 700;
+	text-transform: uppercase;
+	color: #888888;
+	margin-bottom: 0;
+}
+.item-banner.style27 .dungar-subtitle {
+	margin-bottom: 0;
+}
+/*banner home 08*/
+.item-banner.style18 .banner-content {
+	padding-top: 53px;
+	padding-right: 15px;
+	padding-bottom: 60px;
+	padding-left: 50px;
+}
+.item-banner.style18 .title {
+	font-size: 30px;
+	line-height: 32px;
+	font-weight: 700;
+	margin-bottom: 13px;
+}
+.item-banner.style18 .description {
+	margin-bottom: 20px;
+}
+.item-banner.style19 .banner-content {
+	padding-top: 86px;
+	padding-right: 15px;
+	padding-bottom: 90px;
+	padding-left: 15px;
+	text-align: center;
+	margin-bottom: 20px;
+}
+.item-banner.style19 .icon {
+	color: #f7f7f7;
+	font-size: 48px;
+	margin-bottom: 15px;
+	display: block;
+}
+.item-banner.style19 .title {
+	font-size: 24px;
+	border-bottom: 1px solid;
+	display: inline-block;
+	margin-bottom: 5px;
+	letter-spacing: 0;
+}
+.item-banner.style19 .sub-title {
+	font-size: 15px;
+	line-height: 30px;
+	font-weight: 700;
+	color: #ffffff;
+}
+.item-banner.style20 .banner-content {
+	padding-top: 69px;
+	padding-right: 15px;
+	padding-bottom: 56px;
+	padding-left: 30px;
+	margin-bottom: 20px;
+}
+.item-banner.style20 .title {
+	font-size: 38px;
+	line-height: 40px;
+	text-transform: uppercase;
+	margin-bottom: 5px;
+}
+.item-banner.style20 .code {
+	font-size: 13px;
+	color: #cccccc;
+	text-transform: uppercase;
+	font-weight: 700;
+	margin-bottom: 23px;
+}
+.item-banner.style20 .code .nummer-code {
+	font-size: 18px;
+	color: #ffffff;
+	border-bottom: 1px solid
+}
+.banner-pinmap-wrapp .item-banner .inner {
+	position: relative;
+}
+.item-banner.style21 .inner {
+	background-image: url(../image/banner-home-19.jpg);
+	border-radius: 0;
+	background-size: cover;
+}
+.item-banner.style21 .banner-content {
+	padding-top: 180px;
+	padding-right: 15px;
+	padding-bottom: 180px;
+	padding-left: 830px;
+}
+.item-banner.style21 .banner-content .banner-content-inner {
+	float: right;
+}
+.item-banner.style21 .title {
+	font-size: 46px;
+}
+.item-banner.style21 .start-from {
+	text-transform: capitalize;
+	margin-bottom: 23px;
+}
+.item-banner.style21 .start-from span {
+	color: #dd3232;
+	font-weight: 600;
+}
+.item-banner.style21 .group-pinap .btn-pinmap-1 {
+	top: 92px;
+	left: 520px;
+}
+.item-banner.style21 .group-pinap .btn-pinmap-2 {
+	bottom: 20px;
+	left: 313px;
+}
+.popup-pinmap.right.style1 {
+	top: -83px;
+	-webkit-transform: none;
+	-ms-transform: none;
+	-o-transform: none;
+	transform: none;
+}
+.popup-pinmap.right.style1:before {
+	top: 90px;
+}
+.popup-pinmap.left.style1 {
+	top: auto;
+	-webkit-transform: none;
+	-ms-transform: none;
+	-o-transform: none;
+	transform: none;
+	bottom: -5px;
+}
+.popup-pinmap.left.style1:before {
+	top: auto;
+	bottom: 10px;
+}
+.pinmap-popup-main.style1 {
+	min-width: 231px;
+}
+/*banner home 09*/
+.item-banner.style12 .inner {
+	background-image: url(../image/banner-home-10.jpg);
+}
+.item-banner.style12.type2 .inner {
+	background-image: url(../image/banner-home-11.jpg);
+}
+.item-banner.style12 .banner-content {
+	padding-top: 49px;
+	padding-right: 160px;
+	padding-bottom: 53px;
+	padding-left: 23px;
+	margin-bottom: 30px;
+}
+.item-banner.style12 .title {
+	font-size: 26px;
+	line-height: 32px;
+	margin-bottom: 5px;
+}
+.item-banner.style12 .description {
+	margin-bottom: 20px;
+	max-width: 190px;
+}
+.item-banner.style12 .button {
+	height: 39px;
+}
+.item-banner.style13 .banner-content {
+	padding-top: 48px;
+	padding-right: 160px;
+	padding-bottom: 76px;
+	padding-left: 35px;
+	margin-bottom: 30px;
+	text-align: center;
+}
+.item-banner.style13 .sub-title {
+	font-size: 15px;
+	line-height: 30px;
+	color: #ffffff;
+	font-weight: 700;
+}
+.item-banner.style13 .icon {
+	font-size: 48px;
+	color: #f7f7f7;
+	margin-bottom: 15px;
+	display: block;
+}
+.item-banner.style13 .title {
+	border-bottom: 1px solid;
+	display: inline-block;
+	margin-bottom: 7px;
+	letter-spacing: 0;
+}
+.item-banner.style14 .inner {
+	background-image: url(../image/banner-home-12.jpg);
+	background-size: cover;
+}
+.item-banner.style14 .banner-content {
+	padding-top: 43px;
+	padding-right: 30px;
+	padding-bottom: 44px;
+	padding-left: 30px;
+	margin-bottom: 30px;
+	text-align: center;
+}
+.item-banner.style14 .title {
+	font-size: 37px;
+	line-height: 1.2;
+	margin-bottom: 21px;
+}
+.item-banner.style14 .code {
+	font-size: 13px;
+	font-weight: 600;
+	text-transform: uppercase;
+	color: #888888;
+	margin-bottom: 0;
+}
+.item-banner.style14 .code .nummer-code {
+	font-size: 18px;
+	color: #dd3232;
+	position: relative;
+}
+.item-banner.style15 .inner {
+	background-image: url(../image/banner-home-13.jpg);
+	overflow: hidden;
+	background-position: 25% center;
+}
+.item-banner.style15 .banner-content {
+	padding-right: 30px;
+	padding-left: 450px;
+	padding-top: 46px;
+	padding-bottom: 54px;
+	float: right;
+}
+.item-banner.style15 .title {
+	font-size: 28px;
+	font-weight: 500;
+	line-height: 32px;
+}
+.item-banner.style15 .description {
+	margin-bottom: 20px;
+}
+.item-banner.style15 .banner-price {
+	font-size: 23px;
+	font-weight: 600;
+	line-height: 28px;
+	color: #ffffff;
+	text-decoration: underline;
+}
+.item-banner.style16 .inner {
+	background-image: url(../image/banner-home-14.jpg);
+}
+.item-banner.style16 .banner-content {
+	padding-top: 30px;
+	padding-right: 30px;
+	padding-bottom: 36px;
+	padding-left: 23px;
+	margin-bottom: 30px;
+}
+.item-banner.style16 .title {
+	font-size: 28px;
+	font-weight: 500;
+	line-height: 32px;
+}
+.item-banner.style16 .description {
+	margin-bottom: 20px;
+}
+.item-banner.style16 .button {
+	height: 40px;
+	padding-bottom: 5px;
+	padding-top: 5px;
+}
+.item-banner.style17 .inner {
+	background-image: url(https://img.caimei365.com/group1/M00/00/1A/rB-lGGDAfv-AKqM4AAFOfwD11qg032.jpg);
+    background-size: cover;
+}
+.item-banner.style17 .banner-content {
+	padding-top: 48px;
+	padding-bottom: 50px;
+	padding-left: 15px;
+	padding-right: 15px;
+	text-align: center;
+}
+.item-banner.style17 .title {
+	font-size: 34px;
+	line-height: 32px;
+	margin-bottom: 10px;
+}
+.item-banner.style17 .description {
+	margin-bottom: 15px;
+}
+.item-banner.style17 .banner-price {
+	font-size: 16px;
+	color: #888;
+	line-height: 28px;
+	letter-spacing: -0.05em;
+	margin-bottom: 22px;
+}
+.item-banner.style17 .number-price {
+	font-size: 30px;
+	color: #dd3232;
+	font-weight: 600;
+	position: relative;
+}
+/*banner home 10*/
+.item-banner.style10 .inner {
+	background-image: url(../image/banner-home-8.jpg);
+}
+.item-banner.style10 .banner-content {
+	padding-top: 73px;
+	padding-right: 200px;
+	padding-bottom: 77px;
+	padding-left: 50px;
+	margin-bottom: 30px;
+}
+.item-banner.style10 .dungar-subtitle {
+	line-height: 24px;
+}
+.item-banner.style10 .title {
+	font-size: 34px;
+	line-height: 40px;
+	max-width: 200px;
+	margin-bottom: 19px;
+}
+.item-banner.style10 .description {
+	margin-bottom: 0;
+}
+.item-banner.style11 .inner {
+	background-image: url(../image/banner-home-9.jpg);
+}
+.item-banner.style11 .banner-content {
+	padding-top: 65px;
+	padding-right: 330px;
+	padding-bottom: 58px;
+	padding-left: 50px;
+	margin-bottom: 30px;
+}
+.item-banner.style11 .title {
+	font-size: 26px;
+	line-height: 32px;
+	margin-bottom: 5px;
+}
+.item-banner.style11 .description {
+	margin-bottom: 25px;
+	max-width: 200px;
+}
+/*----------------------*/
+/*       FOOTER         */
+/* -------------------- */
+.footer {
+	background: #f3f3f3;
+}
+.footer .container-wapper {
+	padding-top: 60px;
+}
+.footer .footer-end {
+	padding: 20px 0;
+}
+.footer .widget-box .single-img {
+	margin-bottom: 20px;
+}
+.footer .widget-box .text-content-elememnt {
+	font-size: 15px;
+}
+.footer.default .widget-box .text-content-elememnt {
+	padding-right: 100px;
+}
+.footer .widget-box .text-content-elememnt p {
+	margin-bottom: 0;
+}
+.footer .widgettitle {
+	font-size: 14px;
+	font-weight: 600;
+	margin-bottom: 6px;
+	line-height: 24px;
+	position: relative;
+	margin-top: 10px;
+	text-transform: uppercase;
+	font-family: 'Jost';
+}
+.footer {
+	text-align: center;
+}
+.footer .menu {
+	padding: 0;
+	margin: 0;
+	list-style: none;
+}
+.footer .menu .menu-item {
+	color: #191919;
+	line-height: 26px;
+	padding-top: 5px;
+	padding-bottom: 5px;
+}
+.footer .menu .menu-item > a > span {
+	padding-right: 5px;
+	color: #dd3232;
+}
+.dungar-newsletter.style1 {
+	margin-bottom: 10px;
+}
+.dungar-newsletter.style1 .title, .dungar-newsletter.style2 .title {
+	font-size: 14px;
+	font-weight: 600;
+	text-transform: uppercase;
+	margin-bottom: 15px;
+	position: relative;
+	margin-top: 11px;
+	font-family: 'Jost';
+}
+.dungar-newsletter.style1 .list {
+	margin-bottom: 20px;
+}
+.dungar-newsletter.style1 .list .text {
+	font-size: 15px;
+}
+.dungar-newsletter.style1 .list label {
+	color: #bbbbbb;
+	font-weight: 700;
+	margin: 0 0 0 20px;
+	position: relative;
+	padding-left: 20px;
+	cursor: pointer;
+}
+.dungar-newsletter.style1 .list input[type=radio] {
+	display: none;
+}
+.dungar-newsletter.style1 .list input[type=radio]:checked + span {
+	border-bottom: 1px solid #bbbbbb;
+}
+.dungar-newsletter.style1 .list label span:before {
+	position: absolute;
+	content: '';
+	width: 16px;
+	height: 16px;
+	border: 1px solid #666666;
+	left: 0px;
+	top: 5px;
+	border-radius: 50%;
+}
+.dungar-newsletter.style1 .list input[type=radio]:checked + span:after {
+	content: "";
+	display: inline-block;
+	top: 9px;
+	left: 4px;
+	width: 8px;
+	height: 8px;
+	border-radius: 50%;
+	background: #bbbbbb;
+	position: absolute;
+	z-index: 11;
+	padding: 0;
+}
+.dungar-newsletter.style1 .newsletter-form-wrap .input-text {
+	width: 100%;
+	background: #fff;
+	color: #bbbbbb;
+	font-size: 15px;
+	height: 56px;
+	line-height: 56px;
+	text-align: center;
+	margin-bottom: 10px;
+	border-radius: 30px;
+}
+.dungar-newsletter.style1 .newsletter-form-wrap .submit-newsletter {
+	color: #fff;
+	width: 100%;
+	background: #dd3232;
+	height: 56px;
+	line-height: 56px;
+	padding: 0 15px;
+	border-radius: 30px;
+	letter-spacing: 0.1em;
+}
+.footer .dungar-socials .socials {
+	margin: 0;
+	padding: 0;
+}
+.footer .dungar-socials li {
+	list-style: none;
+	display: inline-block;
+	font-size: 23px;
+	color: #555555;
+}
+.footer .dungar-socials li:first-child {
+	padding-left: 0;
+}
+.footer .dungar-socials li a {
+	border-radius: 50%;
+	min-width: 100px;
+	height: 45px;
+	font-size: 26px;
+	line-height: 45px;
+	text-align: center;
+	display: inline-block;
+	position: relative;
+	z-index: 1;
+	margin-bottom: 10px;
+}
+.footer .dungar-socials li a i {
+	z-index: 1;
+	position: relative;
+}
+.footer .border-custom span {
+	margin-top: 45px;
+}
+/*footer style 2*/
+.footer.style2 .container-wapper {
+	padding-top: 60px;
+}
+.footer.style2 .dungar-custommenu {
+	padding-left: 20px;
+}
+.footer.style2 .box-footer:first-child .dungar-custommenu {
+	padding-left: 0;
+}
+.footer.style2 .dungar-newsletter {
+	padding-left: 100px;
+	margin-bottom: 40px;
+	padding-right: 100px;
+}
+.footer.style2 .dungar-payment {
+	padding-left: 100px;
+}
+.footer .menu-connect li a::before {
+	font-family: 'FontAwesome';
+	font-size: 18px;
+	color: #eeeeee;
+	margin-right: 20px;
+}
+.footer .menu-connect li.facebook a::before {
+	content: "\f082";
+}
+.footer .menu-connect li.twitter a::before {
+	content: "\f099";
+}
+.footer .menu-connect li.instagram a::before {
+	content: "\f16d";
+}
+.footer .menu-connect li.youtube a::before {
+	content: "\f16a";
+}
+.footer .menu-connect li.pinterest a::before {
+	content: "\f0d2";
+}
+/*============footer style 3==============*/
+.footer.style3 .dungar-socials {
+	padding-top: 13px;
+}
+.footer.style3 .dungar-socials .social-item {
+	list-style: none;
+	display: inline-block;
+	padding: 17px 12px;
+	font-size: 23px;
+	color: #555555;
+}
+.footer.style3 .dungar-socials .social-item:first-child {
+	padding-left: 0;
+}
+.footer.style3 .dungar-socials .social-item:hover {
+	color: #ffffff;
+}
+.footer .dungar-custommenu.style1 .menu .menu-item {
+	width: 50%;
+	float: left;
+}
+.footer.style3 .dungar-custommenu.style1 {
+	padding-left: 22px;
+	overflow: hidden;
+}
+.dungar-lastestblog .post {
+	overflow: hidden;
+	margin-bottom: 20px;
+}
+.dungar-lastestblog .post:last-child {
+	margin-bottom: 0;
+}
+.dungar-lastestblog .post .time {
+	display: inline-block;
+	float: left;
+	margin-right: 15px;
+	min-width: 48px;
+	height: 49px;
+	text-align: center;
+	border: 1px solid #888;
+	overflow: hidden;
+	padding: 7px 5px;
+	font-weight: 700;
+}
+.dungar-lastestblog .post .time span {
+	display: block;
+	font-weight: 700;
+}
+.dungar-lastestblog .post .time .date {
+	font-size: 16px;
+	color: #ccc;
+	line-height: 16px
+}
+.dungar-lastestblog .post .time .month {
+	font-size: 13px;
+	color: #888;
+	line-height: 13px;
+}
+.dungar-lastestblog .post .infor {
+	overflow: hidden;
+}
+.footer .dungar-lastestblog .widgettitle {
+	margin-bottom: 20px;
+}
+.dungar-lastestblog .post .infor .post-title {
+	font-size: 15px;
+	text-transform: capitalize;
+	margin: 0;
+	line-height: 1.2;
+}
+.dungar-lastestblog .post .infor .post-title a {
+	color: #888888;
+}
+.dungar-lastestblog .post .infor .post-title a:hover {
+	color: #ffffff;
+}
+.dungar-lastestblog .post .infor .meta {
+	font-size: 12px;
+	color: #444444;
+}
+.dungar-newsletter.style2 .subtitle {
+	color: #888;
+	margin-bottom: 25px;
+}
+.dungar-newsletter.style2 .newsletter-form-wrap .input-text {
+	width: 100%;
+	font-size: 15px;
+	color: #888;
+	background: #fff;
+	border-color: #fff;
+	margin-bottom: 20px;
+}
+.dungar-newsletter.style2 .newsletter-form-wrap .submit-newsletter {
+	min-width: 116px;
+	background-color: #333333;
+	color: #ffffff;
+}
+.footer .dungar-newsletter .newsletter-form-wrap .input-text:focus {
+	border-color: #dd3232 !important;
+}
+/*footer style 10*/
+.footer.style10 .dungar-newsletter.style1 .newsletter-form-wrap .submit-newsletter {
+	background-color: #75905e;
+}
+/*footer style 09*/
+.footer.style9 .dungar-iconbox.default {
+	margin-bottom: 0;
+	margin-top: 38px;
+	border-color: #282828;
+}
+.footer.style9 .dungar-iconbox-wrapp .border-custom span {
+	margin-top: 40px;
+}
+.footer.style9 .dungar-iconbox.default .icon {
+	color: #444444;
+}
+.footer.style9 .dungar-iconbox.default .iconbox-inner .content .title {
+	color: #eeeeee;
+}
+.footer.style9 .dungar-iconbox.default .iconbox-inner .content .text {
+	color: #555555;
+}
+/*footer style 08*/
+.footer.style8 {
+	background-color: #060606;
+}
+/* -------------------- */
+/*   RESPONSIVE      */
+/* -------------------- */
+@media (max-width: 1199px) {
+	.item-banner.style1 .inner .title {
+		font-size: 30px;
+	}
+	.item-banner.style2 .title {
+		font-size: 28px;
+	}
+	.item-banner .hot-price .price-number {
+		font-size: 26px;
+	}
+	.product-item.style-list .product-name {
+		font-size: 18px;
+	}
+	.dungar-product.layout1 .head .title {
+		font-size: 24px;
+	}
+	.dungar-newsletter.default .title {
+		font-size: 26px;
+	}
+	.dungar-blog-item .blog-title {
+		font-size: 16px;
+	}
+	.item-banner.style15 .title,
+	.item-banner.style16 .title {
+		font-size: 26px;
+	}
+	.dungar-tabs.default.rows-space-40 {
+		margin-bottom: 35px;
+	}
+	.item-banner.style17 .title,
+	.item-banner.style4 .title, .item-banner.style5 .title, .item-banner.style7 .title, .item-banner.style8 .title, .item-banner.style17 .title,
+	.item-banner.style4 .title, .item-banner.style5 .title, .item-banner.style7 .title, .item-banner.style8 .title {
+		font-size: 24px;
+	}
+	.dungar-newsletter.style3 .title {
+		font-size: 24px;
+	}
+	.dungar-newsletter.style3 {
+		padding: 75px 0 65px;
+	}
+	.team-member .border-custom {
+		margin-top: 55px;
+	}
+	.item-banner.style12 .banner-content {
+		margin-bottom: 18px;
+	}
+	.dungar-newsletter.style3::before,
+	.item-banner .inner::before,
+	.slider-item .slider-inner::before {
+		content: '';
+		position: absolute;
+		top: 0;
+		left: 0;
+		right: 0;
+		bottom: 0;
+		background-color: #fff;
+		opacity: 0.5;
+		display: none;
+	}
+	.header-banner.banner-image .banner-wrap .banner-header,
+	.dungar-newsletter > *,
+	.item-banner .banner-content {
+		position: relative;
+	}
+	.banner-wrapp.rows-space-65,
+	.dungar-product.produc-featured .rows-space-65 {
+		margin-bottom: 55px;
+	}
+	.home-slider-banner {
+		margin-bottom: 33px;
+	}
+	.item-banner.style9 .banner-content {
+		padding-right: 15px;
+	}
+	.dungar-newsletter.default .subtitle {
+		margin-bottom: 20px;
+	}
+	.slider-item.style4 .title-big,
+	.slider-item.style5 .title-big,
+	.slider-item.style6 .title-big {
+		font-size: 34px;
+	}
+	.sevice-box-content .sevice-title,
+	.header-banner .title {
+		font-size: 28px;
+		font-weight: 600;
+	}
+	.comments-area {
+		margin-bottom: 50px;
+	}
+	.pagination {
+		margin-top: 35px;
+	}
+	.pagination.grid {
+		margin-top: 10px;
+	}
+	.post-item .post-title {
+		font-size: 24px;
+	}
+	.dungar-product.produc-featured.rows-space-65 {
+		margin-bottom: 55px;
+	}
+	.item-banner.style9 .title {
+		font-size: 28px;
+	}
+	.dungar-tabs.default.rows-space-30 {
+		margin-bottom: 20px;
+	}
+	.item-banner.style21 .title {
+		font-size: 36px;
+	}
+	.slick-dots {
+		margin-top: 30px;
+	}
+	.dungar-blog-wraap.default {
+		padding-top: 52px;
+		padding-bottom: 52px;
+	}
+	.banner-pinmap-wrapp.rows-space-70 {
+		margin-bottom: 55px;
+	}
+	.home-slider.fullwidth.rows-space-60 {
+		margin-bottom: 45px;
+	}
+	.banner-video-wrapp.rows-space-40,
+	.dungar-product.produc-featured.rows-space-40 {
+		margin-bottom: 25px;
+	}
+	.dungar-product.layout1 {
+		padding: 55px 0 20px;
+		background: #f3f3f3;
+	}
+	.banner-wrapp.rows-space-30 {
+		margin-bottom: 25px;
+	}
+	.slider-item .title-big {
+		font-size: 30px;
+	}
+	.banner-wrapp.rows-space-35 {
+		margin-bottom: 20px;
+	}
+	.banner-wrapp.rows-space-60 {
+		margin-bottom: 55px;
+	}
+	.dungar-tabs.default.rows-space-40 {
+		margin-bottom: 35px;
+	}
+	.item-banner.style6 .banner-content {
+		padding-bottom: 120px;
+		padding-top: 120px;
+	}
+	.item-banner.style6 .title {
+		font-size: 36px;
+	}
+	.product-in-stock-wrapp.rows-space-40 {
+		margin-bottom: 20px;
+	}
+	.custommenu-title-blog {
+		font-size: 26px;
+		margin-bottom: 40px;
+	}
+	.main-content {
+		padding-bottom: 55px;
+	}
+	.banner-wrapp.rows-space-70 {
+		margin-bottom: 50px;
+	}
+	.instagram-wrapp .custommenu-title-blog {
+		margin-top: 50px;
+	}
+	.dungar-tabs .tab-head {
+		margin-bottom: 35px;
+	}
+	.footer .container-wapper {
+		padding-top: 55px;
+	}
+	.home-slider.style1 {
+		padding-top: 0;
+	}
+	.form-message {
+		padding: 45px;
+	}
+	.blog-slider.style-1 .blog-item {
+		margin: 0;
+	}
+	.footer .border-custom span {
+		margin-top: 20px;
+	}
+	.slider-product .slick-slider > .slick-arrow:first-child, .dungar-blog .slick-slider > .slick-arrow:first-child {
+		left: 0;
+	}
+	.slider-product .slick-slider > .slick-arrow, .dungar-blog .slick-slider > .slick-arrow {
+		right: 0;
+	}
+	/*header style1*/
+	.header.style1 .header-element {
+		float: right;
+		text-align: right;
+	}
+	.header.style1 .header-language .dungar-language {
+		margin-left: 25px;
+		float: left;
+	}
+	.header .logo {
+		text-align: left;
+	}
+	.header .header-nav {
+		display: none;
+	}
+	.header .header-block-text, .dungar-menu-panel .header-block-text {
+		display: none;
+	}
+	.header-control {
+		text-align: center;
+		padding: 20px 0 0;
+	}
+	.header-language .dungar-submenu {
+		left: auto;
+		right: 0
+	}
+	.block-search .dungar-submenu {
+		left: -100%;
+		right: auto;
+	}
+	.submenu.menu-page {
+		padding: 30px 20px;
+	}
+	.mega-menu .dungar-custommenu {
+		margin-bottom: 30px;
+	}
+	/*footer*/
+	/*contact page*/
+	.dungar-contact-info .socials {
+		padding-top: 15px;
+	}
+	/*product list*/
+	.product-item.style-list .product-info-left {
+		width: auto;
+		padding: 0 10px;
+	}
+	.product-item.style-list .product-info-right {
+		border: 0;
+		text-align: left;
+		padding: 0 0 0 10px;
+		width: auto;
+	}
+	.full-width .product-item.style-list .product-info-right {
+		width: auto;
+	}
+	.product-item.style-list .product-thumb {
+		border: none;
+		padding-right: 10px;
+	}
+	.slider-lookbook.nav-center > .slick-arrow {
+		opacity: 0;
+		visibility: hidden;
+	}
+	/*in lookbook*/
+	.slider-lookbook:hover > .slick-arrow {
+		opacity: 1;
+		visibility: visible;
+	}
+	.slick-slider.slider-lookbook.nav-center > .slick-arrow {
+		right: 0;
+	}
+	.slick-slider.slider-lookbook.nav-center > .slick-arrow:first-child {
+		left: 0;
+	}
+	/*menu mobile*/
+	.header.style7 .mobile-navigation {
+		top: -10px;
+	}
+	.mobile-navigation {
+		display: inline-block;
+		vertical-align: top;
+		margin-left: 17px;
+		border: 2px solid #dedede;
+		border-radius: 0;
+		padding: 14px 11px 10px;
+		position: relative;
+	}
+	.mobile-navigation span {
+		background-color: #333;
+		display: block;
+		width: 16px;
+		margin-bottom: 3px;
+		height: 2px;
+	}
+	/*checkout page*/
+	.checkout-wrapp .row-col-2 {
+		padding-left: 15px;
+	}
+	/*shop page*/
+	.full-width .details-thumd {
+		padding-left: 0;
+	}
+	/*==========home 01=========*/
+	.product-item.style2 .product-inner {
+		display: block;
+	}
+	.slider-item.style1 .slider-inner .slider-infor, .slider-item.style3 .slider-inner .slider-infor, .slider-item.style2 .slider-inner .slider-infor {
+		padding-left: 200px;
+	}
+	.item-banner.style3 .banner-content {
+		padding-left: 320px;
+	}
+	/*==========home 02=========*/
+	/*header*/
+	.header.style2 .header-control {
+		padding: 0;
+		text-align: right;
+	}
+	.header.style2 .logo {
+		text-align: center;
+	}
+	/*slider*/
+	.slider-item.style4 .slider-inner .slider-infor, .slider-item.style5 .slider-inner .slider-infor, .slider-item.style6 .slider-inner .slider-infor {
+		padding-left: 200px;
+	}
+	/*banner home 02*/
+	.item-banner.style4 .banner-content, .item-banner.style5 .banner-content {
+		padding-right: 130px;
+	}
+	/*footer styel2*/
+	.footer.style2 .dungar-custommenu {
+		padding-left: 0;
+	}
+	.footer.style2 .dungar-newsletter {
+		padding-left: 0;
+		padding-right: 0;
+	}
+	/*==========home 03=========*/
+	/*header style3*/
+	.header.style3 .block-search .dungar-submenu {
+		left: auto;
+		right: 0;
+	}
+	/*footer*/
+	.footer.style3 .dungar-custommenu.style1 {
+		padding-left: 0;
+	}
+	/*==========home 04=========*/
+	.header.vertical-style .header-nav {
+		display: block;
+	}
+	.header.vertical-style .mobile-navigation {
+		display: none;
+	}
+	.header.style4 .logo {
+		text-align: center;
+	}
+	.header.style4 .header-control {
+		padding-top: 0;
+		text-align: right;
+	}
+	.header.style4 .header-control .block-header .dungar-submenu {
+		left: auto;
+	}
+	.slider-item.style22 .slider-inner .slider-infor, .slider-item.style23 .slider-inner .slider-infor, .slider-item.style24 .slider-inner .slider-infor {
+		padding-left: 420px;
+	}
+	/*==========home 05=========*/
+	.header.style5 .header-language {
+		display: none;
+	}
+	.header.style5 .header-nav .header-language {
+		display: block;
+	}
+	.header.style5 .header-control {
+		padding: 0;
+	}
+	.header.style5 .header-element {
+		text-align: right;
+	}
+	.header.style5 .block-search-block {
+		text-align: left;
+	}
+	.slider-item.style25 .slider-inner .slider-infor, .slider-item.style26 .slider-inner .slider-infor, .slider-item.style27 .slider-inner .slider-infor {
+		padding-left: 550px;
+	}
+	.fullwidth.style2 .slick-list .slick-slide {
+		padding: 0;
+	}
+	/*==========home 06=========*/
+	.header.style6 {
+		padding: 30px;
+		
+	}
+	.header.style6 .logo {
+		padding-bottom: 0;
+	}
+	.header.style6 .header-control {
+		margin-bottom: 20px;
+	}
+	.header.style6 .header-nav .mCustomScrollbar {
+		height: calc(100vh - 260px);
+	}
+	.item-banner.style28 .banner-content, .item-banner.style29 .banner-content, .item-banner.style30 .banner-content {
+		padding-bottom: 250px;
+		padding-top: 250px;
+	}
+	.item-banner.style29 .inner {
+		background-position: top;
+	}
+	/*==========home 07=========*/
+	.header .main-header {
+		padding: 40px 0 37px;
+	}
+	.header.style7 .header-nav-container,
+	.header.style7 .header-nav-wapper {
+		display: none;
+	}
+	.header.style7 .header-control {
+		padding-top: 0;
+	}
+	.slider-item.style19 .slider-inner .slider-infor, .slider-item.style20 .slider-inner .slider-infor, .slider-item.style21 .slider-inner .slider-infor {
+		padding-left: 300px;
+	}
+	/*==========home 08=========*/
+	.header.style8 .header-control .block-header .dungar-submenu {
+		left: auto;
+	}
+	.item-banner.style20 .title {
+		font-size: 30px;
+	}
+	.item-banner.style20 .code .nummer-code {
+		font-size: 15px;
+	}
+	.item-banner.style21 .banner-content {
+		padding-left: 500px;
+		padding-top: 80px;
+		padding-bottom: 80px;
+	}
+	.item-banner.style21 .group-pinap .btn-pinmap-1 {
+		left: 360px;
+	}
+	/*==========home 09=========*/
+	/*herder*/
+	.header.style9 .bar-open-menu {
+		display: none;
+	}
+	.header.style9 .header-control {
+		padding-top: 0;
+	}
+	.header.style9 .block-search .dungar-submenu {
+		right: 0;
+		left: auto;
+	}
+	.slider-item.style13 .slider-inner .slider-infor, .slider-item.style14 .slider-inner .slider-infor, .slider-item.style15 .slider-inner .slider-infor {
+		padding-left: 450px;
+	}
+	.slider-item.style13 .pinmap-buttom.btn-pinmap-1 {
+		top: 260px;
+		left: 340px;
+	}
+	.slider-item.style13 .pinmap-buttom.btn-pinmap-2 {
+		left: 230px;
+	}
+	.slider-item.style14 .pinmap-buttom.btn-pinmap-1 {
+		top: 270px;
+		left: 345px;
+	}
+	.slider-item.style14 .pinmap-buttom.btn-pinmap-2 {
+		left: 300px;
+	}
+	.slider-item.style15 .pinmap-buttom.btn-pinmap-1 {
+		left: 390px;
+	}
+	.item-banner.style15 .banner-content,
+	.item-banner.style12 .banner-content, .item-banner.style13 .banner-content, .item-banner.style14 .banner-content,
+	.item-banner.style16 .banner-content {
+		padding-left: 15px;
+		padding-right: 15px;
+	}
+	/*==========home 10=========*/
+	.header.style10 .logo {
+		text-align: center;
+	}
+	.header.style10 .header-language .dungar-language {
+		margin-left: 30px;
+	}
+	.header.style10 .header-control {
+		padding: 0;
+	}
+	.header.style10 .header-control .block-header .dungar-submenu {
+		right: 0;
+		left: auto;
+	}
+	.item-banner.style10 .banner-content {
+		padding-right: 40px;
+		padding-left: 40px;
+	}
+	.item-banner.style11 .banner-content {
+		padding-right: 160px;
+		padding-left: 50px;
+	}
+	.dungar-product .product-list-owl.nav-botton-center {
+		padding: 0;
+	}
+	.slider-product .slick-slider.nav-botton-center > .slick-arrow {
+		right: 0;
+		top: 50%;
+		transform: translateY(-50%);
+	}
+	.slider-product .slick-slider.nav-botton-center > .slick-arrow:first-child {
+		left: 0;
+	}
+	.slider-item.style10 .slider-inner .slider-infor, .slider-item.style11 .slider-inner .slider-infor, .slider-item.style12 .slider-inner .slider-infor {
+		padding-left: 230px;
+	}
+	.product-item.style-6 .product-thumb {
+		margin-bottom: 2px;
+	}
+	.breadcrumb {
+		border-top: 1px solid #e8e8e8;
+	}
+	.custom_blog_title {
+		margin-bottom: 30px;
+		font-size: 24px;
+	}
+	.team-member .custom_blog_title {
+		margin-top: 53px;
+		margin-bottom: 37px;
+	}
+}
+@media (max-width: 1024px) {
+	/*header*/
+	.main-menu .submenu .submenu {
+		left: 60%;
+		top: 50%;
+	}
+}
+@media (max-width: 1199px) and (min-width: 768px) {
+	.col-lg-4.banner-wrapp .banner {
+		width: calc(50% - 10px);
+		float: left;
+	}
+	.col-lg-4.banner-wrapp .banner:last-child {
+		float: right;
+	}
+}
+@media (max-width: 991px) {
+	.item-banner.style11 .banner-content,
+	.item-banner.style10 .banner-content {
+		padding-left: 15px;
+		padding-right: 15px;
+	}
+	.item-banner.style7 .banner-content {
+		padding-right: 130px;
+	}
+	.item-banner.style8 .banner-content {
+		padding-right: 136px;
+	}
+	.header .main-header {
+		padding: 30px 0 20px;
+	}
+	/*popup*/
+	.kt-popup-newsletter .image-newsletter {
+		display: none !important;
+	}
+	.kt-popup-newsletter.style-1 {
+		width: 100%;
+	}
+	.kt-popup-newsletter .popup-content {
+		text-align: center;
+	}
+	/*single blog*/
+	.sidebar .wrapper-sidebar {
+		margin-top: 40px;
+	}
+	/*login*/
+	.customer_login .login-item {
+		margin-bottom: 30px;
+	}
+	/*shop page*/
+	.woof_Widget {
+		padding: 20px;
+	}
+	/*footer*/
+	.coppyright, .footer-end .dungar-payment, .footer-end .demos {
+		text-align: center;
+		padding: 5px 0;
+	}
+	.footer .widget-box .text-content-elememnt {
+		padding-right: 0;
+	}
+	/*in lookbook*/
+	.sevice-item .sevice-thumb {
+		text-align: center;
+		margin-bottom: 30px;
+	}
+	.sevice-item .col-sm-6 ~ .col-sm-6 > .sevice-thumb {
+		margin-bottom: 0;
+	}
+	.sevice-box-content {
+		position: static;
+		transform: none;
+		padding: 0;
+	}
+	.sevice-item.style-1.has-item-sevice .sevice-box-content {
+		padding-bottom: 40px;
+		padding-top: 0;
+	}
+	/*checkout page*/
+	.checkout-wrapp .row-col {
+		width: 100%;
+		float: none;
+		margin-bottom: 20px;
+		padding: 0;
+	}
+	.checkout-form {
+		padding: 30px 20px 10px;
+	}
+	.your-order .title-form {
+		margin-bottom: 25px;
+	}
+	.checkout-wrapp .button {
+		margin-bottom: 30px;
+	}
+	/*GridProducts page*/
+	.shop-grid-content.full-width .shop-top-control .select-item {
+		width: auto;
+	}
+	/*===========home 02=========*/
+	/*header*/
+	.header.style2 .header-control {
+		text-align: center;
+		padding: 20px 0 0;
+	}
+	.header.style2 .header-element {
+		float: right;
+	}
+	.header.style2 .form-search .form-content {
+		text-align: right;
+	}
+	.header.style2 .logo {
+		text-align: left;
+	}
+	/*popup newletter*/
+	.kt-popup-newsletter {
+		display: none;
+		
+	}
+	/*===========home 04=========*/
+	.header.style4 .header-control {
+		text-align: left;
+		padding-top: 0;
+	}
+	.header.style4 .mobile-navigation {
+		display: none;
+	}
+	.header.style4 .mobile-navigation span {
+		background: #eeeeee;
+	}
+	.vertical-style .dungar-demolink .title {
+		color: #0a0a0a;
+	}
+	/*===========home 05=========*/
+	.slider-item.style25 .slider-inner .slider-infor, .slider-item.style26 .slider-inner .slider-infor, .slider-item.style27 .slider-inner .slider-infor {
+		padding-left: 420px;
+	}
+	.header.style5 .header-control {
+		padding-top: 20px;
+	}
+	/*===========home 07=========*/
+	.product-item.style-3 .quantity {
+		display: none;
+	}
+	.header.style7 .header-control {
+		padding-top: 20px;
+	}
+	/*===========home 08=========*/
+	.item-banner.style18 .banner-content {
+		margin-bottom: 20px;
+	}
+	.item-banner.style21 .banner-content {
+		padding-left: 244px;
+	}
+	.dungar-product.layout1 .product-list-owl .product-item .thumb-inner img {
+		margin: 0 auto;
+	}
+	/*===========home 09=========*/
+	.slider-item.style13 .slider-inner .slider-infor, .slider-item.style14 .slider-inner .slider-infor, .slider-item.style15 .slider-inner .slider-infor {
+		padding-left: 200px;
+	}
+	.group-pinap .pinmap-buttom {
+		display: none;
+	}
+	.item-banner.style14 .title {
+		font-size: 35px;
+	}
+	.item-banner.style14 .code {
+		font-size: 12px;
+	}
+	/*===========home 10=========*/
+	.slider-item.style10 .slider-inner .slider-infor, .slider-item.style11 .slider-inner .slider-infor, .slider-item.style12 .slider-inner .slider-infor {
+		padding-left: 200px;
+	}
+	.product-deal-slider .product-list-owl .thumb-link img {
+		margin: 0 auto;
+	}
+	.product-deal-slider {
+		margin-bottom: 30px;
+	}
+	.dungar-iconbox-wrapp.default .col-md-4:not(:last-child) {
+		margin-bottom: 30px;
+	}
+	.dungar-iconbox.default .iconbox-inner {
+		display: block;
+		text-align: center;
+	}
+	.dungar-iconbox.default .iconbox-inner .icon, .dungar-iconbox.default .content {
+		display: block;
+		width: 100%;
+		padding: 0
+	}
+	.dungar-iconbox.default .iconbox-inner .icon {
+		padding-bottom: 5px;
+		font-size: 55px;
+	}
+	.dungar-iconbox.default .content .title {
+		margin-top: 10px;
+	}
+	.cart-form .shop_table tbody > tr > td {
+		padding: 10px;
+	}
+	.cart-form .shop_table .product-thumbnail {
+		padding-left: 10px;
+	}
+	.dungar-newsletter.default .title,
+	.custommenu-title-blog {
+		font-size: 24px;
+	}
+	.item-banner.style10 .title {
+		font-size: 28px;
+	}
+}
+@media (max-width: 767px) {
+	.slider-item .slider-infor .button {
+		font-size: 16px;
+	}
+	.testimonial-item .image {
+		width: 100px;
+		height: 100px;
+	}
+	.testimonial-item .info {
+		padding-right: 30px;
+	}
+	.dungar-countdown .box-count {
+		min-width: 40px;
+	}
+	.box-footer:nth-child(2) {
+		margin-top: 20px;
+		margin-bottom: 20px;
+	}
+	.product-item.style-list .product-name {
+		font-size: 16px;
+	}
+	.title-form {
+		font-size: 16px;
+	}
+	.item-banner.style15 .title, .item-banner.style16 .title {
+		font-size: 22px;
+	}
+	.banner-video-wrapp.rows-space-40 {
+		margin-bottom: 15px;
+	}
+	.dungar-product.produc-featured.rows-space-40 {
+		margin-bottom: 20px;
+	}
+	.item-banner.style1 .title br {
+		display: block;
+	}
+	.item-banner.style21 .title br {
+		display: block;
+	}
+	.dungar-blog-wraap.default {
+		padding-top: 45px;
+		padding-bottom: 45px;
+	}
+	.instagram-wrapp .custommenu-title-blog {
+		margin-top: 45px;
+	}
+	.item-banner.style11 .title {
+		font-size: 24px;
+		font-weight: 600;
+	}
+	.dungar-product.produc-featured.rows-space-65 {
+		margin-bottom: 45px;
+	}
+	.slider-item .title-big {
+		font-size: 24px;
+	}
+	.item-banner .title {
+		font-weight: 500;
+	}
+	.slider-item .price .number-price,
+	.item-banner.style17 .number-price {
+		font-size: 20px;
+	}
+	.item-banner .dungar-subtitle {
+		font-size: 13px;
+	}
+	.item-banner.style17 .title,
+	.item-banner.style4 .title, .item-banner.style5 .title, .item-banner.style7 .title, .item-banner.style8 .title, .item-banner.style17 .title,
+	.item-banner.style4 .title, .item-banner.style5 .title, .item-banner.style7 .title, .item-banner.style8 .title {
+		font-size: 20px;
+	}
+	.dungar-tabs .tab-link::before {
+		display: none;
+	}
+	.item-banner.style6 .banner-content {
+		padding-bottom: 75px;
+		padding-top: 75px;
+	}
+	.shop-top-control {
+		padding-bottom: 10px;
+	}
+	.dungar-newsletter.style3 .title {
+		font-size: 20px;
+	}
+	.dungar-iconbox .content .title {
+		font-size: 14px;
+	}
+	.dungar-newsletter.style3 {
+		overflow: hidden;
+		padding-top: 40px;
+		padding-bottom: 30px;
+	}
+	.footer .dungar-socials li a {
+		min-width: 60px;
+		font-size: 22px;
+	}
+	.slider-item.style4 .slider-inner .slider-infor, .slider-item.style5 .slider-inner .slider-infor, .slider-item.style6 .slider-inner .slider-infor,
+	.slider-item.style1 .slider-inner .slider-infor, .slider-item.style3 .slider-inner .slider-infor, .slider-item.style2 .slider-inner .slider-infor,
+	.slider-item.style7 .slider-inner .slider-infor, .slider-item.style8 .slider-inner .slider-infor, .slider-item.style9 .slider-inner .slider-infor,
+	.slider-item.style13 .slider-inner .slider-infor, .slider-item.style14 .slider-inner .slider-infor, .slider-item.style15 .slider-inner .slider-infor,
+	.slider-item.style19 .slider-inner .slider-infor, .slider-item.style20 .slider-inner .slider-infor, .slider-item.style21 .slider-inner .slider-infor,
+	.slider-item.style25 .slider-inner .slider-infor, .slider-item.style26 .slider-inner .slider-infor, .slider-item.style27 .slider-inner .slider-infor {
+		padding-top: 70px;
+		padding-bottom: 70px;
+	}
+	.item-banner.style1 .inner .title {
+		font-size: 26px;
+	}
+	.item-banner.style2 .title {
+		font-size: 24px;
+	}
+	.dungar-newsletter.style1 .newsletter-form-wrap .input-text {
+		font-size: 13px;
+	}
+	.dungar-newsletter.style1 .newsletter-form-wrap .input-text {
+		height: 44px;
+		padding: 0 15px;
+		line-height: 44px;
+	}
+	.dungar-newsletter.style1 .newsletter-form-wrap .submit-newsletter {
+		height: 44px;
+		line-height: 44px;
+	}
+	input[type="text"], input[type="email"], input[type="password"], input[type="tel"], input[type="search"], input[type="url"], textarea, select {
+		padding: 7px 10px;
+	}
+	.button, button, input[type="submit"] {
+		font-size: 12px;
+	}
+	.item-banner.style10 .title {
+		font-size: 28px;
+		line-height: 1.2;
+	}
+	.banner-wrapp.rows-space-65 {
+		margin-bottom: 40px;
+	}
+	.home-slider-banner {
+		margin-bottom: 25px;
+	}
+	.banner-wrapp.rows-space-70 {
+		margin-bottom: 43px;
+	}
+	.details-infor .product-title {
+		font-size: 22px;
+	}
+	.details-infor .price {
+		font-size: 24px;
+		margin-bottom: 15px;
+	}
+	.sevice-item.style-1 {
+		padding-bottom: 40px;
+		margin-bottom: 40px;
+	}
+	.content-inlookbook .pagination {
+		margin-bottom: 40px;
+	}
+	.wapper-slider-lookbook {
+		padding: 40px 0;
+	}
+	.slider-lookbook-item .lookbook-inner {
+		padding: 15px;
+	}
+	.sevice-box-content .sevice-title,
+	.header-banner .title {
+		font-size: 22px;
+	}
+	.pagination {
+		margin-top: 30px;
+	}
+	.comments-area {
+		margin-bottom: 30px;
+	}
+	.comments-area .comment .children {
+		padding-left: 30px;
+		padding-top: 30px;
+	}
+	.comment-form .comment-reply-content {
+		padding: 0 15px;
+	}
+	.comment-form {
+		padding-top: 0;
+		margin-bottom: 30px;
+	}
+	blockquote, q {
+		margin-bottom: 25px;
+		margin-top: 0;
+	}
+	.post-item .post-title {
+		font-size: 22px;
+	}
+	.blog-articles > .custom_blog_title, .comments-area > .custom_blog_title {
+		font-size: 16px;
+	}
+	.widget .widgettitle {
+		font-size: 14px;
+	}
+	.widget {
+		margin-bottom: 30px;
+	}
+	.newsletter-widget {
+		padding: 20px 15px;
+	}
+	.form-message .title {
+		margin-bottom: 15px;
+		font-size: 14px;
+	}
+	.dungar-newsletter.style3 {
+		overflow: hidden;
+		padding-top: 40px;
+		padding-bottom: 40px;
+	}
+	.dungar-tabs.default.rows-space-30 {
+		margin-bottom: 10px;
+	}
+	.banner-wrapp.rows-space-60,
+	.dungar-product.produc-featured.rows-space-60 {
+		margin-bottom: 35px;
+	}
+	.item-banner.style9 .title {
+		font-size: 22px;
+	}
+	.item-banner.style21 .banner-content {
+		padding-top: 60px;
+		padding-bottom: 60px;
+	}
+	.item-banner.style21 .title {
+		font-size: 26px;
+	}
+	.dungar-product.layout1 .head .title {
+		font-size: 22px;
+	}
+	.dungar-product.layout1 {
+		padding: 40px 0 20px;
+	}
+	.banner-pinmap-wrapp.rows-space-70 {
+		margin-bottom: 40px;
+	}
+	.home-slider.fullwidth.rows-space-60 {
+		margin-bottom: 35px;
+	}
+	.item-banner.style16 .title,
+	.item-banner.style12 .title {
+		font-size: 26px;
+	}
+	.item-banner.style14 .title {
+		font-size: 30px;
+	}
+	.product-in-stock-wrapp.rows-space-40 {
+		margin-bottom: 10px;
+	}
+	.instagram-wrapp .custommenu-title-blog i {
+		font-size: 50px;
+	}
+	.home-slider .slick-slider.nav-center > .slick-arrow {
+		display: none !important;
+	}
+	.dungar-newsletter.default .title,
+	.product-grid-title,
+	.custommenu-title-blog {
+		font-size: 20px;
+	}
+	.product-grid-title,
+	.custommenu-title-blog {
+		margin-bottom: 30px;
+	}
+	.dungar-tabs .tab-head {
+		margin-bottom: 30px;
+	}
+	.dungar-tabs.default.rows-space-40 {
+		margin-bottom: 25px;
+	}
+	.banner-wrapp.rows-space-60 {
+		margin-bottom: 47px;
+	}
+	.logo img {
+		max-width: 140px;
+	}
+	.slick-dots {
+		margin-top: 25px;
+	}
+	.dungar-tabs .tab-link li a {
+		margin: 0 15px;
+	}
+	.item-banner.style6 .title {
+		font-size: 24px;
+	}
+	.product-grid-title {
+		padding-top: 35px;
+	}
+	.tab-details-product {
+		margin-top: 40px;
+	}
+	.cart-form .shop_table tbody tr.cart_item td.product-remove {
+		position: static;
+		transform: none;
+		padding: 20px 0 10px;
+	}
+	.cart-form .shop_table,
+	.cart-form .shop_table tbody,
+	.cart-form .shop_table tr,
+	.cart-form .shop_table td {
+		display: block !important;
+		text-align: center !important;
+		width: 100% !important;
+	}
+	.cart-form .shop_table .product-price {
+		padding-bottom: 20px;
+	}
+	.cart-form .shop_table tbody > tr > td.actions {
+		padding: 20px;
+	}
+	.shop_table .actions > .order-total {
+		float: none;
+	}
+	.cart-form .shop_table .product-quantity .quantity {
+		margin: 0 auto;
+	}
+	.breadcrumb {
+		padding: 25px 0 20px;
+	}
+	.custom_blog_title {
+		margin-bottom: 30px;
+		font-size: 18px;
+	}
+	.blog-articles > .main-info-post {
+		margin-top: 30px;
+		margin-bottom: 30px;
+	}
+	.error-404 {
+		padding: 35px 0 0;
+	}
+	.footer {
+		margin-bottom: 56px;
+	}
+	.footer .footer-end {
+		padding: 20px 0;
+	}
+	.footer .container-wapper {
+		padding-top: 40px;
+	}
+	.footer .border-custom span {
+		margin-top: 20px;
+	}
+	.col-xs-12:last-child .item-banner.style16 .banner-content {
+		margin-bottom: 0;
+	}
+	.header .main-header, .header .top-bar {
+		display: none;
+	}
+	.footer-device-mobile, .header-device-mobile {
+		display: block;
+	}
+	/*single blog*/
+	.blog-item .post-format {
+		float: none;
+		width: auto;
+	}
+	.blog-list .blog-item .post-format {
+		max-width: 100%;
+	}
+	.blog-item .post-info {
+		width: 100%;
+		padding: 0;
+		overflow: visible;
+	}
+	.blog-item .post-info::before {
+		display: none;
+	}
+	.blog-slider.style-1 .blog-item {
+		margin: 0;
+		padding: 15px;
+	}
+	.blog-list .blog-item {
+		padding: 20px;
+	}
+	/*short code*/
+	/*pagination*/
+	.pagination .page-numbers {
+		margin-bottom: 10px;
+	}
+	/*404 page*/
+	.error-404 {
+		display: block;
+	}
+	.error-404 .images, .error-404 .text-404 {
+		display: block;
+		width: 100%;
+		text-align: center;
+		padding-left: 0;
+	}
+	.error-404 .images {
+		margin-bottom: 30px;
+	}
+	.error-404 .search-form .search-field {
+		margin-right: 0
+	}
+	.text-404 .page-title {
+		margin-top: 0;
+	}
+	/*about page*/
+	.dungar-iconbox.layout1 {
+		text-align: center;
+		margin-top: 50px;
+	}
+	.dungar-iconbox.layout1 .icon-item {
+		display: inline-block;
+	}
+	/*shop page*/
+	.shop-top-control .select-form, .shop-top-control .grid-view-mode, .shop-top-control {
+		display: inline-block;
+		text-align: center;
+		vertical-align: top;
+	}
+	.shop-top-control .select-form, .grid-view-mode {
+		margin-bottom: 10px;
+		margin-top: 10px;
+	}
+	.shop-top-control .grid-view-mode {
+		width: auto;
+	}
+	.full-width .details-thumd {
+		padding: 0;
+	}
+	.full-width .details-thumd .owl-nav .owl-prev {
+		left: 0;
+	}
+	.full-width .details-thumd .owl-nav .owl-next {
+		right: 0;
+	}
+	.item-banner.style1 .banner-content, .item-banner.style2 .banner-content {
+		padding-left: 30px;
+	}
+	/*product item*/
+	.product-item .loop-form-add-to-cart {
+		display: none;
+	}
+	/*product list*/
+	.product-item.style-list .product-thumb, .product-item.style-list .product-info-left, .product-item.style-list .product-info-right {
+		display: block;
+		padding: 0;
+		border: none;
+		text-align: center;
+		margin: 0 auto
+	}
+	.product-item.style-list .yith-wcwl-add-to-wishlist {
+		width: auto;
+		float: none;
+	}
+	.slider-lookbook-item .lookboox-thumb {
+		float: none;
+		text-align: center;
+		margin: 0 auto;
+	}
+	.slider-lookbook-item .lookboox-infore {
+		padding: 15px 0 0;
+	}
+	.slider-lookbook-item .name-lookbook {
+		margin-bottom: 20px;
+	}
+	/*details page*/
+	.details-thumd {
+		width: 100%;
+		padding: 0;
+		margin-bottom: 30px;
+	}
+	.details-infor {
+		width: 100%;
+		padding: 0;
+		border: 0;
+		float: none;
+	}
+    .tab-details-product .image img{
+        width:100%;
+    }
+	.tab-details-product .tab-link li {
+		display: block;
+		text-align: center;
+		padding: 0;
+		margin-bottom: 10px;
+	}
+	/*backtotop*/
+	.backtotop.show {
+		display: none !important;
+	}
+	/*====================home 01==============*/
+	.product-item.style2 .product-thumb, .product-item.style2 .product-info {
+		display: block;
+		text-align: center;
+		padding: 0;
+		width: 100%
+	}
+	.product-item.style2 .product-thumb .thumb-inner img, .product-item.style2 .group-buttons {
+		margin: 0 auto;
+	}
+	.dungar-tabs .tab-link li {
+		padding: 10px 0;
+	}
+	.slider-item.style1 .slider-inner .slider-infor, .slider-item.style3 .slider-inner .slider-infor, .slider-item.style2 .slider-inner .slider-infor,
+	.slider-item.style4 .slider-inner .slider-infor, .slider-item.style5 .slider-inner .slider-infor, .slider-item.style6 .slider-inner .slider-infor,
+	.slider-item.style7 .slider-inner .slider-infor, .slider-item.style8 .slider-inner .slider-infor, .slider-item.style9 .slider-inner .slider-infor,
+	.slider-item.style10 .slider-inner .slider-infor, .slider-item.style11 .slider-inner .slider-infor, .slider-item.style12 .slider-inner .slider-infor,
+	.slider-item.style13 .slider-inner .slider-infor, .slider-item.style14 .slider-inner .slider-infor, .slider-item.style15 .slider-inner .slider-infor,
+	.slider-item.style19 .slider-inner .slider-infor, .slider-item.style20 .slider-inner .slider-infor, .slider-item.style21 .slider-inner .slider-infor,
+	.slider-item.style22 .slider-inner .slider-infor, .slider-item.style23 .slider-inner .slider-infor, .slider-item.style24 .slider-inner .slider-infor,
+	.slider-item.style25 .slider-inner .slider-infor, .slider-item.style26 .slider-inner .slider-infor, .slider-item.style27 .slider-inner .slider-infor {
+		padding-right: 30px;
+		padding-left: 30px;
+	}
+	.item-banner.style3 .banner-content {
+		padding-left: 30px;
+	}
+	/*====================home 04==============*/
+	.vertical-style .mega-menu .dungar-custommenu .widgettitle, .vertical-style .mega-menu .dungar-custommenu ul li a {
+		color: #0a0a0a;
+	}
+	/*====================home 05==============*/
+	.dungar-newsletter.style3 .submit-newsletter {
+		margin-left: 0;
+	}
+	.dungar-newsletter.style3 .newsletter-head {
+		margin: 0;
+	}
+	/*====================home 06==============*/
+	.header-vertical .header {
+		left: -100%;
+	}
+	.header-vertical {
+		padding-left: 0;
+	}
+	/*====================home 07==============*/
+	.product-item.style-3 .product-thumb {
+		float: none;
+		max-width: 100%;
+		margin: 0;
+	}
+	.owl-products .product-item.style-3 .product-thumb img {
+		margin: 0 auto;
+	}
+	.product-item.style-3 .product-info {
+		text-align: center;
+	}
+	.product-item.style-3 .group-buttons {
+		display: none;
+	}
+	/*====================home 08==============*/
+	.dungar-product.layout1 .head {
+		width: 100%;
+		padding-top: 0;
+		margin-bottom: 30px;
+		margin-right: 0;
+		padding-bottom: 70px;
+	}
+	.dungar-product.layout1 .product-list-owl {
+		width: 100%;
+	}
+	.slick-slider.nav-center-left .slick-arrow {
+		top: 85px;
+		left: auto;
+		right: calc(50% - 80px);
+		transform: translateX(-50%);
+	}
+	.slick-slider.nav-center-left .slick-arrow:first-child {
+		left: calc(50% - 25px);
+	}
+	.dungar-testimonials.default .testimonial-item {
+		padding-left: 15px;
+		padding-right: 15px;
+	}
+	/*====================home 09==============*/
+	/*====================home 10==============*/
+	.product-item.style-6.product-type-variable .product-inner {
+		padding-bottom: 30px;
+	}
+	.dungar-iconbox.default {
+		border: none;
+	}
+	.dungar-contact-info .title {
+		margin-bottom: 20px;
+		font-size: 14px;
+	}
+	.main-content {
+		padding-bottom: 50px;
+	}
+	.dungar-newsletter.style1 .title, .dungar-newsletter.style2 .title,
+	.footer .widgettitle {
+		margin-top: 5px;
+	}
+	.slider-item.style4 .title-big,
+	.slider-item.style5 .title-big,
+	.slider-item.style6 .title-big {
+		font-size: 28px;
+	}
+}
+@media (max-width: 480px) {
+	.dungar-newsletter.style3 .title,
+	.dungar-newsletter.default .title,
+	.product-grid-title,
+	.custommenu-title-blog {
+		font-size: 18px;
+	}
+	.slider-item .title-big {
+		max-width: 100%;
+	}
+	.dungar-blog-item.style2 .post-thumb {
+		float: none;
+		width: auto;
+	}
+	.dungar-blog-item.style2 .blog-title {
+		margin-bottom: 30px;
+	}
+	.dungar-blog-item.style2 .blog-info {
+		width: 100%;
+		padding: 0;
+		overflow: visible;
+	}
+	.coppyright {
+		font-size: 13px;
+	}
+	.product-item .product-inner {
+		text-align: center;
+	}
+	.product-list-owl .product-item .thumb-inner img {
+		margin: 0 auto;
+	}
+	/*footer*/
+	.dungar-newsletter.style1 .newsletter-form-wrap .submit-newsletter {
+		padding-left: 10px;
+		padding-right: 10px;
+	}
+	/*single blog*/
+	.view-share .author-view, .view-share .share {
+		display: block;
+		float: none;
+	}
+	.comment-form .form-submit .controll {
+		float: none;
+		text-align: center;
+	}
+	/*short code*/
+	.pagination.style1 {
+		text-align: center;
+	}
+	/*login*/
+	.customer_login .login, .customer_login .register {
+		padding: 20px 15px 10px;
+	}
+	.customer_login .title-login {
+		padding: 15px;
+	}
+	/*contact page*/
+	.form-message, .form-contact-information {
+		padding: 20px 15px
+	}
+	.dungar-contact-info .socials {
+		padding-top: 0;
+	}
+	.dungar-contact-info .item {
+		margin-bottom: 20px;
+	}
+	/*shop page*/
+	.shop-top-control .select-form, .shop-top-control .grid-view-mode, .shop-top-control {
+		display: block;
+		width: 100%;
+		border: none;
+	}
+	.shop-top-control {
+		padding-top: 10px;
+		margin-bottom: 30px;
+	}
+	.shop-top-control .grid-view-mode {
+		margin-bottom: 0;
+	}
+	/*lookbook*/
+	.sevice-box-content {
+		padding-left: 15px;
+		padding-right: 15px;
+	}
+	/*checkout page*/
+	.shipping-address .form-row.form-row-first, .shipping-address .form-row.form-row-last {
+		width: 100%;
+	}
+	.shipping-address .form-row.form-row-last {
+		float: none;
+	}
+	.checkout-wrapp .forn-row-col {
+		width: 100%;
+		padding: 0;
+	}
+	.payment-method .form-row-card-number {
+		max-width: 100%;
+	}
+	.list-product-order .product-thumb {
+		float: none;
+		width: auto;
+		margin-bottom: 20px;
+		margin-right: 0;
+	}
+	/*shop page*/
+	/*===============home 01===============*/
+	.dungar-blog-item .post-thumb img {
+		width: 100%;
+	}
+	.slider-item .button {
+		margin-bottom: 20px;
+	}
+	.header-block-text-wrapp {
+		background: #111111;
+	}
+	.header-top-message {
+		font-size: 11px;
+		padding-top: 5px;
+		padding-bottom: 5px;
+		line-height: 16px;
+	}
+	.header-block-text {
+		font-size: 11px;
+		padding-top: 5px;
+		padding-bottom: 5px;
+		line-height: 16px;
+	}
+	.header-top-message .icon {
+		font-size: 15px;
+	}
+	.header-block-text .icon {
+		font-size: 15px;
+	}
+	.header-device-mobile .mobile-search-box, .header-device-mobile .mobile-settings-box, .header-device-mobile .menu-bar {
+		width: 35px;
+	}
+	.header-device-mobile .mobile-navigation, .mobile-search-box > a, .mobile-settings-box > a {
+		width: 35px;
+		height: 35px;
+		line-height: 31px;
+	}
+	.header-device-mobile .mobile-navigation {
+		padding: 11px 8px 10px;
+	}
+	.slider-item.style4 .slider-inner .slider-infor, .slider-item.style5 .slider-inner .slider-infor, .slider-item.style6 .slider-inner .slider-infor,
+	.slider-item.style1 .slider-inner .slider-infor, .slider-item.style3 .slider-inner .slider-infor, .slider-item.style2 .slider-inner .slider-infor,
+	.slider-item.style7 .slider-inner .slider-infor, .slider-item.style8 .slider-inner .slider-infor, .slider-item.style9 .slider-inner .slider-infor,
+	.slider-item.style13 .slider-inner .slider-infor, .slider-item.style14 .slider-inner .slider-infor, .slider-item.style15 .slider-inner .slider-infor,
+	.slider-item.style19 .slider-inner .slider-infor, .slider-item.style20 .slider-inner .slider-infor, .slider-item.style21 .slider-inner .slider-infor,
+	.slider-item.style25 .slider-inner .slider-infor, .slider-item.style26 .slider-inner .slider-infor, .slider-item.style27 .slider-inner .slider-infor {
+		padding-right: 15px;
+		padding-left: 15px;
+		padding-top: 55px;
+		padding-bottom: 55px;
+	}
+	/*===================home 02======================*/
+	.slider-item.style4 .title-big,
+	.slider-item.style5 .title-big,
+	.slider-item.style6 .title-big {
+		font-size: 26px;
+	}
+	.item-banner .banner-content {
+		padding-right: 15px !important;
+		padding-left: 15px !important;
+	}
+	/*===================home 05======================*/
+	.dungar-newsletter.style3 .newsletter-form-wrap,
+	.dungar-newsletter.style3 .email-newsletter {
+		width: 100%;
+	}
+	.dungar-newsletter.style3 {
+		padding-left: 15px;
+		padding-right: 15px;
+	}
+	/*===================home 08======================*/
+	.dungar-testimonials.default .testimonial-item {
+		padding: 20px;
+		text-align: center;
+	}
+	.testimonial-item .image {
+		float: none;
+	}
+	.testimonial-item .info {
+		padding: 20px;
+	}
+}
+.button, button, input[type="submit"], .block-minicart .shopcart-icon .count, .load-more a:hover,
+.dungar-newsletter.style1 .newsletter-form-wrap .submit-newsletter:hover, .customer_login input[type="submit"],
+.sevice-box-content .sevice-button:hover, .footer-device-mobile-item.device-cart .count-icon, .widget_filter_size li.active,
+.product-item.style-list .single_variation_wrap > .button:hover, .shoppingcart-content .control-cart .button:hover, .checkout-wrapp .button:hover,
+.checkout-wrapp .group-button-payment .btn-credit-card, .payment-method-wrapp .button-control .btn-pay-now, .end-checkout .button, .btn-zoom.open_qv:hover,
+.attribute_size .list-size a.active, .attribute_size .list-size a:hover, .tab-details-product .tab-link li a::after,
+.product-item.style2 .group-buttons .button:hover, .product-item.style-2 .group-buttons .added_to_cart:hover, .kt-popup-newsletter.style-2 .mfp-close,
+.shopcart-description .actions .button-viewcart:hover, .kt-popup-quickview .mfp-close, .dungar-newsletter.style2 .newsletter-form-wrap .submit-newsletter:hover,
+.product-item.style-6 .loop-form-add-to-cart .button, .pinmap-buttom, .header-nav-wapper .vertical-wapper,
+.list-category .category-item:hover {
+	background-color: #dd3232;
+	
+}
+.product-item .button:hover,
+input[type="text"]:focus,
+input[type="number"]:focus,
+input[type="search"]:focus,
+input[type="password"]:focus,
+input[type="tel"]:focus,
+input[type="url"]:focus,
+textarea:focus,
+button:focus,
+select:focus, .sevice-box-content .sevice-button:hover, .widget_filter_size li.active, .widget_filter_size li:hover,
+.shoppingcart-content .control-cart .button:hover, .checkout-wrapp .button:hover,
+.checkout-wrapp .group-button-payment .btn-credit-card, .payment-method-wrapp .button-control .btn-pay-now, .end-checkout .button, .btn-zoom.open_qv:hover,
+.attribute_size .list-size a.active, .attribute_size .list-size a:hover, .shopcart-description .actions .button-viewcart:hover,
+.product-item.style-6 .loop-form-add-to-cart .button {
+	
+	border-color: #fff !important;
+	
+}
+a:hover, a:focus, a:active,
+.product-item.style-2 ul li a:hover, .quantity .btn-number:hover, .header-user-form-tabs .tab-link li.active,
+.review .view:hover, .review .s-comments:hover, .product-item.style-list .product-info-left .attributes-display li a:hover, .cart-form .product-remove:hover a:before,
+.cart-form .shop_table .product-name .attributes-select:hover, .cart-form .coupon .button:hover, .slick-slider.slider-lookbook.nav-center > .slick-arrow:hover, .slider-lookbook-item .view-the-look:hover,
+.list-product-order .attributes-select:hover, .header-language .dungar-submenu > li > a:hover, .sidebar input[type="checkbox"]:checked + label::before,
+.main-menu .submenu > li:hover > a, .main-menu .submenu > li.active > a, .block-minicart .no-product .text span,
+.header-account .login .lost_password, .details-thumd .owl-nav div:hover, .details-infor .availability a,
+.details-infor .group-button .yith-wcwl-add-to-wishlist div a:hover::before, .details-infor .group-button .size-chart-wrapp .btn-size-chart a:hover::before,
+.tab-details-product .tab-link li.active a, .review_form .comment-form-review .stars a.active, .review_form .comment-form-review .stars a:hover,
+.related .slick-slider.nav-center > .slick-arrow:hover, .up-sells .slick-slider.nav-center > .slick-arrow:hover, .slider-item .button:hover, .slick-slider.nav-center > .slick-arrow:hover {
+	color: #dd3232;
+	
+}
+.details-thumd .thumbnails_carousel .owl-item .active img {
+	border-color: #dd3232;
+}
+@media (min-width: 1367px) {
+	.home-slider.fullwidth.rows-space-60 {
+		margin-bottom: 80px;
+	}
+	.banner-wrapp.rows-space-35 {
+		margin-bottom: 55px;
+	}
+	.dungar-tabs.default.rows-space-40 {
+		margin-bottom: 60px;
+	}
+	.banner-wrapp.rows-space-60 {
+		margin-bottom: 80px;
+	}
+	.banner-wrapp.rows-space-30 {
+		margin-bottom: 50px;
+	}
+	.main-content {
+		padding-bottom: 85px;
+	}
+	.instagram-wrapp .custommenu-title-blog {
+		margin-top: 70px;
+	}
+	.home-slider-banner {
+		margin-bottom: 58px;
+	}
+	.dungar-product.produc-featured.rows-space-65 {
+		margin-bottom: 82px;
+	}
+	.banner-wrapp.rows-space-65 {
+		margin-bottom: 85px;
+	}
+	.dungar-blog-wraap.default {
+		padding-top: 72px;
+		padding-bottom: 75px;
+	}
+	.home-slider.fullwidth.rows-space-60 {
+		margin-bottom: 80px;
+	}
+	.dungar-product.produc-featured.rows-space-40 {
+		margin-bottom: 60px;
+	}
+	.banner-pinmap-wrapp.rows-space-70 {
+		margin-bottom: 90px;
+	}
+	.dungar-product.layout1 {
+		padding: 90px 0 52px;
+	}
+}
+.product-item .product-inner img {
+	width: 100%;
+}

BIN
src/main/resources/static/font/92zUtBhPNqw73oHt4D4h.woff2


BIN
src/main/resources/static/font/92zUtBhPNqw73oHt5D4hTxM.woff2


BIN
src/main/resources/static/font/92zUtBhPNqw73oHt7j4hTxM.woff2


BIN
src/main/resources/static/font/92zatBhPNqw73oDd4iYl.woff2


BIN
src/main/resources/static/font/92zatBhPNqw73oTd4g.woff2


BIN
src/main/resources/static/font/92zatBhPNqw73ord4iYl.woff2


BIN
src/main/resources/static/font/Flaticon.woff2


BIN
src/main/resources/static/font/fontawesome-webfont.woff2


BIN
src/main/resources/static/image/blank.gif


BIN
src/main/resources/static/image/fancybox_overlay.png


BIN
src/main/resources/static/image/fancybox_sprite.png


BIN
src/main/resources/static/image/icon-checkout.png


BIN
src/main/resources/static/image/quote-item.png


Файловите разлики са ограничени, защото са твърде много
+ 5 - 0
src/main/resources/static/js/bootstrap.min.js


+ 1230 - 0
src/main/resources/static/js/chosen.min.js

@@ -0,0 +1,1230 @@
+/*!
+ Chosen, a Select Box Enhancer for jQuery and Prototype
+ by Patrick Filler for Harvest, http://getharvest.com
+ 
+ Version 1.1.0
+ Full source at https://github.com/harvesthq/chosen
+ Copyright (c) 2011 Harvest http://getharvest.com
+ 
+ MIT License, https://github.com/harvesthq/chosen/blob/master/LICENSE.md
+ This file is generated by `grunt build`, do not edit it by hand.
+ */
+
+(function () {
+    var $, AbstractChosen, Chosen, SelectParser, _ref,
+            __hasProp = {}.hasOwnProperty,
+            __extends = function (child, parent) {
+                for (var key in parent) {
+                    if (__hasProp.call(parent, key))
+                        child[key] = parent[key];
+                }
+                function ctor() {
+                    this.constructor = child;
+                }
+                ctor.prototype = parent.prototype;
+                child.prototype = new ctor();
+                child.__super__ = parent.prototype;
+                return child;
+            };
+
+    SelectParser = (function () {
+        function SelectParser() {
+            this.options_index = 0;
+            this.parsed = [];
+        }
+
+        SelectParser.prototype.add_node = function (child) {
+            if (child.nodeName.toUpperCase() === "OPTGROUP") {
+                return this.add_group(child);
+            } else {
+                return this.add_option(child);
+            }
+        };
+
+        SelectParser.prototype.add_group = function (group) {
+            var group_position, option, _i, _len, _ref, _results;
+            group_position = this.parsed.length;
+            this.parsed.push({
+                array_index: group_position,
+                group: true,
+                label: this.escapeExpression(group.label),
+                children: 0,
+                disabled: group.disabled
+            });
+            _ref = group.childNodes;
+            _results = [];
+            for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+                option = _ref[_i];
+                _results.push(this.add_option(option, group_position, group.disabled));
+            }
+            return _results;
+        };
+
+        SelectParser.prototype.add_option = function (option, group_position, group_disabled) {
+            if (option.nodeName.toUpperCase() === "OPTION") {
+                if (option.text !== "") {
+                    if (group_position != null) {
+                        this.parsed[group_position].children += 1;
+                    }
+                    this.parsed.push({
+                        array_index: this.parsed.length,
+                        options_index: this.options_index,
+                        value: option.value,
+                        text: option.text,
+                        html: option.innerHTML,
+                        selected: option.selected,
+                        disabled: group_disabled === true ? group_disabled : option.disabled,
+                        group_array_index: group_position,
+                        classes: option.className,
+                        style: option.style.cssText
+                    });
+                } else {
+                    this.parsed.push({
+                        array_index: this.parsed.length,
+                        options_index: this.options_index,
+                        empty: true
+                    });
+                }
+                return this.options_index += 1;
+            }
+        };
+
+        SelectParser.prototype.escapeExpression = function (text) {
+            var map, unsafe_chars;
+            if ((text == null) || text === false) {
+                return "";
+            }
+            if (!/[\&\<\>\"\'\`]/.test(text)) {
+                return text;
+            }
+            map = {
+                "<": "&lt;",
+                ">": "&gt;",
+                '"': "&quot;",
+                "'": "&#x27;",
+                "`": "&#x60;"
+            };
+            unsafe_chars = /&(?!\w+;)|[\<\>\"\'\`]/g;
+            return text.replace(unsafe_chars, function (chr) {
+                return map[chr] || "&amp;";
+            });
+        };
+
+        return SelectParser;
+
+    })();
+
+    SelectParser.select_to_array = function (select) {
+        var child, parser, _i, _len, _ref;
+        parser = new SelectParser();
+        _ref = select.childNodes;
+        for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+            child = _ref[_i];
+            parser.add_node(child);
+        }
+        return parser.parsed;
+    };
+
+    AbstractChosen = (function () {
+        function AbstractChosen(form_field, options) {
+            this.form_field = form_field;
+            this.options = options != null ? options : {};
+            if (!AbstractChosen.browser_is_supported()) {
+                return;
+            }
+            this.is_multiple = this.form_field.multiple;
+            this.set_default_text();
+            this.set_default_values();
+            this.setup();
+            this.set_up_html();
+            this.register_observers();
+        }
+
+        AbstractChosen.prototype.set_default_values = function () {
+            var _this = this;
+            this.click_test_action = function (evt) {
+                return _this.test_active_click(evt);
+            };
+            this.activate_action = function (evt) {
+                return _this.activate_field(evt);
+            };
+            this.active_field = false;
+            this.mouse_on_container = false;
+            this.results_showing = false;
+            this.result_highlighted = null;
+            this.allow_single_deselect = (this.options.allow_single_deselect != null) && (this.form_field.options[0] != null) && this.form_field.options[0].text === "" ? this.options.allow_single_deselect : false;
+            this.disable_search_threshold = this.options.disable_search_threshold || 0;
+            this.disable_search = this.options.disable_search || false;
+            this.enable_split_word_search = this.options.enable_split_word_search != null ? this.options.enable_split_word_search : true;
+            this.group_search = this.options.group_search != null ? this.options.group_search : true;
+            this.search_contains = this.options.search_contains || false;
+            this.single_backstroke_delete = this.options.single_backstroke_delete != null ? this.options.single_backstroke_delete : true;
+            this.max_selected_options = this.options.max_selected_options || Infinity;
+            this.inherit_select_classes = this.options.inherit_select_classes || false;
+            this.display_selected_options = this.options.display_selected_options != null ? this.options.display_selected_options : true;
+            return this.display_disabled_options = this.options.display_disabled_options != null ? this.options.display_disabled_options : true;
+        };
+
+        AbstractChosen.prototype.set_default_text = function () {
+            if (this.form_field.getAttribute("data-placeholder")) {
+                this.default_text = this.form_field.getAttribute("data-placeholder");
+            } else if (this.is_multiple) {
+                this.default_text = this.options.placeholder_text_multiple || this.options.placeholder_text || AbstractChosen.default_multiple_text;
+            } else {
+                this.default_text = this.options.placeholder_text_single || this.options.placeholder_text || AbstractChosen.default_single_text;
+            }
+            return this.results_none_found = this.form_field.getAttribute("data-no_results_text") || this.options.no_results_text || AbstractChosen.default_no_result_text;
+        };
+
+        AbstractChosen.prototype.mouse_enter = function () {
+            return this.mouse_on_container = true;
+        };
+
+        AbstractChosen.prototype.mouse_leave = function () {
+            return this.mouse_on_container = false;
+        };
+
+        AbstractChosen.prototype.input_focus = function (evt) {
+            var _this = this;
+            if (this.is_multiple) {
+                if (!this.active_field) {
+                    return setTimeout((function () {
+                        return _this.container_mousedown();
+                    }), 50);
+                }
+            } else {
+                if (!this.active_field) {
+                    return this.activate_field();
+                }
+            }
+        };
+
+        AbstractChosen.prototype.input_blur = function (evt) {
+            var _this = this;
+            if (!this.mouse_on_container) {
+                this.active_field = false;
+                return setTimeout((function () {
+                    return _this.blur_test();
+                }), 100);
+            }
+        };
+
+        AbstractChosen.prototype.results_option_build = function (options) {
+            var content, data, _i, _len, _ref;
+            content = '';
+            _ref = this.results_data;
+            for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+                data = _ref[_i];
+                if (data.group) {
+                    content += this.result_add_group(data);
+                } else {
+                    content += this.result_add_option(data);
+                }
+                if (options != null ? options.first : void 0) {
+                    if (data.selected && this.is_multiple) {
+                        this.choice_build(data);
+                    } else if (data.selected && !this.is_multiple) {
+                        this.single_set_selected_text(data.text);
+                    }
+                }
+            }
+            return content;
+        };
+
+        AbstractChosen.prototype.result_add_option = function (option) {
+            var classes, option_el;
+            if (!option.search_match) {
+                return '';
+            }
+            if (!this.include_option_in_results(option)) {
+                return '';
+            }
+            classes = [];
+            if (!option.disabled && !(option.selected && this.is_multiple)) {
+                classes.push("active-result");
+            }
+            if (option.disabled && !(option.selected && this.is_multiple)) {
+                classes.push("disabled-result");
+            }
+            if (option.selected) {
+                classes.push("result-selected");
+            }
+            if (option.group_array_index != null) {
+                classes.push("group-option");
+            }
+            if (option.classes !== "") {
+                classes.push(option.classes);
+            }
+            option_el = document.createElement("li");
+            option_el.className = classes.join(" ");
+            option_el.style.cssText = option.style;
+            option_el.setAttribute("data-option-array-index", option.array_index);
+            option_el.innerHTML = option.search_text;
+            return this.outerHTML(option_el);
+        };
+
+        AbstractChosen.prototype.result_add_group = function (group) {
+            var group_el;
+            if (!(group.search_match || group.group_match)) {
+                return '';
+            }
+            if (!(group.active_options > 0)) {
+                return '';
+            }
+            group_el = document.createElement("li");
+            group_el.className = "group-result";
+            group_el.innerHTML = group.search_text;
+            return this.outerHTML(group_el);
+        };
+
+        AbstractChosen.prototype.results_update_field = function () {
+            this.set_default_text();
+            if (!this.is_multiple) {
+                this.results_reset_cleanup();
+            }
+            this.result_clear_highlight();
+            this.results_build();
+            if (this.results_showing) {
+                return this.winnow_results();
+            }
+        };
+
+        AbstractChosen.prototype.reset_single_select_options = function () {
+            var result, _i, _len, _ref, _results;
+            _ref = this.results_data;
+            _results = [];
+            for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+                result = _ref[_i];
+                if (result.selected) {
+                    _results.push(result.selected = false);
+                } else {
+                    _results.push(void 0);
+                }
+            }
+            return _results;
+        };
+
+        AbstractChosen.prototype.results_toggle = function () {
+            if (this.results_showing) {
+                return this.results_hide();
+            } else {
+                return this.results_show();
+            }
+        };
+
+        AbstractChosen.prototype.results_search = function (evt) {
+            if (this.results_showing) {
+                return this.winnow_results();
+            } else {
+                return this.results_show();
+            }
+        };
+
+        AbstractChosen.prototype.winnow_results = function () {
+            var escapedSearchText, option, regex, regexAnchor, results, results_group, searchText, startpos, text, zregex, _i, _len, _ref;
+            this.no_results_clear();
+            results = 0;
+            searchText = this.get_search_text();
+            escapedSearchText = searchText.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+            regexAnchor = this.search_contains ? "" : "^";
+            regex = new RegExp(regexAnchor + escapedSearchText, 'i');
+            zregex = new RegExp(escapedSearchText, 'i');
+            _ref = this.results_data;
+            for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+                option = _ref[_i];
+                option.search_match = false;
+                results_group = null;
+                if (this.include_option_in_results(option)) {
+                    if (option.group) {
+                        option.group_match = false;
+                        option.active_options = 0;
+                    }
+                    if ((option.group_array_index != null) && this.results_data[option.group_array_index]) {
+                        results_group = this.results_data[option.group_array_index];
+                        if (results_group.active_options === 0 && results_group.search_match) {
+                            results += 1;
+                        }
+                        results_group.active_options += 1;
+                    }
+                    if (!(option.group && !this.group_search)) {
+                        option.search_text = option.group ? option.label : option.html;
+                        option.search_match = this.search_string_match(option.search_text, regex);
+                        if (option.search_match && !option.group) {
+                            results += 1;
+                        }
+                        if (option.search_match) {
+                            if (searchText.length) {
+                                startpos = option.search_text.search(zregex);
+                                text = option.search_text.substr(0, startpos + searchText.length) + '</em>' + option.search_text.substr(startpos + searchText.length);
+                                option.search_text = text.substr(0, startpos) + '<em>' + text.substr(startpos);
+                            }
+                            if (results_group != null) {
+                                results_group.group_match = true;
+                            }
+                        } else if ((option.group_array_index != null) && this.results_data[option.group_array_index].search_match) {
+                            option.search_match = true;
+                        }
+                    }
+                }
+            }
+            this.result_clear_highlight();
+            if (results < 1 && searchText.length) {
+                this.update_results_content("");
+                return this.no_results(searchText);
+            } else {
+                this.update_results_content(this.results_option_build());
+                return this.winnow_results_set_highlight();
+            }
+        };
+
+        AbstractChosen.prototype.search_string_match = function (search_string, regex) {
+            var part, parts, _i, _len;
+            if (regex.test(search_string)) {
+                return true;
+            } else if (this.enable_split_word_search && (search_string.indexOf(" ") >= 0 || search_string.indexOf("[") === 0)) {
+                parts = search_string.replace(/\[|\]/g, "").split(" ");
+                if (parts.length) {
+                    for (_i = 0, _len = parts.length; _i < _len; _i++) {
+                        part = parts[_i];
+                        if (regex.test(part)) {
+                            return true;
+                        }
+                    }
+                }
+            }
+        };
+
+        AbstractChosen.prototype.choices_count = function () {
+            var option, _i, _len, _ref;
+            if (this.selected_option_count != null) {
+                return this.selected_option_count;
+            }
+            this.selected_option_count = 0;
+            _ref = this.form_field.options;
+            for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+                option = _ref[_i];
+                if (option.selected) {
+                    this.selected_option_count += 1;
+                }
+            }
+            return this.selected_option_count;
+        };
+
+        AbstractChosen.prototype.choices_click = function (evt) {
+            evt.preventDefault();
+            if (!(this.results_showing || this.is_disabled)) {
+                return this.results_show();
+            }
+        };
+
+        AbstractChosen.prototype.keyup_checker = function (evt) {
+            var stroke, _ref;
+            stroke = (_ref = evt.which) != null ? _ref : evt.keyCode;
+            this.search_field_scale();
+            switch (stroke) {
+                case 8:
+                    if (this.is_multiple && this.backstroke_length < 1 && this.choices_count() > 0) {
+                        return this.keydown_backstroke();
+                    } else if (!this.pending_backstroke) {
+                        this.result_clear_highlight();
+                        return this.results_search();
+                    }
+                    break;
+                case 13:
+                    evt.preventDefault();
+                    if (this.results_showing) {
+                        return this.result_select(evt);
+                    }
+                    break;
+                case 27:
+                    if (this.results_showing) {
+                        this.results_hide();
+                    }
+                    return true;
+                case 9:
+                case 38:
+                case 40:
+                case 16:
+                case 91:
+                case 17:
+                    break;
+                default:
+                    return this.results_search();
+            }
+        };
+
+        AbstractChosen.prototype.clipboard_event_checker = function (evt) {
+            var _this = this;
+            return setTimeout((function () {
+                return _this.results_search();
+            }), 50);
+        };
+
+        AbstractChosen.prototype.container_width = function () {
+            if (this.options.width != null) {
+                return this.options.width;
+            } else {
+                return "" + this.form_field.offsetWidth + "px";
+            }
+        };
+
+        AbstractChosen.prototype.include_option_in_results = function (option) {
+            if (this.is_multiple && (!this.display_selected_options && option.selected)) {
+                return false;
+            }
+            if (!this.display_disabled_options && option.disabled) {
+                return false;
+            }
+            if (option.empty) {
+                return false;
+            }
+            return true;
+        };
+
+        AbstractChosen.prototype.search_results_touchstart = function (evt) {
+            this.touch_started = true;
+            return this.search_results_mouseover(evt);
+        };
+
+        AbstractChosen.prototype.search_results_touchmove = function (evt) {
+            this.touch_started = false;
+            return this.search_results_mouseout(evt);
+        };
+
+        AbstractChosen.prototype.search_results_touchend = function (evt) {
+            if (this.touch_started) {
+                return this.search_results_mouseup(evt);
+            }
+        };
+
+        AbstractChosen.prototype.outerHTML = function (element) {
+            var tmp;
+            if (element.outerHTML) {
+                return element.outerHTML;
+            }
+            tmp = document.createElement("div");
+            tmp.appendChild(element);
+            return tmp.innerHTML;
+        };
+
+        AbstractChosen.browser_is_supported = function () {
+            //fixed 05-10-2016
+            //https://github.com/harvesthq/chosen/pull/1388
+            //http://clip2net.com/s/3CYjCR5
+            return true;
+            //***
+            if (window.navigator.appName === "Microsoft Internet Explorer") {
+                return document.documentMode >= 8;
+            }
+            if (/iP(od|hone)/i.test(window.navigator.userAgent)) {
+                return false;
+            }
+            if (/Android/i.test(window.navigator.userAgent)) {
+                if (/Mobile/i.test(window.navigator.userAgent)) {
+                    return false;
+                }
+            }
+            return true;
+        };
+
+        AbstractChosen.default_multiple_text = "Select Some Options";
+
+        AbstractChosen.default_single_text = "Select an Option";
+
+        AbstractChosen.default_no_result_text = "No results match";
+
+        return AbstractChosen;
+
+    })();
+
+    $ = jQuery;
+
+    $.fn.extend({
+        chosen: function (options) {
+            if (!AbstractChosen.browser_is_supported()) {
+                return this;
+            }
+            return this.each(function (input_field) {
+                var $this, chosen;
+                $this = $(this);
+                chosen = $this.data('chosen');
+                if (options === 'destroy' && chosen) {
+                    chosen.destroy();
+                } else if (!chosen) {
+                    $this.data('chosen', new Chosen(this, options));
+                }
+            });
+        }
+    });
+
+    Chosen = (function (_super) {
+        __extends(Chosen, _super);
+
+        function Chosen() {
+            _ref = Chosen.__super__.constructor.apply(this, arguments);
+            return _ref;
+        }
+
+        Chosen.prototype.setup = function () {
+            this.form_field_jq = $(this.form_field);
+            this.current_selectedIndex = this.form_field.selectedIndex;
+            return this.is_rtl = this.form_field_jq.hasClass("chosen-rtl");
+        };
+
+        Chosen.prototype.set_up_html = function () {
+            var container_classes, container_props;
+            container_classes = ["chosen-container"];
+            container_classes.push("chosen-container-" + (this.is_multiple ? "multi" : "single"));
+            if (this.inherit_select_classes && this.form_field.className) {
+                container_classes.push(this.form_field.className);
+            }
+            if (this.is_rtl) {
+                container_classes.push("chosen-rtl");
+            }
+            container_props = {
+                'class': container_classes.join(' '),
+                'style': "width: " + (this.container_width()) + ";",
+                'title': this.form_field.title
+            };
+            if (this.form_field.id.length) {
+                container_props.id = this.form_field.id.replace(/[^\w]/g, '_') + "_chosen";
+            }
+            this.container = $("<div />", container_props);
+            if (this.is_multiple) {
+                this.container.html('<ul class="chosen-choices"><li class="search-field"><input type="text" value="' + this.default_text + '" class="default" autocomplete="off" style="width:25px;" /></li></ul><div class="chosen-drop"><ul class="chosen-results"></ul></div>');
+            } else {
+                this.container.html('<a class="chosen-single chosen-default" tabindex="-1"><span>' + this.default_text + '</span><div><b></b></div></a><div class="chosen-drop"><div class="chosen-search"><input type="text" autocomplete="off" /></div><ul class="chosen-results"></ul></div>');
+            }
+            this.form_field_jq.hide().after(this.container);
+            this.dropdown = this.container.find('div.chosen-drop').first();
+            this.search_field = this.container.find('input').first();
+            this.search_results = this.container.find('ul.chosen-results').first();
+            this.search_field_scale();
+            this.search_no_results = this.container.find('li.no-results').first();
+            if (this.is_multiple) {
+                this.search_choices = this.container.find('ul.chosen-choices').first();
+                this.search_container = this.container.find('li.search-field').first();
+            } else {
+                this.search_container = this.container.find('div.chosen-search').first();
+                this.selected_item = this.container.find('.chosen-single').first();
+            }
+            this.results_build();
+            this.set_tab_index();
+            this.set_label_behavior();
+            return this.form_field_jq.trigger("chosen:ready", {
+                chosen: this
+            });
+        };
+
+        Chosen.prototype.register_observers = function () {
+            var _this = this;
+            this.container.bind('mousedown.chosen', function (evt) {
+                _this.container_mousedown(evt);
+            });
+            this.container.bind('mouseup.chosen', function (evt) {
+                _this.container_mouseup(evt);
+            });
+            this.container.bind('mouseenter.chosen', function (evt) {
+                _this.mouse_enter(evt);
+            });
+            this.container.bind('mouseleave.chosen', function (evt) {
+                _this.mouse_leave(evt);
+            });
+            this.search_results.bind('mouseup.chosen', function (evt) {
+                _this.search_results_mouseup(evt);
+            });
+            this.search_results.bind('mouseover.chosen', function (evt) {
+                _this.search_results_mouseover(evt);
+            });
+            this.search_results.bind('mouseout.chosen', function (evt) {
+                _this.search_results_mouseout(evt);
+            });
+            this.search_results.bind('mousewheel.chosen DOMMouseScroll.chosen', function (evt) {
+                _this.search_results_mousewheel(evt);
+            });
+            this.search_results.bind('touchstart.chosen', function (evt) {
+                _this.search_results_touchstart(evt);
+            });
+            this.search_results.bind('touchmove.chosen', function (evt) {
+                _this.search_results_touchmove(evt);
+            });
+            this.search_results.bind('touchend.chosen', function (evt) {
+                _this.search_results_touchend(evt);
+            });
+            this.form_field_jq.bind("chosen:updated.chosen", function (evt) {
+                _this.results_update_field(evt);
+            });
+            this.form_field_jq.bind("chosen:activate.chosen", function (evt) {
+                _this.activate_field(evt);
+            });
+            this.form_field_jq.bind("chosen:open.chosen", function (evt) {
+                _this.container_mousedown(evt);
+            });
+            this.form_field_jq.bind("chosen:close.chosen", function (evt) {
+                _this.input_blur(evt);
+            });
+            this.search_field.bind('blur.chosen', function (evt) {
+                _this.input_blur(evt);
+            });
+            this.search_field.bind('keyup.chosen', function (evt) {
+                _this.keyup_checker(evt);
+            });
+            this.search_field.bind('keydown.chosen', function (evt) {
+                _this.keydown_checker(evt);
+            });
+            this.search_field.bind('focus.chosen', function (evt) {
+                _this.input_focus(evt);
+            });
+            this.search_field.bind('cut.chosen', function (evt) {
+                _this.clipboard_event_checker(evt);
+            });
+            this.search_field.bind('paste.chosen', function (evt) {
+                _this.clipboard_event_checker(evt);
+            });
+            if (this.is_multiple) {
+                return this.search_choices.bind('click.chosen', function (evt) {
+                    _this.choices_click(evt);
+                });
+            } else {
+                return this.container.bind('click.chosen', function (evt) {
+                    evt.preventDefault();
+                });
+            }
+        };
+
+        Chosen.prototype.destroy = function () {
+            $(this.container[0].ownerDocument).unbind("click.chosen", this.click_test_action);
+            if (this.search_field[0].tabIndex) {
+                this.form_field_jq[0].tabIndex = this.search_field[0].tabIndex;
+            }
+            this.container.remove();
+            this.form_field_jq.removeData('chosen');
+            return this.form_field_jq.show();
+        };
+
+        Chosen.prototype.search_field_disabled = function () {
+            this.is_disabled = this.form_field_jq[0].disabled;
+            if (this.is_disabled) {
+                this.container.addClass('chosen-disabled');
+                this.search_field[0].disabled = true;
+                if (!this.is_multiple) {
+                    this.selected_item.unbind("focus.chosen", this.activate_action);
+                }
+                return this.close_field();
+            } else {
+                this.container.removeClass('chosen-disabled');
+                this.search_field[0].disabled = false;
+                if (!this.is_multiple) {
+                    return this.selected_item.bind("focus.chosen", this.activate_action);
+                }
+            }
+        };
+
+        Chosen.prototype.container_mousedown = function (evt) {
+            if (!this.is_disabled) {
+                if (evt && evt.type === "mousedown" && !this.results_showing) {
+                    evt.preventDefault();
+                }
+                if (!((evt != null) && ($(evt.target)).hasClass("search-choice-close"))) {
+                    if (!this.active_field) {
+                        if (this.is_multiple) {
+                            this.search_field.val("");
+                        }
+                        $(this.container[0].ownerDocument).bind('click.chosen', this.click_test_action);
+                        this.results_show();
+                    } else if (!this.is_multiple && evt && (($(evt.target)[0] === this.selected_item[0]) || $(evt.target).parents("a.chosen-single").length)) {
+                        evt.preventDefault();
+                        this.results_toggle();
+                    }
+                    return this.activate_field();
+                }
+            }
+        };
+
+        Chosen.prototype.container_mouseup = function (evt) {
+            if (evt.target.nodeName === "ABBR" && !this.is_disabled) {
+                return this.results_reset(evt);
+            }
+        };
+
+        Chosen.prototype.search_results_mousewheel = function (evt) {
+            var delta;
+            if (evt.originalEvent) {
+                delta = -evt.originalEvent.wheelDelta || evt.originalEvent.detail;
+            }
+            if (delta != null) {
+                evt.preventDefault();
+                if (evt.type === 'DOMMouseScroll') {
+                    delta = delta * 40;
+                }
+                return this.search_results.scrollTop(delta + this.search_results.scrollTop());
+            }
+        };
+
+        Chosen.prototype.blur_test = function (evt) {
+            if (!this.active_field && this.container.hasClass("chosen-container-active")) {
+                return this.close_field();
+            }
+        };
+
+        Chosen.prototype.close_field = function () {
+            $(this.container[0].ownerDocument).unbind("click.chosen", this.click_test_action);
+            this.active_field = false;
+            this.results_hide();
+            this.container.removeClass("chosen-container-active");
+            this.clear_backstroke();
+            this.show_search_field_default();
+            return this.search_field_scale();
+        };
+
+        Chosen.prototype.activate_field = function () {
+            this.container.addClass("chosen-container-active");
+            this.active_field = true;
+            this.search_field.val(this.search_field.val());
+            return this.search_field.focus();
+        };
+
+        Chosen.prototype.test_active_click = function (evt) {
+            var active_container;
+            active_container = $(evt.target).closest('.chosen-container');
+            if (active_container.length && this.container[0] === active_container[0]) {
+                return this.active_field = true;
+            } else {
+                return this.close_field();
+            }
+        };
+
+        Chosen.prototype.results_build = function () {
+            this.parsing = true;
+            this.selected_option_count = null;
+            this.results_data = SelectParser.select_to_array(this.form_field);
+            if (this.is_multiple) {
+                this.search_choices.find("li.search-choice").remove();
+            } else if (!this.is_multiple) {
+                this.single_set_selected_text();
+                if (this.disable_search || this.form_field.options.length <= this.disable_search_threshold) {
+                    this.search_field[0].readOnly = true;
+                    this.container.addClass("chosen-container-single-nosearch");
+                } else {
+                    this.search_field[0].readOnly = false;
+                    this.container.removeClass("chosen-container-single-nosearch");
+                }
+            }
+            this.update_results_content(this.results_option_build({
+                first: true
+            }));
+            this.search_field_disabled();
+            this.show_search_field_default();
+            this.search_field_scale();
+            return this.parsing = false;
+        };
+
+        Chosen.prototype.result_do_highlight = function (el) {
+            var high_bottom, high_top, maxHeight, visible_bottom, visible_top;
+            if (el.length) {
+                this.result_clear_highlight();
+                this.result_highlight = el;
+                this.result_highlight.addClass("highlighted");
+                maxHeight = parseInt(this.search_results.css("maxHeight"), 10);
+                visible_top = this.search_results.scrollTop();
+                visible_bottom = maxHeight + visible_top;
+                high_top = this.result_highlight.position().top + this.search_results.scrollTop();
+                high_bottom = high_top + this.result_highlight.outerHeight();
+                if (high_bottom >= visible_bottom) {
+                    return this.search_results.scrollTop((high_bottom - maxHeight) > 0 ? high_bottom - maxHeight : 0);
+                } else if (high_top < visible_top) {
+                    return this.search_results.scrollTop(high_top);
+                }
+            }
+        };
+
+        Chosen.prototype.result_clear_highlight = function () {
+            if (this.result_highlight) {
+                this.result_highlight.removeClass("highlighted");
+            }
+            return this.result_highlight = null;
+        };
+
+        Chosen.prototype.results_show = function () {
+            if (this.is_multiple && this.max_selected_options <= this.choices_count()) {
+                this.form_field_jq.trigger("chosen:maxselected", {
+                    chosen: this
+                });
+                return false;
+            }
+            this.container.addClass("chosen-with-drop");
+            this.results_showing = true;
+            this.search_field.focus();
+            this.search_field.val(this.search_field.val());
+            this.winnow_results();
+            return this.form_field_jq.trigger("chosen:showing_dropdown", {
+                chosen: this
+            });
+        };
+
+        Chosen.prototype.update_results_content = function (content) {
+            return this.search_results.html(content);
+        };
+
+        Chosen.prototype.results_hide = function () {
+            if (this.results_showing) {
+                this.result_clear_highlight();
+                this.container.removeClass("chosen-with-drop");
+                this.form_field_jq.trigger("chosen:hiding_dropdown", {
+                    chosen: this
+                });
+            }
+            return this.results_showing = false;
+        };
+
+        Chosen.prototype.set_tab_index = function (el) {
+            var ti;
+            if (this.form_field.tabIndex) {
+                ti = this.form_field.tabIndex;
+                this.form_field.tabIndex = -1;
+                return this.search_field[0].tabIndex = ti;
+            }
+        };
+
+        Chosen.prototype.set_label_behavior = function () {
+            var _this = this;
+            this.form_field_label = this.form_field_jq.parents("label");
+            if (!this.form_field_label.length && this.form_field.id.length) {
+                this.form_field_label = $("label[for='" + this.form_field.id + "']");
+            }
+            if (this.form_field_label.length > 0) {
+                return this.form_field_label.bind('click.chosen', function (evt) {
+                    if (_this.is_multiple) {
+                        return _this.container_mousedown(evt);
+                    } else {
+                        return _this.activate_field();
+                    }
+                });
+            }
+        };
+
+        Chosen.prototype.show_search_field_default = function () {
+            if (this.is_multiple && this.choices_count() < 1 && !this.active_field) {
+                this.search_field.val(this.default_text);
+                return this.search_field.addClass("default");
+            } else {
+                this.search_field.val("");
+                return this.search_field.removeClass("default");
+            }
+        };
+
+        Chosen.prototype.search_results_mouseup = function (evt) {
+            var target;
+            target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first();
+            if (target.length) {
+                this.result_highlight = target;
+                this.result_select(evt);
+                return this.search_field.focus();
+            }
+        };
+
+        Chosen.prototype.search_results_mouseover = function (evt) {
+            var target;
+            target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first();
+            if (target) {
+                return this.result_do_highlight(target);
+            }
+        };
+
+        Chosen.prototype.search_results_mouseout = function (evt) {
+            if ($(evt.target).hasClass("active-result" || $(evt.target).parents('.active-result').first())) {
+                return this.result_clear_highlight();
+            }
+        };
+
+        Chosen.prototype.choice_build = function (item) {
+            var choice, close_link,
+                    _this = this;
+            choice = $('<li />', {
+                "class": "search-choice"
+            }).html("<span>" + item.html + "</span>");
+            if (item.disabled) {
+                choice.addClass('search-choice-disabled');
+            } else {
+                close_link = $('<a />', {
+                    "class": 'search-choice-close',
+                    'data-option-array-index': item.array_index
+                });
+                close_link.bind('click.chosen', function (evt) {
+                    return _this.choice_destroy_link_click(evt);
+                });
+                choice.append(close_link);
+            }
+            return this.search_container.before(choice);
+        };
+
+        Chosen.prototype.choice_destroy_link_click = function (evt) {
+            evt.preventDefault();
+            evt.stopPropagation();
+            if (!this.is_disabled) {
+                return this.choice_destroy($(evt.target));
+            }
+        };
+
+        Chosen.prototype.choice_destroy = function (link) {
+            if (this.result_deselect(link[0].getAttribute("data-option-array-index"))) {
+                this.show_search_field_default();
+                if (this.is_multiple && this.choices_count() > 0 && this.search_field.val().length < 1) {
+                    this.results_hide();
+                }
+                link.parents('li').first().remove();
+                return this.search_field_scale();
+            }
+        };
+
+        Chosen.prototype.results_reset = function () {
+            this.reset_single_select_options();
+            this.form_field.options[0].selected = true;
+            this.single_set_selected_text();
+            this.show_search_field_default();
+            this.results_reset_cleanup();
+            this.form_field_jq.trigger("change");
+            if (this.active_field) {
+                return this.results_hide();
+            }
+        };
+
+        Chosen.prototype.results_reset_cleanup = function () {
+            this.current_selectedIndex = this.form_field.selectedIndex;
+            return this.selected_item.find("abbr").remove();
+        };
+
+        Chosen.prototype.result_select = function (evt) {
+            var high, item;
+            if (this.result_highlight) {
+                high = this.result_highlight;
+                this.result_clear_highlight();
+                if (this.is_multiple && this.max_selected_options <= this.choices_count()) {
+                    this.form_field_jq.trigger("chosen:maxselected", {
+                        chosen: this
+                    });
+                    return false;
+                }
+                if (this.is_multiple) {
+                    high.removeClass("active-result");
+                } else {
+                    this.reset_single_select_options();
+                }
+                item = this.results_data[high[0].getAttribute("data-option-array-index")];
+                item.selected = true;
+                this.form_field.options[item.options_index].selected = true;
+                this.selected_option_count = null;
+                if (this.is_multiple) {
+                    this.choice_build(item);
+                } else {
+                    this.single_set_selected_text(item.text);
+                }
+                if (!((evt.metaKey || evt.ctrlKey) && this.is_multiple)) {
+                    this.results_hide();
+                }
+                this.search_field.val("");
+                if (this.is_multiple || this.form_field.selectedIndex !== this.current_selectedIndex) {
+                    this.form_field_jq.trigger("change", {
+                        'selected': this.form_field.options[item.options_index].value
+                    });
+                }
+                this.current_selectedIndex = this.form_field.selectedIndex;
+                evt.preventDefault();
+                evt.stopPropagation();
+                return this.search_field_scale();
+            }
+        };
+
+        Chosen.prototype.single_set_selected_text = function (text) {
+            if (text == null) {
+                text = this.default_text;
+            }
+            if (text === this.default_text) {
+                this.selected_item.addClass("chosen-default");
+            } else {
+                this.single_deselect_control_build();
+                this.selected_item.removeClass("chosen-default");
+            }
+            return this.selected_item.find("span").text(text);
+        };
+
+        Chosen.prototype.result_deselect = function (pos) {
+            var result_data;
+            result_data = this.results_data[pos];
+            if (!this.form_field.options[result_data.options_index].disabled) {
+                result_data.selected = false;
+                this.form_field.options[result_data.options_index].selected = false;
+                this.selected_option_count = null;
+                this.result_clear_highlight();
+                if (this.results_showing) {
+                    this.winnow_results();
+                }
+                this.form_field_jq.trigger("change", {
+                    deselected: this.form_field.options[result_data.options_index].value
+                });
+                this.search_field_scale();
+                return true;
+            } else {
+                return false;
+            }
+        };
+
+        Chosen.prototype.single_deselect_control_build = function () {
+            if (!this.allow_single_deselect) {
+                return;
+            }
+            if (!this.selected_item.find("abbr").length) {
+                this.selected_item.find("span").first().after("<abbr class=\"search-choice-close\"></abbr>");
+            }
+            return this.selected_item.addClass("chosen-single-with-deselect");
+        };
+
+        Chosen.prototype.get_search_text = function () {
+            if (this.search_field.val() === this.default_text) {
+                return "";
+            } else {
+                return $('<div/>').text($.trim(this.search_field.val())).html();
+            }
+        };
+
+        Chosen.prototype.winnow_results_set_highlight = function () {
+            var do_high, selected_results;
+            selected_results = !this.is_multiple ? this.search_results.find(".result-selected.active-result") : [];
+            do_high = selected_results.length ? selected_results.first() : this.search_results.find(".active-result").first();
+            if (do_high != null) {
+                return this.result_do_highlight(do_high);
+            }
+        };
+
+        Chosen.prototype.no_results = function (terms) {
+            var no_results_html;
+            no_results_html = $('<li class="no-results">' + this.results_none_found + ' "<span></span>"</li>');
+            no_results_html.find("span").first().html(terms);
+            this.search_results.append(no_results_html);
+            return this.form_field_jq.trigger("chosen:no_results", {
+                chosen: this
+            });
+        };
+
+        Chosen.prototype.no_results_clear = function () {
+            return this.search_results.find(".no-results").remove();
+        };
+
+        Chosen.prototype.keydown_arrow = function () {
+            var next_sib;
+            if (this.results_showing && this.result_highlight) {
+                next_sib = this.result_highlight.nextAll("li.active-result").first();
+                if (next_sib) {
+                    return this.result_do_highlight(next_sib);
+                }
+            } else {
+                return this.results_show();
+            }
+        };
+
+        Chosen.prototype.keyup_arrow = function () {
+            var prev_sibs;
+            if (!this.results_showing && !this.is_multiple) {
+                return this.results_show();
+            } else if (this.result_highlight) {
+                prev_sibs = this.result_highlight.prevAll("li.active-result");
+                if (prev_sibs.length) {
+                    return this.result_do_highlight(prev_sibs.first());
+                } else {
+                    if (this.choices_count() > 0) {
+                        this.results_hide();
+                    }
+                    return this.result_clear_highlight();
+                }
+            }
+        };
+
+        Chosen.prototype.keydown_backstroke = function () {
+            var next_available_destroy;
+            if (this.pending_backstroke) {
+                this.choice_destroy(this.pending_backstroke.find("a").first());
+                return this.clear_backstroke();
+            } else {
+                next_available_destroy = this.search_container.siblings("li.search-choice").last();
+                if (next_available_destroy.length && !next_available_destroy.hasClass("search-choice-disabled")) {
+                    this.pending_backstroke = next_available_destroy;
+                    if (this.single_backstroke_delete) {
+                        return this.keydown_backstroke();
+                    } else {
+                        return this.pending_backstroke.addClass("search-choice-focus");
+                    }
+                }
+            }
+        };
+
+        Chosen.prototype.clear_backstroke = function () {
+            if (this.pending_backstroke) {
+                this.pending_backstroke.removeClass("search-choice-focus");
+            }
+            return this.pending_backstroke = null;
+        };
+
+        Chosen.prototype.keydown_checker = function (evt) {
+            var stroke, _ref1;
+            stroke = (_ref1 = evt.which) != null ? _ref1 : evt.keyCode;
+            this.search_field_scale();
+            if (stroke !== 8 && this.pending_backstroke) {
+                this.clear_backstroke();
+            }
+            switch (stroke) {
+                case 8:
+                    this.backstroke_length = this.search_field.val().length;
+                    break;
+                case 9:
+                    if (this.results_showing && !this.is_multiple) {
+                        this.result_select(evt);
+                    }
+                    this.mouse_on_container = false;
+                    break;
+                case 13:
+                    evt.preventDefault();
+                    break;
+                case 38:
+                    evt.preventDefault();
+                    this.keyup_arrow();
+                    break;
+                case 40:
+                    evt.preventDefault();
+                    this.keydown_arrow();
+                    break;
+            }
+        };
+
+        Chosen.prototype.search_field_scale = function () {
+            var div, f_width, h, style, style_block, styles, w, _i, _len;
+            if (this.is_multiple) {
+                h = 0;
+                w = 0;
+                style_block = "position:absolute; left: -1000px; top: -1000px; display:none;";
+                styles = ['font-size', 'font-style', 'font-weight', 'font-family', 'line-height', 'text-transform', 'letter-spacing'];
+                for (_i = 0, _len = styles.length; _i < _len; _i++) {
+                    style = styles[_i];
+                    style_block += style + ":" + this.search_field.css(style) + ";";
+                }
+                div = $('<div />', {
+                    'style': style_block
+                });
+                div.text(this.search_field.val());
+                $('body').append(div);
+                w = div.width() + 25;
+                div.remove();
+                f_width = this.container.outerWidth();
+                if (w > f_width - 10) {
+                    w = f_width - 10;
+                }
+                return this.search_field.css({
+                    'width': w + 'px'
+                });
+            }
+        };
+
+        return Chosen;
+
+    })(AbstractChosen);
+
+}).call(this);

Файловите разлики са ограничени, защото са твърде много
+ 328 - 0
src/main/resources/static/js/frontend-plugin.js


Файловите разлики са ограничени, защото са твърде много
+ 10 - 0
src/main/resources/static/js/isotope.min.js


Файловите разлики са ограничени, защото са твърде много
+ 1 - 0
src/main/resources/static/js/jquery-1.12.4.min.js


Файловите разлики са ограничени, защото са твърде много
+ 0 - 0
src/main/resources/static/js/jquery-countdown.min.js


Файловите разлики са ограничени, защото са твърде много
+ 5 - 0
src/main/resources/static/js/jquery-ui.min.js


+ 14 - 0
src/main/resources/static/js/jquery.actual.min.js

@@ -0,0 +1,14 @@
+/*! Copyright 2012, Ben Lin (http://dreamerslab.com/)
+ * Licensed under the MIT License (LICENSE.txt).
+ *
+ * Version: 1.0.16
+ *
+ * Requires: jQuery >= 1.2.3
+ */
+(function(a){a.fn.addBack=a.fn.addBack||a.fn.andSelf;
+a.fn.extend({actual:function(b,l){if(!this[b]){throw'$.actual => The jQuery method "'+b+'" you called does not exist';}var f={absolute:false,clone:false,includeMargin:false};
+var i=a.extend(f,l);var e=this.eq(0);var h,j;if(i.clone===true){h=function(){var m="position: absolute !important; top: -1000 !important; ";e=e.clone().attr("style",m).appendTo("body");
+};j=function(){e.remove();};}else{var g=[];var d="";var c;h=function(){c=e.parents().addBack().filter(":hidden");d+="visibility: hidden !important; display: block !important; ";
+if(i.absolute===true){d+="position: absolute !important; ";}c.each(function(){var m=a(this);var n=m.attr("style");g.push(n);m.attr("style",n?n+";"+d:d);
+});};j=function(){c.each(function(m){var o=a(this);var n=g[m];if(n===undefined){o.removeAttr("style");}else{o.attr("style",n);}});};}h();var k=/(outer)/.test(b)?e[b](i.includeMargin):e[b]();
+j();return k;}});})(jQuery);

+ 66 - 0
src/main/resources/static/js/jquery.elevateZoom.min.js

@@ -0,0 +1,66 @@
+/* jQuery elevateZoom 3.0.8 - Demo's and documentation: - www.elevateweb.co.uk/image-zoom - Copyright (c) 2013 Andrew Eades - www.elevateweb.co.uk - Dual licensed under the LGPL licenses. - http://en.wikipedia.org/wiki/MIT_License - http://en.wikipedia.org/wiki/GNU_General_Public_License */
+"function"!==typeof Object.create&&(Object.create=function(d){function h(){}h.prototype=d;return new h});
+(function(d,h,l,m){var k={init:function(b,a){var c=this;c.elem=a;c.$elem=d(a);c.imageSrc=c.$elem.data("zoom-image")?c.$elem.data("zoom-image"):c.$elem.attr("src");c.options=d.extend({},d.fn.elevateZoom.options,b);c.options.tint&&(c.options.lensColour="none",c.options.lensOpacity="1");"inner"==c.options.zoomType&&(c.options.showLens=!1);c.$elem.parent().removeAttr("title").removeAttr("alt");c.zoomImage=c.imageSrc;c.refresh(1);d("#"+c.options.gallery+" a").click(function(a){c.options.galleryActiveClass&&
+(d("#"+c.options.gallery+" a").removeClass(c.options.galleryActiveClass),d(this).addClass(c.options.galleryActiveClass));a.preventDefault();d(this).data("zoom-image")?c.zoomImagePre=d(this).data("zoom-image"):c.zoomImagePre=d(this).data("image");c.swaptheimage(d(this).data("image"),c.zoomImagePre);return!1})},refresh:function(b){var a=this;setTimeout(function(){a.fetch(a.imageSrc)},b||a.options.refresh)},fetch:function(b){var a=this,c=new Image;c.onload=function(){a.largeWidth=c.width;a.largeHeight=
+c.height;a.startZoom();a.currentImage=a.imageSrc;a.options.onZoomedImageLoaded(a.$elem)};c.src=b},startZoom:function(){var b=this;b.nzWidth=b.$elem.width();b.nzHeight=b.$elem.height();b.isWindowActive=!1;b.isLensActive=!1;b.isTintActive=!1;b.overWindow=!1;b.options.imageCrossfade&&(b.zoomWrap=b.$elem.wrap('<div style="height:'+b.nzHeight+"px;width:"+b.nzWidth+'px;" class="zoomWrapper" />'),b.$elem.css("position","absolute"));b.zoomLock=1;b.scrollingLock=!1;b.changeBgSize=!1;b.currentZoomLevel=b.options.zoomLevel;
+b.nzOffset=b.$elem.offset();b.widthRatio=b.largeWidth/b.currentZoomLevel/b.nzWidth;b.heightRatio=b.largeHeight/b.currentZoomLevel/b.nzHeight;"window"==b.options.zoomType&&(b.zoomWindowStyle="overflow: hidden;background-position: 0px 0px;text-align:center;background-color: "+String(b.options.zoomWindowBgColour)+";width: "+String(b.options.zoomWindowWidth)+"px;height: "+String(b.options.zoomWindowHeight)+"px;float: left;background-size: "+b.largeWidth/b.currentZoomLevel+"px "+b.largeHeight/b.currentZoomLevel+
+"px;display: none;z-index:100;border: "+String(b.options.borderSize)+"px solid "+b.options.borderColour+";background-repeat: no-repeat;position: absolute;");if("inner"==b.options.zoomType){var a=b.$elem.css("border-left-width");b.zoomWindowStyle="overflow: hidden;margin-left: "+String(a)+";margin-top: "+String(a)+";background-position: 0px 0px;width: "+String(b.nzWidth)+"px;height: "+String(b.nzHeight)+"px;float: left;display: none;cursor:"+b.options.cursor+";px solid "+b.options.borderColour+";background-repeat: no-repeat;position: absolute;"}"window"==
+b.options.zoomType&&(lensHeight=b.nzHeight<b.options.zoomWindowWidth/b.widthRatio?b.nzHeight:String(b.options.zoomWindowHeight/b.heightRatio),lensWidth=b.largeWidth<b.options.zoomWindowWidth?b.nzWidth:b.options.zoomWindowWidth/b.widthRatio,b.lensStyle="background-position: 0px 0px;width: "+String(b.options.zoomWindowWidth/b.widthRatio)+"px;height: "+String(b.options.zoomWindowHeight/b.heightRatio)+"px;float: right;display: none;overflow: hidden;z-index: 999;-webkit-transform: translateZ(0);opacity:"+
+b.options.lensOpacity+";filter: alpha(opacity = "+100*b.options.lensOpacity+"); zoom:1;width:"+lensWidth+"px;height:"+lensHeight+"px;background-color:"+b.options.lensColour+";cursor:"+b.options.cursor+";border: "+b.options.lensBorderSize+"px solid "+b.options.lensBorderColour+";background-repeat: no-repeat;position: absolute;");b.tintStyle="display: block;position: absolute;background-color: "+b.options.tintColour+";filter:alpha(opacity=0);opacity: 0;width: "+b.nzWidth+"px;height: "+b.nzHeight+"px;";
+b.lensRound="";"lens"==b.options.zoomType&&(b.lensStyle="background-position: 0px 0px;float: left;display: none;border: "+String(b.options.borderSize)+"px solid "+b.options.borderColour+";width:"+String(b.options.lensSize)+"px;height:"+String(b.options.lensSize)+"px;background-repeat: no-repeat;position: absolute;");"round"==b.options.lensShape&&(b.lensRound="border-top-left-radius: "+String(b.options.lensSize/2+b.options.borderSize)+"px;border-top-right-radius: "+String(b.options.lensSize/2+b.options.borderSize)+
+"px;border-bottom-left-radius: "+String(b.options.lensSize/2+b.options.borderSize)+"px;border-bottom-right-radius: "+String(b.options.lensSize/2+b.options.borderSize)+"px;");b.zoomContainer=d('<div class="zoomContainer" style="-webkit-transform: translateZ(0);position:absolute;left:'+b.nzOffset.left+"px;top:"+b.nzOffset.top+"px;height:"+b.nzHeight+"px;width:"+b.nzWidth+'px;"></div>');d("body").append(b.zoomContainer);b.options.containLensZoom&&"lens"==b.options.zoomType&&b.zoomContainer.css("overflow",
+"hidden");"inner"!=b.options.zoomType&&(b.zoomLens=d("<div class='zoomLens' style='"+b.lensStyle+b.lensRound+"'>&nbsp;</div>").appendTo(b.zoomContainer).click(function(){b.$elem.trigger("click")}),b.options.tint&&(b.tintContainer=d("<div/>").addClass("tintContainer"),b.zoomTint=d("<div class='zoomTint' style='"+b.tintStyle+"'></div>"),b.zoomLens.wrap(b.tintContainer),b.zoomTintcss=b.zoomLens.after(b.zoomTint),b.zoomTintImage=d('<img style="position: absolute; left: 0px; top: 0px; max-width: none; width: '+
+b.nzWidth+"px; height: "+b.nzHeight+'px;" src="'+b.imageSrc+'">').appendTo(b.zoomLens).click(function(){b.$elem.trigger("click")})));isNaN(b.options.zoomWindowPosition)?b.zoomWindow=d("<div style='z-index:999;left:"+b.windowOffsetLeft+"px;top:"+b.windowOffsetTop+"px;"+b.zoomWindowStyle+"' class='zoomWindow'>&nbsp;</div>").appendTo("body").click(function(){b.$elem.trigger("click")}):b.zoomWindow=d("<div style='z-index:999;left:"+b.windowOffsetLeft+"px;top:"+b.windowOffsetTop+"px;"+b.zoomWindowStyle+
+"' class='zoomWindow'>&nbsp;</div>").appendTo(b.zoomContainer).click(function(){b.$elem.trigger("click")});b.zoomWindowContainer=d("<div/>").addClass("zoomWindowContainer").css("width",b.options.zoomWindowWidth);b.zoomWindow.wrap(b.zoomWindowContainer);"lens"==b.options.zoomType&&b.zoomLens.css({backgroundImage:"url('"+b.imageSrc+"')"});"window"==b.options.zoomType&&b.zoomWindow.css({backgroundImage:"url('"+b.imageSrc+"')"});"inner"==b.options.zoomType&&b.zoomWindow.css({backgroundImage:"url('"+b.imageSrc+
+"')"});b.$elem.bind("touchmove",function(a){a.preventDefault();b.setPosition(a.originalEvent.touches[0]||a.originalEvent.changedTouches[0])});b.zoomContainer.bind("touchmove",function(a){"inner"==b.options.zoomType&&b.showHideWindow("show");a.preventDefault();b.setPosition(a.originalEvent.touches[0]||a.originalEvent.changedTouches[0])});b.zoomContainer.bind("touchend",function(a){b.showHideWindow("hide");b.options.showLens&&b.showHideLens("hide");b.options.tint&&"inner"!=b.options.zoomType&&b.showHideTint("hide")});
+b.$elem.bind("touchend",function(a){b.showHideWindow("hide");b.options.showLens&&b.showHideLens("hide");b.options.tint&&"inner"!=b.options.zoomType&&b.showHideTint("hide")});b.options.showLens&&(b.zoomLens.bind("touchmove",function(a){a.preventDefault();b.setPosition(a.originalEvent.touches[0]||a.originalEvent.changedTouches[0])}),b.zoomLens.bind("touchend",function(a){b.showHideWindow("hide");b.options.showLens&&b.showHideLens("hide");b.options.tint&&"inner"!=b.options.zoomType&&b.showHideTint("hide")}));
+b.$elem.bind("mousemove",function(a){!1==b.overWindow&&b.setElements("show");if(b.lastX!==a.clientX||b.lastY!==a.clientY)b.setPosition(a),b.currentLoc=a;b.lastX=a.clientX;b.lastY=a.clientY});b.zoomContainer.bind("mousemove",function(a){!1==b.overWindow&&b.setElements("show");if(b.lastX!==a.clientX||b.lastY!==a.clientY)b.setPosition(a),b.currentLoc=a;b.lastX=a.clientX;b.lastY=a.clientY});"inner"!=b.options.zoomType&&b.zoomLens.bind("mousemove",function(a){if(b.lastX!==a.clientX||b.lastY!==a.clientY)b.setPosition(a),
+b.currentLoc=a;b.lastX=a.clientX;b.lastY=a.clientY});b.options.tint&&"inner"!=b.options.zoomType&&b.zoomTint.bind("mousemove",function(a){if(b.lastX!==a.clientX||b.lastY!==a.clientY)b.setPosition(a),b.currentLoc=a;b.lastX=a.clientX;b.lastY=a.clientY});"inner"==b.options.zoomType&&b.zoomWindow.bind("mousemove",function(a){if(b.lastX!==a.clientX||b.lastY!==a.clientY)b.setPosition(a),b.currentLoc=a;b.lastX=a.clientX;b.lastY=a.clientY});b.zoomContainer.add(b.$elem).mouseenter(function(){!1==b.overWindow&&
+b.setElements("show")}).mouseleave(function(){b.scrollLock||b.setElements("hide")});"inner"!=b.options.zoomType&&b.zoomWindow.mouseenter(function(){b.overWindow=!0;b.setElements("hide")}).mouseleave(function(){b.overWindow=!1});b.minZoomLevel=b.options.minZoomLevel?b.options.minZoomLevel:2*b.options.scrollZoomIncrement;b.options.scrollZoom&&b.zoomContainer.add(b.$elem).bind("mousewheel DOMMouseScroll MozMousePixelScroll",function(a){b.scrollLock=!0;clearTimeout(d.data(this,"timer"));d.data(this,"timer",
+setTimeout(function(){b.scrollLock=!1},250));var e=a.originalEvent.wheelDelta||-1*a.originalEvent.detail;a.stopImmediatePropagation();a.stopPropagation();a.preventDefault();0<e/120?b.currentZoomLevel>=b.minZoomLevel&&b.changeZoomLevel(b.currentZoomLevel-b.options.scrollZoomIncrement):b.options.maxZoomLevel?b.currentZoomLevel<=b.options.maxZoomLevel&&b.changeZoomLevel(parseFloat(b.currentZoomLevel)+b.options.scrollZoomIncrement):b.changeZoomLevel(parseFloat(b.currentZoomLevel)+b.options.scrollZoomIncrement);
+return!1})},setElements:function(b){if(!this.options.zoomEnabled)return!1;"show"==b&&this.isWindowSet&&("inner"==this.options.zoomType&&this.showHideWindow("show"),"window"==this.options.zoomType&&this.showHideWindow("show"),this.options.showLens&&this.showHideLens("show"),this.options.tint&&"inner"!=this.options.zoomType&&this.showHideTint("show"));"hide"==b&&("window"==this.options.zoomType&&this.showHideWindow("hide"),this.options.tint||this.showHideWindow("hide"),this.options.showLens&&this.showHideLens("hide"),
+this.options.tint&&this.showHideTint("hide"))},setPosition:function(b){if(!this.options.zoomEnabled)return!1;this.nzHeight=this.$elem.height();this.nzWidth=this.$elem.width();this.nzOffset=this.$elem.offset();this.options.tint&&"inner"!=this.options.zoomType&&(this.zoomTint.css({top:0}),this.zoomTint.css({left:0}));this.options.responsive&&!this.options.scrollZoom&&this.options.showLens&&(lensHeight=this.nzHeight<this.options.zoomWindowWidth/this.widthRatio?this.nzHeight:String(this.options.zoomWindowHeight/
+this.heightRatio),lensWidth=this.largeWidth<this.options.zoomWindowWidth?this.nzWidth:this.options.zoomWindowWidth/this.widthRatio,this.widthRatio=this.largeWidth/this.nzWidth,this.heightRatio=this.largeHeight/this.nzHeight,"lens"!=this.options.zoomType&&(lensHeight=this.nzHeight<this.options.zoomWindowWidth/this.widthRatio?this.nzHeight:String(this.options.zoomWindowHeight/this.heightRatio),lensWidth=this.options.zoomWindowWidth<this.options.zoomWindowWidth?this.nzWidth:this.options.zoomWindowWidth/
+this.widthRatio,this.zoomLens.css("width",lensWidth),this.zoomLens.css("height",lensHeight),this.options.tint&&(this.zoomTintImage.css("width",this.nzWidth),this.zoomTintImage.css("height",this.nzHeight))),"lens"==this.options.zoomType&&this.zoomLens.css({width:String(this.options.lensSize)+"px",height:String(this.options.lensSize)+"px"}));this.zoomContainer.css({top:this.nzOffset.top});this.zoomContainer.css({left:this.nzOffset.left});this.mouseLeft=parseInt(b.pageX-this.nzOffset.left);this.mouseTop=
+parseInt(b.pageY-this.nzOffset.top);"window"==this.options.zoomType&&(this.Etoppos=this.mouseTop<this.zoomLens.height()/2,this.Eboppos=this.mouseTop>this.nzHeight-this.zoomLens.height()/2-2*this.options.lensBorderSize,this.Eloppos=this.mouseLeft<0+this.zoomLens.width()/2,this.Eroppos=this.mouseLeft>this.nzWidth-this.zoomLens.width()/2-2*this.options.lensBorderSize);"inner"==this.options.zoomType&&(this.Etoppos=this.mouseTop<this.nzHeight/2/this.heightRatio,this.Eboppos=this.mouseTop>this.nzHeight-
+this.nzHeight/2/this.heightRatio,this.Eloppos=this.mouseLeft<0+this.nzWidth/2/this.widthRatio,this.Eroppos=this.mouseLeft>this.nzWidth-this.nzWidth/2/this.widthRatio-2*this.options.lensBorderSize);0>=this.mouseLeft||0>this.mouseTop||this.mouseLeft>this.nzWidth||this.mouseTop>this.nzHeight?this.setElements("hide"):(this.options.showLens&&(this.lensLeftPos=String(this.mouseLeft-this.zoomLens.width()/2),this.lensTopPos=String(this.mouseTop-this.zoomLens.height()/2)),this.Etoppos&&(this.lensTopPos=0),
+this.Eloppos&&(this.tintpos=this.lensLeftPos=this.windowLeftPos=0),"window"==this.options.zoomType&&(this.Eboppos&&(this.lensTopPos=Math.max(this.nzHeight-this.zoomLens.height()-2*this.options.lensBorderSize,0)),this.Eroppos&&(this.lensLeftPos=this.nzWidth-this.zoomLens.width()-2*this.options.lensBorderSize)),"inner"==this.options.zoomType&&(this.Eboppos&&(this.lensTopPos=Math.max(this.nzHeight-2*this.options.lensBorderSize,0)),this.Eroppos&&(this.lensLeftPos=this.nzWidth-this.nzWidth-2*this.options.lensBorderSize)),
+"lens"==this.options.zoomType&&(this.windowLeftPos=String(-1*((b.pageX-this.nzOffset.left)*this.widthRatio-this.zoomLens.width()/2)),this.windowTopPos=String(-1*((b.pageY-this.nzOffset.top)*this.heightRatio-this.zoomLens.height()/2)),this.zoomLens.css({backgroundPosition:this.windowLeftPos+"px "+this.windowTopPos+"px"}),this.changeBgSize&&(this.nzHeight>this.nzWidth?("lens"==this.options.zoomType&&this.zoomLens.css({"background-size":this.largeWidth/this.newvalueheight+"px "+this.largeHeight/this.newvalueheight+
+"px"}),this.zoomWindow.css({"background-size":this.largeWidth/this.newvalueheight+"px "+this.largeHeight/this.newvalueheight+"px"})):("lens"==this.options.zoomType&&this.zoomLens.css({"background-size":this.largeWidth/this.newvaluewidth+"px "+this.largeHeight/this.newvaluewidth+"px"}),this.zoomWindow.css({"background-size":this.largeWidth/this.newvaluewidth+"px "+this.largeHeight/this.newvaluewidth+"px"})),this.changeBgSize=!1),this.setWindowPostition(b)),this.options.tint&&"inner"!=this.options.zoomType&&
+this.setTintPosition(b),"window"==this.options.zoomType&&this.setWindowPostition(b),"inner"==this.options.zoomType&&this.setWindowPostition(b),this.options.showLens&&(this.fullwidth&&"lens"!=this.options.zoomType&&(this.lensLeftPos=0),this.zoomLens.css({left:this.lensLeftPos+"px",top:this.lensTopPos+"px"})))},showHideWindow:function(b){"show"!=b||this.isWindowActive||(this.options.zoomWindowFadeIn?this.zoomWindow.stop(!0,!0,!1).fadeIn(this.options.zoomWindowFadeIn):this.zoomWindow.show(),this.isWindowActive=
+!0);"hide"==b&&this.isWindowActive&&(this.options.zoomWindowFadeOut?this.zoomWindow.stop(!0,!0).fadeOut(this.options.zoomWindowFadeOut):this.zoomWindow.hide(),this.isWindowActive=!1)},showHideLens:function(b){"show"!=b||this.isLensActive||(this.options.lensFadeIn?this.zoomLens.stop(!0,!0,!1).fadeIn(this.options.lensFadeIn):this.zoomLens.show(),this.isLensActive=!0);"hide"==b&&this.isLensActive&&(this.options.lensFadeOut?this.zoomLens.stop(!0,!0).fadeOut(this.options.lensFadeOut):this.zoomLens.hide(),
+this.isLensActive=!1)},showHideTint:function(b){"show"!=b||this.isTintActive||(this.options.zoomTintFadeIn?this.zoomTint.css({opacity:this.options.tintOpacity}).animate().stop(!0,!0).fadeIn("slow"):(this.zoomTint.css({opacity:this.options.tintOpacity}).animate(),this.zoomTint.show()),this.isTintActive=!0);"hide"==b&&this.isTintActive&&(this.options.zoomTintFadeOut?this.zoomTint.stop(!0,!0).fadeOut(this.options.zoomTintFadeOut):this.zoomTint.hide(),this.isTintActive=!1)},setLensPostition:function(b){},
+setWindowPostition:function(b){var a=this;if(isNaN(a.options.zoomWindowPosition))a.externalContainer=d("#"+a.options.zoomWindowPosition),a.externalContainerWidth=a.externalContainer.width(),a.externalContainerHeight=a.externalContainer.height(),a.externalContainerOffset=a.externalContainer.offset(),a.windowOffsetTop=a.externalContainerOffset.top,a.windowOffsetLeft=a.externalContainerOffset.left;else switch(a.options.zoomWindowPosition){case 1:a.windowOffsetTop=a.options.zoomWindowOffety;a.windowOffsetLeft=
++a.nzWidth;break;case 2:a.options.zoomWindowHeight>a.nzHeight&&(a.windowOffsetTop=-1*(a.options.zoomWindowHeight/2-a.nzHeight/2),a.windowOffsetLeft=a.nzWidth);break;case 3:a.windowOffsetTop=a.nzHeight-a.zoomWindow.height()-2*a.options.borderSize;a.windowOffsetLeft=a.nzWidth;break;case 4:a.windowOffsetTop=a.nzHeight;a.windowOffsetLeft=a.nzWidth;break;case 5:a.windowOffsetTop=a.nzHeight;a.windowOffsetLeft=a.nzWidth-a.zoomWindow.width()-2*a.options.borderSize;break;case 6:a.options.zoomWindowHeight>
+a.nzHeight&&(a.windowOffsetTop=a.nzHeight,a.windowOffsetLeft=-1*(a.options.zoomWindowWidth/2-a.nzWidth/2+2*a.options.borderSize));break;case 7:a.windowOffsetTop=a.nzHeight;a.windowOffsetLeft=0;break;case 8:a.windowOffsetTop=a.nzHeight;a.windowOffsetLeft=-1*(a.zoomWindow.width()+2*a.options.borderSize);break;case 9:a.windowOffsetTop=a.nzHeight-a.zoomWindow.height()-2*a.options.borderSize;a.windowOffsetLeft=-1*(a.zoomWindow.width()+2*a.options.borderSize);break;case 10:a.options.zoomWindowHeight>a.nzHeight&&
+(a.windowOffsetTop=-1*(a.options.zoomWindowHeight/2-a.nzHeight/2),a.windowOffsetLeft=-1*(a.zoomWindow.width()+2*a.options.borderSize));break;case 11:a.windowOffsetTop=a.options.zoomWindowOffety;a.windowOffsetLeft=-1*(a.zoomWindow.width()+2*a.options.borderSize);break;case 12:a.windowOffsetTop=-1*(a.zoomWindow.height()+2*a.options.borderSize);a.windowOffsetLeft=-1*(a.zoomWindow.width()+2*a.options.borderSize);break;case 13:a.windowOffsetTop=-1*(a.zoomWindow.height()+2*a.options.borderSize);a.windowOffsetLeft=
+0;break;case 14:a.options.zoomWindowHeight>a.nzHeight&&(a.windowOffsetTop=-1*(a.zoomWindow.height()+2*a.options.borderSize),a.windowOffsetLeft=-1*(a.options.zoomWindowWidth/2-a.nzWidth/2+2*a.options.borderSize));break;case 15:a.windowOffsetTop=-1*(a.zoomWindow.height()+2*a.options.borderSize);a.windowOffsetLeft=a.nzWidth-a.zoomWindow.width()-2*a.options.borderSize;break;case 16:a.windowOffsetTop=-1*(a.zoomWindow.height()+2*a.options.borderSize);a.windowOffsetLeft=a.nzWidth;break;default:a.windowOffsetTop=
+a.options.zoomWindowOffety,a.windowOffsetLeft=a.nzWidth}a.isWindowSet=!0;a.windowOffsetTop+=a.options.zoomWindowOffety;a.windowOffsetLeft+=a.options.zoomWindowOffetx;a.zoomWindow.css({top:a.windowOffsetTop});a.zoomWindow.css({left:a.windowOffsetLeft});"inner"==a.options.zoomType&&(a.zoomWindow.css({top:0}),a.zoomWindow.css({left:0}));a.windowLeftPos=String(-1*((b.pageX-a.nzOffset.left)*a.widthRatio-a.zoomWindow.width()/2));a.windowTopPos=String(-1*((b.pageY-a.nzOffset.top)*a.heightRatio-a.zoomWindow.height()/
+2));a.Etoppos&&(a.windowTopPos=0);a.Eloppos&&(a.windowLeftPos=0);a.Eboppos&&(a.windowTopPos=-1*(a.largeHeight/a.currentZoomLevel-a.zoomWindow.height()));a.Eroppos&&(a.windowLeftPos=-1*(a.largeWidth/a.currentZoomLevel-a.zoomWindow.width()));a.fullheight&&(a.windowTopPos=0);a.fullwidth&&(a.windowLeftPos=0);if("window"==a.options.zoomType||"inner"==a.options.zoomType)1==a.zoomLock&&(1>=a.widthRatio&&(a.windowLeftPos=0),1>=a.heightRatio&&(a.windowTopPos=0)),a.largeHeight<a.options.zoomWindowHeight&&(a.windowTopPos=
+0),a.largeWidth<a.options.zoomWindowWidth&&(a.windowLeftPos=0),a.options.easing?(a.xp||(a.xp=0),a.yp||(a.yp=0),a.loop||(a.loop=setInterval(function(){a.xp+=(a.windowLeftPos-a.xp)/a.options.easingAmount;a.yp+=(a.windowTopPos-a.yp)/a.options.easingAmount;a.scrollingLock?(clearInterval(a.loop),a.xp=a.windowLeftPos,a.yp=a.windowTopPos,a.xp=-1*((b.pageX-a.nzOffset.left)*a.widthRatio-a.zoomWindow.width()/2),a.yp=-1*((b.pageY-a.nzOffset.top)*a.heightRatio-a.zoomWindow.height()/2),a.changeBgSize&&(a.nzHeight>
+a.nzWidth?("lens"==a.options.zoomType&&a.zoomLens.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/a.newvalueheight+"px"}),a.zoomWindow.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/a.newvalueheight+"px"})):("lens"!=a.options.zoomType&&a.zoomLens.css({"background-size":a.largeWidth/a.newvaluewidth+"px "+a.largeHeight/a.newvalueheight+"px"}),a.zoomWindow.css({"background-size":a.largeWidth/a.newvaluewidth+"px "+a.largeHeight/a.newvaluewidth+"px"})),
+a.changeBgSize=!1),a.zoomWindow.css({backgroundPosition:a.windowLeftPos+"px "+a.windowTopPos+"px"}),a.scrollingLock=!1,a.loop=!1):(a.changeBgSize&&(a.nzHeight>a.nzWidth?("lens"==a.options.zoomType&&a.zoomLens.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/a.newvalueheight+"px"}),a.zoomWindow.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/a.newvalueheight+"px"})):("lens"!=a.options.zoomType&&a.zoomLens.css({"background-size":a.largeWidth/a.newvaluewidth+
+"px "+a.largeHeight/a.newvaluewidth+"px"}),a.zoomWindow.css({"background-size":a.largeWidth/a.newvaluewidth+"px "+a.largeHeight/a.newvaluewidth+"px"})),a.changeBgSize=!1),a.zoomWindow.css({backgroundPosition:a.xp+"px "+a.yp+"px"}))},16))):(a.changeBgSize&&(a.nzHeight>a.nzWidth?("lens"==a.options.zoomType&&a.zoomLens.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/a.newvalueheight+"px"}),a.zoomWindow.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/
+a.newvalueheight+"px"})):("lens"==a.options.zoomType&&a.zoomLens.css({"background-size":a.largeWidth/a.newvaluewidth+"px "+a.largeHeight/a.newvaluewidth+"px"}),a.largeHeight/a.newvaluewidth<a.options.zoomWindowHeight?a.zoomWindow.css({"background-size":a.largeWidth/a.newvaluewidth+"px "+a.largeHeight/a.newvaluewidth+"px"}):a.zoomWindow.css({"background-size":a.largeWidth/a.newvalueheight+"px "+a.largeHeight/a.newvalueheight+"px"})),a.changeBgSize=!1),a.zoomWindow.css({backgroundPosition:a.windowLeftPos+
+"px "+a.windowTopPos+"px"}))},setTintPosition:function(b){this.nzOffset=this.$elem.offset();this.tintpos=String(-1*(b.pageX-this.nzOffset.left-this.zoomLens.width()/2));this.tintposy=String(-1*(b.pageY-this.nzOffset.top-this.zoomLens.height()/2));this.Etoppos&&(this.tintposy=0);this.Eloppos&&(this.tintpos=0);this.Eboppos&&(this.tintposy=-1*(this.nzHeight-this.zoomLens.height()-2*this.options.lensBorderSize));this.Eroppos&&(this.tintpos=-1*(this.nzWidth-this.zoomLens.width()-2*this.options.lensBorderSize));
+this.options.tint&&(this.fullheight&&(this.tintposy=0),this.fullwidth&&(this.tintpos=0),this.zoomTintImage.css({left:this.tintpos+"px"}),this.zoomTintImage.css({top:this.tintposy+"px"}))},swaptheimage:function(b,a){var c=this,e=new Image;c.options.loadingIcon&&(c.spinner=d("<div style=\"background: url('"+c.options.loadingIcon+"') no-repeat center;height:"+c.nzHeight+"px;width:"+c.nzWidth+'px;z-index: 2000;position: absolute; background-position: center center;"></div>'),c.$elem.after(c.spinner));
+c.options.onImageSwap(c.$elem);e.onload=function(){c.largeWidth=e.width;c.largeHeight=e.height;c.zoomImage=a;c.zoomWindow.css({"background-size":c.largeWidth+"px "+c.largeHeight+"px"});c.zoomWindow.css({"background-size":c.largeWidth+"px "+c.largeHeight+"px"});c.swapAction(b,a)};e.src=a},swapAction:function(b,a){var c=this,e=new Image;e.onload=function(){c.nzHeight=e.height;c.nzWidth=e.width;c.options.onImageSwapComplete(c.$elem);c.doneCallback()};e.src=b;c.currentZoomLevel=c.options.zoomLevel;c.options.maxZoomLevel=
+!1;"lens"==c.options.zoomType&&c.zoomLens.css({backgroundImage:"url('"+a+"')"});"window"==c.options.zoomType&&c.zoomWindow.css({backgroundImage:"url('"+a+"')"});"inner"==c.options.zoomType&&c.zoomWindow.css({backgroundImage:"url('"+a+"')"});c.currentImage=a;if(c.options.imageCrossfade){var f=c.$elem,g=f.clone();c.$elem.attr("src",b);c.$elem.after(g);g.stop(!0).fadeOut(c.options.imageCrossfade,function(){d(this).remove()});c.$elem.width("auto").removeAttr("width");c.$elem.height("auto").removeAttr("height");
+f.fadeIn(c.options.imageCrossfade);c.options.tint&&"inner"!=c.options.zoomType&&(f=c.zoomTintImage,g=f.clone(),c.zoomTintImage.attr("src",a),c.zoomTintImage.after(g),g.stop(!0).fadeOut(c.options.imageCrossfade,function(){d(this).remove()}),f.fadeIn(c.options.imageCrossfade),c.zoomTint.css({height:c.$elem.height()}),c.zoomTint.css({width:c.$elem.width()}));c.zoomContainer.css("height",c.$elem.height());c.zoomContainer.css("width",c.$elem.width());"inner"!=c.options.zoomType||c.options.constrainType||
+(c.zoomWrap.parent().css("height",c.$elem.height()),c.zoomWrap.parent().css("width",c.$elem.width()),c.zoomWindow.css("height",c.$elem.height()),c.zoomWindow.css("width",c.$elem.width()))}else c.$elem.attr("src",b),c.options.tint&&(c.zoomTintImage.attr("src",a),c.zoomTintImage.attr("height",c.$elem.height()),c.zoomTintImage.css({height:c.$elem.height()}),c.zoomTint.css({height:c.$elem.height()})),c.zoomContainer.css("height",c.$elem.height()),c.zoomContainer.css("width",c.$elem.width());c.options.imageCrossfade&&
+(c.zoomWrap.css("height",c.$elem.height()),c.zoomWrap.css("width",c.$elem.width()));c.options.constrainType&&("height"==c.options.constrainType&&(c.zoomContainer.css("height",c.options.constrainSize),c.zoomContainer.css("width","auto"),c.options.imageCrossfade?(c.zoomWrap.css("height",c.options.constrainSize),c.zoomWrap.css("width","auto"),c.constwidth=c.zoomWrap.width()):(c.$elem.css("height",c.options.constrainSize),c.$elem.css("width","auto"),c.constwidth=c.$elem.width()),"inner"==c.options.zoomType&&
+(c.zoomWrap.parent().css("height",c.options.constrainSize),c.zoomWrap.parent().css("width",c.constwidth),c.zoomWindow.css("height",c.options.constrainSize),c.zoomWindow.css("width",c.constwidth)),c.options.tint&&(c.tintContainer.css("height",c.options.constrainSize),c.tintContainer.css("width",c.constwidth),c.zoomTint.css("height",c.options.constrainSize),c.zoomTint.css("width",c.constwidth),c.zoomTintImage.css("height",c.options.constrainSize),c.zoomTintImage.css("width",c.constwidth))),"width"==
+c.options.constrainType&&(c.zoomContainer.css("height","auto"),c.zoomContainer.css("width",c.options.constrainSize),c.options.imageCrossfade?(c.zoomWrap.css("height","auto"),c.zoomWrap.css("width",c.options.constrainSize),c.constheight=c.zoomWrap.height()):(c.$elem.css("height","auto"),c.$elem.css("width",c.options.constrainSize),c.constheight=c.$elem.height()),"inner"==c.options.zoomType&&(c.zoomWrap.parent().css("height",c.constheight),c.zoomWrap.parent().css("width",c.options.constrainSize),c.zoomWindow.css("height",
+c.constheight),c.zoomWindow.css("width",c.options.constrainSize)),c.options.tint&&(c.tintContainer.css("height",c.constheight),c.tintContainer.css("width",c.options.constrainSize),c.zoomTint.css("height",c.constheight),c.zoomTint.css("width",c.options.constrainSize),c.zoomTintImage.css("height",c.constheight),c.zoomTintImage.css("width",c.options.constrainSize))))},doneCallback:function(){this.options.loadingIcon&&this.spinner.hide();this.nzOffset=this.$elem.offset();this.nzWidth=this.$elem.width();
+this.nzHeight=this.$elem.height();this.currentZoomLevel=this.options.zoomLevel;this.widthRatio=this.largeWidth/this.nzWidth;this.heightRatio=this.largeHeight/this.nzHeight;"window"==this.options.zoomType&&(lensHeight=this.nzHeight<this.options.zoomWindowWidth/this.widthRatio?this.nzHeight:String(this.options.zoomWindowHeight/this.heightRatio),lensWidth=this.options.zoomWindowWidth<this.options.zoomWindowWidth?this.nzWidth:this.options.zoomWindowWidth/this.widthRatio,this.zoomLens&&(this.zoomLens.css("width",
+lensWidth),this.zoomLens.css("height",lensHeight)))},getCurrentImage:function(){return this.zoomImage},getGalleryList:function(){var b=this;b.gallerylist=[];b.options.gallery?d("#"+b.options.gallery+" a").each(function(){var a="";d(this).data("zoom-image")?a=d(this).data("zoom-image"):d(this).data("image")&&(a=d(this).data("image"));a==b.zoomImage?b.gallerylist.unshift({href:""+a+"",title:d(this).find("img").attr("title")}):b.gallerylist.push({href:""+a+"",title:d(this).find("img").attr("title")})}):
+b.gallerylist.push({href:""+b.zoomImage+"",title:d(this).find("img").attr("title")});return b.gallerylist},changeZoomLevel:function(b){this.scrollingLock=!0;this.newvalue=parseFloat(b).toFixed(2);newvalue=parseFloat(b).toFixed(2);maxheightnewvalue=this.largeHeight/(this.options.zoomWindowHeight/this.nzHeight*this.nzHeight);maxwidthtnewvalue=this.largeWidth/(this.options.zoomWindowWidth/this.nzWidth*this.nzWidth);"inner"!=this.options.zoomType&&(maxheightnewvalue<=newvalue?(this.heightRatio=this.largeHeight/
+maxheightnewvalue/this.nzHeight,this.newvalueheight=maxheightnewvalue,this.fullheight=!0):(this.heightRatio=this.largeHeight/newvalue/this.nzHeight,this.newvalueheight=newvalue,this.fullheight=!1),maxwidthtnewvalue<=newvalue?(this.widthRatio=this.largeWidth/maxwidthtnewvalue/this.nzWidth,this.newvaluewidth=maxwidthtnewvalue,this.fullwidth=!0):(this.widthRatio=this.largeWidth/newvalue/this.nzWidth,this.newvaluewidth=newvalue,this.fullwidth=!1),"lens"==this.options.zoomType&&(maxheightnewvalue<=newvalue?
+(this.fullwidth=!0,this.newvaluewidth=maxheightnewvalue):(this.widthRatio=this.largeWidth/newvalue/this.nzWidth,this.newvaluewidth=newvalue,this.fullwidth=!1)));"inner"==this.options.zoomType&&(maxheightnewvalue=parseFloat(this.largeHeight/this.nzHeight).toFixed(2),maxwidthtnewvalue=parseFloat(this.largeWidth/this.nzWidth).toFixed(2),newvalue>maxheightnewvalue&&(newvalue=maxheightnewvalue),newvalue>maxwidthtnewvalue&&(newvalue=maxwidthtnewvalue),maxheightnewvalue<=newvalue?(this.heightRatio=this.largeHeight/
+newvalue/this.nzHeight,this.newvalueheight=newvalue>maxheightnewvalue?maxheightnewvalue:newvalue,this.fullheight=!0):(this.heightRatio=this.largeHeight/newvalue/this.nzHeight,this.newvalueheight=newvalue>maxheightnewvalue?maxheightnewvalue:newvalue,this.fullheight=!1),maxwidthtnewvalue<=newvalue?(this.widthRatio=this.largeWidth/newvalue/this.nzWidth,this.newvaluewidth=newvalue>maxwidthtnewvalue?maxwidthtnewvalue:newvalue,this.fullwidth=!0):(this.widthRatio=this.largeWidth/newvalue/this.nzWidth,this.newvaluewidth=
+newvalue,this.fullwidth=!1));scrcontinue=!1;"inner"==this.options.zoomType&&(this.nzWidth>this.nzHeight&&(this.newvaluewidth<=maxwidthtnewvalue?scrcontinue=!0:(scrcontinue=!1,this.fullwidth=this.fullheight=!0)),this.nzHeight>this.nzWidth&&(this.newvaluewidth<=maxwidthtnewvalue?scrcontinue=!0:(scrcontinue=!1,this.fullwidth=this.fullheight=!0)));"inner"!=this.options.zoomType&&(scrcontinue=!0);scrcontinue&&(this.zoomLock=0,this.changeZoom=!0,this.options.zoomWindowHeight/this.heightRatio<=this.nzHeight&&
+(this.currentZoomLevel=this.newvalueheight,"lens"!=this.options.zoomType&&"inner"!=this.options.zoomType&&(this.changeBgSize=!0,this.zoomLens.css({height:String(this.options.zoomWindowHeight/this.heightRatio)+"px"})),"lens"==this.options.zoomType||"inner"==this.options.zoomType)&&(this.changeBgSize=!0),this.options.zoomWindowWidth/this.widthRatio<=this.nzWidth&&("inner"!=this.options.zoomType&&this.newvaluewidth>this.newvalueheight&&(this.currentZoomLevel=this.newvaluewidth),"lens"!=this.options.zoomType&&
+"inner"!=this.options.zoomType&&(this.changeBgSize=!0,this.zoomLens.css({width:String(this.options.zoomWindowWidth/this.widthRatio)+"px"})),"lens"==this.options.zoomType||"inner"==this.options.zoomType)&&(this.changeBgSize=!0),"inner"==this.options.zoomType&&(this.changeBgSize=!0,this.nzWidth>this.nzHeight&&(this.currentZoomLevel=this.newvaluewidth),this.nzHeight>this.nzWidth&&(this.currentZoomLevel=this.newvaluewidth)));this.setPosition(this.currentLoc)},closeAll:function(){self.zoomWindow&&self.zoomWindow.hide();
+self.zoomLens&&self.zoomLens.hide();self.zoomTint&&self.zoomTint.hide()},changeState:function(b){"enable"==b&&(this.options.zoomEnabled=!0);"disable"==b&&(this.options.zoomEnabled=!1)}};d.fn.elevateZoom=function(b){return this.each(function(){var a=Object.create(k);a.init(b,this);d.data(this,"elevateZoom",a)})};d.fn.elevateZoom.options={zoomActivation:"hover",zoomEnabled:!0,preloading:1,zoomLevel:1,scrollZoom:!1,scrollZoomIncrement:0.1,minZoomLevel:!1,maxZoomLevel:!1,easing:!1,easingAmount:12,lensSize:200,
+zoomWindowWidth:400,zoomWindowHeight:400,zoomWindowOffetx:0,zoomWindowOffety:0,zoomWindowPosition:1,zoomWindowBgColour:"#fff",lensFadeIn:!1,lensFadeOut:!1,debug:!1,zoomWindowFadeIn:!1,zoomWindowFadeOut:!1,zoomWindowAlwaysShow:!1,zoomTintFadeIn:!1,zoomTintFadeOut:!1,borderSize:4,showLens:!0,borderColour:"#888",lensBorderSize:1,lensBorderColour:"#000",lensShape:"square",zoomType:"window",containLensZoom:!1,lensColour:"white",lensOpacity:0.4,lenszoom:!1,tint:!1,tintColour:"#333",tintOpacity:0.4,gallery:!1,
+galleryActiveClass:"zoomGalleryActive",imageCrossfade:!1,constrainType:!1,constrainSize:!1,loadingIcon:!1,cursor:"default",responsive:!0,onComplete:d.noop,onZoomedImageLoaded:function(){},onImageSwap:d.noop,onImageSwapComplete:d.noop}})(jQuery,window,document);

+ 2020 - 0
src/main/resources/static/js/jquery.fancybox.js

@@ -0,0 +1,2020 @@
+/*!
+ * fancyBox - jQuery Plugin
+ * version: 2.1.5 (Fri, 14 Jun 2013)
+ * @requires jQuery v1.6 or later
+ *
+ * Examples at http://fancyapps.com/fancybox/
+ * License: www.fancyapps.com/fancybox/#license
+ *
+ * Copyright 2012 Janis Skarnelis - janis@fancyapps.com
+ *
+ */
+
+(function (window, document, $, undefined) {
+	"use strict";
+
+	var H = $("html"),
+		W = $(window),
+		D = $(document),
+		F = $.fancybox = function () {
+			F.open.apply( this, arguments );
+		},
+		IE =  navigator.userAgent.match(/msie/i),
+		didUpdate	= null,
+		isTouch		= document.createTouch !== undefined,
+
+		isQuery	= function(obj) {
+			return obj && obj.hasOwnProperty && obj instanceof $;
+		},
+		isString = function(str) {
+			return str && $.type(str) === "string";
+		},
+		isPercentage = function(str) {
+			return isString(str) && str.indexOf('%') > 0;
+		},
+		isScrollable = function(el) {
+			return (el && !(el.style.overflow && el.style.overflow === 'hidden') && ((el.clientWidth && el.scrollWidth > el.clientWidth) || (el.clientHeight && el.scrollHeight > el.clientHeight)));
+		},
+		getScalar = function(orig, dim) {
+			var value = parseInt(orig, 10) || 0;
+
+			if (dim && isPercentage(orig)) {
+				value = F.getViewport()[ dim ] / 100 * value;
+			}
+
+			return Math.ceil(value);
+		},
+		getValue = function(value, dim) {
+			return getScalar(value, dim) + 'px';
+		};
+
+	$.extend(F, {
+		// The current version of fancyBox
+		version: '2.1.5',
+
+		defaults: {
+			padding : 15,
+			margin  : 20,
+
+			width     : 800,
+			height    : 600,
+			minWidth  : 100,
+			minHeight : 100,
+			maxWidth  : 9999,
+			maxHeight : 9999,
+			pixelRatio: 1, // Set to 2 for retina display support
+
+			autoSize   : true,
+			autoHeight : false,
+			autoWidth  : false,
+
+			autoResize  : true,
+			autoCenter  : !isTouch,
+			fitToView   : true,
+			aspectRatio : false,
+			topRatio    : 0.5,
+			leftRatio   : 0.5,
+
+			scrolling : 'auto', // 'auto', 'yes' or 'no'
+			wrapCSS   : '',
+
+			arrows     : true,
+			closeBtn   : true,
+			closeClick : false,
+			nextClick  : false,
+			mouseWheel : true,
+			autoPlay   : false,
+			playSpeed  : 3000,
+			preload    : 3,
+			modal      : false,
+			loop       : true,
+
+			ajax  : {
+				dataType : 'html',
+				headers  : { 'X-fancyBox': true }
+			},
+			iframe : {
+				scrolling : 'auto',
+				preload   : true
+			},
+			swf : {
+				wmode: 'transparent',
+				allowfullscreen   : 'true',
+				allowscriptaccess : 'always'
+			},
+
+			keys  : {
+				next : {
+					13 : 'left', // enter
+					34 : 'up',   // page down
+					39 : 'left', // right arrow
+					40 : 'up'    // down arrow
+				},
+				prev : {
+					8  : 'right',  // backspace
+					33 : 'down',   // page up
+					37 : 'right',  // left arrow
+					38 : 'down'    // up arrow
+				},
+				close  : [27], // escape key
+				play   : [32], // space - start/stop slideshow
+				toggle : [70]  // letter "f" - toggle fullscreen
+			},
+
+			direction : {
+				next : 'left',
+				prev : 'right'
+			},
+
+			scrollOutside  : true,
+
+			// Override some properties
+			index   : 0,
+			type    : null,
+			href    : null,
+			content : null,
+			title   : null,
+
+			// HTML templates
+			tpl: {
+				wrap     : '<div class="fancybox-wrap" tabIndex="-1"><div class="fancybox-skin"><div class="fancybox-outer"><div class="fancybox-inner"></div></div></div></div>',
+				image    : '<img class="fancybox-image" src="{href}" alt="img" />',
+				iframe   : '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen' + (IE ? ' allowtransparency="true"' : '') + '></iframe>',
+				error    : '<p class="fancybox-error">The requested content cannot be loaded.<br/>Please try again later.</p>',
+				closeBtn : '<a title="Close" class="fancybox-item fancybox-close" href="javascript:;"></a>',
+				next     : '<a title="Next" class="fancybox-nav fancybox-next" href="javascript:;"><span></span></a>',
+				prev     : '<a title="Previous" class="fancybox-nav fancybox-prev" href="javascript:;"><span></span></a>'
+			},
+
+			// Properties for each animation type
+			// Opening fancyBox
+			openEffect  : 'fade', // 'elastic', 'fade' or 'none'
+			openSpeed   : 250,
+			openEasing  : 'swing',
+			openOpacity : true,
+			openMethod  : 'zoomIn',
+
+			// Closing fancyBox
+			closeEffect  : 'fade', // 'elastic', 'fade' or 'none'
+			closeSpeed   : 250,
+			closeEasing  : 'swing',
+			closeOpacity : true,
+			closeMethod  : 'zoomOut',
+
+			// Changing next gallery item
+			nextEffect : 'elastic', // 'elastic', 'fade' or 'none'
+			nextSpeed  : 250,
+			nextEasing : 'swing',
+			nextMethod : 'changeIn',
+
+			// Changing previous gallery item
+			prevEffect : 'elastic', // 'elastic', 'fade' or 'none'
+			prevSpeed  : 250,
+			prevEasing : 'swing',
+			prevMethod : 'changeOut',
+
+			// Enable default helpers
+			helpers : {
+				overlay : true,
+				title   : true
+			},
+
+			// Callbacks
+			onCancel     : $.noop, // If canceling
+			beforeLoad   : $.noop, // Before loading
+			afterLoad    : $.noop, // After loading
+			beforeShow   : $.noop, // Before changing in current item
+			afterShow    : $.noop, // After opening
+			beforeChange : $.noop, // Before changing gallery item
+			beforeClose  : $.noop, // Before closing
+			afterClose   : $.noop  // After closing
+		},
+
+		//Current state
+		group    : {}, // Selected group
+		opts     : {}, // Group options
+		previous : null,  // Previous element
+		coming   : null,  // Element being loaded
+		current  : null,  // Currently loaded element
+		isActive : false, // Is activated
+		isOpen   : false, // Is currently open
+		isOpened : false, // Have been fully opened at least once
+
+		wrap  : null,
+		skin  : null,
+		outer : null,
+		inner : null,
+
+		player : {
+			timer    : null,
+			isActive : false
+		},
+
+		// Loaders
+		ajaxLoad   : null,
+		imgPreload : null,
+
+		// Some collections
+		transitions : {},
+		helpers     : {},
+
+		/*
+		 *	Static methods
+		 */
+
+		open: function (group, opts) {
+			if (!group) {
+				return;
+			}
+
+			if (!$.isPlainObject(opts)) {
+				opts = {};
+			}
+
+			// Close if already active
+			if (false === F.close(true)) {
+				return;
+			}
+
+			// Normalize group
+			if (!$.isArray(group)) {
+				group = isQuery(group) ? $(group).get() : [group];
+			}
+
+			// Recheck if the type of each element is `object` and set content type (image, ajax, etc)
+			$.each(group, function(i, element) {
+				var obj = {},
+					href,
+					title,
+					content,
+					type,
+					rez,
+					hrefParts,
+					selector;
+
+				if ($.type(element) === "object") {
+					// Check if is DOM element
+					if (element.nodeType) {
+						element = $(element);
+					}
+
+					if (isQuery(element)) {
+						obj = {
+							href    : element.data('fancybox-href') || element.attr('href'),
+							title   : element.data('fancybox-title') || element.attr('title'),
+							isDom   : true,
+							element : element
+						};
+
+						if ($.metadata) {
+							$.extend(true, obj, element.metadata());
+						}
+
+					} else {
+						obj = element;
+					}
+				}
+
+				href  = opts.href  || obj.href || (isString(element) ? element : null);
+				title = opts.title !== undefined ? opts.title : obj.title || '';
+
+				content = opts.content || obj.content;
+				type    = content ? 'html' : (opts.type  || obj.type);
+
+				if (!type && obj.isDom) {
+					type = element.data('fancybox-type');
+
+					if (!type) {
+						rez  = element.prop('class').match(/fancybox\.(\w+)/);
+						type = rez ? rez[1] : null;
+					}
+				}
+
+				if (isString(href)) {
+					// Try to guess the content type
+					if (!type) {
+						if (F.isImage(href)) {
+							type = 'image';
+
+						} else if (F.isSWF(href)) {
+							type = 'swf';
+
+						} else if (href.charAt(0) === '#') {
+							type = 'inline';
+
+						} else if (isString(element)) {
+							type    = 'html';
+							content = element;
+						}
+					}
+
+					// Split url into two pieces with source url and content selector, e.g,
+					// "/mypage.html #my_id" will load "/mypage.html" and display element having id "my_id"
+					if (type === 'ajax') {
+						hrefParts = href.split(/\s+/, 2);
+						href      = hrefParts.shift();
+						selector  = hrefParts.shift();
+					}
+				}
+
+				if (!content) {
+					if (type === 'inline') {
+						if (href) {
+							content = $( isString(href) ? href.replace(/.*(?=#[^\s]+$)/, '') : href ); //strip for ie7
+
+						} else if (obj.isDom) {
+							content = element;
+						}
+
+					} else if (type === 'html') {
+						content = href;
+
+					} else if (!type && !href && obj.isDom) {
+						type    = 'inline';
+						content = element;
+					}
+				}
+
+				$.extend(obj, {
+					href     : href,
+					type     : type,
+					content  : content,
+					title    : title,
+					selector : selector
+				});
+
+				group[ i ] = obj;
+			});
+
+			// Extend the defaults
+			F.opts = $.extend(true, {}, F.defaults, opts);
+
+			// All options are merged recursive except keys
+			if (opts.keys !== undefined) {
+				F.opts.keys = opts.keys ? $.extend({}, F.defaults.keys, opts.keys) : false;
+			}
+
+			F.group = group;
+
+			return F._start(F.opts.index);
+		},
+
+		// Cancel image loading or abort ajax request
+		cancel: function () {
+			var coming = F.coming;
+
+			if (!coming || false === F.trigger('onCancel')) {
+				return;
+			}
+
+			F.hideLoading();
+
+			if (F.ajaxLoad) {
+				F.ajaxLoad.abort();
+			}
+
+			F.ajaxLoad = null;
+
+			if (F.imgPreload) {
+				F.imgPreload.onload = F.imgPreload.onerror = null;
+			}
+
+			if (coming.wrap) {
+				coming.wrap.stop(true, true).trigger('onReset').remove();
+			}
+
+			F.coming = null;
+
+			// If the first item has been canceled, then clear everything
+			if (!F.current) {
+				F._afterZoomOut( coming );
+			}
+		},
+
+		// Start closing animation if is open; remove immediately if opening/closing
+		close: function (event) {
+			F.cancel();
+
+			if (false === F.trigger('beforeClose')) {
+				return;
+			}
+
+			F.unbindEvents();
+
+			if (!F.isActive) {
+				return;
+			}
+
+			if (!F.isOpen || event === true) {
+				$('.fancybox-wrap').stop(true).trigger('onReset').remove();
+
+				F._afterZoomOut();
+
+			} else {
+				F.isOpen = F.isOpened = false;
+				F.isClosing = true;
+
+				$('.fancybox-item, .fancybox-nav').remove();
+
+				F.wrap.stop(true, true).removeClass('fancybox-opened');
+
+				F.transitions[ F.current.closeMethod ]();
+			}
+		},
+
+		// Manage slideshow:
+		//   $.fancybox.play(); - toggle slideshow
+		//   $.fancybox.play( true ); - start
+		//   $.fancybox.play( false ); - stop
+		play: function ( action ) {
+			var clear = function () {
+					clearTimeout(F.player.timer);
+				},
+				set = function () {
+					clear();
+
+					if (F.current && F.player.isActive) {
+						F.player.timer = setTimeout(F.next, F.current.playSpeed);
+					}
+				},
+				stop = function () {
+					clear();
+
+					D.unbind('.player');
+
+					F.player.isActive = false;
+
+					F.trigger('onPlayEnd');
+				},
+				start = function () {
+					if (F.current && (F.current.loop || F.current.index < F.group.length - 1)) {
+						F.player.isActive = true;
+
+						D.bind({
+							'onCancel.player beforeClose.player' : stop,
+							'onUpdate.player'   : set,
+							'beforeLoad.player' : clear
+						});
+
+						set();
+
+						F.trigger('onPlayStart');
+					}
+				};
+
+			if (action === true || (!F.player.isActive && action !== false)) {
+				start();
+			} else {
+				stop();
+			}
+		},
+
+		// Navigate to next gallery item
+		next: function ( direction ) {
+			var current = F.current;
+
+			if (current) {
+				if (!isString(direction)) {
+					direction = current.direction.next;
+				}
+
+				F.jumpto(current.index + 1, direction, 'next');
+			}
+		},
+
+		// Navigate to previous gallery item
+		prev: function ( direction ) {
+			var current = F.current;
+
+			if (current) {
+				if (!isString(direction)) {
+					direction = current.direction.prev;
+				}
+
+				F.jumpto(current.index - 1, direction, 'prev');
+			}
+		},
+
+		// Navigate to gallery item by index
+		jumpto: function ( index, direction, router ) {
+			var current = F.current;
+
+			if (!current) {
+				return;
+			}
+
+			index = getScalar(index);
+
+			F.direction = direction || current.direction[ (index >= current.index ? 'next' : 'prev') ];
+			F.router    = router || 'jumpto';
+
+			if (current.loop) {
+				if (index < 0) {
+					index = current.group.length + (index % current.group.length);
+				}
+
+				index = index % current.group.length;
+			}
+
+			if (current.group[ index ] !== undefined) {
+				F.cancel();
+
+				F._start(index);
+			}
+		},
+
+		// Center inside viewport and toggle position type to fixed or absolute if needed
+		reposition: function (e, onlyAbsolute) {
+			var current = F.current,
+				wrap    = current ? current.wrap : null,
+				pos;
+
+			if (wrap) {
+				pos = F._getPosition(onlyAbsolute);
+
+				if (e && e.type === 'scroll') {
+					delete pos.position;
+
+					wrap.stop(true, true).animate(pos, 200);
+
+				} else {
+					wrap.css(pos);
+
+					current.pos = $.extend({}, current.dim, pos);
+				}
+			}
+		},
+
+		update: function (e) {
+			var type = (e && e.type),
+				anyway = !type || type === 'orientationchange';
+
+			if (anyway) {
+				clearTimeout(didUpdate);
+
+				didUpdate = null;
+			}
+
+			if (!F.isOpen || didUpdate) {
+				return;
+			}
+
+			didUpdate = setTimeout(function() {
+				var current = F.current;
+
+				if (!current || F.isClosing) {
+					return;
+				}
+
+				F.wrap.removeClass('fancybox-tmp');
+
+				if (anyway || type === 'load' || (type === 'resize' && current.autoResize)) {
+					F._setDimension();
+				}
+
+				if (!(type === 'scroll' && current.canShrink)) {
+					F.reposition(e);
+				}
+
+				F.trigger('onUpdate');
+
+				didUpdate = null;
+
+			}, (anyway && !isTouch ? 0 : 300));
+		},
+
+		// Shrink content to fit inside viewport or restore if resized
+		toggle: function ( action ) {
+			if (F.isOpen) {
+				F.current.fitToView = $.type(action) === "boolean" ? action : !F.current.fitToView;
+
+				// Help browser to restore document dimensions
+				if (isTouch) {
+					F.wrap.removeAttr('style').addClass('fancybox-tmp');
+
+					F.trigger('onUpdate');
+				}
+
+				F.update();
+			}
+		},
+
+		hideLoading: function () {
+			D.unbind('.loading');
+
+			$('#fancybox-loading').remove();
+		},
+
+		showLoading: function () {
+			var el, viewport;
+
+			F.hideLoading();
+
+			el = $('<div id="fancybox-loading"><div></div></div>').click(F.cancel).appendTo('body');
+
+			// If user will press the escape-button, the request will be canceled
+			D.bind('keydown.loading', function(e) {
+				if ((e.which || e.keyCode) === 27) {
+					e.preventDefault();
+
+					F.cancel();
+				}
+			});
+
+			if (!F.defaults.fixed) {
+				viewport = F.getViewport();
+
+				el.css({
+					position : 'absolute',
+					top  : (viewport.h * 0.5) + viewport.y,
+					left : (viewport.w * 0.5) + viewport.x
+				});
+			}
+		},
+
+		getViewport: function () {
+			var locked = (F.current && F.current.locked) || false,
+				rez    = {
+					x: W.scrollLeft(),
+					y: W.scrollTop()
+				};
+
+			if (locked) {
+				rez.w = locked[0].clientWidth;
+				rez.h = locked[0].clientHeight;
+
+			} else {
+				// See http://bugs.jquery.com/ticket/6724
+				rez.w = isTouch && window.innerWidth  ? window.innerWidth  : W.width();
+				rez.h = isTouch && window.innerHeight ? window.innerHeight : W.height();
+			}
+
+			return rez;
+		},
+
+		// Unbind the keyboard / clicking actions
+		unbindEvents: function () {
+			if (F.wrap && isQuery(F.wrap)) {
+				F.wrap.unbind('.fb');
+			}
+
+			D.unbind('.fb');
+			W.unbind('.fb');
+		},
+
+		bindEvents: function () {
+			var current = F.current,
+				keys;
+
+			if (!current) {
+				return;
+			}
+
+			// Changing document height on iOS devices triggers a 'resize' event,
+			// that can change document height... repeating infinitely
+			W.bind('orientationchange.fb' + (isTouch ? '' : ' resize.fb') + (current.autoCenter && !current.locked ? ' scroll.fb' : ''), F.update);
+
+			keys = current.keys;
+
+			if (keys) {
+				D.bind('keydown.fb', function (e) {
+					var code   = e.which || e.keyCode,
+						target = e.target || e.srcElement;
+
+					// Skip esc key if loading, because showLoading will cancel preloading
+					if (code === 27 && F.coming) {
+						return false;
+					}
+
+					// Ignore key combinations and key events within form elements
+					if (!e.ctrlKey && !e.altKey && !e.shiftKey && !e.metaKey && !(target && (target.type || $(target).is('[contenteditable]')))) {
+						$.each(keys, function(i, val) {
+							if (current.group.length > 1 && val[ code ] !== undefined) {
+								F[ i ]( val[ code ] );
+
+								e.preventDefault();
+								return false;
+							}
+
+							if ($.inArray(code, val) > -1) {
+								F[ i ] ();
+
+								e.preventDefault();
+								return false;
+							}
+						});
+					}
+				});
+			}
+
+			if ($.fn.mousewheel && current.mouseWheel) {
+				F.wrap.bind('mousewheel.fb', function (e, delta, deltaX, deltaY) {
+					var target = e.target || null,
+						parent = $(target),
+						canScroll = false;
+
+					while (parent.length) {
+						if (canScroll || parent.is('.fancybox-skin') || parent.is('.fancybox-wrap')) {
+							break;
+						}
+
+						canScroll = isScrollable( parent[0] );
+						parent    = $(parent).parent();
+					}
+
+					if (delta !== 0 && !canScroll) {
+						if (F.group.length > 1 && !current.canShrink) {
+							if (deltaY > 0 || deltaX > 0) {
+								F.prev( deltaY > 0 ? 'down' : 'left' );
+
+							} else if (deltaY < 0 || deltaX < 0) {
+								F.next( deltaY < 0 ? 'up' : 'right' );
+							}
+
+							e.preventDefault();
+						}
+					}
+				});
+			}
+		},
+
+		trigger: function (event, o) {
+			var ret, obj = o || F.coming || F.current;
+
+			if (!obj) {
+				return;
+			}
+
+			if ($.isFunction( obj[event] )) {
+				ret = obj[event].apply(obj, Array.prototype.slice.call(arguments, 1));
+			}
+
+			if (ret === false) {
+				return false;
+			}
+
+			if (obj.helpers) {
+				$.each(obj.helpers, function (helper, opts) {
+					if (opts && F.helpers[helper] && $.isFunction(F.helpers[helper][event])) {
+						F.helpers[helper][event]($.extend(true, {}, F.helpers[helper].defaults, opts), obj);
+					}
+				});
+			}
+
+			D.trigger(event);
+		},
+
+		isImage: function (str) {
+			return isString(str) && str.match(/(^data:image\/.*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg)((\?|#).*)?$)/i);
+		},
+
+		isSWF: function (str) {
+			return isString(str) && str.match(/\.(swf)((\?|#).*)?$/i);
+		},
+
+		_start: function (index) {
+			var coming = {},
+				obj,
+				href,
+				type,
+				margin,
+				padding;
+
+			index = getScalar( index );
+			obj   = F.group[ index ] || null;
+
+			if (!obj) {
+				return false;
+			}
+
+			coming = $.extend(true, {}, F.opts, obj);
+
+			// Convert margin and padding properties to array - top, right, bottom, left
+			margin  = coming.margin;
+			padding = coming.padding;
+
+			if ($.type(margin) === 'number') {
+				coming.margin = [margin, margin, margin, margin];
+			}
+
+			if ($.type(padding) === 'number') {
+				coming.padding = [padding, padding, padding, padding];
+			}
+
+			// 'modal' propery is just a shortcut
+			if (coming.modal) {
+				$.extend(true, coming, {
+					closeBtn   : false,
+					closeClick : false,
+					nextClick  : false,
+					arrows     : false,
+					mouseWheel : false,
+					keys       : null,
+					helpers: {
+						overlay : {
+							closeClick : false
+						}
+					}
+				});
+			}
+
+			// 'autoSize' property is a shortcut, too
+			if (coming.autoSize) {
+				coming.autoWidth = coming.autoHeight = true;
+			}
+
+			if (coming.width === 'auto') {
+				coming.autoWidth = true;
+			}
+
+			if (coming.height === 'auto') {
+				coming.autoHeight = true;
+			}
+
+			/*
+			 * Add reference to the group, so it`s possible to access from callbacks, example:
+			 * afterLoad : function() {
+			 *     this.title = 'Image ' + (this.index + 1) + ' of ' + this.group.length + (this.title ? ' - ' + this.title : '');
+			 * }
+			 */
+
+			coming.group  = F.group;
+			coming.index  = index;
+
+			// Give a chance for callback or helpers to update coming item (type, title, etc)
+			F.coming = coming;
+
+			if (false === F.trigger('beforeLoad')) {
+				F.coming = null;
+
+				return;
+			}
+
+			type = coming.type;
+			href = coming.href;
+
+			if (!type) {
+				F.coming = null;
+
+				//If we can not determine content type then drop silently or display next/prev item if looping through gallery
+				if (F.current && F.router && F.router !== 'jumpto') {
+					F.current.index = index;
+
+					return F[ F.router ]( F.direction );
+				}
+
+				return false;
+			}
+
+			F.isActive = true;
+
+			if (type === 'image' || type === 'swf') {
+				coming.autoHeight = coming.autoWidth = false;
+				coming.scrolling  = 'visible';
+			}
+
+			if (type === 'image') {
+				coming.aspectRatio = true;
+			}
+
+			if (type === 'iframe' && isTouch) {
+				coming.scrolling = 'scroll';
+			}
+
+			// Build the neccessary markup
+			coming.wrap = $(coming.tpl.wrap).addClass('fancybox-' + (isTouch ? 'mobile' : 'desktop') + ' fancybox-type-' + type + ' fancybox-tmp ' + coming.wrapCSS).appendTo( coming.parent || 'body' );
+
+			$.extend(coming, {
+				skin  : $('.fancybox-skin',  coming.wrap),
+				outer : $('.fancybox-outer', coming.wrap),
+				inner : $('.fancybox-inner', coming.wrap)
+			});
+
+			$.each(["Top", "Right", "Bottom", "Left"], function(i, v) {
+				coming.skin.css('padding' + v, getValue(coming.padding[ i ]));
+			});
+
+			F.trigger('onReady');
+
+			// Check before try to load; 'inline' and 'html' types need content, others - href
+			if (type === 'inline' || type === 'html') {
+				if (!coming.content || !coming.content.length) {
+					return F._error( 'content' );
+				}
+
+			} else if (!href) {
+				return F._error( 'href' );
+			}
+
+			if (type === 'image') {
+				F._loadImage();
+
+			} else if (type === 'ajax') {
+				F._loadAjax();
+
+			} else if (type === 'iframe') {
+				F._loadIframe();
+
+			} else {
+				F._afterLoad();
+			}
+		},
+
+		_error: function ( type ) {
+			$.extend(F.coming, {
+				type       : 'html',
+				autoWidth  : true,
+				autoHeight : true,
+				minWidth   : 0,
+				minHeight  : 0,
+				scrolling  : 'no',
+				hasError   : type,
+				content    : F.coming.tpl.error
+			});
+
+			F._afterLoad();
+		},
+
+		_loadImage: function () {
+			// Reset preload image so it is later possible to check "complete" property
+			var img = F.imgPreload = new Image();
+
+			img.onload = function () {
+				this.onload = this.onerror = null;
+
+				F.coming.width  = this.width / F.opts.pixelRatio;
+				F.coming.height = this.height / F.opts.pixelRatio;
+
+				F._afterLoad();
+			};
+
+			img.onerror = function () {
+				this.onload = this.onerror = null;
+
+				F._error( 'image' );
+			};
+
+			img.src = F.coming.href;
+
+			if (img.complete !== true) {
+				F.showLoading();
+			}
+		},
+
+		_loadAjax: function () {
+			var coming = F.coming;
+
+			F.showLoading();
+
+			F.ajaxLoad = $.ajax($.extend({}, coming.ajax, {
+				url: coming.href,
+				error: function (jqXHR, textStatus) {
+					if (F.coming && textStatus !== 'abort') {
+						F._error( 'ajax', jqXHR );
+
+					} else {
+						F.hideLoading();
+					}
+				},
+				success: function (data, textStatus) {
+					if (textStatus === 'success') {
+						coming.content = data;
+
+						F._afterLoad();
+					}
+				}
+			}));
+		},
+
+		_loadIframe: function() {
+			var coming = F.coming,
+				iframe = $(coming.tpl.iframe.replace(/\{rnd\}/g, new Date().getTime()))
+					.attr('scrolling', isTouch ? 'auto' : coming.iframe.scrolling)
+					.attr('src', coming.href);
+
+			// This helps IE
+			$(coming.wrap).bind('onReset', function () {
+				try {
+					$(this).find('iframe').hide().attr('src', '//about:blank').end().empty();
+				} catch (e) {}
+			});
+
+			if (coming.iframe.preload) {
+				F.showLoading();
+
+				iframe.one('load', function() {
+					$(this).data('ready', 1);
+
+					// iOS will lose scrolling if we resize
+					if (!isTouch) {
+						$(this).bind('load.fb', F.update);
+					}
+
+					// Without this trick:
+					//   - iframe won't scroll on iOS devices
+					//   - IE7 sometimes displays empty iframe
+					$(this).parents('.fancybox-wrap').width('100%').removeClass('fancybox-tmp').show();
+
+					F._afterLoad();
+				});
+			}
+
+			coming.content = iframe.appendTo( coming.inner );
+
+			if (!coming.iframe.preload) {
+				F._afterLoad();
+			}
+		},
+
+		_preloadImages: function() {
+			var group   = F.group,
+				current = F.current,
+				len     = group.length,
+				cnt     = current.preload ? Math.min(current.preload, len - 1) : 0,
+				item,
+				i;
+
+			for (i = 1; i <= cnt; i += 1) {
+				item = group[ (current.index + i ) % len ];
+
+				if (item.type === 'image' && item.href) {
+					new Image().src = item.href;
+				}
+			}
+		},
+
+		_afterLoad: function () {
+			var coming   = F.coming,
+				previous = F.current,
+				placeholder = 'fancybox-placeholder',
+				current,
+				content,
+				type,
+				scrolling,
+				href,
+				embed;
+
+			F.hideLoading();
+
+			if (!coming || F.isActive === false) {
+				return;
+			}
+
+			if (false === F.trigger('afterLoad', coming, previous)) {
+				coming.wrap.stop(true).trigger('onReset').remove();
+
+				F.coming = null;
+
+				return;
+			}
+
+			if (previous) {
+				F.trigger('beforeChange', previous);
+
+				previous.wrap.stop(true).removeClass('fancybox-opened')
+					.find('.fancybox-item, .fancybox-nav')
+					.remove();
+			}
+
+			F.unbindEvents();
+
+			current   = coming;
+			content   = coming.content;
+			type      = coming.type;
+			scrolling = coming.scrolling;
+
+			$.extend(F, {
+				wrap  : current.wrap,
+				skin  : current.skin,
+				outer : current.outer,
+				inner : current.inner,
+				current  : current,
+				previous : previous
+			});
+
+			href = current.href;
+
+			switch (type) {
+				case 'inline':
+				case 'ajax':
+				case 'html':
+					if (current.selector) {
+						content = $('<div>').html(content).find(current.selector);
+
+					} else if (isQuery(content)) {
+						if (!content.data(placeholder)) {
+							content.data(placeholder, $('<div class="' + placeholder + '"></div>').insertAfter( content ).hide() );
+						}
+
+						content = content.show().detach();
+
+						current.wrap.bind('onReset', function () {
+							if ($(this).find(content).length) {
+								content.hide().replaceAll( content.data(placeholder) ).data(placeholder, false);
+							}
+						});
+					}
+				break;
+
+				case 'image':
+					content = current.tpl.image.replace('{href}', href);
+				break;
+
+				case 'swf':
+					content = '<object id="fancybox-swf" classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="100%" height="100%"><param name="movie" value="' + href + '"></param>';
+					embed   = '';
+
+					$.each(current.swf, function(name, val) {
+						content += '<param name="' + name + '" value="' + val + '"></param>';
+						embed   += ' ' + name + '="' + val + '"';
+					});
+
+					content += '<embed src="' + href + '" type="application/x-shockwave-flash" width="100%" height="100%"' + embed + '></embed></object>';
+				break;
+			}
+
+			if (!(isQuery(content) && content.parent().is(current.inner))) {
+				current.inner.append( content );
+			}
+
+			// Give a chance for helpers or callbacks to update elements
+			F.trigger('beforeShow');
+
+			// Set scrolling before calculating dimensions
+			current.inner.css('overflow', scrolling === 'yes' ? 'scroll' : (scrolling === 'no' ? 'hidden' : scrolling));
+
+			// Set initial dimensions and start position
+			F._setDimension();
+
+			F.reposition();
+
+			F.isOpen = false;
+			F.coming = null;
+
+			F.bindEvents();
+
+			if (!F.isOpened) {
+				$('.fancybox-wrap').not( current.wrap ).stop(true).trigger('onReset').remove();
+
+			} else if (previous.prevMethod) {
+				F.transitions[ previous.prevMethod ]();
+			}
+
+			F.transitions[ F.isOpened ? current.nextMethod : current.openMethod ]();
+
+			F._preloadImages();
+		},
+
+		_setDimension: function () {
+			var viewport   = F.getViewport(),
+				steps      = 0,
+				canShrink  = false,
+				canExpand  = false,
+				wrap       = F.wrap,
+				skin       = F.skin,
+				inner      = F.inner,
+				current    = F.current,
+				width      = current.width,
+				height     = current.height,
+				minWidth   = current.minWidth,
+				minHeight  = current.minHeight,
+				maxWidth   = current.maxWidth,
+				maxHeight  = current.maxHeight,
+				scrolling  = current.scrolling,
+				scrollOut  = current.scrollOutside ? current.scrollbarWidth : 0,
+				margin     = current.margin,
+				wMargin    = getScalar(margin[1] + margin[3]),
+				hMargin    = getScalar(margin[0] + margin[2]),
+				wPadding,
+				hPadding,
+				wSpace,
+				hSpace,
+				origWidth,
+				origHeight,
+				origMaxWidth,
+				origMaxHeight,
+				ratio,
+				width_,
+				height_,
+				maxWidth_,
+				maxHeight_,
+				iframe,
+				body;
+
+			// Reset dimensions so we could re-check actual size
+			wrap.add(skin).add(inner).width('auto').height('auto').removeClass('fancybox-tmp');
+
+			wPadding = getScalar(skin.outerWidth(true)  - skin.width());
+			hPadding = getScalar(skin.outerHeight(true) - skin.height());
+
+			// Any space between content and viewport (margin, padding, border, title)
+			wSpace = wMargin + wPadding;
+			hSpace = hMargin + hPadding;
+
+			origWidth  = isPercentage(width)  ? (viewport.w - wSpace) * getScalar(width)  / 100 : width;
+			origHeight = isPercentage(height) ? (viewport.h - hSpace) * getScalar(height) / 100 : height;
+
+			if (current.type === 'iframe') {
+				iframe = current.content;
+
+				if (current.autoHeight && iframe.data('ready') === 1) {
+					try {
+						if (iframe[0].contentWindow.document.location) {
+							inner.width( origWidth ).height(9999);
+
+							body = iframe.contents().find('body');
+
+							if (scrollOut) {
+								body.css('overflow-x', 'hidden');
+							}
+
+							origHeight = body.outerHeight(true);
+						}
+
+					} catch (e) {}
+				}
+
+			} else if (current.autoWidth || current.autoHeight) {
+				inner.addClass( 'fancybox-tmp' );
+
+				// Set width or height in case we need to calculate only one dimension
+				if (!current.autoWidth) {
+					inner.width( origWidth );
+				}
+
+				if (!current.autoHeight) {
+					inner.height( origHeight );
+				}
+
+				if (current.autoWidth) {
+					origWidth = inner.width();
+				}
+
+				if (current.autoHeight) {
+					origHeight = inner.height();
+				}
+
+				inner.removeClass( 'fancybox-tmp' );
+			}
+
+			width  = getScalar( origWidth );
+			height = getScalar( origHeight );
+
+			ratio  = origWidth / origHeight;
+
+			// Calculations for the content
+			minWidth  = getScalar(isPercentage(minWidth) ? getScalar(minWidth, 'w') - wSpace : minWidth);
+			maxWidth  = getScalar(isPercentage(maxWidth) ? getScalar(maxWidth, 'w') - wSpace : maxWidth);
+
+			minHeight = getScalar(isPercentage(minHeight) ? getScalar(minHeight, 'h') - hSpace : minHeight);
+			maxHeight = getScalar(isPercentage(maxHeight) ? getScalar(maxHeight, 'h') - hSpace : maxHeight);
+
+			// These will be used to determine if wrap can fit in the viewport
+			origMaxWidth  = maxWidth;
+			origMaxHeight = maxHeight;
+
+			if (current.fitToView) {
+				maxWidth  = Math.min(viewport.w - wSpace, maxWidth);
+				maxHeight = Math.min(viewport.h - hSpace, maxHeight);
+			}
+
+			maxWidth_  = viewport.w - wMargin;
+			maxHeight_ = viewport.h - hMargin;
+
+			if (current.aspectRatio) {
+				if (width > maxWidth) {
+					width  = maxWidth;
+					height = getScalar(width / ratio);
+				}
+
+				if (height > maxHeight) {
+					height = maxHeight;
+					width  = getScalar(height * ratio);
+				}
+
+				if (width < minWidth) {
+					width  = minWidth;
+					height = getScalar(width / ratio);
+				}
+
+				if (height < minHeight) {
+					height = minHeight;
+					width  = getScalar(height * ratio);
+				}
+
+			} else {
+				width = Math.max(minWidth, Math.min(width, maxWidth));
+
+				if (current.autoHeight && current.type !== 'iframe') {
+					inner.width( width );
+
+					height = inner.height();
+				}
+
+				height = Math.max(minHeight, Math.min(height, maxHeight));
+			}
+
+			// Try to fit inside viewport (including the title)
+			if (current.fitToView) {
+				inner.width( width ).height( height );
+
+				wrap.width( width + wPadding );
+
+				// Real wrap dimensions
+				width_  = wrap.width();
+				height_ = wrap.height();
+
+				if (current.aspectRatio) {
+					while ((width_ > maxWidth_ || height_ > maxHeight_) && width > minWidth && height > minHeight) {
+						if (steps++ > 19) {
+							break;
+						}
+
+						height = Math.max(minHeight, Math.min(maxHeight, height - 10));
+						width  = getScalar(height * ratio);
+
+						if (width < minWidth) {
+							width  = minWidth;
+							height = getScalar(width / ratio);
+						}
+
+						if (width > maxWidth) {
+							width  = maxWidth;
+							height = getScalar(width / ratio);
+						}
+
+						inner.width( width ).height( height );
+
+						wrap.width( width + wPadding );
+
+						width_  = wrap.width();
+						height_ = wrap.height();
+					}
+
+				} else {
+					width  = Math.max(minWidth,  Math.min(width,  width  - (width_  - maxWidth_)));
+					height = Math.max(minHeight, Math.min(height, height - (height_ - maxHeight_)));
+				}
+			}
+
+			if (scrollOut && scrolling === 'auto' && height < origHeight && (width + wPadding + scrollOut) < maxWidth_) {
+				width += scrollOut;
+			}
+
+			inner.width( width ).height( height );
+
+			wrap.width( width + wPadding );
+
+			width_  = wrap.width();
+			height_ = wrap.height();
+
+			canShrink = (width_ > maxWidth_ || height_ > maxHeight_) && width > minWidth && height > minHeight;
+			canExpand = current.aspectRatio ? (width < origMaxWidth && height < origMaxHeight && width < origWidth && height < origHeight) : ((width < origMaxWidth || height < origMaxHeight) && (width < origWidth || height < origHeight));
+
+			$.extend(current, {
+				dim : {
+					width	: getValue( width_ ),
+					height	: getValue( height_ )
+				},
+				origWidth  : origWidth,
+				origHeight : origHeight,
+				canShrink  : canShrink,
+				canExpand  : canExpand,
+				wPadding   : wPadding,
+				hPadding   : hPadding,
+				wrapSpace  : height_ - skin.outerHeight(true),
+				skinSpace  : skin.height() - height
+			});
+
+			if (!iframe && current.autoHeight && height > minHeight && height < maxHeight && !canExpand) {
+				inner.height('auto');
+			}
+		},
+
+		_getPosition: function (onlyAbsolute) {
+			var current  = F.current,
+				viewport = F.getViewport(),
+				margin   = current.margin,
+				width    = F.wrap.width()  + margin[1] + margin[3],
+				height   = F.wrap.height() + margin[0] + margin[2],
+				rez      = {
+					position: 'absolute',
+					top  : margin[0],
+					left : margin[3]
+				};
+
+			if (current.autoCenter && current.fixed && !onlyAbsolute && height <= viewport.h && width <= viewport.w) {
+				rez.position = 'fixed';
+
+			} else if (!current.locked) {
+				rez.top  += viewport.y;
+				rez.left += viewport.x;
+			}
+
+			rez.top  = getValue(Math.max(rez.top,  rez.top  + ((viewport.h - height) * current.topRatio)));
+			rez.left = getValue(Math.max(rez.left, rez.left + ((viewport.w - width)  * current.leftRatio)));
+
+			return rez;
+		},
+
+		_afterZoomIn: function () {
+			var current = F.current;
+
+			if (!current) {
+				return;
+			}
+
+			F.isOpen = F.isOpened = true;
+
+			F.wrap.css('overflow', 'visible').addClass('fancybox-opened');
+
+			F.update();
+
+			// Assign a click event
+			if ( current.closeClick || (current.nextClick && F.group.length > 1) ) {
+				F.inner.css('cursor', 'pointer').bind('click.fb', function(e) {
+					if (!$(e.target).is('a') && !$(e.target).parent().is('a')) {
+						e.preventDefault();
+
+						F[ current.closeClick ? 'close' : 'next' ]();
+					}
+				});
+			}
+
+			// Create a close button
+			if (current.closeBtn) {
+				$(current.tpl.closeBtn).appendTo(F.skin).bind('click.fb', function(e) {
+					e.preventDefault();
+
+					F.close();
+				});
+			}
+
+			// Create navigation arrows
+			if (current.arrows && F.group.length > 1) {
+				if (current.loop || current.index > 0) {
+					$(current.tpl.prev).appendTo(F.outer).bind('click.fb', F.prev);
+				}
+
+				if (current.loop || current.index < F.group.length - 1) {
+					$(current.tpl.next).appendTo(F.outer).bind('click.fb', F.next);
+				}
+			}
+
+			F.trigger('afterShow');
+
+			// Stop the slideshow if this is the last item
+			if (!current.loop && current.index === current.group.length - 1) {
+				F.play( false );
+
+			} else if (F.opts.autoPlay && !F.player.isActive) {
+				F.opts.autoPlay = false;
+
+				F.play();
+			}
+		},
+
+		_afterZoomOut: function ( obj ) {
+			obj = obj || F.current;
+
+			$('.fancybox-wrap').trigger('onReset').remove();
+
+			$.extend(F, {
+				group  : {},
+				opts   : {},
+				router : false,
+				current   : null,
+				isActive  : false,
+				isOpened  : false,
+				isOpen    : false,
+				isClosing : false,
+				wrap   : null,
+				skin   : null,
+				outer  : null,
+				inner  : null
+			});
+
+			F.trigger('afterClose', obj);
+		}
+	});
+
+	/*
+	 *	Default transitions
+	 */
+
+	F.transitions = {
+		getOrigPosition: function () {
+			var current  = F.current,
+				element  = current.element,
+				orig     = current.orig,
+				pos      = {},
+				width    = 50,
+				height   = 50,
+				hPadding = current.hPadding,
+				wPadding = current.wPadding,
+				viewport = F.getViewport();
+
+			if (!orig && current.isDom && element.is(':visible')) {
+				orig = element.find('img:first');
+
+				if (!orig.length) {
+					orig = element;
+				}
+			}
+
+			if (isQuery(orig)) {
+				pos = orig.offset();
+
+				if (orig.is('img')) {
+					width  = orig.outerWidth();
+					height = orig.outerHeight();
+				}
+
+			} else {
+				pos.top  = viewport.y + (viewport.h - height) * current.topRatio;
+				pos.left = viewport.x + (viewport.w - width)  * current.leftRatio;
+			}
+
+			if (F.wrap.css('position') === 'fixed' || current.locked) {
+				pos.top  -= viewport.y;
+				pos.left -= viewport.x;
+			}
+
+			pos = {
+				top     : getValue(pos.top  - hPadding * current.topRatio),
+				left    : getValue(pos.left - wPadding * current.leftRatio),
+				width   : getValue(width  + wPadding),
+				height  : getValue(height + hPadding)
+			};
+
+			return pos;
+		},
+
+		step: function (now, fx) {
+			var ratio,
+				padding,
+				value,
+				prop       = fx.prop,
+				current    = F.current,
+				wrapSpace  = current.wrapSpace,
+				skinSpace  = current.skinSpace;
+
+			if (prop === 'width' || prop === 'height') {
+				ratio = fx.end === fx.start ? 1 : (now - fx.start) / (fx.end - fx.start);
+
+				if (F.isClosing) {
+					ratio = 1 - ratio;
+				}
+
+				padding = prop === 'width' ? current.wPadding : current.hPadding;
+				value   = now - padding;
+
+				F.skin[ prop ](  getScalar( prop === 'width' ?  value : value - (wrapSpace * ratio) ) );
+				F.inner[ prop ]( getScalar( prop === 'width' ?  value : value - (wrapSpace * ratio) - (skinSpace * ratio) ) );
+			}
+		},
+
+		zoomIn: function () {
+			var current  = F.current,
+				startPos = current.pos,
+				effect   = current.openEffect,
+				elastic  = effect === 'elastic',
+				endPos   = $.extend({opacity : 1}, startPos);
+
+			// Remove "position" property that breaks older IE
+			delete endPos.position;
+
+			if (elastic) {
+				startPos = this.getOrigPosition();
+
+				if (current.openOpacity) {
+					startPos.opacity = 0.1;
+				}
+
+			} else if (effect === 'fade') {
+				startPos.opacity = 0.1;
+			}
+
+			F.wrap.css(startPos).animate(endPos, {
+				duration : effect === 'none' ? 0 : current.openSpeed,
+				easing   : current.openEasing,
+				step     : elastic ? this.step : null,
+				complete : F._afterZoomIn
+			});
+		},
+
+		zoomOut: function () {
+			var current  = F.current,
+				effect   = current.closeEffect,
+				elastic  = effect === 'elastic',
+				endPos   = {opacity : 0.1};
+
+			if (elastic) {
+				endPos = this.getOrigPosition();
+
+				if (current.closeOpacity) {
+					endPos.opacity = 0.1;
+				}
+			}
+
+			F.wrap.animate(endPos, {
+				duration : effect === 'none' ? 0 : current.closeSpeed,
+				easing   : current.closeEasing,
+				step     : elastic ? this.step : null,
+				complete : F._afterZoomOut
+			});
+		},
+
+		changeIn: function () {
+			var current   = F.current,
+				effect    = current.nextEffect,
+				startPos  = current.pos,
+				endPos    = { opacity : 1 },
+				direction = F.direction,
+				distance  = 200,
+				field;
+
+			startPos.opacity = 0.1;
+
+			if (effect === 'elastic') {
+				field = direction === 'down' || direction === 'up' ? 'top' : 'left';
+
+				if (direction === 'down' || direction === 'right') {
+					startPos[ field ] = getValue(getScalar(startPos[ field ]) - distance);
+					endPos[ field ]   = '+=' + distance + 'px';
+
+				} else {
+					startPos[ field ] = getValue(getScalar(startPos[ field ]) + distance);
+					endPos[ field ]   = '-=' + distance + 'px';
+				}
+			}
+
+			// Workaround for http://bugs.jquery.com/ticket/12273
+			if (effect === 'none') {
+				F._afterZoomIn();
+
+			} else {
+				F.wrap.css(startPos).animate(endPos, {
+					duration : current.nextSpeed,
+					easing   : current.nextEasing,
+					complete : F._afterZoomIn
+				});
+			}
+		},
+
+		changeOut: function () {
+			var previous  = F.previous,
+				effect    = previous.prevEffect,
+				endPos    = { opacity : 0.1 },
+				direction = F.direction,
+				distance  = 200;
+
+			if (effect === 'elastic') {
+				endPos[ direction === 'down' || direction === 'up' ? 'top' : 'left' ] = ( direction === 'up' || direction === 'left' ? '-' : '+' ) + '=' + distance + 'px';
+			}
+
+			previous.wrap.animate(endPos, {
+				duration : effect === 'none' ? 0 : previous.prevSpeed,
+				easing   : previous.prevEasing,
+				complete : function () {
+					$(this).trigger('onReset').remove();
+				}
+			});
+		}
+	};
+
+	/*
+	 *	Overlay helper
+	 */
+
+	F.helpers.overlay = {
+		defaults : {
+			closeClick : true,      // if true, fancyBox will be closed when user clicks on the overlay
+			speedOut   : 200,       // duration of fadeOut animation
+			showEarly  : true,      // indicates if should be opened immediately or wait until the content is ready
+			css        : {},        // custom CSS properties
+			locked     : !isTouch,  // if true, the content will be locked into overlay
+			fixed      : true       // if false, the overlay CSS position property will not be set to "fixed"
+		},
+
+		overlay : null,      // current handle
+		fixed   : false,     // indicates if the overlay has position "fixed"
+		el      : $('html'), // element that contains "the lock"
+
+		// Public methods
+		create : function(opts) {
+			opts = $.extend({}, this.defaults, opts);
+
+			if (this.overlay) {
+				this.close();
+			}
+
+			this.overlay = $('<div class="fancybox-overlay"></div>').appendTo( F.coming ? F.coming.parent : opts.parent );
+			this.fixed   = false;
+
+			if (opts.fixed && F.defaults.fixed) {
+				this.overlay.addClass('fancybox-overlay-fixed');
+
+				this.fixed = true;
+			}
+		},
+
+		open : function(opts) {
+			var that = this;
+
+			opts = $.extend({}, this.defaults, opts);
+
+			if (this.overlay) {
+				this.overlay.unbind('.overlay').width('auto').height('auto');
+
+			} else {
+				this.create(opts);
+			}
+
+			if (!this.fixed) {
+				W.bind('resize.overlay', $.proxy( this.update, this) );
+
+				this.update();
+			}
+
+			if (opts.closeClick) {
+				this.overlay.bind('click.overlay', function(e) {
+					if ($(e.target).hasClass('fancybox-overlay')) {
+						if (F.isActive) {
+							F.close();
+						} else {
+							that.close();
+						}
+
+						return false;
+					}
+				});
+			}
+
+			this.overlay.css( opts.css ).show();
+		},
+
+		close : function() {
+			var scrollV, scrollH;
+
+			W.unbind('resize.overlay');
+
+			if (this.el.hasClass('fancybox-lock')) {
+				$('.fancybox-margin').removeClass('fancybox-margin');
+
+				scrollV = W.scrollTop();
+				scrollH = W.scrollLeft();
+
+				this.el.removeClass('fancybox-lock');
+
+				W.scrollTop( scrollV ).scrollLeft( scrollH );
+			}
+
+			$('.fancybox-overlay').remove().hide();
+
+			$.extend(this, {
+				overlay : null,
+				fixed   : false
+			});
+		},
+
+		// Private, callbacks
+
+		update : function () {
+			var width = '100%', offsetWidth;
+
+			// Reset width/height so it will not mess
+			this.overlay.width(width).height('100%');
+
+			// jQuery does not return reliable result for IE
+			if (IE) {
+				offsetWidth = Math.max(document.documentElement.offsetWidth, document.body.offsetWidth);
+
+				if (D.width() > offsetWidth) {
+					width = D.width();
+				}
+
+			} else if (D.width() > W.width()) {
+				width = D.width();
+			}
+
+			this.overlay.width(width).height(D.height());
+		},
+
+		// This is where we can manipulate DOM, because later it would cause iframes to reload
+		onReady : function (opts, obj) {
+			var overlay = this.overlay;
+
+			$('.fancybox-overlay').stop(true, true);
+
+			if (!overlay) {
+				this.create(opts);
+			}
+
+			if (opts.locked && this.fixed && obj.fixed) {
+				if (!overlay) {
+					this.margin = D.height() > W.height() ? $('html').css('margin-right').replace("px", "") : false;
+				}
+
+				obj.locked = this.overlay.append( obj.wrap );
+				obj.fixed  = false;
+			}
+
+			if (opts.showEarly === true) {
+				this.beforeShow.apply(this, arguments);
+			}
+		},
+
+		beforeShow : function(opts, obj) {
+			var scrollV, scrollH;
+
+			if (obj.locked) {
+				if (this.margin !== false) {
+					$('*').filter(function(){
+						return ($(this).css('position') === 'fixed' && !$(this).hasClass("fancybox-overlay") && !$(this).hasClass("fancybox-wrap") );
+					}).addClass('fancybox-margin');
+
+					this.el.addClass('fancybox-margin');
+				}
+
+				scrollV = W.scrollTop();
+				scrollH = W.scrollLeft();
+
+				this.el.addClass('fancybox-lock');
+
+				W.scrollTop( scrollV ).scrollLeft( scrollH );
+			}
+
+			this.open(opts);
+		},
+
+		onUpdate : function() {
+			if (!this.fixed) {
+				this.update();
+			}
+		},
+
+		afterClose: function (opts) {
+			// Remove overlay if exists and fancyBox is not opening
+			// (e.g., it is not being open using afterClose callback)
+			//if (this.overlay && !F.isActive) {
+			if (this.overlay && !F.coming) {
+				this.overlay.fadeOut(opts.speedOut, $.proxy( this.close, this ));
+			}
+		}
+	};
+
+	/*
+	 *	Title helper
+	 */
+
+	F.helpers.title = {
+		defaults : {
+			type     : 'float', // 'float', 'inside', 'outside' or 'over',
+			position : 'bottom' // 'top' or 'bottom'
+		},
+
+		beforeShow: function (opts) {
+			var current = F.current,
+				text    = current.title,
+				type    = opts.type,
+				title,
+				target;
+
+			if ($.isFunction(text)) {
+				text = text.call(current.element, current);
+			}
+
+			if (!isString(text) || $.trim(text) === '') {
+				return;
+			}
+
+			title = $('<div class="fancybox-title fancybox-title-' + type + '-wrap">' + text + '</div>');
+
+			switch (type) {
+				case 'inside':
+					target = F.skin;
+				break;
+
+				case 'outside':
+					target = F.wrap;
+				break;
+
+				case 'over':
+					target = F.inner;
+				break;
+
+				default: // 'float'
+					target = F.skin;
+
+					title.appendTo('body');
+
+					if (IE) {
+						title.width( title.width() );
+					}
+
+					title.wrapInner('<span class="child"></span>');
+
+					//Increase bottom margin so this title will also fit into viewport
+					F.current.margin[2] += Math.abs( getScalar(title.css('margin-bottom')) );
+				break;
+			}
+
+			title[ (opts.position === 'top' ? 'prependTo'  : 'appendTo') ](target);
+		}
+	};
+
+	// jQuery plugin initialization
+	$.fn.fancybox = function (options) {
+		var index,
+			that     = $(this),
+			selector = this.selector || '',
+			run      = function(e) {
+				var what = $(this).blur(), idx = index, relType, relVal;
+
+				if (!(e.ctrlKey || e.altKey || e.shiftKey || e.metaKey) && !what.is('.fancybox-wrap')) {
+					relType = options.groupAttr || 'data-fancybox-group';
+					relVal  = what.attr(relType);
+
+					if (!relVal) {
+						relType = 'rel';
+						relVal  = what.get(0)[ relType ];
+					}
+
+					if (relVal && relVal !== '' && relVal !== 'nofollow') {
+						what = selector.length ? $(selector) : that;
+						what = what.filter('[' + relType + '="' + relVal + '"]');
+						idx  = what.index(this);
+					}
+
+					options.index = idx;
+
+					// Stop an event from bubbling if everything is fine
+					if (F.open(what, options) !== false) {
+						e.preventDefault();
+					}
+				}
+			};
+
+		options = options || {};
+		index   = options.index || 0;
+
+		if (!selector || options.live === false) {
+			that.unbind('click.fb-start').bind('click.fb-start', run);
+
+		} else {
+			D.undelegate(selector, 'click.fb-start').delegate(selector + ":not('.fancybox-item, .fancybox-nav')", 'click.fb-start', run);
+		}
+
+		this.filter('[data-fancybox-start=1]').trigger('click');
+
+		return this;
+	};
+
+	// Tests that need a body at doc ready
+	D.ready(function() {
+		var w1, w2;
+
+		if ( $.scrollbarWidth === undefined ) {
+			// http://benalman.com/projects/jquery-misc-plugins/#scrollbarwidth
+			$.scrollbarWidth = function() {
+				var parent = $('<div style="width:50px;height:50px;overflow:auto"><div/></div>').appendTo('body'),
+					child  = parent.children(),
+					width  = child.innerWidth() - child.height( 99 ).innerWidth();
+
+				parent.remove();
+
+				return width;
+			};
+		}
+
+		if ( $.support.fixedPosition === undefined ) {
+			$.support.fixedPosition = (function() {
+				var elem  = $('<div style="position:fixed;top:20px;"></div>').appendTo('body'),
+					fixed = ( elem[0].offsetTop === 20 || elem[0].offsetTop === 15 );
+
+				elem.remove();
+
+				return fixed;
+			}());
+		}
+
+		$.extend(F.defaults, {
+			scrollbarWidth : $.scrollbarWidth(),
+			fixed  : $.support.fixedPosition,
+			parent : $('body')
+		});
+
+		//Get real width of page scroll-bar
+		w1 = $(window).width();
+
+		H.addClass('fancybox-lock-test');
+
+		w2 = $(window).width();
+
+		H.removeClass('fancybox-lock-test');
+
+		$("<style type='text/css'>.fancybox-margin{margin-right:" + (w2 - w1) + "px;}</style>").appendTo("head");
+	});
+
+}(window, document, jQuery));

Файловите разлики са ограничени, защото са твърде много
+ 0 - 0
src/main/resources/static/js/jquery.plugin-countdown.min.js


Файловите разлики са ограничени, защото са твърде много
+ 1 - 0
src/main/resources/static/js/jquery.scrollbar.min.js


+ 1 - 0
src/main/resources/static/js/lightbox.min.js

@@ -0,0 +1 @@
+!function(a){a.extend(a.fn,{simpleLightboxVideo:function(){var b={delayAnimation:300,keyCodeClose:27};a.simpleLightboxVideo.vars=a.extend({},b);var c=this;return c.click(function(){if(window.innerHeight>540)var b=(window.innerHeight-540)/2;else var b=0;var c='<iframe src="" width="640" height="360" id="slvj-video-embed" style="border:0;"></iframe>',d='<div id="slvj-close-icon"></div>',e='<div class="slvj-lightbox" style="margin-top:'+b+'px">',f='<div id="slvj-back-lightbox">',g='<div id="slvj-background-close"></div>',h='<div id="slvj-window">',i="</div></div></div>";if(a("body").append(h+g+f+e+d+c+i),a("#slvj-window").hide(),"youtube"==a(this).data("videosite"))var j="http://www.youtube.com/embed/"+a(this).data("videoid")+"?autoplay=1";else if("vimeo"==a(this).data("videosite"))var j="http://player.vimeo.com/video/"+a(this).data("videoid")+"?autoplay=1";return a("#slvj-window").fadeIn(),a("#slvj-video-embed").attr("src",j),a("#slvj-close-icon").click(function(){a("#slvj-window").fadeOut(a.simpleLightboxVideo.vars.delayAnimation,function(){a(this).remove()})}),a("#slvj-background-close").click(function(){a("#slvj-window").fadeOut(a.simpleLightboxVideo.vars.delayAnimation,function(){a(this).remove()})}),!1}),a(document).keyup(function(b){27==b.keyCode&&a("#slvj-window").fadeOut(a.simpleLightboxVideo.vars.delayAnimation,function(){a(this).remove()})}),a(window).resize(function(){if(window.innerHeight>540)var b=(window.innerHeight-540)/2;else var b=0;a(".slvj-lightbox").css({marginTop:b+"px"})}),!1}})}(jQuery),function(a){a.simpleLightboxVideo=function(b,c){return a(c).simpleLightboxVideo()}}(jQuery);

Файловите разлики са ограничени, защото са твърде много
+ 3 - 0
src/main/resources/static/js/magnific-popup.min.js


Файловите разлики са ограничени, защото са твърде много
+ 5 - 0
src/main/resources/static/js/mobile-menu.min.js


Файловите разлики са ограничени, защото са твърде много
+ 0 - 0
src/main/resources/static/js/owl.carousel.min.js


Файловите разлики са ограничени, защото са твърде много
+ 1 - 0
src/main/resources/static/js/owl.thumbs.min.js


Файловите разлики са ограничени, защото са твърде много
+ 17 - 0
src/main/resources/static/js/slick.min.js


BIN
src/main/resources/static/picture/404.png


BIN
src/main/resources/static/picture/logo.png


+ 14 - 0
src/main/resources/templates/404.html

@@ -0,0 +1,14 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title>Dungar - Login</title>
+    <template th:replace="components/head-link"></template>
+</head>
+<body class="inblog-page">
+<template th:replace="components/header"></template>
+<div class="main-content">
+    <img src="/picture/404.png" alt="404" style="display:block;margin:20px auto;max-width:100%;">
+</div>
+<template th:replace="components/footer"></template>
+</body>
+</html>

+ 40 - 0
src/main/resources/templates/about.html

@@ -0,0 +1,40 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title>Dungar - About</title>
+    <template th:replace="components/head-link"></template>
+</head>
+<body class="about-page">
+<template th:replace="components/header"></template>
+<div class="main-content main-content-about">
+    <div class="container">
+        <div class="row">
+            <div class="col-lg-12">
+                <div class="breadcrumb-trail breadcrumbs">
+                    <ul class="trail-items breadcrumb">
+                        <li class="trail-item trail-begin">
+                            <a href="/index.html">Home</a>
+                        </li>
+                        <li class="trail-item trail-end active">
+                            About Us
+                        </li>
+                    </ul>
+                </div>
+            </div>
+        </div>
+        <div class="row">
+            <div class="content-area content-about col-lg-12 col-md-12 col-sm-12 col-xs-12">
+                <div class="site-main">
+                    <h3 class="custom_blog_title">About Us</h3>
+                    <div class="page-main-content">
+                        About Us Page ...
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<template th:replace="components/footer"></template>
+</body>
+</html>

+ 30 - 0
src/main/resources/templates/components/footer.html

@@ -0,0 +1,30 @@
+<footer class="footer style7">
+    <div class="dungar-iconbox-wrapp default">
+        <div class="dungar-iconbox  default center">
+            <p>Copyright © 2015-2021 CAIMEI666.com All Rights Reserved.Shenzhen Caimei E-commerce Network Information Co., Ltd.</p>
+            <p>Guangdong B1-20190322 Record number Guangdong ICP No. 16513624 Value-added telecommunications business license of the People’s Republic of China</p>
+        </div>
+    </div>
+</footer>
+<a href="#" class="backtotop">
+    <i class="fa fa-angle-double-up"></i>
+</a>
+<script src="/js/jquery-1.12.4.min.js"></script>
+<script src="/js/jquery.plugin-countdown.min.js"></script>
+<script src="/js/jquery-countdown.min.js"></script>
+<script src="/js/bootstrap.min.js"></script>
+<script src="/js/owl.carousel.min.js"></script>
+<script src="/js/magnific-popup.min.js"></script>
+<script src="/js/isotope.min.js"></script>
+<script src="/js/jquery.scrollbar.min.js"></script>
+<script src="/js/jquery-ui.min.js"></script>
+<script src="/js/mobile-menu.min.js"></script>
+<script src="/js/chosen.min.js"></script>
+<script src="/js/slick.min.js"></script>
+<script src="/js/jquery.elevateZoom.min.js"></script>
+<script src="/js/jquery.actual.min.js"></script>
+<script src="/js/jquery.fancybox.js"></script>
+<script src="/js/lightbox.min.js"></script>
+<script src="/js/owl.thumbs.min.js"></script>
+<script src="/js/jquery.scrollbar.min.js"></script>
+<script src="/js/frontend-plugin.js"></script>

+ 21 - 0
src/main/resources/templates/components/head-link.html

@@ -0,0 +1,21 @@
+<meta charset="UTF-8">
+<meta http-equiv="X-UA-compatible" content="IE=edge">
+<meta name="viewport" content="width=device-width, initial-scale=1">
+<link rel="shortcut icon" th:href="@{/favicon.png}" type="image/x-icon"/>
+<link rel="bookmark" th:href="@{/favicon.png}" type="image/x-icon"/>
+<link rel="stylesheet" href="/css/css2.css">
+<link rel="stylesheet" href="/css/bootstrap.min.css">
+<link rel="stylesheet" href="/css/font-awesome.min.css">
+<link rel="stylesheet" href="/css/owl.carousel.min.css">
+<link rel="stylesheet" href="/css/animate.min.css">
+<link rel="stylesheet" href="/css/jquery-ui.css">
+<link rel="stylesheet" href="/css/slick.css">
+<link rel="stylesheet" href="/css/chosen.min.css">
+<link rel="stylesheet" href="/css/pe-icon-7-stroke.css">
+<link rel="stylesheet" href="/css/magnific-popup.min.css">
+<link rel="stylesheet" href="/css/lightbox.min.css">
+<link rel="stylesheet" href="/css/jquery.fancybox.css">
+<link rel="stylesheet" href="/css/jquery.scrollbar.min.css">
+<link rel="stylesheet" href="/css/mobile-menu.css">
+<link rel="stylesheet" href="/css/flaticon.css">
+<link rel="stylesheet" href="/css/style.css">

+ 225 - 0
src/main/resources/templates/components/header.html

@@ -0,0 +1,225 @@
+<header class="header style7">
+    <div class="top-bar">
+        <div class="container">
+            <div class="top-bar-left">
+                <div class="header-message">
+                    Welcome to XX e-commerce platform
+                </div>
+            </div>
+            <div class="top-bar-right">
+                <div class="header-language">
+                    <div class="dungar-language dungar-dropdown">
+                        <a href="#" class="active language-toggle" data-dungar="dungar-dropdown">
+                            <span>English</span>
+                        </a>
+                        <ul class="dungar-submenu">
+                            <li class="switcher-option">
+                                <a href="#">
+                                    <span>English</span>
+                                </a>
+                            </li>
+                            <li class="switcher-option">
+                                <a href="#">
+                                    <span>中文简体</span>
+                                </a>
+                            </li>
+                        </ul>
+                    </div>
+                </div>
+                <ul class="header-user-links">
+                    <li>
+                        <a href="login.html">Login or Register</a>
+                    </li>
+                </ul>
+            </div>
+        </div>
+    </div>
+    <div class="container">
+        <div class="main-header">
+            <div class="row">
+                <div class="col-lg-3 col-sm-4 col-md-3 col-xs-7 col-ts-12 header-element">
+                    <div class="logo">
+                        <a href="/index.html">
+                            <img src="/picture/logo.png" alt="img">
+                        </a>
+                    </div>
+                </div>
+                <div class="col-lg-7 col-sm-8 col-md-6 col-xs-5 col-ts-12">
+                    <div class="block-search-block">
+                        <form class="form-search form-search-width-category">
+                            <div class="form-content">
+                                <div class="inner">
+                                    <input type="text" class="input" name="s" value=""
+                                           placeholder="Search here">
+                                </div>
+                                <button class="btn-search" type="submit">
+                                    <span class="icon-search"></span>
+                                </button>
+                            </div>
+                        </form>
+                    </div>
+                </div>
+                <div class="col-lg-2 col-sm-12 col-md-3 col-xs-12 col-ts-12">
+                    <div class="header-control">
+                        <div class="block-minicart dungar-mini-cart block-header dungar-dropdown">
+                            <a href="javascript:void(0);" class="shopcart-icon" data-dungar="dungar-dropdown">
+                                Cart<span class="count">0</span>
+                            </a>
+                        </div>
+                        <div class="block-account block-header dungar-dropdown">
+                            <a href="login.html">
+                                <span class="flaticon-user"></span>
+                            </a>
+                        </div>
+                        <a class="menu-bar mobile-navigation menu-toggle" href="#">
+                            <span></span>
+                            <span></span>
+                            <span></span>
+                        </a>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+    <div class="header-nav-container rows-space-20">
+        <div class="container">
+            <div class="header-nav-wapper main-menu-wapper">
+                <div class="vertical-wapper block-nav-categori">
+                    <div class="block-title">
+                            <span class="icon-bar">
+                                <span></span>
+                                <span></span>
+                                <span></span>
+                            </span>
+                        <span class="text">All Categories</span>
+                    </div>
+                    <div class="block-content verticalmenu-content">
+                        <ul class="dungar-nav-vertical vertical-menu dungar-clone-mobile-menu">
+                            <li class="menu-item">
+                                <a href="#" class="dungar-menu-item-title"
+                                   title="Mesodermal products">Mesodermal products</a>
+                            </li>
+                            <li class="menu-item">
+                                <a title="Anti-aging and wrinkle removal" href="#"
+                                   class="dungar-menu-item-title">Anti-aging and wrinkle removal</a>
+                            </li>
+                            <li class="menu-item menu-item-has-children">
+                                <a title="Postoperative repair" href="#"
+                                   class="dungar-menu-item-title">Postoperative repair</a>
+                            </li>
+                            <li class="menu-item">
+                                <a title="SPA products" href="#" class="dungar-menu-item-title">SPA products</a>
+                            </li>
+                            <li class="menu-item">
+                                <a title="Private product" href="#" class="dungar-menu-item-title">Private
+                                    product</a>
+                            </li>
+                            <li class="menu-item">
+                                <a title="Service products" href="#" class="dungar-menu-item-title">Service
+                                    products</a>
+                            </li>
+                            <li class="menu-item">
+                                <a title="Consumables" href="#" class="dungar-menu-item-title">Consumables</a>
+                            </li>
+                            <li class="menu-item">
+                                <a title="Provisional products" href="#"
+                                   class="dungar-menu-item-title">Provisional products</a>
+                            </li>
+                        </ul>
+                    </div>
+                </div>
+                <div class="header-nav">
+                    <div class="container-wapper">
+                        <ul class="dungar-clone-mobile-menu dungar-nav main-menu " id="menu-main-menu">
+                            <li class="menu-item  menu-item-has-children">
+                                <a href="#" class="dungar-menu-item-title" title="Product">Product</a>
+                            </li>
+                            <li class="menu-item menu-item-has-children">
+                                <a href="#" class="dungar-menu-item-title" title="Instrument">Instrument</a>
+                            </li>
+                            <li class="menu-item  menu-item-has-children item-megamenu">
+                                <a href="#" class="dungar-menu-item-title" title="Consumables">Consumables</a>
+                            </li>
+                            <li class="menu-item  menu-item-has-children">
+                                <a href="#" class="dungar-menu-item-title" title="Brand Investment">Brand Investment</a>
+                            </li>
+                            <li class="menu-item  menu-item-has-children item-megamenu">
+                                <a href="/about.html" class="dungar-menu-item-title" title="Contact Us">About</a>
+                            </li>
+                            <li class="menu-item  menu-item-has-children item-megamenu">
+                                <a href="/help.html" class="dungar-menu-item-title" title="Help Center">Help Center</a>
+                            </li>
+                        </ul>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</header>
+<div class="header-device-mobile">
+    <div class="wapper">
+        <div class="item mobile-logo">
+            <div class="logo">
+                <a href="/index.html">
+                    <img src="/picture/logo.png" alt="img">
+                </a>
+            </div>
+        </div>
+        <div class="item item mobile-search-box has-sub">
+            <a href="#">
+                    <span class="icon">
+                        <i class="fa fa-search" aria-hidden="true"></i>
+                    </span>
+            </a>
+            <div class="block-sub">
+                <a href="#" class="close">
+                    <i class="fa fa-times" aria-hidden="true"></i>
+                </a>
+                <div class="header-searchform-box">
+                    <form class="header-searchform">
+                        <div class="searchform-wrap">
+                            <input type="text" class="search-input" placeholder="Enter keywords to search...">
+                            <input type="submit" class="submit button" value="Search">
+                        </div>
+                    </form>
+                </div>
+            </div>
+        </div>
+        <div class="item mobile-settings-box has-sub">
+            <a href="#">
+                    <span class="icon">
+                        <i class="fa fa-cog" aria-hidden="true"></i>
+                    </span>
+            </a>
+            <div class="block-sub">
+                <a href="#" class="close">
+                    <i class="fa fa-times" aria-hidden="true"></i>
+                </a>
+                <div class="block-sub-item">
+                    <h5 class="block-item-title">Currency</h5>
+                    <form class="currency-form dungar-language">
+                        <ul class="dungar-language-wrap">
+                            <li class="active">
+                                <a href="#">
+                                    <span>English</span>
+                                </a>
+                            </li>
+                            <li>
+                                <a href="#">
+                                    <span>中文简体</span>
+                                </a>
+                            </li>
+                        </ul>
+                    </form>
+                </div>
+            </div>
+        </div>
+        <div class="item menu-bar">
+            <a class=" mobile-navigation  menu-toggle" href="#">
+                <span></span>
+                <span></span>
+                <span></span>
+            </a>
+        </div>
+    </div>
+</div>

+ 40 - 0
src/main/resources/templates/help.html

@@ -0,0 +1,40 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title>Dungar - Help</title>
+    <template th:replace="components/head-link"></template>
+</head>
+<body class="about-page">
+<template th:replace="components/header"></template>
+<div class="main-content main-content-about">
+    <div class="container">
+        <div class="row">
+            <div class="col-lg-12">
+                <div class="breadcrumb-trail breadcrumbs">
+                    <ul class="trail-items breadcrumb">
+                        <li class="trail-item trail-begin">
+                            <a href="/index.html">Home</a>
+                        </li>
+                        <li class="trail-item trail-end active">
+                            Help Center
+                        </li>
+                    </ul>
+                </div>
+            </div>
+        </div>
+        <div class="row">
+            <div class="content-area content-about col-lg-12 col-md-12 col-sm-12 col-xs-12">
+                <div class="site-main">
+                    <h3 class="custom_blog_title">Help Center</h3>
+                    <div class="page-main-content">
+                        Help Center Page ...
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<template th:replace="components/footer"></template>
+</body>
+</html>

+ 687 - 0
src/main/resources/templates/index.html

@@ -0,0 +1,687 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title>Dungar - Home</title>
+    <template th:replace="components/head-link"></template>
+</head>
+<body class="home">
+<template th:replace="components/header"></template>
+<div>
+    <div class="fullwidth-template">
+        <div class="home-slider-banner">
+            <div class="container">
+                <div class="row10">
+                    <div class="col-lg-8 silider-wrapp">
+                        <div class="home-slider">
+                            <div class="slider-owl owl-slick equal-container nav-center"
+                                data-slick='{"autoplay":true, "autoplaySpeed":9000, "arrows":false, "dots":true, "infinite":true, "speed":1000, "rows":1}'
+                                data-responsive='[{"breakpoint":"2000","settings":{"slidesToShow":1}}]'>
+                                <div class="slider-item style7">
+                                    <div class="slider-inner equal-element">
+                                        <div class="slider-infor">
+                                            <h5 class="title-small"></h5>
+                                            <h3 class="title-big"> <br> </h3>
+                                        </div>
+                                    </div>
+                                </div>
+                                <div class="slider-item style8">
+                                    <div class="slider-inner equal-element">
+                                        <div class="slider-infor">
+                                            <h5 class="title-small"></h5>
+                                            <h3 class="title-big"> <br> </h3>
+                                        </div>
+                                    </div>
+                                </div>
+                                <div class="slider-item style9">
+                                    <div class="slider-inner equal-element">
+                                        <div class="slider-infor">
+                                            <h5 class="title-small"></h5>
+                                            <h3 class="title-big"> <br> </h3>
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                    <div class="col-lg-4 banner-wrapp">
+                        <div class="banner">
+                            <div class="item-banner style7">
+                                <div class="inner">
+                                    <div class="banner-content">
+                                        <h3 class="title"><br><br></h3>
+                                        <div class="description"></div>
+                                        <span class="price"></span>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                        <div class="banner">
+                            <div class="item-banner style8">
+                                <div class="inner">
+                                    <div class="banner-content">
+                                        <h3 class="title"><br><br></h3>
+                                        <div class="description"></div>
+                                        <span class="price"></span>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+        <div class="dungar-product produc-featured rows-space-65">
+            <div class="container">
+                <h3 class="custommenu-title-blog">
+                    Postoperative Repair
+                </h3>
+                <div class="owl-products owl-slick equal-container nav-center"
+                    data-slick='{"autoplay":false, "autoplaySpeed":1000, "arrows":false, "dots":true, "infinite":false, "speed":800, "rows":1}'
+                    data-responsive='[{"breakpoint":"2000","settings":{"slidesToShow":4}},{"breakpoint":"1200","settings":{"slidesToShow":3}},{"breakpoint":"992","settings":{"slidesToShow":2}},{"breakpoint":"480","settings":{"slidesToShow":1}}]'>
+                    <div class="product-item style-5">
+                        <div class="product-inner equal-element">
+                            <div class="product-top">
+                                <div class="flash">
+                                    <span class="onnew">
+                                        <span class="text">
+                                            new
+                                        </span>
+                                    </span>
+                                </div>
+                            </div>
+                            <div class="product-thumb">
+                                <div class="thumb-inner">
+                                    <a href="product/6409.html">
+                                        <img src="https://img.caimei365.com/group1/M00/03/E5/Cmis21_2aCiASz1QAAZ990F9lUk763.jpg" alt="img">
+                                    </a>
+                                </div>
+                                <div class="product-count-down">
+                                    <div class="dungar-countdown" data-y="2021" data-m="9" data-w="2"
+                                        data-d="30" data-h="20" data-i="60" data-s="60"></div>
+                                </div>
+                            </div>
+                            <div class="product-info">
+                                <h5 class="product-name product_title">
+                                    <a href="product/6409.html">JDV 以色列活力焕肤弹力精华液“无针水光”</a>
+                                </h5>
+                                <div class="group-info">
+                                    <div class="stars-rating">
+                                        <div class="star-rating">
+                                            <span class="star-3"></span>
+                                        </div>
+                                        <div class="count-star">
+                                            (3)
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                    <div class="product-item style-5">
+                        <div class="product-inner equal-element">
+                            <div class="product-top">
+                                <div class="flash">
+                                    <span class="onnew">
+                                        <span class="text">
+                                            new
+                                        </span>
+                                    </span>
+                                </div>
+                            </div>
+                            <div class="product-thumb">
+                                <div class="thumb-inner">
+                                    <a href="product/6821.html">
+                                        <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg" alt="img">
+                                    </a>
+                                </div>
+                                <div class="product-count-down">
+                                    <div class="dungar-countdown" data-y="2021" data-m="9" data-w="2"
+                                        data-d="30" data-h="20" data-i="60" data-s="60"></div>
+                                </div>
+                            </div>
+                            <div class="product-info">
+                                <h5 class="product-name product_title">
+                                    <a href="product/6821.html">液体敷料传明酸</a>
+                                </h5>
+                                <div class="group-info">
+                                    <div class="stars-rating">
+                                        <div class="star-rating">
+                                            <span class="star-3"></span>
+                                        </div>
+                                        <div class="count-star">
+                                            (3)
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                    <div class="product-item style-5">
+                        <div class="product-inner equal-element">
+                            <div class="product-top">
+                                <div class="flash">
+                                    <span class="onnew">
+                                        <span class="text">
+                                            new
+                                        </span>
+                                    </span>
+                                </div>
+                            </div>
+                            <div class="product-thumb">
+                                <div class="thumb-inner">
+                                    <a href="product/6821.html">
+                                        <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg"
+                                            alt="img">
+                                    </a>
+                                </div>
+                                <div class="product-count-down">
+                                    <div class="dungar-countdown" data-y="2021" data-m="9" data-w="2"
+                                        data-d="30" data-h="20" data-i="60" data-s="60"></div>
+                                </div>
+                            </div>
+                            <div class="product-info">
+                                <h5 class="product-name product_title">
+                                    <a href="product/6821.html">液体敷料传明酸</a>
+                                </h5>
+                                <div class="group-info">
+                                    <div class="stars-rating">
+                                        <div class="star-rating">
+                                            <span class="star-3"></span>
+                                        </div>
+                                        <div class="count-star">
+                                            (3)
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                    <div class="product-item style-5">
+                        <div class="product-inner equal-element">
+                            <div class="product-top">
+                                <div class="flash">
+                                    <span class="onnew">
+                                        <span class="text">
+                                            new
+                                        </span>
+                                    </span>
+                                </div>
+                            </div>
+                            <div class="product-thumb">
+                                <div class="thumb-inner">
+                                    <a href="product/6821.html">
+                                        <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg"
+                                            alt="img">
+                                    </a>
+                                </div>
+                                <div class="product-count-down">
+                                    <div class="dungar-countdown" data-y="2021" data-m="9" data-w="2"
+                                        data-d="30" data-h="20" data-i="60" data-s="60"></div>
+                                </div>
+                            </div>
+                            <div class="product-info">
+                                <h5 class="product-name product_title">
+                                    <a href="product/6821.html">液体敷料传明酸</a>
+                                </h5>
+                                <div class="group-info">
+                                    <div class="stars-rating">
+                                        <div class="star-rating">
+                                            <span class="star-3"></span>
+                                        </div>
+                                        <div class="count-star">
+                                            (3)
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+        <div class="banner-wrapp">
+            <div class="container">
+                <div class="row">
+                    <div class="col-lg-6 col-md-6 col-sm-12">
+                        <div class="banner">
+                            <div class="item-banner style4">
+                                <div class="inner">
+                                    <div class="banner-content">
+                                        <h4 class="dungar-subtitle"><br></h4>
+                                        <h3 class="title"><br></h3>
+                                        <div class="description"><br></div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                    <div class="col-lg-6 col-md-6 col-sm-12">
+                        <div class="banner">
+                            <div class="item-banner style5">
+                                <div class="inner">
+                                    <div class="banner-content">
+                                        <h4 class="dungar-subtitle"><br></h4>
+                                        <h3 class="title"><br></h3>
+                                        <div class="description"><br></div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+        <div class="banner-wrapp rows-space-65">
+            <div class="container">
+                <div class="banner">
+                    <div class="item-banner style17">
+                        <div class="inner">
+                            <div class="banner-content">
+                                <h3 class="title"><br></h3>
+                                <div class="description"><br></div>
+                                <div class="banner-price"><br></div>
+                            </div>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+        <div class="dungar-tabs  default rows-space-40">
+            <div class="container">
+                <div class="tab-head">
+                    <ul class="tab-link">
+                        <li class="active">
+                            <a data-toggle="tab" aria-expanded="true" href="#bestseller">Anti-Aging And Wrinkle
+                                Removal</a>
+                        </li>
+                        <li class="">
+                            <a data-toggle="tab" aria-expanded="true" href="#new_arrivals">Private Product</a>
+                        </li>
+                        <li class="">
+                            <a data-toggle="tab" aria-expanded="true" href="#top-rated">SPA Product</a>
+                        </li>
+                    </ul>
+                </div>
+                <div class="tab-container">
+                    <div id="bestseller" class="tab-panel active">
+                        <div class="dungar-product">
+                            <ul class="row list-products auto-clear equal-container product-grid">
+                                <li class="product-item  col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li
+                                    class="product-item product-type-variable col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li
+                                    class="product-item product-type-variable col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li
+                                    class="product-item product-type-variable col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li class="product-item  col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li
+                                    class="product-item product-type-variable col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li
+                                    class="product-item product-type-variable col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                                <li class="product-item  col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg" alt="img">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                            </ul>
+                        </div>
+                    </div>
+                    <div id="new_arrivals" class="tab-panel">
+                        <div class="dungar-product">
+                            <ul class="row list-products auto-clear equal-container product-grid">
+                                <li class="product-item  col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                            </ul>
+                        </div>
+                    </div>
+                    <div id="top-rated" class="tab-panel">
+                        <div class="dungar-product">
+                            <ul class="row list-products auto-clear equal-container product-grid">
+                                <li class="product-item  col-lg-3 col-md-4 col-sm-6 col-xs-6 col-ts-12 style-1">
+                                    <div class="product-inner equal-element">
+                                        <div class="product-top">
+                                            <div class="flash">
+                                                <span class="onnew">
+                                                    <span class="text">
+                                                        new
+                                                    </span>
+                                                </span>
+                                            </div>
+                                        </div>
+                                        <div class="product-thumb">
+                                            <div class="thumb-inner">
+                                                <a href="product/6821.html">
+                                                    <img src="https://img.caimei365.com/group1/M00/00/22/rB-lF2DmrEOAZUUOAACjiWfeoYg762.jpg">
+                                                </a>
+                                            </div>
+                                        </div>
+                                        <div class="product-info">
+                                            <h5 class="product-name product_title">
+                                                <a href="product/6821.html">液体敷料传明酸</a>
+                                            </h5>
+                                            <div class="group-info">
+                                                <div class="stars-rating">
+                                                    <div class="star-rating">
+                                                        <span class="star-3"></span>
+                                                    </div>
+                                                    <div class="count-star">
+                                                        (3)
+                                                    </div>
+                                                </div>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </li>
+                            </ul>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<template th:replace="components/footer"></template>
+</body>
+</html>

+ 107 - 0
src/main/resources/templates/login.html

@@ -0,0 +1,107 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title>Dungar - Login</title>
+    <template th:replace="components/head-link"></template>
+</head>
+<body class="inblog-page">
+<template th:replace="components/header"></template>
+<div class="main-content main-content-login">
+    <div class="container">
+        <div class="row">
+            <div class="col-lg-12">
+                <div class="breadcrumb-trail breadcrumbs">
+                    <ul class="trail-items breadcrumb">
+                        <li class="trail-item trail-begin">
+                            <a href="/index.html">Home</a>
+                        </li>
+                        <li class="trail-item trail-end active">
+                            Authentication
+                        </li>
+                    </ul>
+                </div>
+            </div>
+        </div>
+        <div class="row">
+            <div class="content-area col-lg-12 col-md-12 col-sm-12 col-xs-12">
+                <div class="site-main">
+                    <h3 class="custom_blog_title">
+                        Authentication
+                    </h3>
+                    <div class="customer_login">
+                        <div class="row">
+                            <div class="col-lg-6 col-md-6 col-sm-12">
+                                <div class="login-item">
+                                    <h5 class="title-login">Login your Account</h5>
+                                    <form class="login">
+                                        <div class="social-account">
+                                            <h6 class="title-social">Login with social account</h6>
+                                            <a href="#" class="mxh-item facebook">
+                                                <i class="icon fa fa-facebook-square" aria-hidden="true"></i>
+                                                <span class="text">FACEBOOK</span>
+                                            </a>
+                                            <a href="#" class="mxh-item twitter">
+                                                <i class="icon fa fa-twitter" aria-hidden="true"></i>
+                                                <span class="text">TWITTER</span>
+                                            </a>
+                                        </div>
+                                        <p class="form-row form-row-wide">
+                                            <label class="text">Username</label>
+                                            <input title="username" type="text" class="input-text">
+                                        </p>
+                                        <p class="form-row form-row-wide">
+                                            <label class="text">Password</label>
+                                            <input title="password" type="password" class="input-text">
+                                        </p>
+                                        <p class="lost_password">
+												<span class="inline">
+													<input type="checkbox" id="cb1">
+													<label for="cb1" class="label-text">Remember me</label>
+												</span>
+                                            <a href="#" class="forgot-pw">Forgot password?</a>
+                                        </p>
+                                        <p class="form-row">
+                                            <input type="submit" class="button-submit" value="login">
+                                        </p>
+                                    </form>
+                                </div>
+                            </div>
+                            <div class="col-lg-6 col-md-6 col-sm-12">
+                                <div class="login-item">
+                                    <h5 class="title-login">Register now</h5>
+                                    <form class="register">
+                                        <p class="form-row form-row-wide">
+                                            <label class="text">Your email</label>
+                                            <input title="email" type="email" class="input-text">
+                                        </p>
+                                        <p class="form-row form-row-wide">
+                                            <label class="text">Username</label>
+                                            <input title="name" type="text" class="input-text">
+                                        </p>
+                                        <p class="form-row form-row-wide">
+                                            <label class="text">Password</label>
+                                            <input title="pass" type="password" class="input-text">
+                                        </p>
+                                        <p class="form-row">
+												<span class="inline">
+													<input type="checkbox" id="cb2">
+													<label for="cb2" class="label-text">I agree to <span>Terms & Conditions</span></label>
+												</span>
+                                        </p>
+                                        <p class="">
+                                            <input type="submit" class="button-submit" value="Register Now">
+                                        </p>
+                                    </form>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<template th:replace="components/footer"></template>
+</body>
+</html>

+ 121 - 0
src/main/resources/templates/product.html

@@ -0,0 +1,121 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title th:text="${product.get('name')}"></title>
+    <template th:replace="components/head-link"></template>
+</head>
+<body class="inblog-page">
+<template th:replace="components/header"></template>
+<div class="main-content main-content-details single no-sidebar">
+    <div class="container">
+        <div class="row">
+            <div class="col-lg-12">
+                <div class="breadcrumb-trail breadcrumbs">
+                    <ul class="trail-items breadcrumb">
+                        <li class="trail-item trail-begin">
+                            <a href="/index.html">Home</a>
+                        </li>
+                        <li class="trail-item trail-end active" th:text="${product.get('name')}"></li>
+                    </ul>
+                </div>
+            </div>
+        </div>
+        <div class="row">
+            <div class="content-area content-details full-width col-lg-9 col-md-8 col-sm-12 col-xs-12">
+                <div class="site-main">
+                    <div class="details-product">
+                        <div class="details-thumd">
+                            <div class="image-preview-container image-thick-box image_preview_container">
+                                <img id="img_zoom" th:attr="data-zoom-image=${product.get('mainImage')}" th:src="${product.get('mainImage')}" alt="img">
+                            </div>
+                        </div>
+                        <div class="details-infor">
+                            <h1 class="product-title" th:text="${product.get('name')}"></h1>
+                            <div class="stars-rating">
+                                <div class="star-rating">
+                                    <span class="star-5"></span>
+                                </div>
+                                <div class="count-star"></div>
+                            </div>
+                            <div class="availability">
+                                availability: <a href="#">in Stock</a>
+                            </div>
+                            <div class="price">
+                                <span>$Invisible</span>
+                            </div>
+                            <div class="product-details-description">
+                                <ul>
+                                    <li>Vestibulum tortor quam</li>
+                                    <li>Imported</li>
+                                    <li>Art.No. 0755-22907771</li>
+                                </ul>
+                            </div>
+                            <div class="variations">
+                                <div class="attribute attribute_color">
+                                    <div class="color-text text-attribute">
+                                        Color:
+                                    </div>
+                                    <div class="list-color list-item">
+                                        <a href="#" class="color1"></a>
+                                        <a href="#" class="color2"></a>
+                                        <a href="#" class="color3 active"></a>
+                                        <a href="#" class="color4"></a>
+                                    </div>
+                                </div>
+                                <div class="attribute attribute_size">
+                                    <div class="size-text text-attribute">
+                                        Size:
+                                    </div>
+                                    <div class="list-size list-item">
+                                        <a href="#" class="">xs</a>
+                                        <a href="#" class="">s</a>
+                                        <a href="#" class="active">m</a>
+                                        <a href="#" class="">l</a>
+                                        <a href="#" class="">xl</a>
+                                        <a href="#" class="">xxl</a>
+                                    </div>
+                                </div>
+                            </div>
+                            <div class="group-button">
+                                <div class="yith-wcwl-add-to-wishlist">
+                                    <div class="yith-wcwl-add-button">
+                                        <a href="wishlist.html">Add to Wishlist</a>
+                                    </div>
+                                </div>
+                                <div class="size-chart-wrapp">
+                                    <div class="btn-size-chart">
+                                        <a id="size_chart" href="javascript:;" class="fancybox">View Size Chart</a>
+                                    </div>
+                                </div>
+                                <div class="quantity-add-to-cart">
+                                    <div class="quantity">
+                                        <div class="control">
+                                            <a class="btn-number qtyminus quantity-minus" href="#">-</a>
+                                            <input type="text" data-step="1" data-min="0" value="1" title="Qty" class="input-qty qty" size="4">
+                                            <a href="#" class="btn-number qtyplus quantity-plus">+</a>
+                                        </div>
+                                    </div>
+                                    <a href="#" class="single_add_to_cart_button button">Add to cart</a>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                    <div class="tab-details-product">
+                        <div class="item">
+                            <!--/*-->
+                            <div th:object="${product.get('productDetail')}">
+                                <div th:utext="*{detailInfo}"></div>
+                            </div>
+                            <!--*/-->
+                        </div>
+                    </div>
+                    <div style="clear: left;"></div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<template th:replace="components/footer"></template>
+</body>
+</html>

+ 13 - 0
src/test/java/com/overseas/website/WebsiteApplicationTests.java

@@ -0,0 +1,13 @@
+package com.overseas.website;
+
+import org.junit.jupiter.api.Test;
+import org.springframework.boot.test.context.SpringBootTest;
+
+@SpringBootTest
+class WebsiteApplicationTests {
+
+    @Test
+    void contextLoads() {
+    }
+
+}

Някои файлове не бяха показани, защото твърде много файлове са промени